Conflicts: modelscope/models/nlp/__init__.py modelscope/pipelines/builder.py modelscope/pipelines/outputs.py modelscope/preprocessors/nlp.py requirements/nlp.txtmaster
| @@ -0,0 +1,3 @@ | |||||
| *.png filter=lfs diff=lfs merge=lfs -text | |||||
| *.jpg filter=lfs diff=lfs merge=lfs -text | |||||
| *.mp4 filter=lfs diff=lfs merge=lfs -text | |||||
| @@ -24,6 +24,7 @@ wheels/ | |||||
| .installed.cfg | .installed.cfg | ||||
| *.egg | *.egg | ||||
| /package | /package | ||||
| /temp | |||||
| MANIFEST | MANIFEST | ||||
| # PyInstaller | # PyInstaller | ||||
| @@ -104,7 +105,6 @@ venv.bak/ | |||||
| # mypy | # mypy | ||||
| .mypy_cache/ | .mypy_cache/ | ||||
| data | |||||
| .vscode | .vscode | ||||
| .idea | .idea | ||||
| @@ -124,3 +124,7 @@ replace.sh | |||||
| # Pytorch | # Pytorch | ||||
| *.pth | *.pth | ||||
| # audio | |||||
| *.wav | |||||
| @@ -0,0 +1,3 @@ | |||||
| version https://git-lfs.github.com/spec/v1 | |||||
| oid sha256:78094cc48fbcfd9b6d321fe13619ecc72b65e006fc1b4c4458409ade9979486d | |||||
| size 129862 | |||||
| @@ -0,0 +1,3 @@ | |||||
| version https://git-lfs.github.com/spec/v1 | |||||
| oid sha256:af83a94899a6d23339c3ecc5c4c58c57c835af57b531a2f4c50461184f820141 | |||||
| size 603621 | |||||
| @@ -0,0 +1,3 @@ | |||||
| version https://git-lfs.github.com/spec/v1 | |||||
| oid sha256:af83a94899a6d23339c3ecc5c4c58c57c835af57b531a2f4c50461184f820141 | |||||
| size 603621 | |||||
| @@ -0,0 +1,3 @@ | |||||
| version https://git-lfs.github.com/spec/v1 | |||||
| oid sha256:5c8435db5583400be5d11a2c17910c96133b462c8a99ccaf0e19f4aac34e0a94 | |||||
| size 141149 | |||||
| @@ -91,6 +91,55 @@ make tests | |||||
| 4. Daily regression tests will run all cases at 0 am each day using master branch. | 4. Daily regression tests will run all cases at 0 am each day using master branch. | ||||
| ### 2.3 Test data storage | |||||
| As we need a lot of data for testing, including images, videos, models. We use git lfs | |||||
| to store those large files. | |||||
| 1. install git-lfs | |||||
| for mac | |||||
| ```bash | |||||
| brew install git-lfs | |||||
| git lfs install | |||||
| ``` | |||||
| for centos, please download rpm from git-lfs github release [website](https://github.com/git-lfs/git-lfs/releases/tag/v3.2.0) | |||||
| ```bash | |||||
| wget http://101374-public.oss-cn-hangzhou-zmf.aliyuncs.com/git-lfs-3.2.0-1.el7.x86_64.rpm | |||||
| sudo rpm -ivh git-lfs-3.2.0-1.el7.x86_64.rpm | |||||
| git lfs install | |||||
| ``` | |||||
| for ubuntu | |||||
| ```bash | |||||
| curl -s https://packagecloud.io/install/repositories/github/git-lfs/script.deb.sh | sudo bash | |||||
| sudo apt-get install git-lfs | |||||
| git lfs install | |||||
| ``` | |||||
| 2. track your data type using git lfs, for example, to track png files | |||||
| ```bash | |||||
| git lfs track "*.png" | |||||
| ``` | |||||
| 3. add your test files to `data/test/` folder, you can make directories if you need. | |||||
| ```bash | |||||
| git add data/test/test.png | |||||
| ``` | |||||
| 4. commit your test data to remote branch | |||||
| ```bash | |||||
| git commit -m "xxx" | |||||
| ``` | |||||
| To pull data from remote repo, just as the same way you pull git files. | |||||
| ```bash | |||||
| git pull origin branch_name | |||||
| ``` | |||||
| ## Code Review | ## Code Review | ||||
| 1. Run following command to create an aone CR, replace `TARGET_BRANCH` and `CR_NAME` with the one you want. | 1. Run following command to create an aone CR, replace `TARGET_BRANCH` and `CR_NAME` with the one you want. | ||||
| @@ -29,3 +29,15 @@ reference: [https://huggingface.co/docs/tokenizers/installation#installation-fro | |||||
| > ERROR: pip's dependency resolver does not currently take into account all the packages that are installed. This behaviour is the source of the following dependency conflicts. | > ERROR: pip's dependency resolver does not currently take into account all the packages that are installed. This behaviour is the source of the following dependency conflicts. | ||||
| 由于依赖库之间的版本不兼容,可能会存在版本冲突的情况,大部分情况下不影响正常运行。 | 由于依赖库之间的版本不兼容,可能会存在版本冲突的情况,大部分情况下不影响正常运行。 | ||||
| ### 3. 安装pytorch出现版本错误 | |||||
| > ERROR: Ignored the following versions that require a different python version: 1.1.0 Requires-Python >=3.8; 1.1.0rc1 Requires-Python >=3.8; 1.1.1 Requires-Python >=3.8 | |||||
| > ERROR: Could not find a version that satisfies the requirement torch==1.8.1+cu111 (from versions: 1.0.0, 1.0.1, 1.0.1.post2, 1.1.0, 1.2.0, 1.3.0, 1.3.1, 1.4.0, 1.5.0, 1.5.1, 1.6.0, 1.7.0, 1.7.1, 1.8.0, 1.8.1, 1.9.0, 1.9.1, 1.10.0, 1.10.1, 1.10.2, 1.11.0) | |||||
| > ERROR: No matching distribution found for torch==1.8.1+cu111 | |||||
| 安装时使用如下命令: | |||||
| ```shell | |||||
| pip install -f https://download.pytorch.org/whl/torch_stable.html -i https://pypi.tuna.tsinghua.edu.cn/simple -r requirements.txt | |||||
| ``` | |||||
| @@ -25,6 +25,10 @@ ModelScope Library目前支持tensorflow,pytorch两大深度学习框架进行 | |||||
| * [Pytorch安装指导](https://pytorch.org/get-started/locally/) | * [Pytorch安装指导](https://pytorch.org/get-started/locally/) | ||||
| * [Tensorflow安装指导](https://www.tensorflow.org/install/pip) | * [Tensorflow安装指导](https://www.tensorflow.org/install/pip) | ||||
| 部分第三方依赖库需要提前安装numpy | |||||
| ``` | |||||
| pip install numpy | |||||
| ``` | |||||
| ## ModelScope library 安装 | ## ModelScope library 安装 | ||||
| @@ -1,5 +1,8 @@ | |||||
| # Copyright (c) Alibaba, Inc. and its affiliates. | # Copyright (c) Alibaba, Inc. and its affiliates. | ||||
| from .audio.tts.am import SambertNetHifi16k | |||||
| from .audio.tts.vocoder import Hifigan16k | |||||
| from .base import Model | from .base import Model | ||||
| from .builder import MODELS, build_model | from .builder import MODELS, build_model | ||||
| from .multi_model import OfaForImageCaptioning | |||||
| from .nlp import BertForSequenceClassification, SbertForSentenceSimilarity | from .nlp import BertForSequenceClassification, SbertForSentenceSimilarity | ||||
| @@ -0,0 +1,60 @@ | |||||
| import torch.nn as nn | |||||
| from .layer_base import LayerBase | |||||
| class RectifiedLinear(LayerBase): | |||||
| def __init__(self, input_dim, output_dim): | |||||
| super(RectifiedLinear, self).__init__() | |||||
| self.dim = input_dim | |||||
| self.relu = nn.ReLU() | |||||
| def forward(self, input): | |||||
| return self.relu(input) | |||||
| def to_kaldi_nnet(self): | |||||
| re_str = '' | |||||
| re_str += '<RectifiedLinear> %d %d\n' % (self.dim, self.dim) | |||||
| return re_str | |||||
| def load_kaldi_nnet(self, instr): | |||||
| return instr | |||||
| class LogSoftmax(LayerBase): | |||||
| def __init__(self, input_dim, output_dim): | |||||
| super(LogSoftmax, self).__init__() | |||||
| self.dim = input_dim | |||||
| self.ls = nn.LogSoftmax() | |||||
| def forward(self, input): | |||||
| return self.ls(input) | |||||
| def to_kaldi_nnet(self): | |||||
| re_str = '' | |||||
| re_str += '<Softmax> %d %d\n' % (self.dim, self.dim) | |||||
| return re_str | |||||
| def load_kaldi_nnet(self, instr): | |||||
| return instr | |||||
| class Sigmoid(LayerBase): | |||||
| def __init__(self, input_dim, output_dim): | |||||
| super(Sigmoid, self).__init__() | |||||
| self.dim = input_dim | |||||
| self.sig = nn.Sigmoid() | |||||
| def forward(self, input): | |||||
| return self.sig(input) | |||||
| def to_kaldi_nnet(self): | |||||
| re_str = '' | |||||
| re_str += '<Sigmoid> %d %d\n' % (self.dim, self.dim) | |||||
| return re_str | |||||
| def load_kaldi_nnet(self, instr): | |||||
| return instr | |||||
| @@ -0,0 +1,78 @@ | |||||
| import numpy as np | |||||
| import torch as th | |||||
| import torch.nn as nn | |||||
| from .layer_base import (LayerBase, expect_kaldi_matrix, expect_token_number, | |||||
| to_kaldi_matrix) | |||||
| class AffineTransform(LayerBase): | |||||
| def __init__(self, input_dim, output_dim): | |||||
| super(AffineTransform, self).__init__() | |||||
| self.input_dim = input_dim | |||||
| self.output_dim = output_dim | |||||
| self.linear = nn.Linear(input_dim, output_dim) | |||||
| def forward(self, input): | |||||
| return self.linear(input) | |||||
| def to_kaldi_nnet(self): | |||||
| re_str = '' | |||||
| re_str += '<AffineTransform> %d %d\n' % (self.output_dim, | |||||
| self.input_dim) | |||||
| re_str += '<LearnRateCoef> 1 <BiasLearnRateCoef> 1 <MaxNorm> 0\n' | |||||
| linear_weights = self.state_dict()['linear.weight'] | |||||
| x = linear_weights.squeeze().numpy() | |||||
| re_str += to_kaldi_matrix(x) | |||||
| linear_bias = self.state_dict()['linear.bias'] | |||||
| x = linear_bias.squeeze().numpy() | |||||
| re_str += to_kaldi_matrix(x) | |||||
| return re_str | |||||
| def to_raw_nnet(self, fid): | |||||
| linear_weights = self.state_dict()['linear.weight'] | |||||
| x = linear_weights.squeeze().numpy() | |||||
| x.tofile(fid) | |||||
| linear_bias = self.state_dict()['linear.bias'] | |||||
| x = linear_bias.squeeze().numpy() | |||||
| x.tofile(fid) | |||||
| def load_kaldi_nnet(self, instr): | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<LearnRateCoef>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('AffineTransform format error for <LearnRateCoef>') | |||||
| instr, lr = output | |||||
| output = expect_token_number(instr, '<BiasLearnRateCoef>') | |||||
| if output is None: | |||||
| raise Exception( | |||||
| 'AffineTransform format error for <BiasLearnRateCoef>') | |||||
| instr, lr = output | |||||
| output = expect_token_number(instr, '<MaxNorm>') | |||||
| if output is None: | |||||
| raise Exception('AffineTransform format error for <MaxNorm>') | |||||
| instr, lr = output | |||||
| output = expect_kaldi_matrix(instr) | |||||
| if output is None: | |||||
| raise Exception('AffineTransform format error for parsing matrix') | |||||
| instr, mat = output | |||||
| print(mat.shape) | |||||
| self.linear.weight = th.nn.Parameter( | |||||
| th.from_numpy(mat).type(th.FloatTensor)) | |||||
| output = expect_kaldi_matrix(instr) | |||||
| if output is None: | |||||
| raise Exception('AffineTransform format error for parsing matrix') | |||||
| instr, mat = output | |||||
| mat = np.squeeze(mat) | |||||
| self.linear.bias = th.nn.Parameter( | |||||
| th.from_numpy(mat).type(th.FloatTensor)) | |||||
| return instr | |||||
| @@ -0,0 +1,178 @@ | |||||
| import numpy as np | |||||
| import torch as th | |||||
| import torch.nn as nn | |||||
| import torch.nn.functional as F | |||||
| from .layer_base import (LayerBase, expect_kaldi_matrix, expect_token_number, | |||||
| to_kaldi_matrix) | |||||
| class DeepFsmn(LayerBase): | |||||
| def __init__(self, | |||||
| input_dim, | |||||
| output_dim, | |||||
| lorder=None, | |||||
| rorder=None, | |||||
| hidden_size=None, | |||||
| layer_norm=False, | |||||
| dropout=0): | |||||
| super(DeepFsmn, self).__init__() | |||||
| self.input_dim = input_dim | |||||
| self.output_dim = output_dim | |||||
| if lorder is None: | |||||
| return | |||||
| self.lorder = lorder | |||||
| self.rorder = rorder | |||||
| self.hidden_size = hidden_size | |||||
| self.layer_norm = layer_norm | |||||
| self.linear = nn.Linear(input_dim, hidden_size) | |||||
| self.norm = nn.LayerNorm(hidden_size) | |||||
| self.drop1 = nn.Dropout(p=dropout) | |||||
| self.drop2 = nn.Dropout(p=dropout) | |||||
| self.project = nn.Linear(hidden_size, output_dim, bias=False) | |||||
| self.conv1 = nn.Conv2d( | |||||
| output_dim, | |||||
| output_dim, [lorder, 1], [1, 1], | |||||
| groups=output_dim, | |||||
| bias=False) | |||||
| self.conv2 = nn.Conv2d( | |||||
| output_dim, | |||||
| output_dim, [rorder, 1], [1, 1], | |||||
| groups=output_dim, | |||||
| bias=False) | |||||
| def forward(self, input): | |||||
| f1 = F.relu(self.linear(input)) | |||||
| f1 = self.drop1(f1) | |||||
| if self.layer_norm: | |||||
| f1 = self.norm(f1) | |||||
| p1 = self.project(f1) | |||||
| x = th.unsqueeze(p1, 1) | |||||
| x_per = x.permute(0, 3, 2, 1) | |||||
| y = F.pad(x_per, [0, 0, self.lorder - 1, 0]) | |||||
| yr = F.pad(x_per, [0, 0, 0, self.rorder]) | |||||
| yr = yr[:, :, 1:, :] | |||||
| out = x_per + self.conv1(y) + self.conv2(yr) | |||||
| out = self.drop2(out) | |||||
| out1 = out.permute(0, 3, 2, 1) | |||||
| return input + out1.squeeze() | |||||
| def to_kaldi_nnet(self): | |||||
| re_str = '' | |||||
| re_str += '<UniDeepFsmn> %d %d\n'\ | |||||
| % (self.output_dim, self.input_dim) | |||||
| re_str += '<LearnRateCoef> %d <HidSize> %d <LOrder> %d <LStride> %d <MaxNorm> 0\n'\ | |||||
| % (1, self.hidden_size, self.lorder, 1) | |||||
| lfiters = self.state_dict()['conv1.weight'] | |||||
| x = np.flipud(lfiters.squeeze().numpy().T) | |||||
| re_str += to_kaldi_matrix(x) | |||||
| proj_weights = self.state_dict()['project.weight'] | |||||
| x = proj_weights.squeeze().numpy() | |||||
| re_str += to_kaldi_matrix(x) | |||||
| linear_weights = self.state_dict()['linear.weight'] | |||||
| x = linear_weights.squeeze().numpy() | |||||
| re_str += to_kaldi_matrix(x) | |||||
| linear_bias = self.state_dict()['linear.bias'] | |||||
| x = linear_bias.squeeze().numpy() | |||||
| re_str += to_kaldi_matrix(x) | |||||
| return re_str | |||||
| def load_kaldi_nnet(self, instr): | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<LearnRateCoef>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for <LearnRateCoef>') | |||||
| instr, lr = output | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<HidSize>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for <HidSize>') | |||||
| instr, hiddensize = output | |||||
| self.hidden_size = int(hiddensize) | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<LOrder>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for <LOrder>') | |||||
| instr, lorder = output | |||||
| self.lorder = int(lorder) | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<LStride>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for <LStride>') | |||||
| instr, lstride = output | |||||
| self.lstride = lstride | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<MaxNorm>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for <MaxNorm>') | |||||
| output = expect_kaldi_matrix(instr) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for parsing matrix') | |||||
| instr, mat = output | |||||
| mat1 = np.fliplr(mat.T).copy() | |||||
| self.conv1 = nn.Conv2d( | |||||
| self.output_dim, | |||||
| self.output_dim, [self.lorder, 1], [1, 1], | |||||
| groups=self.output_dim, | |||||
| bias=False) | |||||
| mat_th = th.from_numpy(mat1).type(th.FloatTensor) | |||||
| mat_th = mat_th.unsqueeze(1) | |||||
| mat_th = mat_th.unsqueeze(3) | |||||
| self.conv1.weight = th.nn.Parameter(mat_th) | |||||
| output = expect_kaldi_matrix(instr) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for parsing matrix') | |||||
| instr, mat = output | |||||
| self.project = nn.Linear(self.hidden_size, self.output_dim, bias=False) | |||||
| self.linear = nn.Linear(self.input_dim, self.hidden_size) | |||||
| self.project.weight = th.nn.Parameter( | |||||
| th.from_numpy(mat).type(th.FloatTensor)) | |||||
| output = expect_kaldi_matrix(instr) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for parsing matrix') | |||||
| instr, mat = output | |||||
| self.linear.weight = th.nn.Parameter( | |||||
| th.from_numpy(mat).type(th.FloatTensor)) | |||||
| output = expect_kaldi_matrix(instr) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for parsing matrix') | |||||
| instr, mat = output | |||||
| self.linear.bias = th.nn.Parameter( | |||||
| th.from_numpy(mat).type(th.FloatTensor)) | |||||
| return instr | |||||
| @@ -0,0 +1,50 @@ | |||||
| import abc | |||||
| import re | |||||
| import numpy as np | |||||
| import torch.nn as nn | |||||
| def expect_token_number(instr, token): | |||||
| first_token = re.match(r'^\s*' + token, instr) | |||||
| if first_token is None: | |||||
| return None | |||||
| instr = instr[first_token.end():] | |||||
| lr = re.match(r'^\s*(-?\d+\.?\d*e?-?\d*?)', instr) | |||||
| if lr is None: | |||||
| return None | |||||
| return instr[lr.end():], lr.groups()[0] | |||||
| def expect_kaldi_matrix(instr): | |||||
| pos2 = instr.find('[', 0) | |||||
| pos3 = instr.find(']', pos2) | |||||
| mat = [] | |||||
| for stt in instr[pos2 + 1:pos3].split('\n'): | |||||
| tmp_mat = np.fromstring(stt, dtype=np.float32, sep=' ') | |||||
| if tmp_mat.size > 0: | |||||
| mat.append(tmp_mat) | |||||
| return instr[pos3 + 1:], np.array(mat) | |||||
| def to_kaldi_matrix(np_mat): | |||||
| """ | |||||
| function that transform as str numpy mat to standard kaldi str matrix | |||||
| :param np_mat: numpy mat | |||||
| :return: str | |||||
| """ | |||||
| np.set_printoptions(threshold=np.inf, linewidth=np.nan, suppress=True) | |||||
| out_str = str(np_mat) | |||||
| out_str = out_str.replace('[', '') | |||||
| out_str = out_str.replace(']', '') | |||||
| return '[ %s ]\n' % out_str | |||||
| class LayerBase(nn.Module, metaclass=abc.ABCMeta): | |||||
| def __init__(self): | |||||
| super(LayerBase, self).__init__() | |||||
| @abc.abstractmethod | |||||
| def to_kaldi_nnet(self): | |||||
| pass | |||||
| @@ -0,0 +1,482 @@ | |||||
| import numpy as np | |||||
| import torch as th | |||||
| import torch.nn as nn | |||||
| import torch.nn.functional as F | |||||
| from .layer_base import (LayerBase, expect_kaldi_matrix, expect_token_number, | |||||
| to_kaldi_matrix) | |||||
| class SepConv(nn.Module): | |||||
| def __init__(self, | |||||
| in_channels, | |||||
| filters, | |||||
| out_channels, | |||||
| kernel_size=(5, 2), | |||||
| dilation=(1, 1)): | |||||
| """ :param kernel_size (time, frequency) | |||||
| """ | |||||
| super(SepConv, self).__init__() | |||||
| # depthwise + pointwise | |||||
| self.dconv = nn.Conv2d( | |||||
| in_channels, | |||||
| in_channels * filters, | |||||
| kernel_size, | |||||
| dilation=dilation, | |||||
| groups=in_channels) | |||||
| self.pconv = nn.Conv2d( | |||||
| in_channels * filters, out_channels, kernel_size=1) | |||||
| self.padding = dilation[0] * (kernel_size[0] - 1) | |||||
| def forward(self, input): | |||||
| ''' input: [B, C, T, F] | |||||
| ''' | |||||
| x = F.pad(input, [0, 0, self.padding, 0]) | |||||
| x = self.dconv(x) | |||||
| x = self.pconv(x) | |||||
| return x | |||||
| class Conv2d(nn.Module): | |||||
| def __init__(self, | |||||
| input_dim, | |||||
| output_dim, | |||||
| lorder=20, | |||||
| rorder=0, | |||||
| groups=1, | |||||
| bias=False, | |||||
| skip_connect=True): | |||||
| super(Conv2d, self).__init__() | |||||
| self.lorder = lorder | |||||
| self.conv = nn.Conv2d( | |||||
| input_dim, output_dim, [lorder, 1], groups=groups, bias=bias) | |||||
| self.rorder = rorder | |||||
| if self.rorder: | |||||
| self.conv2 = nn.Conv2d( | |||||
| input_dim, output_dim, [rorder, 1], groups=groups, bias=bias) | |||||
| self.skip_connect = skip_connect | |||||
| def forward(self, input): | |||||
| # [B, 1, T, F] | |||||
| x = th.unsqueeze(input, 1) | |||||
| # [B, F, T, 1] | |||||
| x_per = x.permute(0, 3, 2, 1) | |||||
| y = F.pad(x_per, [0, 0, self.lorder - 1, 0]) | |||||
| out = self.conv(y) | |||||
| if self.rorder: | |||||
| yr = F.pad(x_per, [0, 0, 0, self.rorder]) | |||||
| yr = yr[:, :, 1:, :] | |||||
| out += self.conv2(yr) | |||||
| out = out.permute(0, 3, 2, 1).squeeze(1) | |||||
| if self.skip_connect: | |||||
| out = out + input | |||||
| return out | |||||
| class SelfAttLayer(nn.Module): | |||||
| def __init__(self, input_dim, output_dim, lorder=None, hidden_size=None): | |||||
| super(SelfAttLayer, self).__init__() | |||||
| self.input_dim = input_dim | |||||
| self.output_dim = output_dim | |||||
| if lorder is None: | |||||
| return | |||||
| self.lorder = lorder | |||||
| self.hidden_size = hidden_size | |||||
| self.linear = nn.Linear(input_dim, hidden_size) | |||||
| self.project = nn.Linear(hidden_size, output_dim, bias=False) | |||||
| self.att = nn.Linear(input_dim, lorder, bias=False) | |||||
| def forward(self, input): | |||||
| f1 = F.relu(self.linear(input)) | |||||
| p1 = self.project(f1) | |||||
| x = th.unsqueeze(p1, 1) | |||||
| x_per = x.permute(0, 3, 2, 1) | |||||
| y = F.pad(x_per, [0, 0, self.lorder - 1, 0]) | |||||
| # z [B, F, T, lorder] | |||||
| z = x_per | |||||
| for i in range(1, self.lorder): | |||||
| z = th.cat([z, y[:, :, self.lorder - 1 - i:-i, :]], axis=-1) | |||||
| # [B, T, lorder] | |||||
| att = F.softmax(self.att(input), dim=-1) | |||||
| att = th.unsqueeze(att, 1) | |||||
| z = th.sum(z * att, axis=-1) | |||||
| out1 = z.permute(0, 2, 1) | |||||
| return input + out1 | |||||
| class TFFsmn(nn.Module): | |||||
| def __init__(self, | |||||
| input_dim, | |||||
| output_dim, | |||||
| lorder=None, | |||||
| hidden_size=None, | |||||
| dilation=1, | |||||
| layer_norm=False, | |||||
| dropout=0, | |||||
| skip_connect=True): | |||||
| super(TFFsmn, self).__init__() | |||||
| self.skip_connect = skip_connect | |||||
| self.linear = nn.Linear(input_dim, hidden_size) | |||||
| self.norm = nn.Identity() | |||||
| if layer_norm: | |||||
| self.norm = nn.LayerNorm(input_dim) | |||||
| self.act = nn.ReLU() | |||||
| self.project = nn.Linear(hidden_size, output_dim, bias=False) | |||||
| self.conv1 = nn.Conv2d( | |||||
| output_dim, | |||||
| output_dim, [lorder, 1], | |||||
| dilation=[dilation, 1], | |||||
| groups=output_dim, | |||||
| bias=False) | |||||
| self.padding_left = dilation * (lorder - 1) | |||||
| dorder = 5 | |||||
| self.conv2 = nn.Conv2d(1, 1, [dorder, 1], bias=False) | |||||
| self.padding_freq = dorder - 1 | |||||
| def forward(self, input): | |||||
| return self.compute1(input) | |||||
| def compute1(self, input): | |||||
| ''' linear-dconv-relu(norm)-linear-dconv | |||||
| ''' | |||||
| x = self.linear(input) | |||||
| # [B, 1, F, T] | |||||
| x = th.unsqueeze(x, 1).permute(0, 1, 3, 2) | |||||
| z = F.pad(x, [0, 0, self.padding_freq, 0]) | |||||
| z = self.conv2(z) + x | |||||
| x = z.permute(0, 3, 2, 1).squeeze(-1) | |||||
| x = self.act(x) | |||||
| x = self.norm(x) | |||||
| x = self.project(x) | |||||
| x = th.unsqueeze(x, 1).permute(0, 3, 2, 1) | |||||
| # [B, F, T+lorder-1, 1] | |||||
| y = F.pad(x, [0, 0, self.padding_left, 0]) | |||||
| out = self.conv1(y) | |||||
| if self.skip_connect: | |||||
| out = out + x | |||||
| out = out.permute(0, 3, 2, 1).squeeze() | |||||
| return input + out | |||||
| class CNNFsmn(nn.Module): | |||||
| ''' use cnn to reduce parameters | |||||
| ''' | |||||
| def __init__(self, | |||||
| input_dim, | |||||
| output_dim, | |||||
| lorder=None, | |||||
| hidden_size=None, | |||||
| dilation=1, | |||||
| layer_norm=False, | |||||
| dropout=0, | |||||
| skip_connect=True): | |||||
| super(CNNFsmn, self).__init__() | |||||
| self.input_dim = input_dim | |||||
| self.output_dim = output_dim | |||||
| self.skip_connect = skip_connect | |||||
| if lorder is None: | |||||
| return | |||||
| self.lorder = lorder | |||||
| self.hidden_size = hidden_size | |||||
| self.linear = nn.Linear(input_dim, hidden_size) | |||||
| self.act = nn.ReLU() | |||||
| kernel_size = (3, 8) | |||||
| stride = (1, 4) | |||||
| self.conv = nn.Sequential( | |||||
| nn.ConstantPad2d((stride[1], 0, kernel_size[0] - 1, 0), 0), | |||||
| nn.Conv2d(1, stride[1], kernel_size=kernel_size, stride=stride)) | |||||
| self.dconv = nn.Conv2d( | |||||
| output_dim, | |||||
| output_dim, [lorder, 1], | |||||
| dilation=[dilation, 1], | |||||
| groups=output_dim, | |||||
| bias=False) | |||||
| self.padding_left = dilation * (lorder - 1) | |||||
| def forward(self, input): | |||||
| return self.compute2(input) | |||||
| def compute1(self, input): | |||||
| ''' linear-relu(norm)-conv2d-relu?-dconv | |||||
| ''' | |||||
| # [B, T, F] | |||||
| x = self.linear(input) | |||||
| x = self.act(x) | |||||
| x = th.unsqueeze(x, 1) | |||||
| x = self.conv(x) | |||||
| # [B, C, T, F] -> [B, 1, T, F] | |||||
| b, c, t, f = x.shape | |||||
| x = x.view([b, 1, t, -1]) | |||||
| x = x.permute(0, 3, 2, 1) | |||||
| # [B, F, T+lorder-1, 1] | |||||
| y = F.pad(x, [0, 0, self.padding_left, 0]) | |||||
| out = self.dconv(y) | |||||
| if self.skip_connect: | |||||
| out = out + x | |||||
| out = out.permute(0, 3, 2, 1).squeeze() | |||||
| return input + out | |||||
| def compute2(self, input): | |||||
| ''' conv2d-relu-linear-relu?-dconv | |||||
| ''' | |||||
| x = th.unsqueeze(input, 1) | |||||
| x = self.conv(x) | |||||
| x = self.act(x) | |||||
| # [B, C, T, F] -> [B, T, F] | |||||
| b, c, t, f = x.shape | |||||
| x = x.view([b, t, -1]) | |||||
| x = self.linear(x) | |||||
| x = th.unsqueeze(x, 1).permute(0, 3, 2, 1) | |||||
| y = F.pad(x, [0, 0, self.padding_left, 0]) | |||||
| out = self.dconv(y) | |||||
| if self.skip_connect: | |||||
| out = out + x | |||||
| out = out.permute(0, 3, 2, 1).squeeze() | |||||
| return input + out | |||||
| class UniDeepFsmn(LayerBase): | |||||
| def __init__(self, | |||||
| input_dim, | |||||
| output_dim, | |||||
| lorder=None, | |||||
| hidden_size=None, | |||||
| dilation=1, | |||||
| layer_norm=False, | |||||
| dropout=0, | |||||
| skip_connect=True): | |||||
| super(UniDeepFsmn, self).__init__() | |||||
| self.input_dim = input_dim | |||||
| self.output_dim = output_dim | |||||
| self.skip_connect = skip_connect | |||||
| if lorder is None: | |||||
| return | |||||
| self.lorder = lorder | |||||
| self.hidden_size = hidden_size | |||||
| self.linear = nn.Linear(input_dim, hidden_size) | |||||
| self.norm = nn.Identity() | |||||
| if layer_norm: | |||||
| self.norm = nn.LayerNorm(input_dim) | |||||
| self.act = nn.ReLU() | |||||
| self.project = nn.Linear(hidden_size, output_dim, bias=False) | |||||
| self.conv1 = nn.Conv2d( | |||||
| output_dim, | |||||
| output_dim, [lorder, 1], | |||||
| dilation=[dilation, 1], | |||||
| groups=output_dim, | |||||
| bias=False) | |||||
| self.padding_left = dilation * (lorder - 1) | |||||
| def forward(self, input): | |||||
| return self.compute1(input) | |||||
| def compute1(self, input): | |||||
| ''' linear-relu(norm)-linear-dconv | |||||
| ''' | |||||
| # [B, T, F] | |||||
| x = self.linear(input) | |||||
| x = self.act(x) | |||||
| x = self.norm(x) | |||||
| x = self.project(x) | |||||
| x = th.unsqueeze(x, 1).permute(0, 3, 2, 1) | |||||
| # [B, F, T+lorder-1, 1] | |||||
| y = F.pad(x, [0, 0, self.padding_left, 0]) | |||||
| out = self.conv1(y) | |||||
| if self.skip_connect: | |||||
| out = out + x | |||||
| out = out.permute(0, 3, 2, 1).squeeze() | |||||
| return input + out | |||||
| def compute2(self, input): | |||||
| ''' linear-dconv-linear-relu(norm) | |||||
| ''' | |||||
| x = self.project(input) | |||||
| x = th.unsqueeze(x, 1).permute(0, 3, 2, 1) | |||||
| y = F.pad(x, [0, 0, self.padding_left, 0]) | |||||
| out = self.conv1(y) | |||||
| if self.skip_connect: | |||||
| out = out + x | |||||
| out = out.permute(0, 3, 2, 1).squeeze() | |||||
| x = self.linear(out) | |||||
| x = self.act(x) | |||||
| x = self.norm(x) | |||||
| return input + x | |||||
| def compute3(self, input): | |||||
| ''' dconv-linear-relu(norm)-linear | |||||
| ''' | |||||
| x = th.unsqueeze(input, 1).permute(0, 3, 2, 1) | |||||
| y = F.pad(x, [0, 0, self.padding_left, 0]) | |||||
| out = self.conv1(y) | |||||
| if self.skip_connect: | |||||
| out = out + x | |||||
| out = out.permute(0, 3, 2, 1).squeeze() | |||||
| x = self.linear(out) | |||||
| x = self.act(x) | |||||
| x = self.norm(x) | |||||
| x = self.project(x) | |||||
| return input + x | |||||
| def to_kaldi_nnet(self): | |||||
| re_str = '' | |||||
| re_str += '<UniDeepFsmn> %d %d\n' \ | |||||
| % (self.output_dim, self.input_dim) | |||||
| re_str += '<LearnRateCoef> %d <HidSize> %d <LOrder> %d <LStride> %d <MaxNorm> 0\n' \ | |||||
| % (1, self.hidden_size, self.lorder, 1) | |||||
| lfiters = self.state_dict()['conv1.weight'] | |||||
| x = np.flipud(lfiters.squeeze().numpy().T) | |||||
| re_str += to_kaldi_matrix(x) | |||||
| proj_weights = self.state_dict()['project.weight'] | |||||
| x = proj_weights.squeeze().numpy() | |||||
| re_str += to_kaldi_matrix(x) | |||||
| linear_weights = self.state_dict()['linear.weight'] | |||||
| x = linear_weights.squeeze().numpy() | |||||
| re_str += to_kaldi_matrix(x) | |||||
| linear_bias = self.state_dict()['linear.bias'] | |||||
| x = linear_bias.squeeze().numpy() | |||||
| re_str += to_kaldi_matrix(x) | |||||
| return re_str | |||||
| def to_raw_nnet(self, fid): | |||||
| lfiters = self.state_dict()['conv1.weight'] | |||||
| x = np.flipud(lfiters.squeeze().numpy().T) | |||||
| x.tofile(fid) | |||||
| proj_weights = self.state_dict()['project.weight'] | |||||
| x = proj_weights.squeeze().numpy() | |||||
| x.tofile(fid) | |||||
| linear_weights = self.state_dict()['linear.weight'] | |||||
| x = linear_weights.squeeze().numpy() | |||||
| x.tofile(fid) | |||||
| linear_bias = self.state_dict()['linear.bias'] | |||||
| x = linear_bias.squeeze().numpy() | |||||
| x.tofile(fid) | |||||
| def load_kaldi_nnet(self, instr): | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<LearnRateCoef>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for <LearnRateCoef>') | |||||
| instr, lr = output | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<HidSize>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for <HidSize>') | |||||
| instr, hiddensize = output | |||||
| self.hidden_size = int(hiddensize) | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<LOrder>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for <LOrder>') | |||||
| instr, lorder = output | |||||
| self.lorder = int(lorder) | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<LStride>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for <LStride>') | |||||
| instr, lstride = output | |||||
| self.lstride = lstride | |||||
| output = expect_token_number( | |||||
| instr, | |||||
| '<MaxNorm>', | |||||
| ) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for <MaxNorm>') | |||||
| output = expect_kaldi_matrix(instr) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for parsing matrix') | |||||
| instr, mat = output | |||||
| mat1 = np.fliplr(mat.T).copy() | |||||
| self.conv1 = nn.Conv2d( | |||||
| self.output_dim, | |||||
| self.output_dim, [self.lorder, 1], [1, 1], | |||||
| groups=self.output_dim, | |||||
| bias=False) | |||||
| mat_th = th.from_numpy(mat1).type(th.FloatTensor) | |||||
| mat_th = mat_th.unsqueeze(1) | |||||
| mat_th = mat_th.unsqueeze(3) | |||||
| self.conv1.weight = th.nn.Parameter(mat_th) | |||||
| output = expect_kaldi_matrix(instr) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for parsing matrix') | |||||
| instr, mat = output | |||||
| self.project = nn.Linear(self.hidden_size, self.output_dim, bias=False) | |||||
| self.linear = nn.Linear(self.input_dim, self.hidden_size) | |||||
| self.project.weight = th.nn.Parameter( | |||||
| th.from_numpy(mat).type(th.FloatTensor)) | |||||
| output = expect_kaldi_matrix(instr) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for parsing matrix') | |||||
| instr, mat = output | |||||
| self.linear.weight = th.nn.Parameter( | |||||
| th.from_numpy(mat).type(th.FloatTensor)) | |||||
| output = expect_kaldi_matrix(instr) | |||||
| if output is None: | |||||
| raise Exception('UniDeepFsmn format error for parsing matrix') | |||||
| instr, mat = output | |||||
| mat = np.squeeze(mat) | |||||
| self.linear.bias = th.nn.Parameter( | |||||
| th.from_numpy(mat).type(th.FloatTensor)) | |||||
| return instr | |||||
| @@ -0,0 +1,394 @@ | |||||
| import torch | |||||
| import torch.nn.functional as F | |||||
| from .modulation_loss import (GaborSTRFConv, MelScale, | |||||
| ModulationDomainLossModule) | |||||
| EPS = 1e-8 | |||||
| def compute_mask(mixed_spec, clean_spec, mask_type='psmiam', clip=1): | |||||
| ''' | |||||
| stft: (batch, ..., 2) or complex(batch, ...) | |||||
| y = x + n | |||||
| ''' | |||||
| if torch.is_complex(mixed_spec): | |||||
| yr, yi = mixed_spec.real, mixed_spec.imag | |||||
| else: | |||||
| yr, yi = mixed_spec[..., 0], mixed_spec[..., 1] | |||||
| if torch.is_complex(clean_spec): | |||||
| xr, xi = clean_spec.real, clean_spec.imag | |||||
| else: | |||||
| xr, xi = clean_spec[..., 0], clean_spec[..., 1] | |||||
| if mask_type == 'iam': | |||||
| ymag = torch.sqrt(yr**2 + yi**2) | |||||
| xmag = torch.sqrt(xr**2 + xi**2) | |||||
| iam = xmag / (ymag + EPS) | |||||
| return torch.clamp(iam, 0, 1) | |||||
| elif mask_type == 'psm': | |||||
| ypow = yr**2 + yi**2 | |||||
| psm = (xr * yr + xi * yi) / (ypow + EPS) | |||||
| return torch.clamp(psm, 0, 1) | |||||
| elif mask_type == 'psmiam': | |||||
| ypow = yr**2 + yi**2 | |||||
| psm = (xr * yr + xi * yi) / (ypow + EPS) | |||||
| ymag = torch.sqrt(yr**2 + yi**2) | |||||
| xmag = torch.sqrt(xr**2 + xi**2) | |||||
| iam = xmag / (ymag + EPS) | |||||
| psmiam = psm * iam | |||||
| return torch.clamp(psmiam, 0, 1) | |||||
| elif mask_type == 'crm': | |||||
| ypow = yr**2 + yi**2 | |||||
| mr = (xr * yr + xi * yi) / (ypow + EPS) | |||||
| mi = (xi * yr - xr * yi) / (ypow + EPS) | |||||
| mr = torch.clamp(mr, -clip, clip) | |||||
| mi = torch.clamp(mi, -clip, clip) | |||||
| return mr, mi | |||||
| def energy_vad(spec, | |||||
| thdhigh=320 * 600 * 600 * 2, | |||||
| thdlow=320 * 300 * 300 * 2, | |||||
| int16=True): | |||||
| ''' | |||||
| energy based vad should be accurate enough | |||||
| spec: (batch, bins, frames, 2) | |||||
| returns (batch, frames) | |||||
| ''' | |||||
| energy = torch.sum(spec[..., 0]**2 + spec[..., 1]**2, dim=1) | |||||
| vad = energy > thdhigh | |||||
| idx = torch.logical_and(vad == 0, energy > thdlow) | |||||
| vad[idx] = 0.5 | |||||
| return vad | |||||
| def modulation_loss_init(n_fft): | |||||
| gabor_strf_parameters = torch.load( | |||||
| './network/gabor_strf_parameters.pt')['state_dict'] | |||||
| gabor_modulation_kernels = GaborSTRFConv(supn=30, supk=30, nkern=60) | |||||
| gabor_modulation_kernels.load_state_dict(gabor_strf_parameters) | |||||
| modulation_loss_module = ModulationDomainLossModule( | |||||
| gabor_modulation_kernels.eval()) | |||||
| for param in modulation_loss_module.parameters(): | |||||
| param.requires_grad = False | |||||
| stft2mel = MelScale( | |||||
| n_mels=80, sample_rate=16000, n_stft=n_fft // 2 + 1).cuda() | |||||
| return modulation_loss_module, stft2mel | |||||
| def mask_loss_function( | |||||
| loss_func='psm_loss', | |||||
| loss_type='mse', # ['mse', 'mae', 'comb'] | |||||
| mask_type='psmiam', | |||||
| use_mod_loss=False, | |||||
| use_wav2vec_loss=False, | |||||
| n_fft=640, | |||||
| hop_length=320, | |||||
| EPS=1e-8, | |||||
| weight=None): | |||||
| if weight is not None: | |||||
| print(f'Use loss weight: {weight}') | |||||
| winlen = n_fft | |||||
| window = torch.hamming_window(winlen, periodic=False) | |||||
| def stft(x, return_complex=False): | |||||
| # returns [batch, bins, frames, 2] | |||||
| return torch.stft( | |||||
| x, | |||||
| n_fft, | |||||
| hop_length, | |||||
| winlen, | |||||
| window=window.to(x.device), | |||||
| center=False, | |||||
| return_complex=return_complex) | |||||
| def istft(x, slen): | |||||
| return torch.istft( | |||||
| x, | |||||
| n_fft, | |||||
| hop_length, | |||||
| winlen, | |||||
| window=window.to(x.device), | |||||
| center=False, | |||||
| length=slen) | |||||
| def mask_loss(targets, masks, nframes): | |||||
| ''' [Batch, Time, Frequency] | |||||
| ''' | |||||
| with torch.no_grad(): | |||||
| mask_for_loss = torch.ones_like(targets) | |||||
| for idx, num in enumerate(nframes): | |||||
| mask_for_loss[idx, num:, :] = 0 | |||||
| masks = masks * mask_for_loss | |||||
| targets = targets * mask_for_loss | |||||
| if weight is None: | |||||
| alpha = 1 | |||||
| else: # for aec ST | |||||
| alpha = weight - targets | |||||
| if loss_type == 'mse': | |||||
| loss = 0.5 * torch.sum(alpha * torch.pow(targets - masks, 2)) | |||||
| elif loss_type == 'mae': | |||||
| loss = torch.sum(alpha * torch.abs(targets - masks)) | |||||
| else: # mse(mask), mae(mask) approx 1:2 | |||||
| loss = 0.5 * torch.sum(alpha * torch.pow(targets - masks, 2) | |||||
| + 0.1 * alpha * torch.abs(targets - masks)) | |||||
| loss /= torch.sum(nframes) | |||||
| return loss | |||||
| def spectrum_loss(targets, spec, nframes): | |||||
| ''' [Batch, Time, Frequency, 2] | |||||
| ''' | |||||
| with torch.no_grad(): | |||||
| mask_for_loss = torch.ones_like(targets[..., 0]) | |||||
| for idx, num in enumerate(nframes): | |||||
| mask_for_loss[idx, num:, :] = 0 | |||||
| xr = spec[..., 0] * mask_for_loss | |||||
| xi = spec[..., 1] * mask_for_loss | |||||
| yr = targets[..., 0] * mask_for_loss | |||||
| yi = targets[..., 1] * mask_for_loss | |||||
| xmag = torch.sqrt(spec[..., 0]**2 + spec[..., 1]**2) * mask_for_loss | |||||
| ymag = torch.sqrt(targets[..., 0]**2 | |||||
| + targets[..., 1]**2) * mask_for_loss | |||||
| loss1 = torch.sum(torch.pow(xr - yr, 2) + torch.pow(xi - yi, 2)) | |||||
| loss2 = torch.sum(torch.pow(xmag - ymag, 2)) | |||||
| loss = (loss1 + loss2) / torch.sum(nframes) | |||||
| return loss | |||||
| def sa_loss_dlen(mixed, clean, masks, nframes): | |||||
| yspec = stft(mixed).permute([0, 2, 1, 3]) / 32768 | |||||
| xspec = stft(clean).permute([0, 2, 1, 3]) / 32768 | |||||
| with torch.no_grad(): | |||||
| mask_for_loss = torch.ones_like(xspec[..., 0]) | |||||
| for idx, num in enumerate(nframes): | |||||
| mask_for_loss[idx, num:, :] = 0 | |||||
| emag = ((yspec[..., 0]**2 + yspec[..., 1]**2)**0.15) * (masks**0.3) | |||||
| xmag = (xspec[..., 0]**2 + xspec[..., 1]**2)**0.15 | |||||
| emag = emag * mask_for_loss | |||||
| xmag = xmag * mask_for_loss | |||||
| loss = torch.sum(torch.pow(emag - xmag, 2)) / torch.sum(nframes) | |||||
| return loss | |||||
| def psm_vad_loss_dlen(mixed, clean, masks, nframes, subtask=None): | |||||
| mixed_spec = stft(mixed) | |||||
| clean_spec = stft(clean) | |||||
| targets = compute_mask(mixed_spec, clean_spec, mask_type) | |||||
| # [B, T, F] | |||||
| targets = targets.permute(0, 2, 1) | |||||
| loss = mask_loss(targets, masks, nframes) | |||||
| if subtask is not None: | |||||
| vadtargets = energy_vad(clean_spec) | |||||
| with torch.no_grad(): | |||||
| mask_for_loss = torch.ones_like(targets[:, :, 0]) | |||||
| for idx, num in enumerate(nframes): | |||||
| mask_for_loss[idx, num:] = 0 | |||||
| subtask = subtask[:, :, 0] * mask_for_loss | |||||
| vadtargets = vadtargets * mask_for_loss | |||||
| loss_vad = F.binary_cross_entropy(subtask, vadtargets) | |||||
| return loss + loss_vad | |||||
| return loss | |||||
| def modulation_loss(mixed, clean, masks, nframes, subtask=None): | |||||
| mixed_spec = stft(mixed, True) | |||||
| clean_spec = stft(clean, True) | |||||
| enhanced_mag = torch.abs(mixed_spec) | |||||
| clean_mag = torch.abs(clean_spec) | |||||
| with torch.no_grad(): | |||||
| mask_for_loss = torch.ones_like(clean_mag) | |||||
| for idx, num in enumerate(nframes): | |||||
| mask_for_loss[idx, :, num:] = 0 | |||||
| clean_mag = clean_mag * mask_for_loss | |||||
| enhanced_mag = enhanced_mag * mask_for_loss * masks.permute([0, 2, 1]) | |||||
| # Covert to log-mel representation | |||||
| # (B,T,#mel_channels) | |||||
| clean_log_mel = torch.log( | |||||
| torch.transpose(stft2mel(clean_mag**2), 2, 1) + 1e-8) | |||||
| enhanced_log_mel = torch.log( | |||||
| torch.transpose(stft2mel(enhanced_mag**2), 2, 1) + 1e-8) | |||||
| alpha = compute_mask(mixed_spec, clean_spec, mask_type) | |||||
| alpha = alpha.permute(0, 2, 1) | |||||
| loss = 0.05 * modulation_loss_module(enhanced_log_mel, clean_log_mel, | |||||
| alpha) | |||||
| loss2 = psm_vad_loss_dlen(mixed, clean, masks, nframes, subtask) | |||||
| # print(loss.item(), loss2.item()) #approx 1:4 | |||||
| loss = loss + loss2 | |||||
| return loss | |||||
| def wav2vec_loss(mixed, clean, masks, nframes, subtask=None): | |||||
| mixed /= 32768 | |||||
| clean /= 32768 | |||||
| mixed_spec = stft(mixed) | |||||
| with torch.no_grad(): | |||||
| mask_for_loss = torch.ones_like(masks) | |||||
| for idx, num in enumerate(nframes): | |||||
| mask_for_loss[idx, num:, :] = 0 | |||||
| masks_est = masks * mask_for_loss | |||||
| estimate = mixed_spec * masks_est.permute([0, 2, 1]).unsqueeze(3) | |||||
| est_clean = istft(estimate, clean.shape[1]) | |||||
| loss = wav2vec_loss_module(est_clean, clean) | |||||
| return loss | |||||
| def sisdr_loss_dlen(mixed, | |||||
| clean, | |||||
| masks, | |||||
| nframes, | |||||
| subtask=None, | |||||
| zero_mean=True): | |||||
| mixed_spec = stft(mixed) | |||||
| with torch.no_grad(): | |||||
| mask_for_loss = torch.ones_like(masks) | |||||
| for idx, num in enumerate(nframes): | |||||
| mask_for_loss[idx, num:, :] = 0 | |||||
| masks_est = masks * mask_for_loss | |||||
| estimate = mixed_spec * masks_est.permute([0, 2, 1]).unsqueeze(3) | |||||
| est_clean = istft(estimate, clean.shape[1]) | |||||
| flen = min(clean.shape[1], est_clean.shape[1]) | |||||
| clean = clean[:, :flen] | |||||
| est_clean = est_clean[:, :flen] | |||||
| # follow asteroid/losses/sdr.py | |||||
| if zero_mean: | |||||
| clean = clean - torch.mean(clean, dim=1, keepdim=True) | |||||
| est_clean = est_clean - torch.mean(est_clean, dim=1, keepdim=True) | |||||
| dot = torch.sum(est_clean * clean, dim=1, keepdim=True) | |||||
| s_clean_energy = torch.sum(clean**2, dim=1, keepdim=True) + EPS | |||||
| scaled_clean = dot * clean / s_clean_energy | |||||
| e_noise = est_clean - scaled_clean | |||||
| # [batch] | |||||
| sisdr = torch.sum( | |||||
| scaled_clean**2, dim=1) / ( | |||||
| torch.sum(e_noise**2, dim=1) + EPS) | |||||
| sisdr = -10 * torch.log10(sisdr + EPS) | |||||
| loss = sisdr.mean() | |||||
| return loss | |||||
| def sisdr_freq_loss_dlen(mixed, clean, masks, nframes, subtask=None): | |||||
| mixed_spec = stft(mixed) | |||||
| clean_spec = stft(clean) | |||||
| with torch.no_grad(): | |||||
| mask_for_loss = torch.ones_like(masks) | |||||
| for idx, num in enumerate(nframes): | |||||
| mask_for_loss[idx, num:, :] = 0 | |||||
| masks_est = masks * mask_for_loss | |||||
| estimate = mixed_spec * masks_est.permute([0, 2, 1]).unsqueeze(3) | |||||
| dot_real = estimate[..., 0] * clean_spec[..., 0] + \ | |||||
| estimate[..., 1] * clean_spec[..., 1] | |||||
| dot_imag = estimate[..., 0] * clean_spec[..., 1] - \ | |||||
| estimate[..., 1] * clean_spec[..., 0] | |||||
| dot = torch.cat([dot_real.unsqueeze(3), dot_imag.unsqueeze(3)], dim=-1) | |||||
| s_clean_energy = clean_spec[..., 0] ** 2 + \ | |||||
| clean_spec[..., 1] ** 2 + EPS | |||||
| scaled_clean = dot * clean_spec / s_clean_energy.unsqueeze(3) | |||||
| e_noise = estimate - scaled_clean | |||||
| # [batch] | |||||
| scaled_clean_energy = torch.sum( | |||||
| scaled_clean[..., 0]**2 + scaled_clean[..., 1]**2, dim=1) | |||||
| e_noise_energy = torch.sum( | |||||
| e_noise[..., 0]**2 + e_noise[..., 1]**2, dim=1) | |||||
| sisdr = torch.sum( | |||||
| scaled_clean_energy, dim=1) / ( | |||||
| torch.sum(e_noise_energy, dim=1) + EPS) | |||||
| sisdr = -10 * torch.log10(sisdr + EPS) | |||||
| loss = sisdr.mean() | |||||
| return loss | |||||
| def crm_loss_dlen(mixed, clean, masks, nframes, subtask=None): | |||||
| mixed_spec = stft(mixed).permute([0, 2, 1, 3]) | |||||
| clean_spec = stft(clean).permute([0, 2, 1, 3]) | |||||
| mixed_spec = mixed_spec / 32768 | |||||
| clean_spec = clean_spec / 32768 | |||||
| tgt_mr, tgt_mi = compute_mask(mixed_spec, clean_spec, mask_type='crm') | |||||
| D = int(masks.shape[2] / 2) | |||||
| with torch.no_grad(): | |||||
| mask_for_loss = torch.ones_like(clean_spec[..., 0]) | |||||
| for idx, num in enumerate(nframes): | |||||
| mask_for_loss[idx, num:, :] = 0 | |||||
| mr = masks[..., :D] * mask_for_loss | |||||
| mi = masks[..., D:] * mask_for_loss | |||||
| tgt_mr = tgt_mr * mask_for_loss | |||||
| tgt_mi = tgt_mi * mask_for_loss | |||||
| if weight is None: | |||||
| alpha = 1 | |||||
| else: | |||||
| alpha = weight - tgt_mr | |||||
| # signal approximation | |||||
| yr = mixed_spec[..., 0] | |||||
| yi = mixed_spec[..., 1] | |||||
| loss1 = torch.sum(alpha * torch.pow((mr * yr - mi * yi) - clean_spec[..., 0], 2)) \ | |||||
| + torch.sum(alpha * torch.pow((mr * yi + mi * yr) - clean_spec[..., 1], 2)) | |||||
| # mask approximation | |||||
| loss2 = torch.sum(alpha * torch.pow(mr - tgt_mr, 2)) \ | |||||
| + torch.sum(alpha * torch.pow(mi - tgt_mi, 2)) | |||||
| loss = 0.5 * (loss1 + loss2) / torch.sum(nframes) | |||||
| return loss | |||||
| def crm_miso_loss_dlen(mixed, clean, masks, nframes): | |||||
| return crm_loss_dlen(mixed[..., 0], clean[..., 0], masks, nframes) | |||||
| def mimo_loss_dlen(mixed, clean, masks, nframes): | |||||
| chs = mixed.shape[-1] | |||||
| D = masks.shape[2] // chs | |||||
| loss = psm_vad_loss_dlen(mixed[..., 0], clean[..., 0], masks[..., :D], | |||||
| nframes) | |||||
| for ch in range(1, chs): | |||||
| loss1 = psm_vad_loss_dlen(mixed[..., ch], clean[..., ch], | |||||
| masks[..., ch * D:ch * D + D], nframes) | |||||
| loss = loss + loss1 | |||||
| return loss / chs | |||||
| def spec_loss_dlen(mixed, clean, spec, nframes): | |||||
| clean_spec = stft(clean).permute([0, 2, 1, 3]) | |||||
| clean_spec = clean_spec / 32768 | |||||
| D = spec.shape[2] // 2 | |||||
| spec_est = torch.cat([spec[..., :D, None], spec[..., D:, None]], | |||||
| dim=-1) | |||||
| loss = spectrum_loss(clean_spec, spec_est, nframes) | |||||
| return loss | |||||
| if loss_func == 'psm_vad_loss_dlen': | |||||
| return psm_vad_loss_dlen | |||||
| elif loss_func == 'sisdr_loss_dlen': | |||||
| return sisdr_loss_dlen | |||||
| elif loss_func == 'sisdr_freq_loss_dlen': | |||||
| return sisdr_freq_loss_dlen | |||||
| elif loss_func == 'crm_loss_dlen': | |||||
| return crm_loss_dlen | |||||
| elif loss_func == 'modulation_loss': | |||||
| return modulation_loss | |||||
| elif loss_func == 'wav2vec_loss': | |||||
| return wav2vec_loss | |||||
| elif loss_func == 'mimo_loss_dlen': | |||||
| return mimo_loss_dlen | |||||
| elif loss_func == 'spec_loss_dlen': | |||||
| return spec_loss_dlen | |||||
| elif loss_func == 'sa_loss_dlen': | |||||
| return sa_loss_dlen | |||||
| else: | |||||
| print('error loss func') | |||||
| return None | |||||
| @@ -0,0 +1,248 @@ | |||||
| import math | |||||
| import torch | |||||
| import torch.nn as nn | |||||
| import torch.nn.functional as F | |||||
| from torchaudio.transforms import MelScale | |||||
| class ModulationDomainLossModule(torch.nn.Module): | |||||
| """Modulation-domain loss function developed in [1] for supervised speech enhancement | |||||
| In our paper, we used the gabor-based STRF kernels as the modulation kernels and used the log-mel spectrogram | |||||
| as the input spectrogram representation. | |||||
| Specific parameter details are in the paper and in the example below | |||||
| Parameters | |||||
| ---------- | |||||
| modulation_kernels: nn.Module | |||||
| Differentiable module that transforms a spectrogram representation to the modulation domain | |||||
| modulation_domain = modulation_kernels(input_tf_representation) | |||||
| Input Spectrogram representation (B, T, F) ---> |(M) modulation_kernels|--->Modulation Domain(B, M, T', F') | |||||
| norm: boolean | |||||
| Normalizes the modulation domain representation to be 0 mean across time | |||||
| [1] T. Vuong, Y. Xia, and R. M. Stern, “A modulation-domain lossfor neural-network-based real-time | |||||
| speech enhancement” | |||||
| Accepted ICASSP 2021, https://arxiv.org/abs/2102.07330 | |||||
| """ | |||||
| def __init__(self, modulation_kernels, norm=True): | |||||
| super(ModulationDomainLossModule, self).__init__() | |||||
| self.modulation_kernels = modulation_kernels | |||||
| self.mse = nn.MSELoss(reduce=False) | |||||
| self.norm = norm | |||||
| def forward(self, enhanced_spect, clean_spect, weight=None): | |||||
| """Calculate modulation-domain loss | |||||
| Args: | |||||
| enhanced_spect (Tensor): spectrogram representation of enhanced signal (B, #frames, #freq_channels). | |||||
| clean_spect (Tensor): spectrogram representation of clean ground-truth signal (B, #frames, #freq_channels). | |||||
| Returns: | |||||
| Tensor: Modulation-domain loss value. | |||||
| """ | |||||
| clean_mod = self.modulation_kernels(clean_spect) | |||||
| enhanced_mod = self.modulation_kernels(enhanced_spect) | |||||
| if self.norm: | |||||
| mean_clean_mod = torch.mean(clean_mod, dim=2) | |||||
| mean_enhanced_mod = torch.mean(enhanced_mod, dim=2) | |||||
| clean_mod = clean_mod - mean_clean_mod.unsqueeze(2) | |||||
| enhanced_mod = enhanced_mod - mean_enhanced_mod.unsqueeze(2) | |||||
| if weight is None: | |||||
| alpha = 1 | |||||
| else: # TF-mask weight | |||||
| alpha = 1 + torch.sum(weight, dim=-1, keepdim=True).unsqueeze(1) | |||||
| mod_mse_loss = self.mse(enhanced_mod, clean_mod) * alpha | |||||
| mod_mse_loss = torch.mean( | |||||
| torch.sum(mod_mse_loss, dim=(1, 2, 3)) | |||||
| / torch.sum(clean_mod**2, dim=(1, 2, 3))) | |||||
| return mod_mse_loss | |||||
| class ModulationDomainNCCLossModule(torch.nn.Module): | |||||
| """Modulation-domain loss function developed in [1] for supervised speech enhancement | |||||
| # Speech Intelligibility Prediction Using Spectro-Temporal Modulation Analysis - based off of this | |||||
| In our paper, we used the gabor-based STRF kernels as the modulation kernels and used the log-mel spectrogram | |||||
| as the input spectrogram representation. | |||||
| Specific parameter details are in the paper and in the example below | |||||
| Parameters | |||||
| ---------- | |||||
| modulation_kernels: nn.Module | |||||
| Differentiable module that transforms a spectrogram representation to the modulation domain | |||||
| modulation_domain = modulation_kernels(input_tf_representation) | |||||
| Input Spectrogram representation(B, T, F) --- (M) modulation_kernels---> Modulation Domain(B, M, T', F') | |||||
| [1] | |||||
| """ | |||||
| def __init__(self, modulation_kernels): | |||||
| super(ModulationDomainNCCLossModule, self).__init__() | |||||
| self.modulation_kernels = modulation_kernels | |||||
| self.mse = nn.MSELoss(reduce=False) | |||||
| def forward(self, enhanced_spect, clean_spect): | |||||
| """Calculate modulation-domain loss | |||||
| Args: | |||||
| enhanced_spect (Tensor): spectrogram representation of enhanced signal (B, #frames, #freq_channels). | |||||
| clean_spect (Tensor): spectrogram representation of clean ground-truth signal (B, #frames, #freq_channels). | |||||
| Returns: | |||||
| Tensor: Modulation-domain loss value. | |||||
| """ | |||||
| clean_mod = self.modulation_kernels(clean_spect) | |||||
| enhanced_mod = self.modulation_kernels(enhanced_spect) | |||||
| mean_clean_mod = torch.mean(clean_mod, dim=2) | |||||
| mean_enhanced_mod = torch.mean(enhanced_mod, dim=2) | |||||
| normalized_clean = clean_mod - mean_clean_mod.unsqueeze(2) | |||||
| normalized_enhanced = enhanced_mod - mean_enhanced_mod.unsqueeze(2) | |||||
| inner_product = torch.sum( | |||||
| normalized_clean * normalized_enhanced, dim=2) | |||||
| normalized_denom = (torch.sum( | |||||
| normalized_clean * normalized_clean, dim=2))**.5 * (torch.sum( | |||||
| normalized_enhanced * normalized_enhanced, dim=2))**.5 | |||||
| ncc = inner_product / normalized_denom | |||||
| mod_mse_loss = torch.mean((ncc - 1.0)**2) | |||||
| return mod_mse_loss | |||||
| class GaborSTRFConv(nn.Module): | |||||
| """Gabor-STRF-based cross-correlation kernel.""" | |||||
| def __init__(self, | |||||
| supn, | |||||
| supk, | |||||
| nkern, | |||||
| rates=None, | |||||
| scales=None, | |||||
| norm_strf=True, | |||||
| real_only=False): | |||||
| """Instantiate a Gabor-based STRF convolution layer. | |||||
| Parameters | |||||
| ---------- | |||||
| supn: int | |||||
| Time support in number of frames. Also the window length. | |||||
| supk: int | |||||
| Frequency support in number of channels. Also the window length. | |||||
| nkern: int | |||||
| Number of kernels, each with a learnable rate and scale. | |||||
| rates: list of float, None | |||||
| Initial values for temporal modulation. | |||||
| scales: list of float, None | |||||
| Initial values for spectral modulation. | |||||
| norm_strf: Boolean | |||||
| Normalize STRF kernels to be unit length | |||||
| real_only: Boolean | |||||
| If True, nkern REAL gabor-STRF kernels | |||||
| If False, nkern//2 REAL and nkern//2 IMAGINARY gabor-STRF kernels | |||||
| """ | |||||
| super(GaborSTRFConv, self).__init__() | |||||
| self.numN = supn | |||||
| self.numK = supk | |||||
| self.numKern = nkern | |||||
| self.real_only = real_only | |||||
| self.norm_strf = norm_strf | |||||
| if not real_only: | |||||
| nkern = nkern // 2 | |||||
| if supk % 2 == 0: # force odd number | |||||
| supk += 1 | |||||
| self.supk = torch.arange(supk, dtype=torch.float32) | |||||
| if supn % 2 == 0: # force odd number | |||||
| supn += 1 | |||||
| self.supn = torch.arange(supn, dtype=self.supk.dtype) | |||||
| self.padding = (supn // 2, supk // 2) | |||||
| # Set up learnable parameters | |||||
| # for param in (rates, scales): | |||||
| # assert (not param) or len(param) == nkern | |||||
| if not rates: | |||||
| rates = torch.rand(nkern) * math.pi / 2.0 | |||||
| if not scales: | |||||
| scales = (torch.rand(nkern) * 2.0 - 1.0) * math.pi / 2.0 | |||||
| self.rates_ = nn.Parameter(torch.Tensor(rates)) | |||||
| self.scales_ = nn.Parameter(torch.Tensor(scales)) | |||||
| def strfs(self): | |||||
| """Make STRFs using the current parameters.""" | |||||
| if self.supn.device != self.rates_.device: # for first run | |||||
| self.supn = self.supn.to(self.rates_.device) | |||||
| self.supk = self.supk.to(self.rates_.device) | |||||
| n0, k0 = self.padding | |||||
| nwind = .5 - .5 * \ | |||||
| torch.cos(2 * math.pi * (self.supn + 1) / (len(self.supn) + 1)) | |||||
| kwind = .5 - .5 * \ | |||||
| torch.cos(2 * math.pi * (self.supk + 1) / (len(self.supk) + 1)) | |||||
| new_wind = torch.matmul((nwind).unsqueeze(-1), (kwind).unsqueeze(0)) | |||||
| n_n_0 = self.supn - n0 | |||||
| k_k_0 = self.supk - k0 | |||||
| n_mult = torch.matmul( | |||||
| n_n_0.unsqueeze(1), | |||||
| torch.ones((1, len(self.supk))).type(torch.FloatTensor).to( | |||||
| self.rates_.device)) | |||||
| k_mult = torch.matmul( | |||||
| torch.ones((len(self.supn), | |||||
| 1)).type(torch.FloatTensor).to(self.rates_.device), | |||||
| k_k_0.unsqueeze(0)) | |||||
| inside = self.rates_.unsqueeze(1).unsqueeze( | |||||
| 1) * n_mult + self.scales_.unsqueeze(1).unsqueeze(1) * k_mult | |||||
| real_strf = torch.cos(inside) * new_wind.unsqueeze(0) | |||||
| if self.real_only: | |||||
| final_strf = real_strf | |||||
| else: | |||||
| imag_strf = torch.sin(inside) * new_wind.unsqueeze(0) | |||||
| final_strf = torch.cat([real_strf, imag_strf], dim=0) | |||||
| if self.norm_strf: | |||||
| final_strf = final_strf / (torch.sum( | |||||
| final_strf**2, dim=(1, 2)).unsqueeze(1).unsqueeze(2))**.5 | |||||
| return final_strf | |||||
| def forward(self, sigspec): | |||||
| """Forward pass a batch of (real) spectra [Batch x Time x Frequency].""" | |||||
| if len(sigspec.shape) == 2: # expand batch dimension if single eg | |||||
| sigspec = sigspec.unsqueeze(0) | |||||
| strfs = self.strfs().unsqueeze(1).type_as(sigspec) | |||||
| out = F.conv2d(sigspec.unsqueeze(1), strfs, padding=self.padding) | |||||
| return out | |||||
| def __repr__(self): | |||||
| """Gabor filter""" | |||||
| report = """ | |||||
| +++++ Gabor Filter Kernels [{}], supn[{}], supk[{}] real only [{}] norm strf [{}] +++++ | |||||
| """.format(self.numKern, self.numN, self.numK, self.real_only, | |||||
| self.norm_strf) | |||||
| return report | |||||
| @@ -0,0 +1,483 @@ | |||||
| import torch | |||||
| import torch.nn as nn | |||||
| import torch.nn.functional as F | |||||
| from ..layers.activations import RectifiedLinear, Sigmoid | |||||
| from ..layers.affine_transform import AffineTransform | |||||
| from ..layers.deep_fsmn import DeepFsmn | |||||
| from ..layers.uni_deep_fsmn import Conv2d, UniDeepFsmn | |||||
| class MaskNet(nn.Module): | |||||
| def __init__(self, | |||||
| indim, | |||||
| outdim, | |||||
| layers=9, | |||||
| hidden_dim=128, | |||||
| hidden_dim2=None, | |||||
| lorder=20, | |||||
| rorder=0, | |||||
| dilation=1, | |||||
| layer_norm=False, | |||||
| dropout=0, | |||||
| crm=False, | |||||
| vad=False, | |||||
| linearout=False): | |||||
| super(MaskNet, self).__init__() | |||||
| self.linear1 = AffineTransform(indim, hidden_dim) | |||||
| self.relu = RectifiedLinear(hidden_dim, hidden_dim) | |||||
| if hidden_dim2 is None: | |||||
| hidden_dim2 = hidden_dim | |||||
| if rorder == 0: | |||||
| repeats = [ | |||||
| UniDeepFsmn( | |||||
| hidden_dim, | |||||
| hidden_dim, | |||||
| lorder, | |||||
| hidden_dim2, | |||||
| dilation=dilation, | |||||
| layer_norm=layer_norm, | |||||
| dropout=dropout) for i in range(layers) | |||||
| ] | |||||
| else: | |||||
| repeats = [ | |||||
| DeepFsmn( | |||||
| hidden_dim, | |||||
| hidden_dim, | |||||
| lorder, | |||||
| rorder, | |||||
| hidden_dim2, | |||||
| layer_norm=layer_norm, | |||||
| dropout=dropout) for i in range(layers) | |||||
| ] | |||||
| self.deepfsmn = nn.Sequential(*repeats) | |||||
| self.linear2 = AffineTransform(hidden_dim, outdim) | |||||
| self.crm = crm | |||||
| if self.crm: | |||||
| self.sig = nn.Tanh() | |||||
| else: | |||||
| self.sig = Sigmoid(outdim, outdim) | |||||
| self.vad = vad | |||||
| if self.vad: | |||||
| self.linear3 = AffineTransform(hidden_dim, 1) | |||||
| self.layers = layers | |||||
| self.linearout = linearout | |||||
| if self.linearout and self.vad: | |||||
| print('Warning: not supported nnet') | |||||
| def forward(self, feat, ctl=None): | |||||
| x1 = self.linear1(feat) | |||||
| x2 = self.relu(x1) | |||||
| if ctl is not None: | |||||
| ctl = min(ctl, self.layers - 1) | |||||
| for i in range(ctl): | |||||
| x2 = self.deepfsmn[i](x2) | |||||
| mask = self.sig(self.linear2(x2)) | |||||
| if self.vad: | |||||
| vad = torch.sigmoid(self.linear3(x2)) | |||||
| return mask, vad | |||||
| else: | |||||
| return mask | |||||
| x3 = self.deepfsmn(x2) | |||||
| if self.linearout: | |||||
| return self.linear2(x3) | |||||
| mask = self.sig(self.linear2(x3)) | |||||
| if self.vad: | |||||
| vad = torch.sigmoid(self.linear3(x3)) | |||||
| return mask, vad | |||||
| else: | |||||
| return mask | |||||
| def to_kaldi_nnet(self): | |||||
| re_str = '' | |||||
| re_str += '<Nnet>\n' | |||||
| re_str += self.linear1.to_kaldi_nnet() | |||||
| re_str += self.relu.to_kaldi_nnet() | |||||
| for dfsmn in self.deepfsmn: | |||||
| re_str += dfsmn.to_kaldi_nnet() | |||||
| re_str += self.linear2.to_kaldi_nnet() | |||||
| re_str += self.sig.to_kaldi_nnet() | |||||
| re_str += '</Nnet>\n' | |||||
| return re_str | |||||
| def to_raw_nnet(self, fid): | |||||
| self.linear1.to_raw_nnet(fid) | |||||
| for dfsmn in self.deepfsmn: | |||||
| dfsmn.to_raw_nnet(fid) | |||||
| self.linear2.to_raw_nnet(fid) | |||||
| class StageNet(nn.Module): | |||||
| def __init__(self, | |||||
| indim, | |||||
| outdim, | |||||
| layers=9, | |||||
| layers2=6, | |||||
| hidden_dim=128, | |||||
| lorder=20, | |||||
| rorder=0, | |||||
| layer_norm=False, | |||||
| dropout=0, | |||||
| crm=False, | |||||
| vad=False, | |||||
| linearout=False): | |||||
| super(StageNet, self).__init__() | |||||
| self.stage1 = nn.ModuleList() | |||||
| self.stage2 = nn.ModuleList() | |||||
| layer = nn.Sequential(nn.Linear(indim, hidden_dim), nn.ReLU()) | |||||
| self.stage1.append(layer) | |||||
| for i in range(layers): | |||||
| layer = UniDeepFsmn( | |||||
| hidden_dim, | |||||
| hidden_dim, | |||||
| lorder, | |||||
| hidden_dim, | |||||
| layer_norm=layer_norm, | |||||
| dropout=dropout) | |||||
| self.stage1.append(layer) | |||||
| layer = nn.Sequential(nn.Linear(hidden_dim, 321), nn.Sigmoid()) | |||||
| self.stage1.append(layer) | |||||
| # stage2 | |||||
| layer = nn.Sequential(nn.Linear(321 + indim, hidden_dim), nn.ReLU()) | |||||
| self.stage2.append(layer) | |||||
| for i in range(layers2): | |||||
| layer = UniDeepFsmn( | |||||
| hidden_dim, | |||||
| hidden_dim, | |||||
| lorder, | |||||
| hidden_dim, | |||||
| layer_norm=layer_norm, | |||||
| dropout=dropout) | |||||
| self.stage2.append(layer) | |||||
| layer = nn.Sequential( | |||||
| nn.Linear(hidden_dim, outdim), | |||||
| nn.Sigmoid() if not crm else nn.Tanh()) | |||||
| self.stage2.append(layer) | |||||
| self.crm = crm | |||||
| self.vad = vad | |||||
| self.linearout = linearout | |||||
| self.window = torch.hamming_window(640, periodic=False).cuda() | |||||
| self.freezed = False | |||||
| def freeze(self): | |||||
| if not self.freezed: | |||||
| for param in self.stage1.parameters(): | |||||
| param.requires_grad = False | |||||
| self.freezed = True | |||||
| print('freezed stage1') | |||||
| def forward(self, feat, mixture, ctl=None): | |||||
| if ctl == 'off': | |||||
| x = feat | |||||
| for i in range(len(self.stage1)): | |||||
| x = self.stage1[i](x) | |||||
| return x | |||||
| else: | |||||
| self.freeze() | |||||
| x = feat | |||||
| for i in range(len(self.stage1)): | |||||
| x = self.stage1[i](x) | |||||
| spec = torch.stft( | |||||
| mixture / 32768, | |||||
| 640, | |||||
| 320, | |||||
| 640, | |||||
| self.window, | |||||
| center=False, | |||||
| return_complex=True) | |||||
| spec = torch.view_as_real(spec).permute([0, 2, 1, 3]) | |||||
| specmag = torch.sqrt(spec[..., 0]**2 + spec[..., 1]**2) | |||||
| est = x * specmag | |||||
| y = torch.cat([est, feat], dim=-1) | |||||
| for i in range(len(self.stage2)): | |||||
| y = self.stage2[i](y) | |||||
| return y | |||||
| class Unet(nn.Module): | |||||
| def __init__(self, | |||||
| indim, | |||||
| outdim, | |||||
| layers=9, | |||||
| dims=[256] * 4, | |||||
| lorder=20, | |||||
| rorder=0, | |||||
| dilation=1, | |||||
| layer_norm=False, | |||||
| dropout=0, | |||||
| crm=False, | |||||
| vad=False, | |||||
| linearout=False): | |||||
| super(Unet, self).__init__() | |||||
| self.linear1 = AffineTransform(indim, dims[0]) | |||||
| self.relu = RectifiedLinear(dims[0], dims[0]) | |||||
| self.encoder = nn.ModuleList() | |||||
| self.decoder = nn.ModuleList() | |||||
| for i in range(len(dims) - 1): | |||||
| layer = nn.Sequential( | |||||
| nn.Linear(dims[i], dims[i + 1]), nn.ReLU(), | |||||
| nn.Linear(dims[i + 1], dims[i + 1], bias=False), | |||||
| Conv2d( | |||||
| dims[i + 1], | |||||
| dims[i + 1], | |||||
| lorder, | |||||
| groups=dims[i + 1], | |||||
| skip_connect=True)) | |||||
| self.encoder.append(layer) | |||||
| for i in range(len(dims) - 1, 0, -1): | |||||
| layer = nn.Sequential( | |||||
| nn.Linear(dims[i] * 2, dims[i - 1]), nn.ReLU(), | |||||
| nn.Linear(dims[i - 1], dims[i - 1], bias=False), | |||||
| Conv2d( | |||||
| dims[i - 1], | |||||
| dims[i - 1], | |||||
| lorder, | |||||
| groups=dims[i - 1], | |||||
| skip_connect=True)) | |||||
| self.decoder.append(layer) | |||||
| self.tf = nn.ModuleList() | |||||
| for i in range(layers - 2 * (len(dims) - 1)): | |||||
| layer = nn.Sequential( | |||||
| nn.Linear(dims[-1], dims[-1]), nn.ReLU(), | |||||
| nn.Linear(dims[-1], dims[-1], bias=False), | |||||
| Conv2d( | |||||
| dims[-1], | |||||
| dims[-1], | |||||
| lorder, | |||||
| groups=dims[-1], | |||||
| skip_connect=True)) | |||||
| self.tf.append(layer) | |||||
| self.linear2 = AffineTransform(dims[0], outdim) | |||||
| self.crm = crm | |||||
| self.act = nn.Tanh() if self.crm else nn.Sigmoid() | |||||
| self.vad = False | |||||
| self.layers = layers | |||||
| self.linearout = linearout | |||||
| def forward(self, x, ctl=None): | |||||
| x = self.linear1(x) | |||||
| x = self.relu(x) | |||||
| encoder_out = [] | |||||
| for i in range(len(self.encoder)): | |||||
| x = self.encoder[i](x) | |||||
| encoder_out.append(x) | |||||
| for i in range(len(self.tf)): | |||||
| x = self.tf[i](x) | |||||
| for i in range(len(self.decoder)): | |||||
| x = torch.cat([x, encoder_out[-1 - i]], dim=-1) | |||||
| x = self.decoder[i](x) | |||||
| x = self.linear2(x) | |||||
| if self.linearout: | |||||
| return x | |||||
| return self.act(x) | |||||
| class BranchNet(nn.Module): | |||||
| def __init__(self, | |||||
| indim, | |||||
| outdim, | |||||
| layers=9, | |||||
| hidden_dim=256, | |||||
| lorder=20, | |||||
| rorder=0, | |||||
| dilation=1, | |||||
| layer_norm=False, | |||||
| dropout=0, | |||||
| crm=False, | |||||
| vad=False, | |||||
| linearout=False): | |||||
| super(BranchNet, self).__init__() | |||||
| self.linear1 = AffineTransform(indim, hidden_dim) | |||||
| self.relu = RectifiedLinear(hidden_dim, hidden_dim) | |||||
| self.convs = nn.ModuleList() | |||||
| self.deepfsmn = nn.ModuleList() | |||||
| self.FREQ = nn.ModuleList() | |||||
| self.TIME = nn.ModuleList() | |||||
| self.br1 = nn.ModuleList() | |||||
| self.br2 = nn.ModuleList() | |||||
| for i in range(layers): | |||||
| ''' | |||||
| layer = nn.Sequential( | |||||
| nn.Linear(hidden_dim, hidden_dim), | |||||
| nn.ReLU(), | |||||
| nn.Linear(hidden_dim, hidden_dim, bias=False), | |||||
| Conv2d(hidden_dim, hidden_dim, lorder, | |||||
| groups=hidden_dim, skip_connect=True) | |||||
| ) | |||||
| self.deepfsmn.append(layer) | |||||
| ''' | |||||
| layer = nn.Sequential(nn.Linear(hidden_dim, hidden_dim), nn.ReLU()) | |||||
| self.FREQ.append(layer) | |||||
| ''' | |||||
| layer = nn.GRU(hidden_dim, hidden_dim, | |||||
| batch_first=True, | |||||
| bidirectional=False) | |||||
| self.TIME.append(layer) | |||||
| layer = nn.Sequential( | |||||
| nn.Linear(hidden_dim, hidden_dim//2, bias=False), | |||||
| Conv2d(hidden_dim//2, hidden_dim//2, lorder, | |||||
| groups=hidden_dim//2, skip_connect=True) | |||||
| ) | |||||
| self.br1.append(layer) | |||||
| layer = nn.GRU(hidden_dim, hidden_dim//2, | |||||
| batch_first=True, | |||||
| bidirectional=False) | |||||
| self.br2.append(layer) | |||||
| ''' | |||||
| self.linear2 = AffineTransform(hidden_dim, outdim) | |||||
| self.crm = crm | |||||
| self.act = nn.Tanh() if self.crm else nn.Sigmoid() | |||||
| self.vad = False | |||||
| self.layers = layers | |||||
| self.linearout = linearout | |||||
| def forward(self, x, ctl=None): | |||||
| return self.forward_branch(x) | |||||
| def forward_sepconv(self, x): | |||||
| x = torch.unsqueeze(x, 1) | |||||
| for i in range(len(self.convs)): | |||||
| x = self.convs[i](x) | |||||
| x = F.relu(x) | |||||
| B, C, H, W = x.shape | |||||
| x = x.permute(0, 2, 1, 3) | |||||
| x = torch.reshape(x, [B, H, C * W]) | |||||
| x = self.linear1(x) | |||||
| x = self.relu(x) | |||||
| for i in range(self.layers): | |||||
| x = self.deepfsmn[i](x) + x | |||||
| x = self.linear2(x) | |||||
| return self.act(x) | |||||
| def forward_branch(self, x): | |||||
| x = self.linear1(x) | |||||
| x = self.relu(x) | |||||
| for i in range(self.layers): | |||||
| z = self.FREQ[i](x) | |||||
| x = z + x | |||||
| x = self.linear2(x) | |||||
| if self.linearout: | |||||
| return x | |||||
| return self.act(x) | |||||
| class TACNet(nn.Module): | |||||
| ''' transform average concatenate for ad hoc dr | |||||
| ''' | |||||
| def __init__(self, | |||||
| indim, | |||||
| outdim, | |||||
| layers=9, | |||||
| hidden_dim=128, | |||||
| lorder=20, | |||||
| rorder=0, | |||||
| crm=False, | |||||
| vad=False, | |||||
| linearout=False): | |||||
| super(TACNet, self).__init__() | |||||
| self.linear1 = AffineTransform(indim, hidden_dim) | |||||
| self.relu = RectifiedLinear(hidden_dim, hidden_dim) | |||||
| if rorder == 0: | |||||
| repeats = [ | |||||
| UniDeepFsmn(hidden_dim, hidden_dim, lorder, hidden_dim) | |||||
| for i in range(layers) | |||||
| ] | |||||
| else: | |||||
| repeats = [ | |||||
| DeepFsmn(hidden_dim, hidden_dim, lorder, rorder, hidden_dim) | |||||
| for i in range(layers) | |||||
| ] | |||||
| self.deepfsmn = nn.Sequential(*repeats) | |||||
| self.ch_transform = nn.ModuleList([]) | |||||
| self.ch_average = nn.ModuleList([]) | |||||
| self.ch_concat = nn.ModuleList([]) | |||||
| for i in range(layers): | |||||
| self.ch_transform.append( | |||||
| nn.Sequential(nn.Linear(hidden_dim, hidden_dim), nn.PReLU())) | |||||
| self.ch_average.append( | |||||
| nn.Sequential(nn.Linear(hidden_dim, hidden_dim), nn.PReLU())) | |||||
| self.ch_concat.append( | |||||
| nn.Sequential( | |||||
| nn.Linear(hidden_dim * 2, hidden_dim), nn.PReLU())) | |||||
| self.linear2 = AffineTransform(hidden_dim, outdim) | |||||
| self.crm = crm | |||||
| if self.crm: | |||||
| self.sig = nn.Tanh() | |||||
| else: | |||||
| self.sig = Sigmoid(outdim, outdim) | |||||
| self.vad = vad | |||||
| if self.vad: | |||||
| self.linear3 = AffineTransform(hidden_dim, 1) | |||||
| self.layers = layers | |||||
| self.linearout = linearout | |||||
| if self.linearout and self.vad: | |||||
| print('Warning: not supported nnet') | |||||
| def forward(self, feat, ctl=None): | |||||
| B, T, F = feat.shape | |||||
| # assume 4ch | |||||
| ch = 4 | |||||
| zlist = [] | |||||
| for c in range(ch): | |||||
| z = self.linear1(feat[..., c * (F // 4):(c + 1) * (F // 4)]) | |||||
| z = self.relu(z) | |||||
| zlist.append(z) | |||||
| for i in range(self.layers): | |||||
| # forward | |||||
| for c in range(ch): | |||||
| zlist[c] = self.deepfsmn[i](zlist[c]) | |||||
| # transform | |||||
| olist = [] | |||||
| for c in range(ch): | |||||
| z = self.ch_transform[i](zlist[c]) | |||||
| olist.append(z) | |||||
| # average | |||||
| avg = 0 | |||||
| for c in range(ch): | |||||
| avg = avg + olist[c] | |||||
| avg = avg / ch | |||||
| avg = self.ch_average[i](avg) | |||||
| # concate | |||||
| for c in range(ch): | |||||
| tac = torch.cat([olist[c], avg], dim=-1) | |||||
| tac = self.ch_concat[i](tac) | |||||
| zlist[c] = zlist[c] + tac | |||||
| for c in range(ch): | |||||
| zlist[c] = self.sig(self.linear2(zlist[c])) | |||||
| mask = torch.cat(zlist, dim=-1) | |||||
| return mask | |||||
| def to_kaldi_nnet(self): | |||||
| pass | |||||
| @@ -0,0 +1 @@ | |||||
| from .sambert_hifi_16k import * # noqa F403 | |||||
| @@ -0,0 +1,8 @@ | |||||
| from .robutrans import RobuTrans | |||||
| def create_model(name, hparams): | |||||
| if name == 'robutrans': | |||||
| return RobuTrans(hparams) | |||||
| else: | |||||
| raise Exception('Unknown model: ' + name) | |||||
| @@ -0,0 +1,82 @@ | |||||
| """Functions for compatibility with different TensorFlow versions.""" | |||||
| import tensorflow as tf | |||||
| def is_tf2(): | |||||
| """Returns ``True`` if running TensorFlow 2.0.""" | |||||
| return tf.__version__.startswith('2') | |||||
| def tf_supports(symbol): | |||||
| """Returns ``True`` if TensorFlow defines :obj:`symbol`.""" | |||||
| return _string_to_tf_symbol(symbol) is not None | |||||
| def tf_any(*symbols): | |||||
| """Returns the first supported symbol.""" | |||||
| for symbol in symbols: | |||||
| module = _string_to_tf_symbol(symbol) | |||||
| if module is not None: | |||||
| return module | |||||
| return None | |||||
| def tf_compat(v2=None, v1=None): # pylint: disable=invalid-name | |||||
| """Returns the compatible symbol based on the current TensorFlow version. | |||||
| Args: | |||||
| v2: The candidate v2 symbol name. | |||||
| v1: The candidate v1 symbol name. | |||||
| Returns: | |||||
| A TensorFlow symbol. | |||||
| Raises: | |||||
| ValueError: if no symbol can be found. | |||||
| """ | |||||
| candidates = [] | |||||
| if v2 is not None: | |||||
| candidates.append(v2) | |||||
| if v1 is not None: | |||||
| candidates.append(v1) | |||||
| candidates.append('compat.v1.%s' % v1) | |||||
| symbol = tf_any(*candidates) | |||||
| if symbol is None: | |||||
| raise ValueError('Failure to resolve the TensorFlow symbol') | |||||
| return symbol | |||||
| def name_from_variable_scope(name=''): | |||||
| """Creates a name prefixed by the current variable scope.""" | |||||
| var_scope = tf_compat(v1='get_variable_scope')().name | |||||
| compat_name = '' | |||||
| if name: | |||||
| compat_name = '%s/' % name | |||||
| if var_scope: | |||||
| compat_name = '%s/%s' % (var_scope, compat_name) | |||||
| return compat_name | |||||
| def reuse(): | |||||
| """Returns ``True`` if the current variable scope is marked for reuse.""" | |||||
| return tf_compat(v1='get_variable_scope')().reuse | |||||
| def _string_to_tf_symbol(symbol): | |||||
| modules = symbol.split('.') | |||||
| namespace = tf | |||||
| for module in modules: | |||||
| namespace = getattr(namespace, module, None) | |||||
| if namespace is None: | |||||
| return None | |||||
| return namespace | |||||
| # pylint: disable=invalid-name | |||||
| gfile_copy = tf_compat(v2='io.gfile.copy', v1='gfile.Copy') | |||||
| gfile_exists = tf_compat(v2='io.gfile.exists', v1='gfile.Exists') | |||||
| gfile_open = tf_compat(v2='io.gfile.GFile', v1='gfile.GFile') | |||||
| is_tensor = tf_compat(v2='is_tensor', v1='contrib.framework.is_tensor') | |||||
| logging = tf_compat(v1='logging') | |||||
| nest = tf_compat(v2='nest', v1='contrib.framework.nest') | |||||
| @@ -0,0 +1,273 @@ | |||||
| import tensorflow as tf | |||||
| def build_sequence_mask(sequence_length, | |||||
| maximum_length=None, | |||||
| dtype=tf.float32): | |||||
| """Builds the dot product mask. | |||||
| Args: | |||||
| sequence_length: The sequence length. | |||||
| maximum_length: Optional size of the returned time dimension. Otherwise | |||||
| it is the maximum of :obj:`sequence_length`. | |||||
| dtype: The type of the mask tensor. | |||||
| Returns: | |||||
| A broadcastable ``tf.Tensor`` of type :obj:`dtype` and shape | |||||
| ``[batch_size, max_length]``. | |||||
| """ | |||||
| mask = tf.sequence_mask( | |||||
| sequence_length, maxlen=maximum_length, dtype=dtype) | |||||
| return mask | |||||
| def norm(inputs): | |||||
| """Layer normalizes :obj:`inputs`.""" | |||||
| return tf.contrib.layers.layer_norm(inputs, begin_norm_axis=-1) | |||||
| def pad_in_time(x, padding_shape): | |||||
| """Helper function to pad a tensor in the time dimension and retain the static depth dimension. | |||||
| Agrs: | |||||
| x: [Batch, Time, Frequency] | |||||
| padding_length: padding size of constant value (0) before the time dimension | |||||
| return: | |||||
| padded x | |||||
| """ | |||||
| depth = x.get_shape().as_list()[-1] | |||||
| x = tf.pad(x, [[0, 0], padding_shape, [0, 0]]) | |||||
| x.set_shape((None, None, depth)) | |||||
| return x | |||||
| def pad_in_time_right(x, padding_length): | |||||
| """Helper function to pad a tensor in the time dimension and retain the static depth dimension. | |||||
| Agrs: | |||||
| x: [Batch, Time, Frequency] | |||||
| padding_length: padding size of constant value (0) before the time dimension | |||||
| return: | |||||
| padded x | |||||
| """ | |||||
| depth = x.get_shape().as_list()[-1] | |||||
| x = tf.pad(x, [[0, 0], [0, padding_length], [0, 0]]) | |||||
| x.set_shape((None, None, depth)) | |||||
| return x | |||||
| def feed_forward(x, ffn_dim, memory_units, mode, dropout=0.0): | |||||
| """Implements the Transformer's "Feed Forward" layer. | |||||
| .. math:: | |||||
| ffn(x) = max(0, x*W_1 + b_1)*W_2 | |||||
| Args: | |||||
| x: The input. | |||||
| ffn_dim: The number of units of the nonlinear transformation. | |||||
| memory_units: the number of units of linear transformation | |||||
| mode: A ``tf.estimator.ModeKeys`` mode. | |||||
| dropout: The probability to drop units from the inner transformation. | |||||
| Returns: | |||||
| The transformed input. | |||||
| """ | |||||
| inner = tf.layers.conv1d(x, ffn_dim, 1, activation=tf.nn.relu) | |||||
| inner = tf.layers.dropout( | |||||
| inner, rate=dropout, training=mode == tf.estimator.ModeKeys.TRAIN) | |||||
| outer = tf.layers.conv1d(inner, memory_units, 1, use_bias=False) | |||||
| return outer | |||||
| def drop_and_add(inputs, outputs, mode, dropout=0.0): | |||||
| """Drops units in the outputs and adds the previous values. | |||||
| Args: | |||||
| inputs: The input of the previous layer. | |||||
| outputs: The output of the previous layer. | |||||
| mode: A ``tf.estimator.ModeKeys`` mode. | |||||
| dropout: The probability to drop units in :obj:`outputs`. | |||||
| Returns: | |||||
| The residual and normalized output. | |||||
| """ | |||||
| outputs = tf.layers.dropout(outputs, rate=dropout, training=mode) | |||||
| input_dim = inputs.get_shape().as_list()[-1] | |||||
| output_dim = outputs.get_shape().as_list()[-1] | |||||
| if input_dim == output_dim: | |||||
| outputs += inputs | |||||
| return outputs | |||||
| def MemoryBlock( | |||||
| inputs, | |||||
| filter_size, | |||||
| mode, | |||||
| mask=None, | |||||
| dropout=0.0, | |||||
| ): | |||||
| """ | |||||
| Define the bidirectional memory block in FSMN | |||||
| Agrs: | |||||
| inputs: The output of the previous layer. [Batch, Time, Frequency] | |||||
| filter_size: memory block filter size | |||||
| mode: Training or Evaluation | |||||
| mask: A ``tf.Tensor`` applied to the memory block output | |||||
| return: | |||||
| output: 3-D tensor ([Batch, Time, Frequency]) | |||||
| """ | |||||
| static_shape = inputs.get_shape().as_list() | |||||
| depth = static_shape[-1] | |||||
| inputs = tf.expand_dims(inputs, axis=1) # [Batch, 1, Time, Frequency] | |||||
| depthwise_filter = tf.get_variable( | |||||
| 'depth_conv_w', | |||||
| shape=[1, filter_size, depth, 1], | |||||
| initializer=tf.glorot_uniform_initializer(), | |||||
| dtype=tf.float32) | |||||
| memory = tf.nn.depthwise_conv2d( | |||||
| input=inputs, | |||||
| filter=depthwise_filter, | |||||
| strides=[1, 1, 1, 1], | |||||
| padding='SAME', | |||||
| rate=[1, 1], | |||||
| data_format='NHWC') | |||||
| memory = memory + inputs | |||||
| output = tf.layers.dropout(memory, rate=dropout, training=mode) | |||||
| output = tf.reshape( | |||||
| output, | |||||
| [tf.shape(output)[0], tf.shape(output)[2], depth]) | |||||
| if mask is not None: | |||||
| output = output * tf.expand_dims(mask, -1) | |||||
| return output | |||||
| def MemoryBlockV2( | |||||
| inputs, | |||||
| filter_size, | |||||
| mode, | |||||
| shift=0, | |||||
| mask=None, | |||||
| dropout=0.0, | |||||
| ): | |||||
| """ | |||||
| Define the bidirectional memory block in FSMN | |||||
| Agrs: | |||||
| inputs: The output of the previous layer. [Batch, Time, Frequency] | |||||
| filter_size: memory block filter size | |||||
| mode: Training or Evaluation | |||||
| shift: left padding, to control delay | |||||
| mask: A ``tf.Tensor`` applied to the memory block output | |||||
| return: | |||||
| output: 3-D tensor ([Batch, Time, Frequency]) | |||||
| """ | |||||
| if mask is not None: | |||||
| inputs = inputs * tf.expand_dims(mask, -1) | |||||
| static_shape = inputs.get_shape().as_list() | |||||
| depth = static_shape[-1] | |||||
| # padding | |||||
| left_padding = int(round((filter_size - 1) / 2)) | |||||
| right_padding = int((filter_size - 1) / 2) | |||||
| if shift > 0: | |||||
| left_padding = left_padding + shift | |||||
| right_padding = right_padding - shift | |||||
| pad_inputs = pad_in_time(inputs, [left_padding, right_padding]) | |||||
| pad_inputs = tf.expand_dims( | |||||
| pad_inputs, axis=1) # [Batch, 1, Time, Frequency] | |||||
| depthwise_filter = tf.get_variable( | |||||
| 'depth_conv_w', | |||||
| shape=[1, filter_size, depth, 1], | |||||
| initializer=tf.glorot_uniform_initializer(), | |||||
| dtype=tf.float32) | |||||
| memory = tf.nn.depthwise_conv2d( | |||||
| input=pad_inputs, | |||||
| filter=depthwise_filter, | |||||
| strides=[1, 1, 1, 1], | |||||
| padding='VALID', | |||||
| rate=[1, 1], | |||||
| data_format='NHWC') | |||||
| memory = tf.reshape( | |||||
| memory, | |||||
| [tf.shape(memory)[0], tf.shape(memory)[2], depth]) | |||||
| memory = memory + inputs | |||||
| output = tf.layers.dropout(memory, rate=dropout, training=mode) | |||||
| if mask is not None: | |||||
| output = output * tf.expand_dims(mask, -1) | |||||
| return output | |||||
| def UniMemoryBlock( | |||||
| inputs, | |||||
| filter_size, | |||||
| mode, | |||||
| cache=None, | |||||
| mask=None, | |||||
| dropout=0.0, | |||||
| ): | |||||
| """ | |||||
| Define the unidirectional memory block in FSMN | |||||
| Agrs: | |||||
| inputs: The output of the previous layer. [Batch, Time, Frequency] | |||||
| filter_size: memory block filter size | |||||
| cache: for streaming inference | |||||
| mode: Training or Evaluation | |||||
| mask: A ``tf.Tensor`` applied to the memory block output | |||||
| dropout: dorpout factor | |||||
| return: | |||||
| output: 3-D tensor ([Batch, Time, Frequency]) | |||||
| """ | |||||
| if cache is not None: | |||||
| static_shape = cache['queries'].get_shape().as_list() | |||||
| depth = static_shape[-1] | |||||
| queries = tf.slice(cache['queries'], [0, 1, 0], [ | |||||
| tf.shape(cache['queries'])[0], | |||||
| tf.shape(cache['queries'])[1] - 1, depth | |||||
| ]) | |||||
| queries = tf.concat([queries, inputs], axis=1) | |||||
| cache['queries'] = queries | |||||
| else: | |||||
| padding_length = filter_size - 1 | |||||
| queries = pad_in_time(inputs, [padding_length, 0]) | |||||
| queries = tf.expand_dims(queries, axis=1) # [Batch, 1, Time, Frequency] | |||||
| static_shape = queries.get_shape().as_list() | |||||
| depth = static_shape[-1] | |||||
| depthwise_filter = tf.get_variable( | |||||
| 'depth_conv_w', | |||||
| shape=[1, filter_size, depth, 1], | |||||
| initializer=tf.glorot_uniform_initializer(), | |||||
| dtype=tf.float32) | |||||
| memory = tf.nn.depthwise_conv2d( | |||||
| input=queries, | |||||
| filter=depthwise_filter, | |||||
| strides=[1, 1, 1, 1], | |||||
| padding='VALID', | |||||
| rate=[1, 1], | |||||
| data_format='NHWC') | |||||
| memory = tf.reshape( | |||||
| memory, | |||||
| [tf.shape(memory)[0], tf.shape(memory)[2], depth]) | |||||
| memory = memory + inputs | |||||
| output = tf.layers.dropout(memory, rate=dropout, training=mode) | |||||
| if mask is not None: | |||||
| output = output * tf.expand_dims(mask, -1) | |||||
| return output | |||||
| @@ -0,0 +1,178 @@ | |||||
| import tensorflow as tf | |||||
| from . import fsmn | |||||
| class FsmnEncoder(): | |||||
| """Encoder using Fsmn | |||||
| """ | |||||
| def __init__(self, | |||||
| filter_size, | |||||
| fsmn_num_layers, | |||||
| dnn_num_layers, | |||||
| num_memory_units=512, | |||||
| ffn_inner_dim=2048, | |||||
| dropout=0.0, | |||||
| position_encoder=None): | |||||
| """Initializes the parameters of the encoder. | |||||
| Args: | |||||
| filter_size: the total order of memory block | |||||
| fsmn_num_layers: The number of fsmn layers. | |||||
| dnn_num_layers: The number of dnn layers | |||||
| num_units: The number of memory units. | |||||
| ffn_inner_dim: The number of units of the inner linear transformation | |||||
| in the feed forward layer. | |||||
| dropout: The probability to drop units from the outputs. | |||||
| position_encoder: The :class:`opennmt.layers.position.PositionEncoder` to | |||||
| apply on inputs or ``None``. | |||||
| """ | |||||
| super(FsmnEncoder, self).__init__() | |||||
| self.filter_size = filter_size | |||||
| self.fsmn_num_layers = fsmn_num_layers | |||||
| self.dnn_num_layers = dnn_num_layers | |||||
| self.num_memory_units = num_memory_units | |||||
| self.ffn_inner_dim = ffn_inner_dim | |||||
| self.dropout = dropout | |||||
| self.position_encoder = position_encoder | |||||
| def encode(self, inputs, sequence_length=None, mode=True): | |||||
| if self.position_encoder is not None: | |||||
| inputs = self.position_encoder(inputs) | |||||
| inputs = tf.layers.dropout(inputs, rate=self.dropout, training=mode) | |||||
| mask = fsmn.build_sequence_mask( | |||||
| sequence_length, maximum_length=tf.shape(inputs)[1]) | |||||
| state = () | |||||
| for layer in range(self.fsmn_num_layers): | |||||
| with tf.variable_scope('fsmn_layer_{}'.format(layer)): | |||||
| with tf.variable_scope('ffn'): | |||||
| context = fsmn.feed_forward( | |||||
| inputs, | |||||
| self.ffn_inner_dim, | |||||
| self.num_memory_units, | |||||
| mode, | |||||
| dropout=self.dropout) | |||||
| with tf.variable_scope('memory'): | |||||
| memory = fsmn.MemoryBlock( | |||||
| context, | |||||
| self.filter_size, | |||||
| mode, | |||||
| mask=mask, | |||||
| dropout=self.dropout) | |||||
| memory = fsmn.drop_and_add( | |||||
| inputs, memory, mode, dropout=self.dropout) | |||||
| inputs = memory | |||||
| state += (tf.reduce_mean(inputs, axis=1), ) | |||||
| for layer in range(self.dnn_num_layers): | |||||
| with tf.variable_scope('dnn_layer_{}'.format(layer)): | |||||
| transformed = fsmn.feed_forward( | |||||
| inputs, | |||||
| self.ffn_inner_dim, | |||||
| self.num_memory_units, | |||||
| mode, | |||||
| dropout=self.dropout) | |||||
| inputs = transformed | |||||
| state += (tf.reduce_mean(inputs, axis=1), ) | |||||
| outputs = inputs | |||||
| return (outputs, state, sequence_length) | |||||
| class FsmnEncoderV2(): | |||||
| """Encoder using Fsmn | |||||
| """ | |||||
| def __init__(self, | |||||
| filter_size, | |||||
| fsmn_num_layers, | |||||
| dnn_num_layers, | |||||
| num_memory_units=512, | |||||
| ffn_inner_dim=2048, | |||||
| dropout=0.0, | |||||
| shift=0, | |||||
| position_encoder=None): | |||||
| """Initializes the parameters of the encoder. | |||||
| Args: | |||||
| filter_size: the total order of memory block | |||||
| fsmn_num_layers: The number of fsmn layers. | |||||
| dnn_num_layers: The number of dnn layers | |||||
| num_units: The number of memory units. | |||||
| ffn_inner_dim: The number of units of the inner linear transformation | |||||
| in the feed forward layer. | |||||
| dropout: The probability to drop units from the outputs. | |||||
| shift: left padding, to control delay | |||||
| position_encoder: The :class:`opennmt.layers.position.PositionEncoder` to | |||||
| apply on inputs or ``None``. | |||||
| """ | |||||
| super(FsmnEncoderV2, self).__init__() | |||||
| self.filter_size = filter_size | |||||
| self.fsmn_num_layers = fsmn_num_layers | |||||
| self.dnn_num_layers = dnn_num_layers | |||||
| self.num_memory_units = num_memory_units | |||||
| self.ffn_inner_dim = ffn_inner_dim | |||||
| self.dropout = dropout | |||||
| self.shift = shift | |||||
| if not isinstance(shift, list): | |||||
| self.shift = [shift for _ in range(self.fsmn_num_layers)] | |||||
| self.position_encoder = position_encoder | |||||
| def encode(self, inputs, sequence_length=None, mode=True): | |||||
| if self.position_encoder is not None: | |||||
| inputs = self.position_encoder(inputs) | |||||
| inputs = tf.layers.dropout(inputs, rate=self.dropout, training=mode) | |||||
| mask = fsmn.build_sequence_mask( | |||||
| sequence_length, maximum_length=tf.shape(inputs)[1]) | |||||
| state = () | |||||
| for layer in range(self.fsmn_num_layers): | |||||
| with tf.variable_scope('fsmn_layer_{}'.format(layer)): | |||||
| with tf.variable_scope('ffn'): | |||||
| context = fsmn.feed_forward( | |||||
| inputs, | |||||
| self.ffn_inner_dim, | |||||
| self.num_memory_units, | |||||
| mode, | |||||
| dropout=self.dropout) | |||||
| with tf.variable_scope('memory'): | |||||
| memory = fsmn.MemoryBlockV2( | |||||
| context, | |||||
| self.filter_size, | |||||
| mode, | |||||
| shift=self.shift[layer], | |||||
| mask=mask, | |||||
| dropout=self.dropout) | |||||
| memory = fsmn.drop_and_add( | |||||
| inputs, memory, mode, dropout=self.dropout) | |||||
| inputs = memory | |||||
| state += (tf.reduce_mean(inputs, axis=1), ) | |||||
| for layer in range(self.dnn_num_layers): | |||||
| with tf.variable_scope('dnn_layer_{}'.format(layer)): | |||||
| transformed = fsmn.feed_forward( | |||||
| inputs, | |||||
| self.ffn_inner_dim, | |||||
| self.num_memory_units, | |||||
| mode, | |||||
| dropout=self.dropout) | |||||
| inputs = transformed | |||||
| state += (tf.reduce_mean(inputs, axis=1), ) | |||||
| outputs = inputs | |||||
| return (outputs, state, sequence_length) | |||||
| @@ -0,0 +1,160 @@ | |||||
| import numpy as np | |||||
| import tensorflow as tf | |||||
| from tensorflow.contrib.seq2seq import Helper | |||||
| class VarTestHelper(Helper): | |||||
| def __init__(self, batch_size, inputs, dim): | |||||
| with tf.name_scope('VarTestHelper'): | |||||
| self._batch_size = batch_size | |||||
| self._inputs = inputs | |||||
| self._dim = dim | |||||
| num_steps = tf.shape(self._inputs)[1] | |||||
| self._lengths = tf.tile([num_steps], [self._batch_size]) | |||||
| self._inputs = tf.roll(inputs, shift=-1, axis=1) | |||||
| self._init_inputs = inputs[:, 0, :] | |||||
| @property | |||||
| def batch_size(self): | |||||
| return self._batch_size | |||||
| @property | |||||
| def sample_ids_shape(self): | |||||
| return tf.TensorShape([]) | |||||
| @property | |||||
| def sample_ids_dtype(self): | |||||
| return np.int32 | |||||
| def initialize(self, name=None): | |||||
| return (tf.tile([False], [self._batch_size]), | |||||
| _go_frames(self._batch_size, self._dim, self._init_inputs)) | |||||
| def sample(self, time, outputs, state, name=None): | |||||
| return tf.tile([0], [self._batch_size]) # Return all 0; we ignore them | |||||
| def next_inputs(self, time, outputs, state, sample_ids, name=None): | |||||
| with tf.name_scope('VarTestHelper'): | |||||
| finished = (time + 1 >= self._lengths) | |||||
| next_inputs = tf.concat([outputs, self._inputs[:, time, :]], | |||||
| axis=-1) | |||||
| return (finished, next_inputs, state) | |||||
| class VarTrainingHelper(Helper): | |||||
| def __init__(self, targets, inputs, dim): | |||||
| with tf.name_scope('VarTrainingHelper'): | |||||
| self._targets = targets # [N, T_in, 1] | |||||
| self._batch_size = tf.shape(inputs)[0] # N | |||||
| self._inputs = inputs | |||||
| self._dim = dim | |||||
| num_steps = tf.shape(self._targets)[1] | |||||
| self._lengths = tf.tile([num_steps], [self._batch_size]) | |||||
| self._inputs = tf.roll(inputs, shift=-1, axis=1) | |||||
| self._init_inputs = inputs[:, 0, :] | |||||
| @property | |||||
| def batch_size(self): | |||||
| return self._batch_size | |||||
| @property | |||||
| def sample_ids_shape(self): | |||||
| return tf.TensorShape([]) | |||||
| @property | |||||
| def sample_ids_dtype(self): | |||||
| return np.int32 | |||||
| def initialize(self, name=None): | |||||
| return (tf.tile([False], [self._batch_size]), | |||||
| _go_frames(self._batch_size, self._dim, self._init_inputs)) | |||||
| def sample(self, time, outputs, state, name=None): | |||||
| return tf.tile([0], [self._batch_size]) # Return all 0; we ignore them | |||||
| def next_inputs(self, time, outputs, state, sample_ids, name=None): | |||||
| with tf.name_scope(name or 'VarTrainingHelper'): | |||||
| finished = (time + 1 >= self._lengths) | |||||
| next_inputs = tf.concat( | |||||
| [self._targets[:, time, :], self._inputs[:, time, :]], axis=-1) | |||||
| return (finished, next_inputs, state) | |||||
| class VarTrainingSSHelper(Helper): | |||||
| def __init__(self, targets, inputs, dim, global_step, schedule_begin, | |||||
| alpha, decay_steps): | |||||
| with tf.name_scope('VarTrainingSSHelper'): | |||||
| self._targets = targets # [N, T_in, 1] | |||||
| self._batch_size = tf.shape(inputs)[0] # N | |||||
| self._inputs = inputs | |||||
| self._dim = dim | |||||
| num_steps = tf.shape(self._targets)[1] | |||||
| self._lengths = tf.tile([num_steps], [self._batch_size]) | |||||
| self._inputs = tf.roll(inputs, shift=-1, axis=1) | |||||
| self._init_inputs = inputs[:, 0, :] | |||||
| # for schedule sampling | |||||
| self._global_step = global_step | |||||
| self._schedule_begin = schedule_begin | |||||
| self._alpha = alpha | |||||
| self._decay_steps = decay_steps | |||||
| @property | |||||
| def batch_size(self): | |||||
| return self._batch_size | |||||
| @property | |||||
| def sample_ids_shape(self): | |||||
| return tf.TensorShape([]) | |||||
| @property | |||||
| def sample_ids_dtype(self): | |||||
| return np.int32 | |||||
| def initialize(self, name=None): | |||||
| self._ratio = _tf_decay(self._global_step, self._schedule_begin, | |||||
| self._alpha, self._decay_steps) | |||||
| return (tf.tile([False], [self._batch_size]), | |||||
| _go_frames(self._batch_size, self._dim, self._init_inputs)) | |||||
| def sample(self, time, outputs, state, name=None): | |||||
| return tf.tile([0], [self._batch_size]) # Return all 0; we ignore them | |||||
| def next_inputs(self, time, outputs, state, sample_ids, name=None): | |||||
| with tf.name_scope(name or 'VarTrainingHelper'): | |||||
| finished = (time + 1 >= self._lengths) | |||||
| next_inputs_tmp = tf.cond( | |||||
| tf.less( | |||||
| tf.random_uniform([], minval=0, maxval=1, | |||||
| dtype=tf.float32), self._ratio), | |||||
| lambda: self._targets[:, time, :], lambda: outputs) | |||||
| next_inputs = tf.concat( | |||||
| [next_inputs_tmp, self._inputs[:, time, :]], axis=-1) | |||||
| return (finished, next_inputs, state) | |||||
| def _go_frames(batch_size, dim, init_inputs): | |||||
| '''Returns all-zero <GO> frames for a given batch size and output dimension''' | |||||
| return tf.concat([tf.tile([[0.0]], [batch_size, dim]), init_inputs], | |||||
| axis=-1) | |||||
| def _tf_decay(global_step, schedule_begin, alpha, decay_steps): | |||||
| tfr = tf.train.exponential_decay( | |||||
| 1.0, | |||||
| global_step=global_step - schedule_begin, | |||||
| decay_steps=decay_steps, | |||||
| decay_rate=alpha, | |||||
| name='tfr_decay') | |||||
| final_tfr = tf.cond( | |||||
| tf.less(global_step, schedule_begin), lambda: 1.0, lambda: tfr) | |||||
| return final_tfr | |||||
| @@ -0,0 +1,461 @@ | |||||
| import tensorflow as tf | |||||
| from tensorflow.contrib.cudnn_rnn import CudnnLSTM | |||||
| from tensorflow.contrib.cudnn_rnn.python.ops import cudnn_rnn_ops | |||||
| from tensorflow.contrib.rnn import LSTMBlockCell | |||||
| def encoder_prenet(inputs, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| dense_units, | |||||
| is_training, | |||||
| mask=None, | |||||
| scope='encoder_prenet'): | |||||
| x = inputs | |||||
| with tf.variable_scope(scope): | |||||
| for i in range(n_conv_layers): | |||||
| x = conv1d( | |||||
| x, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=tf.nn.relu, | |||||
| dropout=True, | |||||
| mask=mask, | |||||
| scope='conv1d_{}'.format(i)) | |||||
| x = tf.layers.dense( | |||||
| x, units=dense_units, activation=None, name='dense') | |||||
| return x | |||||
| def decoder_prenet(inputs, | |||||
| prenet_units, | |||||
| dense_units, | |||||
| is_training, | |||||
| scope='decoder_prenet'): | |||||
| x = inputs | |||||
| with tf.variable_scope(scope): | |||||
| for i, units in enumerate(prenet_units): | |||||
| x = tf.layers.dense( | |||||
| x, | |||||
| units=units, | |||||
| activation=tf.nn.relu, | |||||
| name='dense_{}'.format(i)) | |||||
| x = tf.layers.dropout( | |||||
| x, rate=0.5, training=is_training, name='dropout_{}'.format(i)) | |||||
| x = tf.layers.dense( | |||||
| x, units=dense_units, activation=None, name='dense') | |||||
| return x | |||||
| def encoder(inputs, | |||||
| input_lengths, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| is_training, | |||||
| embedded_inputs_speaker, | |||||
| mask=None, | |||||
| scope='encoder'): | |||||
| with tf.variable_scope(scope): | |||||
| x = conv_and_lstm( | |||||
| inputs, | |||||
| input_lengths, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| is_training, | |||||
| embedded_inputs_speaker, | |||||
| mask=mask) | |||||
| return x | |||||
| def prenet(inputs, prenet_units, is_training, scope='prenet'): | |||||
| x = inputs | |||||
| with tf.variable_scope(scope): | |||||
| for i, units in enumerate(prenet_units): | |||||
| x = tf.layers.dense( | |||||
| x, | |||||
| units=units, | |||||
| activation=tf.nn.relu, | |||||
| name='dense_{}'.format(i)) | |||||
| x = tf.layers.dropout( | |||||
| x, rate=0.5, training=is_training, name='dropout_{}'.format(i)) | |||||
| return x | |||||
| def postnet_residual_ulstm(inputs, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| output_units, | |||||
| is_training, | |||||
| scope='postnet_residual_ulstm'): | |||||
| with tf.variable_scope(scope): | |||||
| x = conv_and_ulstm(inputs, None, n_conv_layers, filters, kernel_size, | |||||
| lstm_units, is_training) | |||||
| x = conv1d( | |||||
| x, | |||||
| output_units, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=None, | |||||
| dropout=False, | |||||
| scope='conv1d_{}'.format(n_conv_layers - 1)) | |||||
| return x | |||||
| def postnet_residual_lstm(inputs, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| output_units, | |||||
| is_training, | |||||
| scope='postnet_residual_lstm'): | |||||
| with tf.variable_scope(scope): | |||||
| x = conv_and_lstm(inputs, None, n_conv_layers, filters, kernel_size, | |||||
| lstm_units, is_training) | |||||
| x = conv1d( | |||||
| x, | |||||
| output_units, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=None, | |||||
| dropout=False, | |||||
| scope='conv1d_{}'.format(n_conv_layers - 1)) | |||||
| return x | |||||
| def postnet_linear_ulstm(inputs, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| output_units, | |||||
| is_training, | |||||
| scope='postnet_linear'): | |||||
| with tf.variable_scope(scope): | |||||
| x = conv_and_ulstm(inputs, None, n_conv_layers, filters, kernel_size, | |||||
| lstm_units, is_training) | |||||
| x = tf.layers.dense(x, units=output_units) | |||||
| return x | |||||
| def postnet_linear_lstm(inputs, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| output_units, | |||||
| output_lengths, | |||||
| is_training, | |||||
| embedded_inputs_speaker2, | |||||
| mask=None, | |||||
| scope='postnet_linear'): | |||||
| with tf.variable_scope(scope): | |||||
| x = conv_and_lstm_dec( | |||||
| inputs, | |||||
| output_lengths, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| is_training, | |||||
| embedded_inputs_speaker2, | |||||
| mask=mask) | |||||
| x = tf.layers.dense(x, units=output_units) | |||||
| return x | |||||
| def postnet_linear(inputs, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| output_units, | |||||
| output_lengths, | |||||
| is_training, | |||||
| embedded_inputs_speaker2, | |||||
| mask=None, | |||||
| scope='postnet_linear'): | |||||
| with tf.variable_scope(scope): | |||||
| x = conv_dec( | |||||
| inputs, | |||||
| output_lengths, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| is_training, | |||||
| embedded_inputs_speaker2, | |||||
| mask=mask) | |||||
| return x | |||||
| def conv_and_lstm(inputs, | |||||
| sequence_lengths, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| is_training, | |||||
| embedded_inputs_speaker, | |||||
| mask=None, | |||||
| scope='conv_and_lstm'): | |||||
| x = inputs | |||||
| with tf.variable_scope(scope): | |||||
| for i in range(n_conv_layers): | |||||
| x = conv1d( | |||||
| x, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=tf.nn.relu, | |||||
| dropout=True, | |||||
| mask=mask, | |||||
| scope='conv1d_{}'.format(i)) | |||||
| x = tf.concat([x, embedded_inputs_speaker], axis=2) | |||||
| outputs, states = tf.nn.bidirectional_dynamic_rnn( | |||||
| LSTMBlockCell(lstm_units), | |||||
| LSTMBlockCell(lstm_units), | |||||
| x, | |||||
| sequence_length=sequence_lengths, | |||||
| dtype=tf.float32) | |||||
| x = tf.concat(outputs, axis=-1) | |||||
| return x | |||||
| def conv_and_lstm_dec(inputs, | |||||
| sequence_lengths, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| is_training, | |||||
| embedded_inputs_speaker2, | |||||
| mask=None, | |||||
| scope='conv_and_lstm'): | |||||
| x = inputs | |||||
| with tf.variable_scope(scope): | |||||
| for i in range(n_conv_layers): | |||||
| x = conv1d( | |||||
| x, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=tf.nn.relu, | |||||
| dropout=True, | |||||
| mask=mask, | |||||
| scope='conv1d_{}'.format(i)) | |||||
| x = tf.concat([x, embedded_inputs_speaker2], axis=2) | |||||
| outputs, states = tf.nn.bidirectional_dynamic_rnn( | |||||
| LSTMBlockCell(lstm_units), | |||||
| LSTMBlockCell(lstm_units), | |||||
| x, | |||||
| sequence_length=sequence_lengths, | |||||
| dtype=tf.float32) | |||||
| x = tf.concat(outputs, axis=-1) | |||||
| return x | |||||
| def conv_dec(inputs, | |||||
| sequence_lengths, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| is_training, | |||||
| embedded_inputs_speaker2, | |||||
| mask=None, | |||||
| scope='conv_and_lstm'): | |||||
| x = inputs | |||||
| with tf.variable_scope(scope): | |||||
| for i in range(n_conv_layers): | |||||
| x = conv1d( | |||||
| x, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=tf.nn.relu, | |||||
| dropout=True, | |||||
| mask=mask, | |||||
| scope='conv1d_{}'.format(i)) | |||||
| x = tf.concat([x, embedded_inputs_speaker2], axis=2) | |||||
| return x | |||||
| def conv_and_ulstm(inputs, | |||||
| sequence_lengths, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| is_training, | |||||
| scope='conv_and_ulstm'): | |||||
| x = inputs | |||||
| with tf.variable_scope(scope): | |||||
| for i in range(n_conv_layers): | |||||
| x = conv1d( | |||||
| x, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=tf.nn.relu, | |||||
| dropout=True, | |||||
| scope='conv1d_{}'.format(i)) | |||||
| outputs, states = tf.nn.dynamic_rnn( | |||||
| LSTMBlockCell(lstm_units), | |||||
| x, | |||||
| sequence_length=sequence_lengths, | |||||
| dtype=tf.float32) | |||||
| return outputs | |||||
| def conv1d(inputs, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=None, | |||||
| dropout=False, | |||||
| mask=None, | |||||
| scope='conv1d'): | |||||
| with tf.variable_scope(scope): | |||||
| if mask is not None: | |||||
| inputs = inputs * tf.expand_dims(mask, -1) | |||||
| x = tf.layers.conv1d( | |||||
| inputs, filters=filters, kernel_size=kernel_size, padding='same') | |||||
| if mask is not None: | |||||
| x = x * tf.expand_dims(mask, -1) | |||||
| x = tf.layers.batch_normalization(x, training=is_training) | |||||
| if activation is not None: | |||||
| x = activation(x) | |||||
| if dropout: | |||||
| x = tf.layers.dropout(x, rate=0.5, training=is_training) | |||||
| return x | |||||
| def conv1d_dp(inputs, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=None, | |||||
| dropout=False, | |||||
| dropoutrate=0.5, | |||||
| mask=None, | |||||
| scope='conv1d'): | |||||
| with tf.variable_scope(scope): | |||||
| if mask is not None: | |||||
| inputs = inputs * tf.expand_dims(mask, -1) | |||||
| x = tf.layers.conv1d( | |||||
| inputs, filters=filters, kernel_size=kernel_size, padding='same') | |||||
| if mask is not None: | |||||
| x = x * tf.expand_dims(mask, -1) | |||||
| x = tf.contrib.layers.layer_norm(x) | |||||
| if activation is not None: | |||||
| x = activation(x) | |||||
| if dropout: | |||||
| x = tf.layers.dropout(x, rate=dropoutrate, training=is_training) | |||||
| return x | |||||
| def duration_predictor(inputs, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| lstm_units, | |||||
| input_lengths, | |||||
| is_training, | |||||
| embedded_inputs_speaker, | |||||
| mask=None, | |||||
| scope='duration_predictor'): | |||||
| with tf.variable_scope(scope): | |||||
| x = inputs | |||||
| for i in range(n_conv_layers): | |||||
| x = conv1d_dp( | |||||
| x, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=tf.nn.relu, | |||||
| dropout=True, | |||||
| dropoutrate=0.1, | |||||
| mask=mask, | |||||
| scope='conv1d_{}'.format(i)) | |||||
| x = tf.concat([x, embedded_inputs_speaker], axis=2) | |||||
| outputs, states = tf.nn.bidirectional_dynamic_rnn( | |||||
| LSTMBlockCell(lstm_units), | |||||
| LSTMBlockCell(lstm_units), | |||||
| x, | |||||
| sequence_length=input_lengths, | |||||
| dtype=tf.float32) | |||||
| x = tf.concat(outputs, axis=-1) | |||||
| x = tf.layers.dense(x, units=1) | |||||
| x = tf.nn.relu(x) | |||||
| return x | |||||
| def duration_predictor2(inputs, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| input_lengths, | |||||
| is_training, | |||||
| mask=None, | |||||
| scope='duration_predictor'): | |||||
| with tf.variable_scope(scope): | |||||
| x = inputs | |||||
| for i in range(n_conv_layers): | |||||
| x = conv1d_dp( | |||||
| x, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=tf.nn.relu, | |||||
| dropout=True, | |||||
| dropoutrate=0.1, | |||||
| mask=mask, | |||||
| scope='conv1d_{}'.format(i)) | |||||
| x = tf.layers.dense(x, units=1) | |||||
| x = tf.nn.relu(x) | |||||
| return x | |||||
| def conv_prenet(inputs, | |||||
| n_conv_layers, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| mask=None, | |||||
| scope='conv_prenet'): | |||||
| x = inputs | |||||
| with tf.variable_scope(scope): | |||||
| for i in range(n_conv_layers): | |||||
| x = conv1d( | |||||
| x, | |||||
| filters, | |||||
| kernel_size, | |||||
| is_training, | |||||
| activation=tf.nn.relu, | |||||
| dropout=True, | |||||
| mask=mask, | |||||
| scope='conv1d_{}'.format(i)) | |||||
| return x | |||||
| @@ -0,0 +1,174 @@ | |||||
| """Define position encoder classes.""" | |||||
| import abc | |||||
| import math | |||||
| import tensorflow as tf | |||||
| from .reducer import SumReducer | |||||
| class PositionEncoder(tf.keras.layers.Layer): | |||||
| """Base class for position encoders.""" | |||||
| def __init__(self, reducer=None, **kwargs): | |||||
| """Initializes the position encoder. | |||||
| Args: | |||||
| reducer: A :class:`opennmt.layers.Reducer` to merge inputs and position | |||||
| encodings. Defaults to :class:`opennmt.layers.SumReducer`. | |||||
| **kwargs: Additional layer keyword arguments. | |||||
| """ | |||||
| super(PositionEncoder, self).__init__(**kwargs) | |||||
| if reducer is None: | |||||
| reducer = SumReducer(dtype=kwargs.get('dtype')) | |||||
| self.reducer = reducer | |||||
| def call(self, inputs, position=None): # pylint: disable=arguments-differ | |||||
| """Add position encodings to :obj:`inputs`. | |||||
| Args: | |||||
| inputs: The inputs to encode. | |||||
| position: The single position to encode, to use when this layer is called | |||||
| step by step. | |||||
| Returns: | |||||
| A ``tf.Tensor`` whose shape depends on the configured ``reducer``. | |||||
| """ | |||||
| batch_size = tf.shape(inputs)[0] | |||||
| timesteps = tf.shape(inputs)[1] | |||||
| input_dim = inputs.shape[-1].value | |||||
| positions = tf.range(timesteps) + 1 if position is None else [position] | |||||
| position_encoding = self._encode([positions], input_dim) | |||||
| position_encoding = tf.tile(position_encoding, [batch_size, 1, 1]) | |||||
| return self.reducer([inputs, position_encoding]) | |||||
| @abc.abstractmethod | |||||
| def _encode(self, positions, depth): | |||||
| """Creates position encodings. | |||||
| Args: | |||||
| positions: The positions to encode of shape :math:`[B, ...]`. | |||||
| depth: The encoding depth :math:`D`. | |||||
| Returns: | |||||
| A ``tf.Tensor`` of shape :math:`[B, ..., D]`. | |||||
| """ | |||||
| raise NotImplementedError() | |||||
| class PositionEmbedder(PositionEncoder): | |||||
| """Encodes position with a lookup table.""" | |||||
| def __init__(self, maximum_position=128, reducer=None, **kwargs): | |||||
| """Initializes the position encoder. | |||||
| Args: | |||||
| maximum_position: The maximum position to embed. Positions greater | |||||
| than this value will be set to :obj:`maximum_position`. | |||||
| reducer: A :class:`opennmt.layers.Reducer` to merge inputs and position | |||||
| encodings. Defaults to :class:`opennmt.layers.SumReducer`. | |||||
| **kwargs: Additional layer keyword arguments. | |||||
| """ | |||||
| super(PositionEmbedder, self).__init__(reducer=reducer, **kwargs) | |||||
| self.maximum_position = maximum_position | |||||
| self.embedding = None | |||||
| def build(self, input_shape): | |||||
| shape = [self.maximum_position + 1, input_shape[-1]] | |||||
| self.embedding = self.add_weight('position_embedding', shape) | |||||
| super(PositionEmbedder, self).build(input_shape) | |||||
| def _encode(self, positions, depth): | |||||
| positions = tf.minimum(positions, self.maximum_position) | |||||
| return tf.nn.embedding_lookup(self.embedding, positions) | |||||
| class SinusoidalPositionEncoder(PositionEncoder): | |||||
| """Encodes positions with sine waves as described in | |||||
| https://arxiv.org/abs/1706.03762. | |||||
| """ | |||||
| def _encode(self, positions, depth): | |||||
| if depth % 2 != 0: | |||||
| raise ValueError( | |||||
| 'SinusoidalPositionEncoder expects the depth to be divisble ' | |||||
| 'by 2 but got %d' % depth) | |||||
| batch_size = tf.shape(positions)[0] | |||||
| positions = tf.cast(positions, tf.float32) | |||||
| log_timescale_increment = math.log(10000) / (depth / 2 - 1) | |||||
| inv_timescales = tf.exp( | |||||
| tf.range(depth / 2, dtype=tf.float32) * -log_timescale_increment) | |||||
| inv_timescales = tf.reshape( | |||||
| tf.tile(inv_timescales, [batch_size]), [batch_size, depth // 2]) | |||||
| scaled_time = tf.expand_dims(positions, -1) * tf.expand_dims( | |||||
| inv_timescales, 1) | |||||
| encoding = tf.concat( | |||||
| [tf.sin(scaled_time), tf.cos(scaled_time)], axis=2) | |||||
| return tf.cast(encoding, self.dtype) | |||||
| class SinusodalPositionalEncoding(tf.keras.layers.Layer): | |||||
| def __init__(self, name='SinusodalPositionalEncoding'): | |||||
| super(SinusodalPositionalEncoding, self).__init__(name=name) | |||||
| @staticmethod | |||||
| def positional_encoding(len, dim, step=1.): | |||||
| """ | |||||
| :param len: int scalar | |||||
| :param dim: int scalar | |||||
| :param step: | |||||
| :return: position embedding | |||||
| """ | |||||
| pos_mat = tf.tile( | |||||
| tf.expand_dims( | |||||
| tf.range(0, tf.cast(len, dtype=tf.float32), dtype=tf.float32) | |||||
| * step, | |||||
| axis=-1), [1, dim]) | |||||
| dim_mat = tf.tile( | |||||
| tf.expand_dims( | |||||
| tf.range(0, tf.cast(dim, dtype=tf.float32), dtype=tf.float32), | |||||
| axis=0), [len, 1]) | |||||
| dim_mat_int = tf.cast(dim_mat, dtype=tf.int32) | |||||
| pos_encoding = tf.where( # [time, dims] | |||||
| tf.math.equal(tf.math.mod(dim_mat_int, 2), 0), | |||||
| x=tf.math.sin( | |||||
| pos_mat / tf.pow(10000., dim_mat / tf.cast(dim, tf.float32))), | |||||
| y=tf.math.cos(pos_mat | |||||
| / tf.pow(10000., | |||||
| (dim_mat - 1) / tf.cast(dim, tf.float32)))) | |||||
| return pos_encoding | |||||
| class BatchSinusodalPositionalEncoding(tf.keras.layers.Layer): | |||||
| def __init__(self, name='BatchSinusodalPositionalEncoding'): | |||||
| super(BatchSinusodalPositionalEncoding, self).__init__(name=name) | |||||
| @staticmethod | |||||
| def positional_encoding(batch_size, len, dim, pos_mat, step=1.): | |||||
| """ | |||||
| :param len: int scalar | |||||
| :param dim: int scalar | |||||
| :param step: | |||||
| :param pos_mat: [B, len] = [len, 1] * dim | |||||
| :return: position embedding | |||||
| """ | |||||
| pos_mat = tf.tile( | |||||
| tf.expand_dims(tf.cast(pos_mat, dtype=tf.float32) * step, axis=-1), | |||||
| [1, 1, dim]) # [B, len, dim] | |||||
| dim_mat = tf.tile( | |||||
| tf.expand_dims( | |||||
| tf.expand_dims( | |||||
| tf.range( | |||||
| 0, tf.cast(dim, dtype=tf.float32), dtype=tf.float32), | |||||
| axis=0), | |||||
| axis=0), [batch_size, len, 1]) # [B, len, dim] | |||||
| dim_mat_int = tf.cast(dim_mat, dtype=tf.int32) | |||||
| pos_encoding = tf.where( # [B, time, dims] | |||||
| tf.math.equal(tf.mod(dim_mat_int, 2), 0), | |||||
| x=tf.math.sin( | |||||
| pos_mat / tf.pow(10000., dim_mat / tf.cast(dim, tf.float32))), | |||||
| y=tf.math.cos(pos_mat | |||||
| / tf.pow(10000., | |||||
| (dim_mat - 1) / tf.cast(dim, tf.float32)))) | |||||
| return pos_encoding | |||||
| @@ -0,0 +1,155 @@ | |||||
| """Define reducers: objects that merge inputs.""" | |||||
| import abc | |||||
| import functools | |||||
| import tensorflow as tf | |||||
| def pad_in_time(x, padding_length): | |||||
| """Helper function to pad a tensor in the time dimension and retain the static depth dimension.""" | |||||
| return tf.pad(x, [[0, 0], [0, padding_length], [0, 0]]) | |||||
| def align_in_time(x, length): | |||||
| """Aligns the time dimension of :obj:`x` with :obj:`length`.""" | |||||
| time_dim = tf.shape(x)[1] | |||||
| return tf.cond( | |||||
| tf.less(time_dim, length), | |||||
| true_fn=lambda: pad_in_time(x, length - time_dim), | |||||
| false_fn=lambda: x[:, :length]) | |||||
| def pad_with_identity(x, | |||||
| sequence_length, | |||||
| max_sequence_length, | |||||
| identity_values=0, | |||||
| maxlen=None): | |||||
| """Pads a tensor with identity values up to :obj:`max_sequence_length`. | |||||
| Args: | |||||
| x: A ``tf.Tensor`` of shape ``[batch_size, time, depth]``. | |||||
| sequence_length: The true sequence length of :obj:`x`. | |||||
| max_sequence_length: The sequence length up to which the tensor must contain | |||||
| :obj:`identity values`. | |||||
| identity_values: The identity value. | |||||
| maxlen: Size of the output time dimension. Default is the maximum value in | |||||
| obj:`max_sequence_length`. | |||||
| Returns: | |||||
| A ``tf.Tensor`` of shape ``[batch_size, maxlen, depth]``. | |||||
| """ | |||||
| if maxlen is None: | |||||
| maxlen = tf.reduce_max(max_sequence_length) | |||||
| mask = tf.sequence_mask(sequence_length, maxlen=maxlen, dtype=x.dtype) | |||||
| mask = tf.expand_dims(mask, axis=-1) | |||||
| mask_combined = tf.sequence_mask( | |||||
| max_sequence_length, maxlen=maxlen, dtype=x.dtype) | |||||
| mask_combined = tf.expand_dims(mask_combined, axis=-1) | |||||
| identity_mask = mask_combined * (1.0 - mask) | |||||
| x = pad_in_time(x, maxlen - tf.shape(x)[1]) | |||||
| x = x * mask + (identity_mask * identity_values) | |||||
| return x | |||||
| def pad_n_with_identity(inputs, sequence_lengths, identity_values=0): | |||||
| """Pads each input tensors with identity values up to | |||||
| ``max(sequence_lengths)`` for each batch. | |||||
| Args: | |||||
| inputs: A list of ``tf.Tensor``. | |||||
| sequence_lengths: A list of sequence length. | |||||
| identity_values: The identity value. | |||||
| Returns: | |||||
| A tuple ``(padded, max_sequence_length)`` which are respectively a list of | |||||
| ``tf.Tensor`` where each tensor are padded with identity and the combined | |||||
| sequence length. | |||||
| """ | |||||
| max_sequence_length = tf.reduce_max(sequence_lengths, axis=0) | |||||
| maxlen = tf.reduce_max([tf.shape(x)[1] for x in inputs]) | |||||
| padded = [ | |||||
| pad_with_identity( | |||||
| x, | |||||
| length, | |||||
| max_sequence_length, | |||||
| identity_values=identity_values, | |||||
| maxlen=maxlen) for x, length in zip(inputs, sequence_lengths) | |||||
| ] | |||||
| return padded, max_sequence_length | |||||
| class Reducer(tf.keras.layers.Layer): | |||||
| """Base class for reducers.""" | |||||
| def zip_and_reduce(self, x, y): | |||||
| """Zips the :obj:`x` with :obj:`y` structures together and reduces all | |||||
| elements. If the structures are nested, they will be flattened first. | |||||
| Args: | |||||
| x: The first structure. | |||||
| y: The second structure. | |||||
| Returns: | |||||
| The same structure as :obj:`x` and :obj:`y` where each element from | |||||
| :obj:`x` is reduced with the correspond element from :obj:`y`. | |||||
| Raises: | |||||
| ValueError: if the two structures are not the same. | |||||
| """ | |||||
| tf.nest.assert_same_structure(x, y) | |||||
| x_flat = tf.nest.flatten(x) | |||||
| y_flat = tf.nest.flatten(y) | |||||
| reduced = list(map(self, zip(x_flat, y_flat))) | |||||
| return tf.nest.pack_sequence_as(x, reduced) | |||||
| def call(self, inputs, sequence_length=None): # pylint: disable=arguments-differ | |||||
| """Reduces all input elements. | |||||
| Args: | |||||
| inputs: A list of ``tf.Tensor``. | |||||
| sequence_length: The length of each input, if reducing sequences. | |||||
| Returns: | |||||
| If :obj:`sequence_length` is set, a tuple | |||||
| ``(reduced_input, reduced_length)``, otherwise a reduced ``tf.Tensor`` | |||||
| only. | |||||
| """ | |||||
| if sequence_length is None: | |||||
| return self.reduce(inputs) | |||||
| else: | |||||
| return self.reduce_sequence( | |||||
| inputs, sequence_lengths=sequence_length) | |||||
| @abc.abstractmethod | |||||
| def reduce(self, inputs): | |||||
| """See :meth:`opennmt.layers.Reducer.__call__`.""" | |||||
| raise NotImplementedError() | |||||
| @abc.abstractmethod | |||||
| def reduce_sequence(self, inputs, sequence_lengths): | |||||
| """See :meth:`opennmt.layers.Reducer.__call__`.""" | |||||
| raise NotImplementedError() | |||||
| class SumReducer(Reducer): | |||||
| """A reducer that sums the inputs.""" | |||||
| def reduce(self, inputs): | |||||
| if len(inputs) == 1: | |||||
| return inputs[0] | |||||
| if len(inputs) == 2: | |||||
| return inputs[0] + inputs[1] | |||||
| return tf.add_n(inputs) | |||||
| def reduce_sequence(self, inputs, sequence_lengths): | |||||
| padded, combined_length = pad_n_with_identity( | |||||
| inputs, sequence_lengths, identity_values=0) | |||||
| return self.reduce(padded), combined_length | |||||
| class MultiplyReducer(Reducer): | |||||
| """A reducer that multiplies the inputs.""" | |||||
| def reduce(self, inputs): | |||||
| return functools.reduce(lambda a, x: a * x, inputs) | |||||
| def reduce_sequence(self, inputs, sequence_lengths): | |||||
| padded, combined_length = pad_n_with_identity( | |||||
| inputs, sequence_lengths, identity_values=1) | |||||
| return self.reduce(padded), combined_length | |||||
| @@ -0,0 +1,240 @@ | |||||
| import numpy as np | |||||
| import tensorflow as tf | |||||
| from tensorflow.contrib.rnn import RNNCell | |||||
| from tensorflow.contrib.seq2seq import AttentionWrapperState | |||||
| from tensorflow.python.ops import rnn_cell_impl | |||||
| from .modules import prenet | |||||
| class VarPredictorCell(RNNCell): | |||||
| '''Wrapper wrapper knock knock.''' | |||||
| def __init__(self, var_predictor_cell, is_training, dim, prenet_units): | |||||
| super(VarPredictorCell, self).__init__() | |||||
| self._var_predictor_cell = var_predictor_cell | |||||
| self._is_training = is_training | |||||
| self._dim = dim | |||||
| self._prenet_units = prenet_units | |||||
| @property | |||||
| def state_size(self): | |||||
| return tuple([self.output_size, self._var_predictor_cell.state_size]) | |||||
| @property | |||||
| def output_size(self): | |||||
| return self._dim | |||||
| def zero_state(self, batch_size, dtype): | |||||
| return tuple([ | |||||
| rnn_cell_impl._zero_state_tensors(self.output_size, batch_size, | |||||
| dtype), | |||||
| self._var_predictor_cell.zero_state(batch_size, dtype) | |||||
| ]) | |||||
| def call(self, inputs, state): | |||||
| '''Run the Tacotron2 super decoder cell.''' | |||||
| super_cell_out, decoder_state = state | |||||
| # split | |||||
| prenet_input = inputs[:, 0:self._dim] | |||||
| encoder_output = inputs[:, self._dim:] | |||||
| # prenet and concat | |||||
| prenet_output = prenet( | |||||
| prenet_input, | |||||
| self._prenet_units, | |||||
| self._is_training, | |||||
| scope='var_prenet') | |||||
| decoder_input = tf.concat([prenet_output, encoder_output], axis=-1) | |||||
| # decoder LSTM/GRU | |||||
| new_super_cell_out, new_decoder_state = self._var_predictor_cell( | |||||
| decoder_input, decoder_state) | |||||
| # projection | |||||
| new_super_cell_out = tf.layers.dense( | |||||
| new_super_cell_out, units=self._dim) | |||||
| new_states = tuple([new_super_cell_out, new_decoder_state]) | |||||
| return new_super_cell_out, new_states | |||||
| class DurPredictorCell(RNNCell): | |||||
| '''Wrapper wrapper knock knock.''' | |||||
| def __init__(self, var_predictor_cell, is_training, dim, prenet_units): | |||||
| super(DurPredictorCell, self).__init__() | |||||
| self._var_predictor_cell = var_predictor_cell | |||||
| self._is_training = is_training | |||||
| self._dim = dim | |||||
| self._prenet_units = prenet_units | |||||
| @property | |||||
| def state_size(self): | |||||
| return tuple([self.output_size, self._var_predictor_cell.state_size]) | |||||
| @property | |||||
| def output_size(self): | |||||
| return self._dim | |||||
| def zero_state(self, batch_size, dtype): | |||||
| return tuple([ | |||||
| rnn_cell_impl._zero_state_tensors(self.output_size, batch_size, | |||||
| dtype), | |||||
| self._var_predictor_cell.zero_state(batch_size, dtype) | |||||
| ]) | |||||
| def call(self, inputs, state): | |||||
| '''Run the Tacotron2 super decoder cell.''' | |||||
| super_cell_out, decoder_state = state | |||||
| # split | |||||
| prenet_input = inputs[:, 0:self._dim] | |||||
| encoder_output = inputs[:, self._dim:] | |||||
| # prenet and concat | |||||
| prenet_output = prenet( | |||||
| prenet_input, | |||||
| self._prenet_units, | |||||
| self._is_training, | |||||
| scope='dur_prenet') | |||||
| decoder_input = tf.concat([prenet_output, encoder_output], axis=-1) | |||||
| # decoder LSTM/GRU | |||||
| new_super_cell_out, new_decoder_state = self._var_predictor_cell( | |||||
| decoder_input, decoder_state) | |||||
| # projection | |||||
| new_super_cell_out = tf.layers.dense( | |||||
| new_super_cell_out, units=self._dim) | |||||
| new_super_cell_out = tf.nn.relu(new_super_cell_out) | |||||
| # new_super_cell_out = tf.log(tf.cast(tf.round(tf.exp(new_super_cell_out) - 1), tf.float32) + 1) | |||||
| new_states = tuple([new_super_cell_out, new_decoder_state]) | |||||
| return new_super_cell_out, new_states | |||||
| class DurPredictorCECell(RNNCell): | |||||
| '''Wrapper wrapper knock knock.''' | |||||
| def __init__(self, var_predictor_cell, is_training, dim, prenet_units, | |||||
| max_dur, dur_embedding_dim): | |||||
| super(DurPredictorCECell, self).__init__() | |||||
| self._var_predictor_cell = var_predictor_cell | |||||
| self._is_training = is_training | |||||
| self._dim = dim | |||||
| self._prenet_units = prenet_units | |||||
| self._max_dur = max_dur | |||||
| self._dur_embedding_dim = dur_embedding_dim | |||||
| @property | |||||
| def state_size(self): | |||||
| return tuple([self.output_size, self._var_predictor_cell.state_size]) | |||||
| @property | |||||
| def output_size(self): | |||||
| return self._max_dur | |||||
| def zero_state(self, batch_size, dtype): | |||||
| return tuple([ | |||||
| rnn_cell_impl._zero_state_tensors(self.output_size, batch_size, | |||||
| dtype), | |||||
| self._var_predictor_cell.zero_state(batch_size, dtype) | |||||
| ]) | |||||
| def call(self, inputs, state): | |||||
| '''Run the Tacotron2 super decoder cell.''' | |||||
| super_cell_out, decoder_state = state | |||||
| # split | |||||
| prenet_input = tf.squeeze( | |||||
| tf.cast(inputs[:, 0:self._dim], tf.int32), axis=-1) # [N] | |||||
| prenet_input = tf.one_hot( | |||||
| prenet_input, self._max_dur, on_value=1.0, off_value=0.0, | |||||
| axis=-1) # [N, 120] | |||||
| prenet_input = tf.layers.dense( | |||||
| prenet_input, units=self._dur_embedding_dim) | |||||
| encoder_output = inputs[:, self._dim:] | |||||
| # prenet and concat | |||||
| prenet_output = prenet( | |||||
| prenet_input, | |||||
| self._prenet_units, | |||||
| self._is_training, | |||||
| scope='dur_prenet') | |||||
| decoder_input = tf.concat([prenet_output, encoder_output], axis=-1) | |||||
| # decoder LSTM/GRU | |||||
| new_super_cell_out, new_decoder_state = self._var_predictor_cell( | |||||
| decoder_input, decoder_state) | |||||
| # projection | |||||
| new_super_cell_out = tf.layers.dense( | |||||
| new_super_cell_out, units=self._max_dur) # [N, 120] | |||||
| new_super_cell_out = tf.nn.softmax(new_super_cell_out) # [N, 120] | |||||
| new_states = tuple([new_super_cell_out, new_decoder_state]) | |||||
| return new_super_cell_out, new_states | |||||
| class VarPredictorCell2(RNNCell): | |||||
| '''Wrapper wrapper knock knock.''' | |||||
| def __init__(self, var_predictor_cell, is_training, dim, prenet_units): | |||||
| super(VarPredictorCell2, self).__init__() | |||||
| self._var_predictor_cell = var_predictor_cell | |||||
| self._is_training = is_training | |||||
| self._dim = dim | |||||
| self._prenet_units = prenet_units | |||||
| @property | |||||
| def state_size(self): | |||||
| return tuple([self.output_size, self._var_predictor_cell.state_size]) | |||||
| @property | |||||
| def output_size(self): | |||||
| return self._dim | |||||
| def zero_state(self, batch_size, dtype): | |||||
| return tuple([ | |||||
| rnn_cell_impl._zero_state_tensors(self.output_size, batch_size, | |||||
| dtype), | |||||
| self._var_predictor_cell.zero_state(batch_size, dtype) | |||||
| ]) | |||||
| def call(self, inputs, state): | |||||
| '''Run the Tacotron2 super decoder cell.''' | |||||
| super_cell_out, decoder_state = state | |||||
| # split | |||||
| prenet_input = inputs[:, 0:self._dim] | |||||
| encoder_output = inputs[:, self._dim:] | |||||
| # prenet and concat | |||||
| prenet_output = prenet( | |||||
| prenet_input, | |||||
| self._prenet_units, | |||||
| self._is_training, | |||||
| scope='var_prenet') | |||||
| decoder_input = tf.concat([prenet_output, encoder_output], axis=-1) | |||||
| # decoder LSTM/GRU | |||||
| new_super_cell_out, new_decoder_state = self._var_predictor_cell( | |||||
| decoder_input, decoder_state) | |||||
| # projection | |||||
| new_super_cell_out = tf.layers.dense( | |||||
| new_super_cell_out, units=self._dim) | |||||
| # split and relu | |||||
| new_super_cell_out = tf.concat([ | |||||
| tf.nn.relu(new_super_cell_out[:, 0:1]), new_super_cell_out[:, 1:] | |||||
| ], axis=-1) # yapf:disable | |||||
| new_states = tuple([new_super_cell_out, new_decoder_state]) | |||||
| return new_super_cell_out, new_states | |||||
| @@ -0,0 +1,760 @@ | |||||
| import tensorflow as tf | |||||
| from tensorflow.contrib.rnn import LSTMBlockCell, MultiRNNCell | |||||
| from tensorflow.contrib.seq2seq import BasicDecoder | |||||
| from tensorflow.python.ops.ragged.ragged_util import repeat | |||||
| from .fsmn_encoder import FsmnEncoderV2 | |||||
| from .helpers import VarTestHelper, VarTrainingHelper | |||||
| from .modules import conv_prenet, decoder_prenet, encoder_prenet | |||||
| from .position import (BatchSinusodalPositionalEncoding, | |||||
| SinusodalPositionalEncoding) | |||||
| from .rnn_wrappers import DurPredictorCell, VarPredictorCell | |||||
| from .self_attention_decoder import SelfAttentionDecoder | |||||
| from .self_attention_encoder import SelfAttentionEncoder | |||||
| class RobuTrans(): | |||||
| def __init__(self, hparams): | |||||
| self._hparams = hparams | |||||
| def initialize(self, | |||||
| inputs, | |||||
| inputs_emotion, | |||||
| inputs_speaker, | |||||
| input_lengths, | |||||
| output_lengths=None, | |||||
| mel_targets=None, | |||||
| durations=None, | |||||
| pitch_contours=None, | |||||
| uv_masks=None, | |||||
| pitch_scales=None, | |||||
| duration_scales=None, | |||||
| energy_contours=None, | |||||
| energy_scales=None): | |||||
| '''Initializes the model for inference. | |||||
| Sets "mel_outputs", "linear_outputs", "stop_token_outputs", and "alignments" fields. | |||||
| Args: | |||||
| inputs: int32 Tensor with shape [N, T_in] where N is batch size, T_in is number of | |||||
| steps in the input time series, and values are character IDs | |||||
| input_lengths: int32 Tensor with shape [N] where N is batch size and values are the lengths | |||||
| of each sequence in inputs. | |||||
| output_lengths: int32 Tensor with shape [N] where N is batch size and values are the lengths | |||||
| of each sequence in outputs. | |||||
| mel_targets: float32 Tensor with shape [N, T_out, M] where N is batch size, T_out is number | |||||
| of steps in the output time series, M is num_mels, and values are entries in the mel | |||||
| spectrogram. Only needed for training. | |||||
| ''' | |||||
| with tf.variable_scope('inference') as _: | |||||
| is_training = mel_targets is not None | |||||
| batch_size = tf.shape(inputs)[0] | |||||
| hp = self._hparams | |||||
| input_mask = None | |||||
| if input_lengths is not None and is_training: | |||||
| input_mask = tf.sequence_mask( | |||||
| input_lengths, tf.shape(inputs)[1], dtype=tf.float32) | |||||
| if input_mask is not None: | |||||
| inputs = inputs * tf.expand_dims(input_mask, -1) | |||||
| # speaker embedding | |||||
| embedded_inputs_speaker = tf.layers.dense( | |||||
| inputs_speaker, | |||||
| 32, | |||||
| activation=None, | |||||
| use_bias=False, | |||||
| kernel_initializer=tf.truncated_normal_initializer(stddev=0.5)) | |||||
| # emotion embedding | |||||
| embedded_inputs_emotion = tf.layers.dense( | |||||
| inputs_emotion, | |||||
| 32, | |||||
| activation=None, | |||||
| use_bias=False, | |||||
| kernel_initializer=tf.truncated_normal_initializer(stddev=0.5)) | |||||
| # symbol embedding | |||||
| with tf.variable_scope('Embedding'): | |||||
| embedded_inputs = tf.layers.dense( | |||||
| inputs, | |||||
| hp.embedding_dim, | |||||
| activation=None, | |||||
| use_bias=False, | |||||
| kernel_initializer=tf.truncated_normal_initializer( | |||||
| stddev=0.5)) | |||||
| # Encoder | |||||
| with tf.variable_scope('Encoder'): | |||||
| Encoder = SelfAttentionEncoder( | |||||
| num_layers=hp.encoder_num_layers, | |||||
| num_units=hp.encoder_num_units, | |||||
| num_heads=hp.encoder_num_heads, | |||||
| ffn_inner_dim=hp.encoder_ffn_inner_dim, | |||||
| dropout=hp.encoder_dropout, | |||||
| attention_dropout=hp.encoder_attention_dropout, | |||||
| relu_dropout=hp.encoder_relu_dropout) | |||||
| encoder_outputs, state_mo, sequence_length_mo, attns = Encoder.encode( | |||||
| embedded_inputs, | |||||
| sequence_length=input_lengths, | |||||
| mode=is_training) | |||||
| encoder_outputs = tf.layers.dense( | |||||
| encoder_outputs, | |||||
| hp.encoder_projection_units, | |||||
| activation=None, | |||||
| use_bias=False, | |||||
| kernel_initializer=tf.truncated_normal_initializer( | |||||
| stddev=0.5)) | |||||
| # pitch and energy | |||||
| var_inputs = tf.concat([ | |||||
| encoder_outputs, embedded_inputs_speaker, | |||||
| embedded_inputs_emotion | |||||
| ], 2) | |||||
| if input_mask is not None: | |||||
| var_inputs = var_inputs * tf.expand_dims(input_mask, -1) | |||||
| with tf.variable_scope('Pitch_Predictor'): | |||||
| Pitch_Predictor_FSMN = FsmnEncoderV2( | |||||
| filter_size=hp.predictor_filter_size, | |||||
| fsmn_num_layers=hp.predictor_fsmn_num_layers, | |||||
| dnn_num_layers=hp.predictor_dnn_num_layers, | |||||
| num_memory_units=hp.predictor_num_memory_units, | |||||
| ffn_inner_dim=hp.predictor_ffn_inner_dim, | |||||
| dropout=hp.predictor_dropout, | |||||
| shift=hp.predictor_shift, | |||||
| position_encoder=None) | |||||
| pitch_contour_outputs, _, _ = Pitch_Predictor_FSMN.encode( | |||||
| tf.concat([ | |||||
| encoder_outputs, embedded_inputs_speaker, | |||||
| embedded_inputs_emotion | |||||
| ], 2), | |||||
| sequence_length=input_lengths, | |||||
| mode=is_training) | |||||
| pitch_contour_outputs, _ = tf.nn.bidirectional_dynamic_rnn( | |||||
| LSTMBlockCell(hp.predictor_lstm_units), | |||||
| LSTMBlockCell(hp.predictor_lstm_units), | |||||
| pitch_contour_outputs, | |||||
| sequence_length=input_lengths, | |||||
| dtype=tf.float32) | |||||
| pitch_contour_outputs = tf.concat( | |||||
| pitch_contour_outputs, axis=-1) | |||||
| pitch_contour_outputs = tf.layers.dense( | |||||
| pitch_contour_outputs, units=1) # [N, T_in, 1] | |||||
| pitch_contour_outputs = tf.squeeze( | |||||
| pitch_contour_outputs, axis=2) # [N, T_in] | |||||
| with tf.variable_scope('Energy_Predictor'): | |||||
| Energy_Predictor_FSMN = FsmnEncoderV2( | |||||
| filter_size=hp.predictor_filter_size, | |||||
| fsmn_num_layers=hp.predictor_fsmn_num_layers, | |||||
| dnn_num_layers=hp.predictor_dnn_num_layers, | |||||
| num_memory_units=hp.predictor_num_memory_units, | |||||
| ffn_inner_dim=hp.predictor_ffn_inner_dim, | |||||
| dropout=hp.predictor_dropout, | |||||
| shift=hp.predictor_shift, | |||||
| position_encoder=None) | |||||
| energy_contour_outputs, _, _ = Energy_Predictor_FSMN.encode( | |||||
| tf.concat([ | |||||
| encoder_outputs, embedded_inputs_speaker, | |||||
| embedded_inputs_emotion | |||||
| ], 2), | |||||
| sequence_length=input_lengths, | |||||
| mode=is_training) | |||||
| energy_contour_outputs, _ = tf.nn.bidirectional_dynamic_rnn( | |||||
| LSTMBlockCell(hp.predictor_lstm_units), | |||||
| LSTMBlockCell(hp.predictor_lstm_units), | |||||
| energy_contour_outputs, | |||||
| sequence_length=input_lengths, | |||||
| dtype=tf.float32) | |||||
| energy_contour_outputs = tf.concat( | |||||
| energy_contour_outputs, axis=-1) | |||||
| energy_contour_outputs = tf.layers.dense( | |||||
| energy_contour_outputs, units=1) # [N, T_in, 1] | |||||
| energy_contour_outputs = tf.squeeze( | |||||
| energy_contour_outputs, axis=2) # [N, T_in] | |||||
| if is_training: | |||||
| pitch_embeddings = tf.expand_dims( | |||||
| pitch_contours, axis=2) # [N, T_in, 1] | |||||
| pitch_embeddings = tf.layers.conv1d( | |||||
| pitch_embeddings, | |||||
| filters=hp.encoder_projection_units, | |||||
| kernel_size=9, | |||||
| padding='same', | |||||
| name='pitch_embeddings') # [N, T_in, 32] | |||||
| energy_embeddings = tf.expand_dims( | |||||
| energy_contours, axis=2) # [N, T_in, 1] | |||||
| energy_embeddings = tf.layers.conv1d( | |||||
| energy_embeddings, | |||||
| filters=hp.encoder_projection_units, | |||||
| kernel_size=9, | |||||
| padding='same', | |||||
| name='energy_embeddings') # [N, T_in, 32] | |||||
| else: | |||||
| pitch_contour_outputs *= pitch_scales | |||||
| pitch_embeddings = tf.expand_dims( | |||||
| pitch_contour_outputs, axis=2) # [N, T_in, 1] | |||||
| pitch_embeddings = tf.layers.conv1d( | |||||
| pitch_embeddings, | |||||
| filters=hp.encoder_projection_units, | |||||
| kernel_size=9, | |||||
| padding='same', | |||||
| name='pitch_embeddings') # [N, T_in, 32] | |||||
| energy_contour_outputs *= energy_scales | |||||
| energy_embeddings = tf.expand_dims( | |||||
| energy_contour_outputs, axis=2) # [N, T_in, 1] | |||||
| energy_embeddings = tf.layers.conv1d( | |||||
| energy_embeddings, | |||||
| filters=hp.encoder_projection_units, | |||||
| kernel_size=9, | |||||
| padding='same', | |||||
| name='energy_embeddings') # [N, T_in, 32] | |||||
| encoder_outputs_ = encoder_outputs + pitch_embeddings + energy_embeddings | |||||
| # duration | |||||
| dur_inputs = tf.concat([ | |||||
| encoder_outputs_, embedded_inputs_speaker, | |||||
| embedded_inputs_emotion | |||||
| ], 2) | |||||
| if input_mask is not None: | |||||
| dur_inputs = dur_inputs * tf.expand_dims(input_mask, -1) | |||||
| with tf.variable_scope('Duration_Predictor'): | |||||
| duration_predictor_cell = MultiRNNCell([ | |||||
| LSTMBlockCell(hp.predictor_lstm_units), | |||||
| LSTMBlockCell(hp.predictor_lstm_units) | |||||
| ], state_is_tuple=True) # yapf:disable | |||||
| duration_output_cell = DurPredictorCell( | |||||
| duration_predictor_cell, is_training, 1, | |||||
| hp.predictor_prenet_units) | |||||
| duration_predictor_init_state = duration_output_cell.zero_state( | |||||
| batch_size=batch_size, dtype=tf.float32) | |||||
| if is_training: | |||||
| duration_helper = VarTrainingHelper( | |||||
| tf.expand_dims( | |||||
| tf.log(tf.cast(durations, tf.float32) + 1), | |||||
| axis=2), dur_inputs, 1) | |||||
| else: | |||||
| duration_helper = VarTestHelper(batch_size, dur_inputs, 1) | |||||
| ( | |||||
| duration_outputs, _ | |||||
| ), final_duration_predictor_state, _ = tf.contrib.seq2seq.dynamic_decode( | |||||
| BasicDecoder(duration_output_cell, duration_helper, | |||||
| duration_predictor_init_state), | |||||
| maximum_iterations=1000) | |||||
| duration_outputs = tf.squeeze( | |||||
| duration_outputs, axis=2) # [N, T_in] | |||||
| if input_mask is not None: | |||||
| duration_outputs = duration_outputs * input_mask | |||||
| duration_outputs_ = tf.exp(duration_outputs) - 1 | |||||
| # Length Regulator | |||||
| with tf.variable_scope('Length_Regulator'): | |||||
| if is_training: | |||||
| i = tf.constant(1) | |||||
| # position embedding | |||||
| j = tf.constant(1) | |||||
| dur_len = tf.shape(durations)[-1] | |||||
| embedded_position_i = tf.range(1, durations[0, 0] + 1) | |||||
| def condition_pos(j, e): | |||||
| return tf.less(j, dur_len) | |||||
| def loop_body_pos(j, embedded_position_i): | |||||
| embedded_position_i = tf.concat([ | |||||
| embedded_position_i, | |||||
| tf.range(1, durations[0, j] + 1) | |||||
| ], axis=0) # yapf:disable | |||||
| return [j + 1, embedded_position_i] | |||||
| j, embedded_position_i = tf.while_loop( | |||||
| condition_pos, | |||||
| loop_body_pos, [j, embedded_position_i], | |||||
| shape_invariants=[ | |||||
| j.get_shape(), | |||||
| tf.TensorShape([None]) | |||||
| ]) | |||||
| embedded_position = tf.reshape(embedded_position_i, | |||||
| (1, -1)) | |||||
| # others | |||||
| LR_outputs = repeat( | |||||
| encoder_outputs_[0:1, :, :], durations[0, :], axis=1) | |||||
| embedded_outputs_speaker = repeat( | |||||
| embedded_inputs_speaker[0:1, :, :], | |||||
| durations[0, :], | |||||
| axis=1) | |||||
| embedded_outputs_emotion = repeat( | |||||
| embedded_inputs_emotion[0:1, :, :], | |||||
| durations[0, :], | |||||
| axis=1) | |||||
| def condition(i, pos, layer, s, e): | |||||
| return tf.less(i, tf.shape(mel_targets)[0]) | |||||
| def loop_body(i, embedded_position, LR_outputs, | |||||
| embedded_outputs_speaker, | |||||
| embedded_outputs_emotion): | |||||
| # position embedding | |||||
| jj = tf.constant(1) | |||||
| embedded_position_i = tf.range(1, durations[i, 0] + 1) | |||||
| def condition_pos_i(j, e): | |||||
| return tf.less(j, dur_len) | |||||
| def loop_body_pos_i(j, embedded_position_i): | |||||
| embedded_position_i = tf.concat([ | |||||
| embedded_position_i, | |||||
| tf.range(1, durations[i, j] + 1) | |||||
| ], axis=0) # yapf:disable | |||||
| return [j + 1, embedded_position_i] | |||||
| jj, embedded_position_i = tf.while_loop( | |||||
| condition_pos_i, | |||||
| loop_body_pos_i, [jj, embedded_position_i], | |||||
| shape_invariants=[ | |||||
| jj.get_shape(), | |||||
| tf.TensorShape([None]) | |||||
| ]) | |||||
| embedded_position = tf.concat([ | |||||
| embedded_position, | |||||
| tf.reshape(embedded_position_i, (1, -1)) | |||||
| ], 0) | |||||
| # others | |||||
| LR_outputs = tf.concat([ | |||||
| LR_outputs, | |||||
| repeat( | |||||
| encoder_outputs_[i:i + 1, :, :], | |||||
| durations[i, :], | |||||
| axis=1) | |||||
| ], 0) | |||||
| embedded_outputs_speaker = tf.concat([ | |||||
| embedded_outputs_speaker, | |||||
| repeat( | |||||
| embedded_inputs_speaker[i:i + 1, :, :], | |||||
| durations[i, :], | |||||
| axis=1) | |||||
| ], 0) | |||||
| embedded_outputs_emotion = tf.concat([ | |||||
| embedded_outputs_emotion, | |||||
| repeat( | |||||
| embedded_inputs_emotion[i:i + 1, :, :], | |||||
| durations[i, :], | |||||
| axis=1) | |||||
| ], 0) | |||||
| return [ | |||||
| i + 1, embedded_position, LR_outputs, | |||||
| embedded_outputs_speaker, embedded_outputs_emotion | |||||
| ] | |||||
| i, embedded_position, LR_outputs, | |||||
| embedded_outputs_speaker, | |||||
| embedded_outputs_emotion = tf.while_loop( | |||||
| condition, | |||||
| loop_body, [ | |||||
| i, embedded_position, LR_outputs, | |||||
| embedded_outputs_speaker, embedded_outputs_emotion | |||||
| ], | |||||
| shape_invariants=[ | |||||
| i.get_shape(), | |||||
| tf.TensorShape([None, None]), | |||||
| tf.TensorShape([None, None, None]), | |||||
| tf.TensorShape([None, None, None]), | |||||
| tf.TensorShape([None, None, None]) | |||||
| ], | |||||
| parallel_iterations=hp.batch_size) | |||||
| ori_framenum = tf.shape(mel_targets)[1] | |||||
| else: | |||||
| # position | |||||
| j = tf.constant(1) | |||||
| dur_len = tf.shape(duration_outputs_)[-1] | |||||
| embedded_position_i = tf.range( | |||||
| 1, | |||||
| tf.cast(tf.round(duration_outputs_)[0, 0], tf.int32) | |||||
| + 1) | |||||
| def condition_pos(j, e): | |||||
| return tf.less(j, dur_len) | |||||
| def loop_body_pos(j, embedded_position_i): | |||||
| embedded_position_i = tf.concat([ | |||||
| embedded_position_i, | |||||
| tf.range( | |||||
| 1, | |||||
| tf.cast( | |||||
| tf.round(duration_outputs_)[0, j], | |||||
| tf.int32) + 1) | |||||
| ], axis=0) # yapf:disable | |||||
| return [j + 1, embedded_position_i] | |||||
| j, embedded_position_i = tf.while_loop( | |||||
| condition_pos, | |||||
| loop_body_pos, [j, embedded_position_i], | |||||
| shape_invariants=[ | |||||
| j.get_shape(), | |||||
| tf.TensorShape([None]) | |||||
| ]) | |||||
| embedded_position = tf.reshape(embedded_position_i, | |||||
| (1, -1)) | |||||
| # others | |||||
| duration_outputs_ *= duration_scales | |||||
| LR_outputs = repeat( | |||||
| encoder_outputs_[0:1, :, :], | |||||
| tf.cast(tf.round(duration_outputs_)[0, :], tf.int32), | |||||
| axis=1) | |||||
| embedded_outputs_speaker = repeat( | |||||
| embedded_inputs_speaker[0:1, :, :], | |||||
| tf.cast(tf.round(duration_outputs_)[0, :], tf.int32), | |||||
| axis=1) | |||||
| embedded_outputs_emotion = repeat( | |||||
| embedded_inputs_emotion[0:1, :, :], | |||||
| tf.cast(tf.round(duration_outputs_)[0, :], tf.int32), | |||||
| axis=1) | |||||
| ori_framenum = tf.shape(LR_outputs)[1] | |||||
| left = hp.outputs_per_step - tf.mod( | |||||
| ori_framenum, hp.outputs_per_step) | |||||
| LR_outputs = tf.cond( | |||||
| tf.equal(left, | |||||
| hp.outputs_per_step), lambda: LR_outputs, | |||||
| lambda: tf.pad(LR_outputs, [[0, 0], [0, left], [0, 0]], | |||||
| 'CONSTANT')) | |||||
| embedded_outputs_speaker = tf.cond( | |||||
| tf.equal(left, hp.outputs_per_step), | |||||
| lambda: embedded_outputs_speaker, lambda: tf.pad( | |||||
| embedded_outputs_speaker, [[0, 0], [0, left], | |||||
| [0, 0]], 'CONSTANT')) | |||||
| embedded_outputs_emotion = tf.cond( | |||||
| tf.equal(left, hp.outputs_per_step), | |||||
| lambda: embedded_outputs_emotion, lambda: tf.pad( | |||||
| embedded_outputs_emotion, [[0, 0], [0, left], | |||||
| [0, 0]], 'CONSTANT')) | |||||
| embedded_position = tf.cond( | |||||
| tf.equal(left, hp.outputs_per_step), | |||||
| lambda: embedded_position, | |||||
| lambda: tf.pad(embedded_position, [[0, 0], [0, left]], | |||||
| 'CONSTANT')) | |||||
| # Pos_Embedding | |||||
| with tf.variable_scope('Position_Embedding'): | |||||
| Pos_Embedding = BatchSinusodalPositionalEncoding() | |||||
| position_embeddings = Pos_Embedding.positional_encoding( | |||||
| batch_size, | |||||
| tf.shape(LR_outputs)[1], hp.encoder_projection_units, | |||||
| embedded_position) | |||||
| LR_outputs += position_embeddings | |||||
| # multi-frame | |||||
| LR_outputs = tf.reshape(LR_outputs, [ | |||||
| batch_size, -1, | |||||
| hp.outputs_per_step * hp.encoder_projection_units | |||||
| ]) | |||||
| embedded_outputs_speaker = tf.reshape( | |||||
| embedded_outputs_speaker, | |||||
| [batch_size, -1, hp.outputs_per_step * 32])[:, :, :32] | |||||
| embedded_outputs_emotion = tf.reshape( | |||||
| embedded_outputs_emotion, | |||||
| [batch_size, -1, hp.outputs_per_step * 32])[:, :, :32] | |||||
| # [N, T_out, D_LR_outputs] (D_LR_outputs = hp.outputs_per_step * hp.encoder_projection_units + 64) | |||||
| LR_outputs = tf.concat([ | |||||
| LR_outputs, embedded_outputs_speaker, embedded_outputs_emotion | |||||
| ], -1) | |||||
| # auto bandwidth | |||||
| if is_training: | |||||
| durations_mask = tf.cast(durations, | |||||
| tf.float32) * input_mask # [N, T_in] | |||||
| else: | |||||
| durations_mask = duration_outputs_ | |||||
| X_band_width = tf.cast( | |||||
| tf.round(tf.reduce_max(durations_mask) / hp.outputs_per_step), | |||||
| tf.int32) | |||||
| H_band_width = X_band_width | |||||
| with tf.variable_scope('Decoder'): | |||||
| Decoder = SelfAttentionDecoder( | |||||
| num_layers=hp.decoder_num_layers, | |||||
| num_units=hp.decoder_num_units, | |||||
| num_heads=hp.decoder_num_heads, | |||||
| ffn_inner_dim=hp.decoder_ffn_inner_dim, | |||||
| dropout=hp.decoder_dropout, | |||||
| attention_dropout=hp.decoder_attention_dropout, | |||||
| relu_dropout=hp.decoder_relu_dropout, | |||||
| prenet_units=hp.prenet_units, | |||||
| dense_units=hp.prenet_proj_units, | |||||
| num_mels=hp.num_mels, | |||||
| outputs_per_step=hp.outputs_per_step, | |||||
| X_band_width=X_band_width, | |||||
| H_band_width=H_band_width, | |||||
| position_encoder=None) | |||||
| if is_training: | |||||
| if hp.free_run: | |||||
| r = hp.outputs_per_step | |||||
| init_decoder_input = tf.expand_dims( | |||||
| tf.tile([[0.0]], [batch_size, hp.num_mels]), | |||||
| axis=1) # [N, 1, hp.num_mels] | |||||
| decoder_input_lengths = tf.cast( | |||||
| output_lengths / r, tf.int32) | |||||
| decoder_outputs, attention_x, attention_h = Decoder.dynamic_decode_and_search( | |||||
| init_decoder_input, | |||||
| maximum_iterations=tf.shape(LR_outputs)[1], | |||||
| mode=is_training, | |||||
| memory=LR_outputs, | |||||
| memory_sequence_length=decoder_input_lengths) | |||||
| else: | |||||
| r = hp.outputs_per_step | |||||
| decoder_input = mel_targets[:, r - 1:: | |||||
| r, :] # [N, T_out / r, hp.num_mels] | |||||
| init_decoder_input = tf.expand_dims( | |||||
| tf.tile([[0.0]], [batch_size, hp.num_mels]), | |||||
| axis=1) # [N, 1, hp.num_mels] | |||||
| decoder_input = tf.concat( | |||||
| [init_decoder_input, decoder_input], | |||||
| axis=1) # [N, T_out / r + 1, hp.num_mels] | |||||
| decoder_input = decoder_input[:, : | |||||
| -1, :] # [N, T_out / r, hp.num_mels] | |||||
| decoder_input_lengths = tf.cast( | |||||
| output_lengths / r, tf.int32) | |||||
| decoder_outputs, attention_x, attention_h = Decoder.decode_from_inputs( | |||||
| decoder_input, | |||||
| decoder_input_lengths, | |||||
| mode=is_training, | |||||
| memory=LR_outputs, | |||||
| memory_sequence_length=decoder_input_lengths) | |||||
| else: | |||||
| init_decoder_input = tf.expand_dims( | |||||
| tf.tile([[0.0]], [batch_size, hp.num_mels]), | |||||
| axis=1) # [N, 1, hp.num_mels] | |||||
| decoder_outputs, attention_x, attention_h = Decoder.dynamic_decode_and_search( | |||||
| init_decoder_input, | |||||
| maximum_iterations=tf.shape(LR_outputs)[1], | |||||
| mode=is_training, | |||||
| memory=LR_outputs, | |||||
| memory_sequence_length=tf.expand_dims( | |||||
| tf.shape(LR_outputs)[1], axis=0)) | |||||
| if is_training: | |||||
| mel_outputs_ = tf.reshape(decoder_outputs, | |||||
| [batch_size, -1, hp.num_mels]) | |||||
| else: | |||||
| mel_outputs_ = tf.reshape( | |||||
| decoder_outputs, | |||||
| [batch_size, -1, hp.num_mels])[:, :ori_framenum, :] | |||||
| mel_outputs = mel_outputs_ | |||||
| with tf.variable_scope('Postnet'): | |||||
| Postnet_FSMN = FsmnEncoderV2( | |||||
| filter_size=hp.postnet_filter_size, | |||||
| fsmn_num_layers=hp.postnet_fsmn_num_layers, | |||||
| dnn_num_layers=hp.postnet_dnn_num_layers, | |||||
| num_memory_units=hp.postnet_num_memory_units, | |||||
| ffn_inner_dim=hp.postnet_ffn_inner_dim, | |||||
| dropout=hp.postnet_dropout, | |||||
| shift=hp.postnet_shift, | |||||
| position_encoder=None) | |||||
| if is_training: | |||||
| postnet_fsmn_outputs, _, _ = Postnet_FSMN.encode( | |||||
| mel_outputs, | |||||
| sequence_length=output_lengths, | |||||
| mode=is_training) | |||||
| hidden_lstm_outputs, _ = tf.nn.dynamic_rnn( | |||||
| LSTMBlockCell(hp.postnet_lstm_units), | |||||
| postnet_fsmn_outputs, | |||||
| sequence_length=output_lengths, | |||||
| dtype=tf.float32) | |||||
| else: | |||||
| postnet_fsmn_outputs, _, _ = Postnet_FSMN.encode( | |||||
| mel_outputs, | |||||
| sequence_length=[tf.shape(mel_outputs_)[1]], | |||||
| mode=is_training) | |||||
| hidden_lstm_outputs, _ = tf.nn.dynamic_rnn( | |||||
| LSTMBlockCell(hp.postnet_lstm_units), | |||||
| postnet_fsmn_outputs, | |||||
| sequence_length=[tf.shape(mel_outputs_)[1]], | |||||
| dtype=tf.float32) | |||||
| mel_residual_outputs = tf.layers.dense( | |||||
| hidden_lstm_outputs, units=hp.num_mels) | |||||
| mel_outputs += mel_residual_outputs | |||||
| self.inputs = inputs | |||||
| self.inputs_speaker = inputs_speaker | |||||
| self.inputs_emotion = inputs_emotion | |||||
| self.input_lengths = input_lengths | |||||
| self.durations = durations | |||||
| self.output_lengths = output_lengths | |||||
| self.mel_outputs_ = mel_outputs_ | |||||
| self.mel_outputs = mel_outputs | |||||
| self.mel_targets = mel_targets | |||||
| self.duration_outputs = duration_outputs | |||||
| self.duration_outputs_ = duration_outputs_ | |||||
| self.duration_scales = duration_scales | |||||
| self.pitch_contour_outputs = pitch_contour_outputs | |||||
| self.pitch_contours = pitch_contours | |||||
| self.pitch_scales = pitch_scales | |||||
| self.energy_contour_outputs = energy_contour_outputs | |||||
| self.energy_contours = energy_contours | |||||
| self.energy_scales = energy_scales | |||||
| self.uv_masks_ = uv_masks | |||||
| self.embedded_inputs_emotion = embedded_inputs_emotion | |||||
| self.embedding_fsmn_outputs = embedded_inputs | |||||
| self.encoder_outputs = encoder_outputs | |||||
| self.encoder_outputs_ = encoder_outputs_ | |||||
| self.LR_outputs = LR_outputs | |||||
| self.postnet_fsmn_outputs = postnet_fsmn_outputs | |||||
| self.pitch_embeddings = pitch_embeddings | |||||
| self.energy_embeddings = energy_embeddings | |||||
| self.attns = attns | |||||
| self.attention_x = attention_x | |||||
| self.attention_h = attention_h | |||||
| self.X_band_width = X_band_width | |||||
| self.H_band_width = H_band_width | |||||
| def add_loss(self): | |||||
| '''Adds loss to the model. Sets "loss" field. initialize must have been called.''' | |||||
| with tf.variable_scope('loss') as _: | |||||
| hp = self._hparams | |||||
| mask = tf.sequence_mask( | |||||
| self.output_lengths, | |||||
| tf.shape(self.mel_targets)[1], | |||||
| dtype=tf.float32) | |||||
| valid_outputs = tf.reduce_sum(mask) | |||||
| mask_input = tf.sequence_mask( | |||||
| self.input_lengths, | |||||
| tf.shape(self.durations)[1], | |||||
| dtype=tf.float32) | |||||
| valid_inputs = tf.reduce_sum(mask_input) | |||||
| # mel loss | |||||
| if self.uv_masks_ is not None: | |||||
| valid_outputs_mask = tf.reduce_sum( | |||||
| tf.expand_dims(mask, -1) * self.uv_masks_) | |||||
| self.mel_loss_ = tf.reduce_sum( | |||||
| tf.abs(self.mel_targets - self.mel_outputs_) | |||||
| * tf.expand_dims(mask, -1) * self.uv_masks_) / ( | |||||
| valid_outputs_mask * hp.num_mels) | |||||
| self.mel_loss = tf.reduce_sum( | |||||
| tf.abs(self.mel_targets - self.mel_outputs) | |||||
| * tf.expand_dims(mask, -1) * self.uv_masks_) / ( | |||||
| valid_outputs_mask * hp.num_mels) | |||||
| else: | |||||
| self.mel_loss_ = tf.reduce_sum( | |||||
| tf.abs(self.mel_targets - self.mel_outputs_) | |||||
| * tf.expand_dims(mask, -1)) / ( | |||||
| valid_outputs * hp.num_mels) | |||||
| self.mel_loss = tf.reduce_sum( | |||||
| tf.abs(self.mel_targets - self.mel_outputs) | |||||
| * tf.expand_dims(mask, -1)) / ( | |||||
| valid_outputs * hp.num_mels) | |||||
| # duration loss | |||||
| self.duration_loss = tf.reduce_sum( | |||||
| tf.abs( | |||||
| tf.log(tf.cast(self.durations, tf.float32) + 1) | |||||
| - self.duration_outputs) * mask_input) / valid_inputs | |||||
| # pitch contour loss | |||||
| self.pitch_contour_loss = tf.reduce_sum( | |||||
| tf.abs(self.pitch_contours - self.pitch_contour_outputs) | |||||
| * mask_input) / valid_inputs | |||||
| # energy contour loss | |||||
| self.energy_contour_loss = tf.reduce_sum( | |||||
| tf.abs(self.energy_contours - self.energy_contour_outputs) | |||||
| * mask_input) / valid_inputs | |||||
| # final loss | |||||
| self.loss = self.mel_loss_ + self.mel_loss + self.duration_loss \ | |||||
| + self.pitch_contour_loss + self.energy_contour_loss | |||||
| # guided attention loss | |||||
| self.guided_attention_loss = tf.constant(0.0) | |||||
| if hp.guided_attention: | |||||
| i0 = tf.constant(0) | |||||
| loss0 = tf.constant(0.0) | |||||
| def c(i, _): | |||||
| return tf.less(i, tf.shape(mel_targets)[0]) | |||||
| def loop_body(i, loss): | |||||
| decoder_input_lengths = tf.cast( | |||||
| self.output_lengths / hp.outputs_per_step, tf.int32) | |||||
| input_len = decoder_input_lengths[i] | |||||
| output_len = decoder_input_lengths[i] | |||||
| input_w = tf.expand_dims( | |||||
| tf.range(tf.cast(input_len, dtype=tf.float32)), | |||||
| axis=1) / tf.cast( | |||||
| input_len, dtype=tf.float32) # [T_in, 1] | |||||
| output_w = tf.expand_dims( | |||||
| tf.range(tf.cast(output_len, dtype=tf.float32)), | |||||
| axis=0) / tf.cast( | |||||
| output_len, dtype=tf.float32) # [1, T_out] | |||||
| guided_attention_w = 1.0 - tf.exp( | |||||
| -(1 / hp.guided_attention_2g_squared) | |||||
| * tf.square(input_w - output_w)) # [T_in, T_out] | |||||
| guided_attention_w = tf.expand_dims( | |||||
| guided_attention_w, axis=0) # [1, T_in, T_out] | |||||
| # [hp.decoder_num_heads, T_in, T_out] | |||||
| guided_attention_w = tf.tile(guided_attention_w, | |||||
| [hp.decoder_num_heads, 1, 1]) | |||||
| loss_i = tf.constant(0.0) | |||||
| for j in range(hp.decoder_num_layers): | |||||
| loss_i += tf.reduce_mean( | |||||
| self.attention_h[j][i, :, :input_len, :output_len] | |||||
| * guided_attention_w) | |||||
| return [tf.add(i, 1), tf.add(loss, loss_i)] | |||||
| _, loss = tf.while_loop( | |||||
| c, | |||||
| loop_body, | |||||
| loop_vars=[i0, loss0], | |||||
| parallel_iterations=hp.batch_size) | |||||
| self.guided_attention_loss = loss / hp.batch_size | |||||
| self.loss += hp.guided_attention_loss_weight * self.guided_attention_loss | |||||
| def add_optimizer(self, global_step): | |||||
| '''Adds optimizer. Sets "gradients" and "optimize" fields. add_loss must have been called. | |||||
| Args: | |||||
| global_step: int32 scalar Tensor representing current global step in training | |||||
| ''' | |||||
| with tf.variable_scope('optimizer') as _: | |||||
| hp = self._hparams | |||||
| if hp.decay_learning_rate: | |||||
| self.learning_rate = _learning_rate_decay( | |||||
| hp.initial_learning_rate, global_step) | |||||
| else: | |||||
| self.learning_rate = tf.convert_to_tensor( | |||||
| hp.initial_learning_rate) | |||||
| optimizer = tf.train.AdamOptimizer(self.learning_rate, | |||||
| hp.adam_beta1, hp.adam_beta2) | |||||
| gradients, variables = zip(*optimizer.compute_gradients(self.loss)) | |||||
| self.gradients = gradients | |||||
| clipped_gradients, _ = tf.clip_by_global_norm(gradients, 1.0) | |||||
| # Add dependency on UPDATE_OPS; otherwise batchnorm won't work correctly. See: | |||||
| # https://github.com/tensorflow/tensorflow/issues/1122 | |||||
| with tf.control_dependencies( | |||||
| tf.get_collection(tf.GraphKeys.UPDATE_OPS)): | |||||
| self.optimize = optimizer.apply_gradients( | |||||
| zip(clipped_gradients, variables), global_step=global_step) | |||||
| def _learning_rate_decay(init_lr, global_step): | |||||
| # Noam scheme from tensor2tensor: | |||||
| warmup_steps = 4000.0 | |||||
| step = tf.cast(global_step + 1, dtype=tf.float32) | |||||
| return init_lr * warmup_steps**0.5 * tf.minimum(step * warmup_steps**-1.5, | |||||
| step**-0.5) | |||||
| @@ -0,0 +1,817 @@ | |||||
| """Define self-attention decoder.""" | |||||
| import sys | |||||
| import tensorflow as tf | |||||
| from . import compat, transformer | |||||
| from .modules import decoder_prenet | |||||
| from .position import SinusoidalPositionEncoder | |||||
| class SelfAttentionDecoder(): | |||||
| """Decoder using self-attention as described in | |||||
| https://arxiv.org/abs/1706.03762. | |||||
| """ | |||||
| def __init__(self, | |||||
| num_layers, | |||||
| num_units=512, | |||||
| num_heads=8, | |||||
| ffn_inner_dim=2048, | |||||
| dropout=0.1, | |||||
| attention_dropout=0.1, | |||||
| relu_dropout=0.1, | |||||
| prenet_units=256, | |||||
| dense_units=128, | |||||
| num_mels=80, | |||||
| outputs_per_step=3, | |||||
| X_band_width=None, | |||||
| H_band_width=None, | |||||
| position_encoder=SinusoidalPositionEncoder(), | |||||
| self_attention_type='scaled_dot'): | |||||
| """Initializes the parameters of the decoder. | |||||
| Args: | |||||
| num_layers: The number of layers. | |||||
| num_units: The number of hidden units. | |||||
| num_heads: The number of heads in the multi-head attention. | |||||
| ffn_inner_dim: The number of units of the inner linear transformation | |||||
| in the feed forward layer. | |||||
| dropout: The probability to drop units from the outputs. | |||||
| attention_dropout: The probability to drop units from the attention. | |||||
| relu_dropout: The probability to drop units from the ReLU activation in | |||||
| the feed forward layer. | |||||
| position_encoder: A :class:`opennmt.layers.position.PositionEncoder` to | |||||
| apply on inputs or ``None``. | |||||
| self_attention_type: Type of self attention, "scaled_dot" or "average" (case | |||||
| insensitive). | |||||
| Raises: | |||||
| ValueError: if :obj:`self_attention_type` is invalid. | |||||
| """ | |||||
| super(SelfAttentionDecoder, self).__init__() | |||||
| self.num_layers = num_layers | |||||
| self.num_units = num_units | |||||
| self.num_heads = num_heads | |||||
| self.ffn_inner_dim = ffn_inner_dim | |||||
| self.dropout = dropout | |||||
| self.attention_dropout = attention_dropout | |||||
| self.relu_dropout = relu_dropout | |||||
| self.position_encoder = position_encoder | |||||
| self.self_attention_type = self_attention_type.lower() | |||||
| if self.self_attention_type not in ('scaled_dot', 'average'): | |||||
| raise ValueError('invalid attention type %s' | |||||
| % self.self_attention_type) | |||||
| if self.self_attention_type == 'average': | |||||
| tf.logging.warning( | |||||
| 'Support for average attention network is experimental ' | |||||
| 'and may change in future versions.') | |||||
| self.prenet_units = prenet_units | |||||
| self.dense_units = dense_units | |||||
| self.num_mels = num_mels | |||||
| self.outputs_per_step = outputs_per_step | |||||
| self.X_band_width = X_band_width | |||||
| self.H_band_width = H_band_width | |||||
| @property | |||||
| def output_size(self): | |||||
| """Returns the decoder output size.""" | |||||
| return self.num_units | |||||
| @property | |||||
| def support_alignment_history(self): | |||||
| return True | |||||
| @property | |||||
| def support_multi_source(self): | |||||
| return True | |||||
| def _init_cache(self, batch_size, dtype=tf.float32, num_sources=1): | |||||
| cache = {} | |||||
| for layer in range(self.num_layers): | |||||
| proj_cache_shape = [ | |||||
| batch_size, self.num_heads, 0, self.num_units // self.num_heads | |||||
| ] | |||||
| layer_cache = {} | |||||
| layer_cache['memory'] = [{ | |||||
| 'memory_keys': | |||||
| tf.zeros(proj_cache_shape, dtype=dtype), | |||||
| 'memory_values': | |||||
| tf.zeros(proj_cache_shape, dtype=dtype) | |||||
| } for _ in range(num_sources)] | |||||
| if self.self_attention_type == 'scaled_dot': | |||||
| layer_cache['self_keys'] = tf.zeros( | |||||
| proj_cache_shape, dtype=dtype) | |||||
| layer_cache['self_values'] = tf.zeros( | |||||
| proj_cache_shape, dtype=dtype) | |||||
| elif self.self_attention_type == 'average': | |||||
| layer_cache['prev_g'] = tf.zeros( | |||||
| [batch_size, 1, self.num_units], dtype=dtype) | |||||
| cache['layer_{}'.format(layer)] = layer_cache | |||||
| return cache | |||||
| def _init_attn(self, dtype=tf.float32): | |||||
| attn = [] | |||||
| for layer in range(self.num_layers): | |||||
| attn.append(tf.TensorArray(tf.float32, size=0, dynamic_size=True)) | |||||
| return attn | |||||
| def _self_attention_stack(self, | |||||
| inputs, | |||||
| sequence_length=None, | |||||
| mode=True, | |||||
| cache=None, | |||||
| memory=None, | |||||
| memory_sequence_length=None, | |||||
| step=None): | |||||
| # [N, T_out, self.dense_units] or [N, 1, self.dense_units] | |||||
| prenet_outputs = decoder_prenet(inputs, self.prenet_units, | |||||
| self.dense_units, mode) | |||||
| if step is None: | |||||
| decoder_inputs = tf.concat( | |||||
| [memory, prenet_outputs], | |||||
| axis=-1) # [N, T_out, memory_size + self.dense_units] | |||||
| else: | |||||
| decoder_inputs = tf.concat( | |||||
| [memory[:, step:step + 1, :], prenet_outputs], | |||||
| axis=-1) # [N, 1, memory_size + self.dense_units] | |||||
| decoder_inputs = tf.layers.dense( | |||||
| decoder_inputs, units=self.dense_units) | |||||
| inputs = decoder_inputs | |||||
| inputs *= self.num_units**0.5 | |||||
| if self.position_encoder is not None: | |||||
| inputs = self.position_encoder( | |||||
| inputs, position=step + 1 if step is not None else None) | |||||
| inputs = tf.layers.dropout(inputs, rate=self.dropout, training=mode) | |||||
| decoder_mask = None | |||||
| memory_mask = None | |||||
| # last_attention = None | |||||
| X_band_width_tmp = -1 | |||||
| H_band_width_tmp = -1 | |||||
| if self.X_band_width is not None: | |||||
| X_band_width_tmp = tf.cast( | |||||
| tf.cond( | |||||
| tf.less(tf.shape(memory)[1], self.X_band_width), | |||||
| lambda: -1, lambda: self.X_band_width), | |||||
| dtype=tf.int64) | |||||
| if self.H_band_width is not None: | |||||
| H_band_width_tmp = tf.cast( | |||||
| tf.cond( | |||||
| tf.less(tf.shape(memory)[1], self.H_band_width), | |||||
| lambda: -1, lambda: self.H_band_width), | |||||
| dtype=tf.int64) | |||||
| if self.self_attention_type == 'scaled_dot': | |||||
| if sequence_length is not None: | |||||
| decoder_mask = transformer.build_future_mask( | |||||
| sequence_length, | |||||
| num_heads=self.num_heads, | |||||
| maximum_length=tf.shape(inputs)[1], | |||||
| band=X_band_width_tmp) # [N, 1, T_out, T_out] | |||||
| elif self.self_attention_type == 'average': | |||||
| if cache is None: | |||||
| if sequence_length is None: | |||||
| sequence_length = tf.fill([tf.shape(inputs)[0]], | |||||
| tf.shape(inputs)[1]) | |||||
| decoder_mask = transformer.cumulative_average_mask( | |||||
| sequence_length, | |||||
| maximum_length=tf.shape(inputs)[1], | |||||
| dtype=inputs.dtype) | |||||
| if memory is not None and not tf.contrib.framework.nest.is_sequence( | |||||
| memory): | |||||
| memory = (memory, ) | |||||
| if memory_sequence_length is not None: | |||||
| if not tf.contrib.framework.nest.is_sequence( | |||||
| memory_sequence_length): | |||||
| memory_sequence_length = (memory_sequence_length, ) | |||||
| if step is None: | |||||
| memory_mask = [ | |||||
| transformer.build_history_mask( | |||||
| length, | |||||
| num_heads=self.num_heads, | |||||
| maximum_length=tf.shape(m)[1], | |||||
| band=H_band_width_tmp) | |||||
| for m, length in zip(memory, memory_sequence_length) | |||||
| ] | |||||
| else: | |||||
| memory_mask = [ | |||||
| transformer.build_history_mask( | |||||
| length, | |||||
| num_heads=self.num_heads, | |||||
| maximum_length=tf.shape(m)[1], | |||||
| band=H_band_width_tmp)[:, :, step:step + 1, :] | |||||
| for m, length in zip(memory, memory_sequence_length) | |||||
| ] | |||||
| # last_attention = None | |||||
| attns_x = [] | |||||
| attns_h = [] | |||||
| for layer in range(self.num_layers): | |||||
| layer_name = 'layer_{}'.format(layer) | |||||
| layer_cache = cache[layer_name] if cache is not None else None | |||||
| with tf.variable_scope(layer_name): | |||||
| if memory is not None: | |||||
| for i, (mem, mask) in enumerate(zip(memory, memory_mask)): | |||||
| memory_cache = None | |||||
| if layer_cache is not None: | |||||
| memory_cache = layer_cache['memory'][i] | |||||
| scope_name = 'multi_head_{}'.format(i) | |||||
| if i == 0: | |||||
| scope_name = 'multi_head' | |||||
| with tf.variable_scope(scope_name): | |||||
| encoded, attn_x, attn_h = transformer.multi_head_attention_PNCA( | |||||
| self.num_heads, | |||||
| transformer.norm(inputs), | |||||
| mem, | |||||
| mode, | |||||
| num_units=self.num_units, | |||||
| mask=decoder_mask, | |||||
| mask_h=mask, | |||||
| cache=layer_cache, | |||||
| cache_h=memory_cache, | |||||
| dropout=self.attention_dropout, | |||||
| return_attention=True, | |||||
| layer_name=layer_name, | |||||
| X_band_width=self.X_band_width) | |||||
| attns_x.append(attn_x) | |||||
| attns_h.append(attn_h) | |||||
| context = transformer.drop_and_add( | |||||
| inputs, encoded, mode, dropout=self.dropout) | |||||
| with tf.variable_scope('ffn'): | |||||
| transformed = transformer.feed_forward_ori( | |||||
| transformer.norm(context), | |||||
| self.ffn_inner_dim, | |||||
| mode, | |||||
| dropout=self.relu_dropout) | |||||
| transformed = transformer.drop_and_add( | |||||
| context, transformed, mode, dropout=self.dropout) | |||||
| inputs = transformed | |||||
| outputs = transformer.norm(inputs) | |||||
| outputs = tf.layers.dense( | |||||
| outputs, units=self.num_mels * self.outputs_per_step) | |||||
| return outputs, attns_x, attns_h | |||||
| def decode_from_inputs(self, | |||||
| inputs, | |||||
| sequence_length, | |||||
| initial_state=None, | |||||
| mode=True, | |||||
| memory=None, | |||||
| memory_sequence_length=None): | |||||
| outputs, attention_x, attention_h = self._self_attention_stack( | |||||
| inputs, | |||||
| sequence_length=sequence_length, | |||||
| mode=mode, | |||||
| memory=memory, | |||||
| memory_sequence_length=memory_sequence_length) | |||||
| return outputs, attention_x, attention_h | |||||
| def step_fn(self, | |||||
| mode, | |||||
| batch_size, | |||||
| initial_state=None, | |||||
| memory=None, | |||||
| memory_sequence_length=None, | |||||
| dtype=tf.float32): | |||||
| if memory is None: | |||||
| num_sources = 0 | |||||
| elif tf.contrib.framework.nest.is_sequence(memory): | |||||
| num_sources = len(memory) | |||||
| else: | |||||
| num_sources = 1 | |||||
| cache = self._init_cache( | |||||
| batch_size, dtype=dtype, num_sources=num_sources) | |||||
| attention_x = self._init_attn(dtype=dtype) | |||||
| attention_h = self._init_attn(dtype=dtype) | |||||
| def _fn(step, inputs, cache): | |||||
| outputs, attention_x, attention_h = self._self_attention_stack( | |||||
| inputs, | |||||
| mode=mode, | |||||
| cache=cache, | |||||
| memory=memory, | |||||
| memory_sequence_length=memory_sequence_length, | |||||
| step=step) | |||||
| attention_x_tmp = [] | |||||
| for layer in range(len(attention_h)): | |||||
| attention_x_tmp_l = tf.zeros_like(attention_h[layer]) | |||||
| if self.X_band_width is not None: | |||||
| pred = tf.less(step, self.X_band_width + 1) | |||||
| attention_x_tmp_l_1 = tf.cond(pred, # yapf:disable | |||||
| lambda: attention_x_tmp_l[:, :, :, :step + 1] + attention_x[layer], | |||||
| lambda: tf.concat([ | |||||
| attention_x_tmp_l[:, :, :, | |||||
| :step - self.X_band_width], | |||||
| attention_x_tmp_l[:, :, :, | |||||
| step - self.X_band_width:step + 1] | |||||
| + attention_x[layer]], | |||||
| axis=-1)) # yapf:disable | |||||
| attention_x_tmp_l_2 = attention_x_tmp_l[:, :, :, step + 1:] | |||||
| attention_x_tmp.append( | |||||
| tf.concat([attention_x_tmp_l_1, attention_x_tmp_l_2], | |||||
| axis=-1)) | |||||
| else: | |||||
| attention_x_tmp_l_1 = attention_x_tmp_l[:, :, :, :step + 1] | |||||
| attention_x_tmp_l_2 = attention_x_tmp_l[:, :, :, step + 1:] | |||||
| attention_x_tmp.append( | |||||
| tf.concat([ | |||||
| attention_x_tmp_l_1 + attention_x[layer], | |||||
| attention_x_tmp_l_2 | |||||
| ], axis=-1)) # yapf:disable | |||||
| attention_x = attention_x_tmp | |||||
| return outputs, cache, attention_x, attention_h | |||||
| return _fn, cache, attention_x, attention_h | |||||
| def dynamic_decode_and_search(self, init_decoder_input, maximum_iterations, | |||||
| mode, memory, memory_sequence_length): | |||||
| batch_size = tf.shape(init_decoder_input)[0] | |||||
| step_fn, init_cache, init_attn_x, init_attn_h = self.step_fn( | |||||
| mode, | |||||
| batch_size, | |||||
| memory=memory, | |||||
| memory_sequence_length=memory_sequence_length) | |||||
| outputs, attention_x, attention_h, cache = self.dynamic_decode( | |||||
| step_fn, | |||||
| init_decoder_input, | |||||
| init_cache=init_cache, | |||||
| init_attn_x=init_attn_x, | |||||
| init_attn_h=init_attn_h, | |||||
| maximum_iterations=maximum_iterations, | |||||
| batch_size=batch_size) | |||||
| return outputs, attention_x, attention_h | |||||
| def dynamic_decode_and_search_teacher_forcing(self, decoder_input, | |||||
| maximum_iterations, mode, | |||||
| memory, | |||||
| memory_sequence_length): | |||||
| batch_size = tf.shape(decoder_input)[0] | |||||
| step_fn, init_cache, init_attn_x, init_attn_h = self.step_fn( | |||||
| mode, | |||||
| batch_size, | |||||
| memory=memory, | |||||
| memory_sequence_length=memory_sequence_length) | |||||
| outputs, attention_x, attention_h, cache = self.dynamic_decode_teacher_forcing( | |||||
| step_fn, | |||||
| decoder_input, | |||||
| init_cache=init_cache, | |||||
| init_attn_x=init_attn_x, | |||||
| init_attn_h=init_attn_h, | |||||
| maximum_iterations=maximum_iterations, | |||||
| batch_size=batch_size) | |||||
| return outputs, attention_x, attention_h | |||||
| def dynamic_decode(self, | |||||
| step_fn, | |||||
| init_decoder_input, | |||||
| init_cache=None, | |||||
| init_attn_x=None, | |||||
| init_attn_h=None, | |||||
| maximum_iterations=None, | |||||
| batch_size=None): | |||||
| def _cond(step, cache, inputs, outputs, attention_x, attention_h): # pylint: disable=unused-argument | |||||
| return tf.less(step, maximum_iterations) | |||||
| def _body(step, cache, inputs, outputs, attention_x, attention_h): | |||||
| # output: [1, 1, num_mels * r] | |||||
| # attn: [1, 1, T_out] | |||||
| output, cache, attn_x, attn_h = step_fn( | |||||
| step, inputs, cache) # outputs, cache, attention, attns | |||||
| for layer in range(len(attention_x)): | |||||
| attention_x[layer] = attention_x[layer].write( | |||||
| step, tf.cast(attn_x[layer], tf.float32)) | |||||
| for layer in range(len(attention_h)): | |||||
| attention_h[layer] = attention_h[layer].write( | |||||
| step, tf.cast(attn_h[layer], tf.float32)) | |||||
| outputs = outputs.write(step, tf.cast(output, tf.float32)) | |||||
| return step + 1, cache, output[:, :, -self. | |||||
| num_mels:], outputs, attention_x, attention_h | |||||
| step = tf.constant(0, dtype=tf.int32) | |||||
| outputs = tf.TensorArray(tf.float32, size=0, dynamic_size=True) | |||||
| _, cache, _, outputs, attention_x, attention_h = tf.while_loop( | |||||
| _cond, | |||||
| _body, | |||||
| loop_vars=(step, init_cache, init_decoder_input, outputs, | |||||
| init_attn_x, init_attn_h), | |||||
| shape_invariants=(step.shape, | |||||
| compat.nest.map_structure( | |||||
| self._get_shape_invariants, init_cache), | |||||
| compat.nest.map_structure( | |||||
| self._get_shape_invariants, | |||||
| init_decoder_input), tf.TensorShape(None), | |||||
| compat.nest.map_structure( | |||||
| self._get_shape_invariants, init_attn_x), | |||||
| compat.nest.map_structure( | |||||
| self._get_shape_invariants, init_attn_h)), | |||||
| parallel_iterations=1, | |||||
| back_prop=False, | |||||
| maximum_iterations=maximum_iterations) | |||||
| # element of outputs: [N, 1, num_mels * r] | |||||
| outputs_stack = outputs.stack() # [T_out, N, 1, num_mels * r] | |||||
| outputs_stack = tf.transpose( | |||||
| outputs_stack, perm=[2, 1, 0, 3]) # [1, N, T_out, num_mels * r] | |||||
| outputs_stack = tf.squeeze( | |||||
| outputs_stack, axis=0) # [N, T_out, num_mels * r] | |||||
| attention_x_stack = [] | |||||
| for layer in range(len(attention_x)): | |||||
| attention_x_stack_tmp = attention_x[layer].stack( | |||||
| ) # [T_out, N, H, 1, T_out] | |||||
| attention_x_stack_tmp = tf.transpose( | |||||
| attention_x_stack_tmp, perm=[3, 1, 2, 0, | |||||
| 4]) # [1, N, H, T_out, T_out] | |||||
| attention_x_stack_tmp = tf.squeeze( | |||||
| attention_x_stack_tmp, axis=0) # [N, H, T_out, T_out] | |||||
| attention_x_stack.append(attention_x_stack_tmp) | |||||
| attention_h_stack = [] | |||||
| for layer in range(len(attention_h)): | |||||
| attention_h_stack_tmp = attention_h[layer].stack( | |||||
| ) # [T_out, N, H, 1, T_out] | |||||
| attention_h_stack_tmp = tf.transpose( | |||||
| attention_h_stack_tmp, perm=[3, 1, 2, 0, | |||||
| 4]) # [1, N, H, T_out, T_out] | |||||
| attention_h_stack_tmp = tf.squeeze( | |||||
| attention_h_stack_tmp, axis=0) # [N, H, T_out, T_out] | |||||
| attention_h_stack.append(attention_h_stack_tmp) | |||||
| return outputs_stack, attention_x_stack, attention_h_stack, cache | |||||
| def dynamic_decode_teacher_forcing(self, | |||||
| step_fn, | |||||
| decoder_input, | |||||
| init_cache=None, | |||||
| init_attn_x=None, | |||||
| init_attn_h=None, | |||||
| maximum_iterations=None, | |||||
| batch_size=None): | |||||
| def _cond(step, cache, inputs, outputs, attention_x, attention_h): # pylint: disable=unused-argument | |||||
| return tf.less(step, maximum_iterations) | |||||
| def _body(step, cache, inputs, outputs, attention_x, attention_h): | |||||
| # output: [1, 1, num_mels * r] | |||||
| # attn: [1, 1, T_out] | |||||
| output, cache, attn_x, attn_h = step_fn( | |||||
| step, inputs[:, step:step + 1, :], | |||||
| cache) # outputs, cache, attention, attns | |||||
| for layer in range(len(attention_x)): | |||||
| attention_x[layer] = attention_x[layer].write( | |||||
| step, tf.cast(attn_x[layer], tf.float32)) | |||||
| for layer in range(len(attention_h)): | |||||
| attention_h[layer] = attention_h[layer].write( | |||||
| step, tf.cast(attn_h[layer], tf.float32)) | |||||
| outputs = outputs.write(step, tf.cast(output, tf.float32)) | |||||
| return step + 1, cache, inputs, outputs, attention_x, attention_h | |||||
| step = tf.constant(0, dtype=tf.int32) | |||||
| outputs = tf.TensorArray(tf.float32, size=0, dynamic_size=True) | |||||
| _, cache, _, outputs, attention_x, attention_h = tf.while_loop( | |||||
| _cond, | |||||
| _body, | |||||
| loop_vars=(step, init_cache, decoder_input, outputs, init_attn_x, | |||||
| init_attn_h), | |||||
| shape_invariants=(step.shape, | |||||
| compat.nest.map_structure( | |||||
| self._get_shape_invariants, | |||||
| init_cache), decoder_input.shape, | |||||
| tf.TensorShape(None), | |||||
| compat.nest.map_structure( | |||||
| self._get_shape_invariants, init_attn_x), | |||||
| compat.nest.map_structure( | |||||
| self._get_shape_invariants, init_attn_h)), | |||||
| parallel_iterations=1, | |||||
| back_prop=False, | |||||
| maximum_iterations=maximum_iterations) | |||||
| # element of outputs: [N, 1, num_mels * r] | |||||
| outputs_stack = outputs.stack() # [T_out, N, 1, num_mels * r] | |||||
| outputs_stack = tf.transpose( | |||||
| outputs_stack, perm=[2, 1, 0, 3]) # [1, N, T_out, num_mels * r] | |||||
| outputs_stack = tf.squeeze( | |||||
| outputs_stack, axis=0) # [N, T_out, num_mels * r] | |||||
| attention_x_stack = [] | |||||
| for layer in range(len(attention_x)): | |||||
| attention_x_stack_tmp = attention_x[layer].stack( | |||||
| ) # [T_out, N, H, 1, T_out] | |||||
| attention_x_stack_tmp = tf.transpose( | |||||
| attention_x_stack_tmp, perm=[3, 1, 2, 0, | |||||
| 4]) # [1, N, H, T_out, T_out] | |||||
| attention_x_stack_tmp = tf.squeeze( | |||||
| attention_x_stack_tmp, axis=0) # [N, H, T_out, T_out] | |||||
| attention_x_stack.append(attention_x_stack_tmp) | |||||
| attention_h_stack = [] | |||||
| for layer in range(len(attention_h)): | |||||
| attention_h_stack_tmp = attention_h[layer].stack( | |||||
| ) # [T_out, N, H, 1, T_out] | |||||
| attention_h_stack_tmp = tf.transpose( | |||||
| attention_h_stack_tmp, perm=[3, 1, 2, 0, | |||||
| 4]) # [1, N, H, T_out, T_out] | |||||
| attention_h_stack_tmp = tf.squeeze( | |||||
| attention_h_stack_tmp, axis=0) # [N, H, T_out, T_out] | |||||
| attention_h_stack.append(attention_h_stack_tmp) | |||||
| return outputs_stack, attention_x_stack, attention_h_stack, cache | |||||
| def _get_shape_invariants(self, tensor): | |||||
| """Returns the shape of the tensor but sets middle dims to None.""" | |||||
| if isinstance(tensor, tf.TensorArray): | |||||
| shape = None | |||||
| else: | |||||
| shape = tensor.shape.as_list() | |||||
| for i in range(1, len(shape) - 1): | |||||
| shape[i] = None | |||||
| return tf.TensorShape(shape) | |||||
| class SelfAttentionDecoderOri(): | |||||
| """Decoder using self-attention as described in | |||||
| https://arxiv.org/abs/1706.03762. | |||||
| """ | |||||
| def __init__(self, | |||||
| num_layers, | |||||
| num_units=512, | |||||
| num_heads=8, | |||||
| ffn_inner_dim=2048, | |||||
| dropout=0.1, | |||||
| attention_dropout=0.1, | |||||
| relu_dropout=0.1, | |||||
| position_encoder=SinusoidalPositionEncoder(), | |||||
| self_attention_type='scaled_dot'): | |||||
| """Initializes the parameters of the decoder. | |||||
| Args: | |||||
| num_layers: The number of layers. | |||||
| num_units: The number of hidden units. | |||||
| num_heads: The number of heads in the multi-head attention. | |||||
| ffn_inner_dim: The number of units of the inner linear transformation | |||||
| in the feed forward layer. | |||||
| dropout: The probability to drop units from the outputs. | |||||
| attention_dropout: The probability to drop units from the attention. | |||||
| relu_dropout: The probability to drop units from the ReLU activation in | |||||
| the feed forward layer. | |||||
| position_encoder: A :class:`opennmt.layers.position.PositionEncoder` to | |||||
| apply on inputs or ``None``. | |||||
| self_attention_type: Type of self attention, "scaled_dot" or "average" (case | |||||
| insensitive). | |||||
| Raises: | |||||
| ValueError: if :obj:`self_attention_type` is invalid. | |||||
| """ | |||||
| super(SelfAttentionDecoderOri, self).__init__() | |||||
| self.num_layers = num_layers | |||||
| self.num_units = num_units | |||||
| self.num_heads = num_heads | |||||
| self.ffn_inner_dim = ffn_inner_dim | |||||
| self.dropout = dropout | |||||
| self.attention_dropout = attention_dropout | |||||
| self.relu_dropout = relu_dropout | |||||
| self.position_encoder = position_encoder | |||||
| self.self_attention_type = self_attention_type.lower() | |||||
| if self.self_attention_type not in ('scaled_dot', 'average'): | |||||
| raise ValueError('invalid attention type %s' | |||||
| % self.self_attention_type) | |||||
| if self.self_attention_type == 'average': | |||||
| tf.logging.warning( | |||||
| 'Support for average attention network is experimental ' | |||||
| 'and may change in future versions.') | |||||
| @property | |||||
| def output_size(self): | |||||
| """Returns the decoder output size.""" | |||||
| return self.num_units | |||||
| @property | |||||
| def support_alignment_history(self): | |||||
| return True | |||||
| @property | |||||
| def support_multi_source(self): | |||||
| return True | |||||
| def _init_cache(self, batch_size, dtype=tf.float32, num_sources=1): | |||||
| cache = {} | |||||
| for layer in range(self.num_layers): | |||||
| proj_cache_shape = [ | |||||
| batch_size, self.num_heads, 0, self.num_units // self.num_heads | |||||
| ] | |||||
| layer_cache = {} | |||||
| layer_cache['memory'] = [{ | |||||
| 'memory_keys': | |||||
| tf.zeros(proj_cache_shape, dtype=dtype), | |||||
| 'memory_values': | |||||
| tf.zeros(proj_cache_shape, dtype=dtype) | |||||
| } for _ in range(num_sources)] | |||||
| if self.self_attention_type == 'scaled_dot': | |||||
| layer_cache['self_keys'] = tf.zeros( | |||||
| proj_cache_shape, dtype=dtype) | |||||
| layer_cache['self_values'] = tf.zeros( | |||||
| proj_cache_shape, dtype=dtype) | |||||
| elif self.self_attention_type == 'average': | |||||
| layer_cache['prev_g'] = tf.zeros( | |||||
| [batch_size, 1, self.num_units], dtype=dtype) | |||||
| cache['layer_{}'.format(layer)] = layer_cache | |||||
| return cache | |||||
| def _self_attention_stack(self, | |||||
| inputs, | |||||
| sequence_length=None, | |||||
| mode=True, | |||||
| cache=None, | |||||
| memory=None, | |||||
| memory_sequence_length=None, | |||||
| step=None): | |||||
| inputs *= self.num_units**0.5 | |||||
| if self.position_encoder is not None: | |||||
| inputs = self.position_encoder( | |||||
| inputs, position=step + 1 if step is not None else None) | |||||
| inputs = tf.layers.dropout(inputs, rate=self.dropout, training=mode) | |||||
| decoder_mask = None | |||||
| memory_mask = None | |||||
| last_attention = None | |||||
| if self.self_attention_type == 'scaled_dot': | |||||
| if sequence_length is not None: | |||||
| decoder_mask = transformer.build_future_mask( | |||||
| sequence_length, | |||||
| num_heads=self.num_heads, | |||||
| maximum_length=tf.shape(inputs)[1]) | |||||
| elif self.self_attention_type == 'average': | |||||
| if cache is None: | |||||
| if sequence_length is None: | |||||
| sequence_length = tf.fill([tf.shape(inputs)[0]], | |||||
| tf.shape(inputs)[1]) | |||||
| decoder_mask = transformer.cumulative_average_mask( | |||||
| sequence_length, | |||||
| maximum_length=tf.shape(inputs)[1], | |||||
| dtype=inputs.dtype) | |||||
| if memory is not None and not tf.contrib.framework.nest.is_sequence( | |||||
| memory): | |||||
| memory = (memory, ) | |||||
| if memory_sequence_length is not None: | |||||
| if not tf.contrib.framework.nest.is_sequence( | |||||
| memory_sequence_length): | |||||
| memory_sequence_length = (memory_sequence_length, ) | |||||
| memory_mask = [ | |||||
| transformer.build_sequence_mask( | |||||
| length, | |||||
| num_heads=self.num_heads, | |||||
| maximum_length=tf.shape(m)[1]) | |||||
| for m, length in zip(memory, memory_sequence_length) | |||||
| ] | |||||
| for layer in range(self.num_layers): | |||||
| layer_name = 'layer_{}'.format(layer) | |||||
| layer_cache = cache[layer_name] if cache is not None else None | |||||
| with tf.variable_scope(layer_name): | |||||
| if self.self_attention_type == 'scaled_dot': | |||||
| with tf.variable_scope('masked_multi_head'): | |||||
| encoded = transformer.multi_head_attention( | |||||
| self.num_heads, | |||||
| transformer.norm(inputs), | |||||
| None, | |||||
| mode, | |||||
| num_units=self.num_units, | |||||
| mask=decoder_mask, | |||||
| cache=layer_cache, | |||||
| dropout=self.attention_dropout) | |||||
| last_context = transformer.drop_and_add( | |||||
| inputs, encoded, mode, dropout=self.dropout) | |||||
| elif self.self_attention_type == 'average': | |||||
| with tf.variable_scope('average_attention'): | |||||
| # Cumulative average. | |||||
| x = transformer.norm(inputs) | |||||
| y = transformer.cumulative_average( | |||||
| x, | |||||
| decoder_mask if cache is None else step, | |||||
| cache=layer_cache) | |||||
| # FFN. | |||||
| y = transformer.feed_forward( | |||||
| y, | |||||
| self.ffn_inner_dim, | |||||
| mode, | |||||
| dropout=self.relu_dropout) | |||||
| # Gating layer. | |||||
| z = tf.layers.dense( | |||||
| tf.concat([x, y], -1), self.num_units * 2) | |||||
| i, f = tf.split(z, 2, axis=-1) | |||||
| y = tf.sigmoid(i) * x + tf.sigmoid(f) * y | |||||
| last_context = transformer.drop_and_add( | |||||
| inputs, y, mode, dropout=self.dropout) | |||||
| if memory is not None: | |||||
| for i, (mem, mask) in enumerate(zip(memory, memory_mask)): | |||||
| memory_cache = layer_cache['memory'][i] if layer_cache is not None else None # yapf:disable | |||||
| with tf.variable_scope('multi_head' if i | |||||
| == 0 else 'multi_head_%d' % i): # yapf:disable | |||||
| context, last_attention = transformer.multi_head_attention( | |||||
| self.num_heads, | |||||
| transformer.norm(last_context), | |||||
| mem, | |||||
| mode, | |||||
| mask=mask, | |||||
| cache=memory_cache, | |||||
| dropout=self.attention_dropout, | |||||
| return_attention=True) | |||||
| last_context = transformer.drop_and_add( | |||||
| last_context, | |||||
| context, | |||||
| mode, | |||||
| dropout=self.dropout) | |||||
| if i > 0: # Do not return attention in case of multi source. | |||||
| last_attention = None | |||||
| with tf.variable_scope('ffn'): | |||||
| transformed = transformer.feed_forward_ori( | |||||
| transformer.norm(last_context), | |||||
| self.ffn_inner_dim, | |||||
| mode, | |||||
| dropout=self.relu_dropout) | |||||
| transformed = transformer.drop_and_add( | |||||
| last_context, transformed, mode, dropout=self.dropout) | |||||
| inputs = transformed | |||||
| if last_attention is not None: | |||||
| # The first head of the last layer is returned. | |||||
| first_head_attention = last_attention[:, 0] | |||||
| else: | |||||
| first_head_attention = None | |||||
| outputs = transformer.norm(inputs) | |||||
| return outputs, first_head_attention | |||||
| def decode_from_inputs(self, | |||||
| inputs, | |||||
| sequence_length, | |||||
| initial_state=None, | |||||
| mode=True, | |||||
| memory=None, | |||||
| memory_sequence_length=None): | |||||
| outputs, attention = self._self_attention_stack( | |||||
| inputs, | |||||
| sequence_length=sequence_length, | |||||
| mode=mode, | |||||
| memory=memory, | |||||
| memory_sequence_length=memory_sequence_length) | |||||
| return outputs, None, attention | |||||
| def step_fn(self, | |||||
| mode, | |||||
| batch_size, | |||||
| initial_state=None, | |||||
| memory=None, | |||||
| memory_sequence_length=None, | |||||
| dtype=tf.float32): | |||||
| if memory is None: | |||||
| num_sources = 0 | |||||
| elif tf.contrib.framework.nest.is_sequence(memory): | |||||
| num_sources = len(memory) | |||||
| else: | |||||
| num_sources = 1 | |||||
| cache = self._init_cache( | |||||
| batch_size, dtype=dtype, num_sources=num_sources) | |||||
| def _fn(step, inputs, cache, mode): | |||||
| inputs = tf.expand_dims(inputs, 1) | |||||
| outputs, attention = self._self_attention_stack( | |||||
| inputs, | |||||
| mode=mode, | |||||
| cache=cache, | |||||
| memory=memory, | |||||
| memory_sequence_length=memory_sequence_length, | |||||
| step=step) | |||||
| outputs = tf.squeeze(outputs, axis=1) | |||||
| if attention is not None: | |||||
| attention = tf.squeeze(attention, axis=1) | |||||
| return outputs, cache, attention | |||||
| return _fn, cache | |||||
| @@ -0,0 +1,182 @@ | |||||
| """Define the self-attention encoder.""" | |||||
| import tensorflow as tf | |||||
| from . import transformer | |||||
| from .position import SinusoidalPositionEncoder | |||||
| class SelfAttentionEncoder(): | |||||
| """Encoder using self-attention as described in | |||||
| https://arxiv.org/abs/1706.03762. | |||||
| """ | |||||
| def __init__(self, | |||||
| num_layers, | |||||
| num_units=512, | |||||
| num_heads=8, | |||||
| ffn_inner_dim=2048, | |||||
| dropout=0.1, | |||||
| attention_dropout=0.1, | |||||
| relu_dropout=0.1, | |||||
| position_encoder=SinusoidalPositionEncoder()): | |||||
| """Initializes the parameters of the encoder. | |||||
| Args: | |||||
| num_layers: The number of layers. | |||||
| num_units: The number of hidden units. | |||||
| num_heads: The number of heads in the multi-head attention. | |||||
| ffn_inner_dim: The number of units of the inner linear transformation | |||||
| in the feed forward layer. | |||||
| dropout: The probability to drop units from the outputs. | |||||
| attention_dropout: The probability to drop units from the attention. | |||||
| relu_dropout: The probability to drop units from the ReLU activation in | |||||
| the feed forward layer. | |||||
| position_encoder: The :class:`opennmt.layers.position.PositionEncoder` to | |||||
| apply on inputs or ``None``. | |||||
| """ | |||||
| super(SelfAttentionEncoder, self).__init__() | |||||
| self.num_layers = num_layers | |||||
| self.num_units = num_units | |||||
| self.num_heads = num_heads | |||||
| self.ffn_inner_dim = ffn_inner_dim | |||||
| self.dropout = dropout | |||||
| self.attention_dropout = attention_dropout | |||||
| self.relu_dropout = relu_dropout | |||||
| self.position_encoder = position_encoder | |||||
| def encode(self, inputs, sequence_length=None, mode=True): | |||||
| inputs *= self.num_units**0.5 | |||||
| if self.position_encoder is not None: | |||||
| inputs = self.position_encoder(inputs) | |||||
| inputs = tf.layers.dropout(inputs, rate=self.dropout, training=mode) | |||||
| mask = transformer.build_sequence_mask( | |||||
| sequence_length, | |||||
| num_heads=self.num_heads, | |||||
| maximum_length=tf.shape(inputs)[1]) | |||||
| mask_FF = tf.squeeze( | |||||
| transformer.build_sequence_mask( | |||||
| sequence_length, maximum_length=tf.shape(inputs)[1]), | |||||
| axis=1) | |||||
| state = () | |||||
| attns = [] | |||||
| for layer in range(self.num_layers): | |||||
| with tf.variable_scope('layer_{}'.format(layer)): | |||||
| with tf.variable_scope('multi_head'): | |||||
| context, attn = transformer.multi_head_attention( | |||||
| self.num_heads, | |||||
| transformer.norm(inputs), | |||||
| None, | |||||
| mode, | |||||
| num_units=self.num_units, | |||||
| mask=mask, | |||||
| dropout=self.attention_dropout, | |||||
| return_attention=True) | |||||
| attns.append(attn) | |||||
| context = transformer.drop_and_add( | |||||
| inputs, context, mode, dropout=self.dropout) | |||||
| with tf.variable_scope('ffn'): | |||||
| transformed = transformer.feed_forward( | |||||
| transformer.norm(context), | |||||
| self.ffn_inner_dim, | |||||
| mode, | |||||
| dropout=self.relu_dropout, | |||||
| mask=mask_FF) | |||||
| transformed = transformer.drop_and_add( | |||||
| context, transformed, mode, dropout=self.dropout) | |||||
| inputs = transformed | |||||
| state += (tf.reduce_mean(inputs, axis=1), ) | |||||
| outputs = transformer.norm(inputs) | |||||
| return (outputs, state, sequence_length, attns) | |||||
| class SelfAttentionEncoderOri(): | |||||
| """Encoder using self-attention as described in | |||||
| https://arxiv.org/abs/1706.03762. | |||||
| """ | |||||
| def __init__(self, | |||||
| num_layers, | |||||
| num_units=512, | |||||
| num_heads=8, | |||||
| ffn_inner_dim=2048, | |||||
| dropout=0.1, | |||||
| attention_dropout=0.1, | |||||
| relu_dropout=0.1, | |||||
| position_encoder=SinusoidalPositionEncoder()): | |||||
| """Initializes the parameters of the encoder. | |||||
| Args: | |||||
| num_layers: The number of layers. | |||||
| num_units: The number of hidden units. | |||||
| num_heads: The number of heads in the multi-head attention. | |||||
| ffn_inner_dim: The number of units of the inner linear transformation | |||||
| in the feed forward layer. | |||||
| dropout: The probability to drop units from the outputs. | |||||
| attention_dropout: The probability to drop units from the attention. | |||||
| relu_dropout: The probability to drop units from the ReLU activation in | |||||
| the feed forward layer. | |||||
| position_encoder: The :class:`opennmt.layers.position.PositionEncoder` to | |||||
| apply on inputs or ``None``. | |||||
| """ | |||||
| super(SelfAttentionEncoderOri, self).__init__() | |||||
| self.num_layers = num_layers | |||||
| self.num_units = num_units | |||||
| self.num_heads = num_heads | |||||
| self.ffn_inner_dim = ffn_inner_dim | |||||
| self.dropout = dropout | |||||
| self.attention_dropout = attention_dropout | |||||
| self.relu_dropout = relu_dropout | |||||
| self.position_encoder = position_encoder | |||||
| def encode(self, inputs, sequence_length=None, mode=True): | |||||
| inputs *= self.num_units**0.5 | |||||
| if self.position_encoder is not None: | |||||
| inputs = self.position_encoder(inputs) | |||||
| inputs = tf.layers.dropout(inputs, rate=self.dropout, training=mode) | |||||
| mask = transformer.build_sequence_mask( | |||||
| sequence_length, | |||||
| num_heads=self.num_heads, | |||||
| maximum_length=tf.shape(inputs)[1]) # [N, 1, 1, T_out] | |||||
| state = () | |||||
| attns = [] | |||||
| for layer in range(self.num_layers): | |||||
| with tf.variable_scope('layer_{}'.format(layer)): | |||||
| with tf.variable_scope('multi_head'): | |||||
| context, attn = transformer.multi_head_attention( | |||||
| self.num_heads, | |||||
| transformer.norm(inputs), | |||||
| None, | |||||
| mode, | |||||
| num_units=self.num_units, | |||||
| mask=mask, | |||||
| dropout=self.attention_dropout, | |||||
| return_attention=True) | |||||
| attns.append(attn) | |||||
| context = transformer.drop_and_add( | |||||
| inputs, context, mode, dropout=self.dropout) | |||||
| with tf.variable_scope('ffn'): | |||||
| transformed = transformer.feed_forward_ori( | |||||
| transformer.norm(context), | |||||
| self.ffn_inner_dim, | |||||
| mode, | |||||
| dropout=self.relu_dropout) | |||||
| transformed = transformer.drop_and_add( | |||||
| context, transformed, mode, dropout=self.dropout) | |||||
| inputs = transformed | |||||
| state += (tf.reduce_mean(inputs, axis=1), ) | |||||
| outputs = transformer.norm(inputs) | |||||
| return (outputs, state, sequence_length, attns) | |||||
| @@ -0,0 +1,255 @@ | |||||
| import io | |||||
| import os | |||||
| from typing import Any, Dict, Optional, Union | |||||
| import numpy as np | |||||
| import tensorflow as tf | |||||
| from sklearn.preprocessing import MultiLabelBinarizer | |||||
| from modelscope.models.base import Model | |||||
| from modelscope.models.builder import MODELS | |||||
| from modelscope.utils.constant import ModelFile, Tasks | |||||
| from .models import create_model | |||||
| from .text.symbols import load_symbols | |||||
| from .text.symbols_dict import SymbolsDict | |||||
| __all__ = ['SambertNetHifi16k'] | |||||
| def multi_label_symbol_to_sequence(my_classes, my_symbol): | |||||
| one_hot = MultiLabelBinarizer(my_classes) | |||||
| tokens = my_symbol.strip().split(' ') | |||||
| sequences = [] | |||||
| for token in tokens: | |||||
| sequences.append(tuple(token.split('&'))) | |||||
| # sequences.append(tuple(['~'])) # sequence length minus 1 to ignore EOS ~ | |||||
| return one_hot.fit_transform(sequences) | |||||
| @MODELS.register_module(Tasks.text_to_speech, module_name=r'sambert_hifi_16k') | |||||
| class SambertNetHifi16k(Model): | |||||
| def __init__(self, | |||||
| model_dir, | |||||
| pitch_control_str='', | |||||
| duration_control_str='', | |||||
| energy_control_str='', | |||||
| *args, | |||||
| **kwargs): | |||||
| tf.reset_default_graph() | |||||
| local_ckpt_path = os.path.join(ModelFile.TF_CHECKPOINT_FOLDER, 'ckpt') | |||||
| self._ckpt_path = os.path.join(model_dir, local_ckpt_path) | |||||
| self._dict_path = os.path.join(model_dir, 'dicts') | |||||
| self._hparams = tf.contrib.training.HParams(**kwargs) | |||||
| values = self._hparams.values() | |||||
| hp = [' {}:{}'.format(name, values[name]) for name in sorted(values)] | |||||
| print('Hyperparameters:\n' + '\n'.join(hp)) | |||||
| super().__init__(self._ckpt_path, *args, **kwargs) | |||||
| model_name = 'robutrans' | |||||
| self._lfeat_type_list = self._hparams.lfeat_type_list.strip().split( | |||||
| ',') | |||||
| sy, tone, syllable_flag, word_segment, emo_category, speaker = load_symbols( | |||||
| self._dict_path) | |||||
| self._sy = sy | |||||
| self._tone = tone | |||||
| self._syllable_flag = syllable_flag | |||||
| self._word_segment = word_segment | |||||
| self._emo_category = emo_category | |||||
| self._speaker = speaker | |||||
| self._inputs_dim = dict() | |||||
| for lfeat_type in self._lfeat_type_list: | |||||
| if lfeat_type == 'sy': | |||||
| self._inputs_dim[lfeat_type] = len(sy) | |||||
| elif lfeat_type == 'tone': | |||||
| self._inputs_dim[lfeat_type] = len(tone) | |||||
| elif lfeat_type == 'syllable_flag': | |||||
| self._inputs_dim[lfeat_type] = len(syllable_flag) | |||||
| elif lfeat_type == 'word_segment': | |||||
| self._inputs_dim[lfeat_type] = len(word_segment) | |||||
| elif lfeat_type == 'emo_category': | |||||
| self._inputs_dim[lfeat_type] = len(emo_category) | |||||
| elif lfeat_type == 'speaker': | |||||
| self._inputs_dim[lfeat_type] = len(speaker) | |||||
| self._symbols_dict = SymbolsDict(sy, tone, syllable_flag, word_segment, | |||||
| emo_category, speaker, | |||||
| self._inputs_dim, | |||||
| self._lfeat_type_list) | |||||
| dim_inputs = sum(self._inputs_dim.values( | |||||
| )) - self._inputs_dim['speaker'] - self._inputs_dim['emo_category'] | |||||
| inputs = tf.placeholder(tf.float32, [1, None, dim_inputs], 'inputs') | |||||
| inputs_emotion = tf.placeholder( | |||||
| tf.float32, [1, None, self._inputs_dim['emo_category']], | |||||
| 'inputs_emotion') | |||||
| inputs_speaker = tf.placeholder(tf.float32, | |||||
| [1, None, self._inputs_dim['speaker']], | |||||
| 'inputs_speaker') | |||||
| input_lengths = tf.placeholder(tf.int32, [1], 'input_lengths') | |||||
| pitch_contours_scale = tf.placeholder(tf.float32, [1, None], | |||||
| 'pitch_contours_scale') | |||||
| energy_contours_scale = tf.placeholder(tf.float32, [1, None], | |||||
| 'energy_contours_scale') | |||||
| duration_scale = tf.placeholder(tf.float32, [1, None], | |||||
| 'duration_scale') | |||||
| with tf.variable_scope('model') as _: | |||||
| self._model = create_model(model_name, self._hparams) | |||||
| self._model.initialize( | |||||
| inputs, | |||||
| inputs_emotion, | |||||
| inputs_speaker, | |||||
| input_lengths, | |||||
| duration_scales=duration_scale, | |||||
| pitch_scales=pitch_contours_scale, | |||||
| energy_scales=energy_contours_scale) | |||||
| self._mel_spec = self._model.mel_outputs[0] | |||||
| self._duration_outputs = self._model.duration_outputs[0] | |||||
| self._duration_outputs_ = self._model.duration_outputs_[0] | |||||
| self._pitch_contour_outputs = self._model.pitch_contour_outputs[0] | |||||
| self._energy_contour_outputs = self._model.energy_contour_outputs[ | |||||
| 0] | |||||
| self._embedded_inputs_emotion = self._model.embedded_inputs_emotion[ | |||||
| 0] | |||||
| self._embedding_fsmn_outputs = self._model.embedding_fsmn_outputs[ | |||||
| 0] | |||||
| self._encoder_outputs = self._model.encoder_outputs[0] | |||||
| self._pitch_embeddings = self._model.pitch_embeddings[0] | |||||
| self._energy_embeddings = self._model.energy_embeddings[0] | |||||
| self._LR_outputs = self._model.LR_outputs[0] | |||||
| self._postnet_fsmn_outputs = self._model.postnet_fsmn_outputs[0] | |||||
| self._attention_h = self._model.attention_h | |||||
| self._attention_x = self._model.attention_x | |||||
| print('Loading checkpoint: %s' % self._ckpt_path) | |||||
| config = tf.ConfigProto() | |||||
| config.gpu_options.allow_growth = True | |||||
| self._session = tf.Session(config=config) | |||||
| self._session.run(tf.global_variables_initializer()) | |||||
| saver = tf.train.Saver() | |||||
| saver.restore(self._session, self._ckpt_path) | |||||
| duration_cfg_lst = [] | |||||
| if len(duration_control_str) != 0: | |||||
| for item in duration_control_str.strip().split('|'): | |||||
| percent, scale = item.lstrip('(').rstrip(')').split(',') | |||||
| duration_cfg_lst.append((float(percent), float(scale))) | |||||
| self._duration_cfg_lst = duration_cfg_lst | |||||
| pitch_contours_cfg_lst = [] | |||||
| if len(pitch_control_str) != 0: | |||||
| for item in pitch_control_str.strip().split('|'): | |||||
| percent, scale = item.lstrip('(').rstrip(')').split(',') | |||||
| pitch_contours_cfg_lst.append( | |||||
| (float(percent), float(scale))) | |||||
| self._pitch_contours_cfg_lst = pitch_contours_cfg_lst | |||||
| energy_contours_cfg_lst = [] | |||||
| if len(energy_control_str) != 0: | |||||
| for item in energy_control_str.strip().split('|'): | |||||
| percent, scale = item.lstrip('(').rstrip(')').split(',') | |||||
| energy_contours_cfg_lst.append( | |||||
| (float(percent), float(scale))) | |||||
| self._energy_contours_cfg_lst = energy_contours_cfg_lst | |||||
| def forward(self, text): | |||||
| cleaner_names = [x.strip() for x in self._hparams.cleaners.split(',')] | |||||
| lfeat_symbol = text.strip().split(' ') | |||||
| lfeat_symbol_separate = [''] * int(len(self._lfeat_type_list)) | |||||
| for this_lfeat_symbol in lfeat_symbol: | |||||
| this_lfeat_symbol = this_lfeat_symbol.strip('{').strip('}').split( | |||||
| '$') | |||||
| if len(this_lfeat_symbol) != len(self._lfeat_type_list): | |||||
| raise Exception( | |||||
| 'Length of this_lfeat_symbol in training data' | |||||
| + ' is not equal to the length of lfeat_type_list, ' | |||||
| + str(len(this_lfeat_symbol)) + ' VS. ' | |||||
| + str(len(self._lfeat_type_list))) | |||||
| index = 0 | |||||
| while index < len(lfeat_symbol_separate): | |||||
| lfeat_symbol_separate[index] = lfeat_symbol_separate[ | |||||
| index] + this_lfeat_symbol[index] + ' ' | |||||
| index = index + 1 | |||||
| index = 0 | |||||
| lfeat_type = self._lfeat_type_list[index] | |||||
| sequence = self._symbols_dict.symbol_to_sequence( | |||||
| lfeat_symbol_separate[index].strip(), lfeat_type, cleaner_names) | |||||
| sequence_array = np.asarray( | |||||
| sequence[:-1], | |||||
| dtype=np.int32) # sequence length minus 1 to ignore EOS ~ | |||||
| inputs = np.eye( | |||||
| self._inputs_dim[lfeat_type], dtype=np.float32)[sequence_array] | |||||
| index = index + 1 | |||||
| while index < len(self._lfeat_type_list) - 2: | |||||
| lfeat_type = self._lfeat_type_list[index] | |||||
| sequence = self._symbols_dict.symbol_to_sequence( | |||||
| lfeat_symbol_separate[index].strip(), lfeat_type, | |||||
| cleaner_names) | |||||
| sequence_array = np.asarray( | |||||
| sequence[:-1], | |||||
| dtype=np.int32) # sequence length minus 1 to ignore EOS ~ | |||||
| inputs_temp = np.eye( | |||||
| self._inputs_dim[lfeat_type], dtype=np.float32)[sequence_array] | |||||
| inputs = np.concatenate((inputs, inputs_temp), axis=1) | |||||
| index = index + 1 | |||||
| seq = inputs | |||||
| lfeat_type = 'emo_category' | |||||
| inputs_emotion = multi_label_symbol_to_sequence( | |||||
| self._emo_category, lfeat_symbol_separate[index].strip()) | |||||
| # inputs_emotion = inputs_emotion * 1.5 | |||||
| index = index + 1 | |||||
| lfeat_type = 'speaker' | |||||
| inputs_speaker = multi_label_symbol_to_sequence( | |||||
| self._speaker, lfeat_symbol_separate[index].strip()) | |||||
| duration_scale = np.ones((len(seq), ), dtype=np.float32) | |||||
| start_idx = 0 | |||||
| for (percent, scale) in self._duration_cfg_lst: | |||||
| duration_scale[start_idx:start_idx | |||||
| + int(percent * len(seq))] = scale | |||||
| start_idx += int(percent * len(seq)) | |||||
| pitch_contours_scale = np.ones((len(seq), ), dtype=np.float32) | |||||
| start_idx = 0 | |||||
| for (percent, scale) in self._pitch_contours_cfg_lst: | |||||
| pitch_contours_scale[start_idx:start_idx | |||||
| + int(percent * len(seq))] = scale | |||||
| start_idx += int(percent * len(seq)) | |||||
| energy_contours_scale = np.ones((len(seq), ), dtype=np.float32) | |||||
| start_idx = 0 | |||||
| for (percent, scale) in self._energy_contours_cfg_lst: | |||||
| energy_contours_scale[start_idx:start_idx | |||||
| + int(percent * len(seq))] = scale | |||||
| start_idx += int(percent * len(seq)) | |||||
| feed_dict = { | |||||
| self._model.inputs: [np.asarray(seq, dtype=np.float32)], | |||||
| self._model.inputs_emotion: | |||||
| [np.asarray(inputs_emotion, dtype=np.float32)], | |||||
| self._model.inputs_speaker: | |||||
| [np.asarray(inputs_speaker, dtype=np.float32)], | |||||
| self._model.input_lengths: | |||||
| np.asarray([len(seq)], dtype=np.int32), | |||||
| self._model.duration_scales: [duration_scale], | |||||
| self._model.pitch_scales: [pitch_contours_scale], | |||||
| self._model.energy_scales: [energy_contours_scale] | |||||
| } | |||||
| result = self._session.run([ | |||||
| self._mel_spec, self._duration_outputs, self._duration_outputs_, | |||||
| self._pitch_contour_outputs, self._embedded_inputs_emotion, | |||||
| self._embedding_fsmn_outputs, self._encoder_outputs, | |||||
| self._pitch_embeddings, self._LR_outputs, | |||||
| self._postnet_fsmn_outputs, self._energy_contour_outputs, | |||||
| self._energy_embeddings, self._attention_x, self._attention_h | |||||
| ], feed_dict=feed_dict) # yapf:disable | |||||
| return result[0] | |||||
| @@ -0,0 +1,89 @@ | |||||
| ''' | |||||
| Cleaners are transformations that run over the input text at both training and eval time. | |||||
| Cleaners can be selected by passing a comma-delimited list of cleaner names as the "cleaners" | |||||
| hyperparameter. Some cleaners are English-specific. You'll typically want to use: | |||||
| 1. "english_cleaners" for English text | |||||
| 2. "transliteration_cleaners" for non-English text that can be transliterated to ASCII using | |||||
| the Unidecode library (https://pypi.python.org/pypi/Unidecode) | |||||
| 3. "basic_cleaners" if you do not want to transliterate (in this case, you should also update | |||||
| the symbols in symbols.py to match your data). | |||||
| ''' | |||||
| import re | |||||
| from unidecode import unidecode | |||||
| from .numbers import normalize_numbers | |||||
| # Regular expression matching whitespace: | |||||
| _whitespace_re = re.compile(r'\s+') | |||||
| # List of (regular expression, replacement) pairs for abbreviations: | |||||
| _abbreviations = [(re.compile('\\b%s\\.' % x[0], re.IGNORECASE), x[1]) | |||||
| for x in [ | |||||
| ('mrs', 'misess'), | |||||
| ('mr', 'mister'), | |||||
| ('dr', 'doctor'), | |||||
| ('st', 'saint'), | |||||
| ('co', 'company'), | |||||
| ('jr', 'junior'), | |||||
| ('maj', 'major'), | |||||
| ('gen', 'general'), | |||||
| ('drs', 'doctors'), | |||||
| ('rev', 'reverend'), | |||||
| ('lt', 'lieutenant'), | |||||
| ('hon', 'honorable'), | |||||
| ('sgt', 'sergeant'), | |||||
| ('capt', 'captain'), | |||||
| ('esq', 'esquire'), | |||||
| ('ltd', 'limited'), | |||||
| ('col', 'colonel'), | |||||
| ('ft', 'fort'), ]] # yapf:disable | |||||
| def expand_abbreviations(text): | |||||
| for regex, replacement in _abbreviations: | |||||
| text = re.sub(regex, replacement, text) | |||||
| return text | |||||
| def expand_numbers(text): | |||||
| return normalize_numbers(text) | |||||
| def lowercase(text): | |||||
| return text.lower() | |||||
| def collapse_whitespace(text): | |||||
| return re.sub(_whitespace_re, ' ', text) | |||||
| def convert_to_ascii(text): | |||||
| return unidecode(text) | |||||
| def basic_cleaners(text): | |||||
| '''Basic pipeline that lowercases and collapses whitespace without transliteration.''' | |||||
| text = lowercase(text) | |||||
| text = collapse_whitespace(text) | |||||
| return text | |||||
| def transliteration_cleaners(text): | |||||
| '''Pipeline for non-English text that transliterates to ASCII.''' | |||||
| text = convert_to_ascii(text) | |||||
| text = lowercase(text) | |||||
| text = collapse_whitespace(text) | |||||
| return text | |||||
| def english_cleaners(text): | |||||
| '''Pipeline for English text, including number and abbreviation expansion.''' | |||||
| text = convert_to_ascii(text) | |||||
| text = lowercase(text) | |||||
| text = expand_numbers(text) | |||||
| text = expand_abbreviations(text) | |||||
| text = collapse_whitespace(text) | |||||
| return text | |||||
| @@ -0,0 +1,64 @@ | |||||
| import re | |||||
| valid_symbols = [ | |||||
| 'AA', 'AA0', 'AA1', 'AA2', 'AE', 'AE0', 'AE1', 'AE2', 'AH', 'AH0', 'AH1', | |||||
| 'AH2', 'AO', 'AO0', 'AO1', 'AO2', 'AW', 'AW0', 'AW1', 'AW2', 'AY', 'AY0', | |||||
| 'AY1', 'AY2', 'B', 'CH', 'D', 'DH', 'EH', 'EH0', 'EH1', 'EH2', 'ER', 'ER0', | |||||
| 'ER1', 'ER2', 'EY', 'EY0', 'EY1', 'EY2', 'F', 'G', 'HH', 'IH', 'IH0', | |||||
| 'IH1', 'IH2', 'IY', 'IY0', 'IY1', 'IY2', 'JH', 'K', 'L', 'M', 'N', 'NG', | |||||
| 'OW', 'OW0', 'OW1', 'OW2', 'OY', 'OY0', 'OY1', 'OY2', 'P', 'R', 'S', 'SH', | |||||
| 'T', 'TH', 'UH', 'UH0', 'UH1', 'UH2', 'UW', 'UW0', 'UW1', 'UW2', 'V', 'W', | |||||
| 'Y', 'Z', 'ZH' | |||||
| ] | |||||
| _valid_symbol_set = set(valid_symbols) | |||||
| class CMUDict: | |||||
| '''Thin wrapper around CMUDict data. http://www.speech.cs.cmu.edu/cgi-bin/cmudict''' | |||||
| def __init__(self, file_or_path, keep_ambiguous=True): | |||||
| if isinstance(file_or_path, str): | |||||
| with open(file_or_path, encoding='latin-1') as f: | |||||
| entries = _parse_cmudict(f) | |||||
| else: | |||||
| entries = _parse_cmudict(file_or_path) | |||||
| if not keep_ambiguous: | |||||
| entries = { | |||||
| word: pron | |||||
| for word, pron in entries.items() if len(pron) == 1 | |||||
| } | |||||
| self._entries = entries | |||||
| def __len__(self): | |||||
| return len(self._entries) | |||||
| def lookup(self, word): | |||||
| '''Returns list of ARPAbet pronunciations of the given word.''' | |||||
| return self._entries.get(word.upper()) | |||||
| _alt_re = re.compile(r'\([0-9]+\)') | |||||
| def _parse_cmudict(file): | |||||
| cmudict = {} | |||||
| for line in file: | |||||
| if len(line) and (line[0] >= 'A' and line[0] <= 'Z' or line[0] == "'"): | |||||
| parts = line.split(' ') | |||||
| word = re.sub(_alt_re, '', parts[0]) | |||||
| pronunciation = _get_pronunciation(parts[1]) | |||||
| if pronunciation: | |||||
| if word in cmudict: | |||||
| cmudict[word].append(pronunciation) | |||||
| else: | |||||
| cmudict[word] = [pronunciation] | |||||
| return cmudict | |||||
| def _get_pronunciation(s): | |||||
| parts = s.strip().split(' ') | |||||
| for part in parts: | |||||
| if part not in _valid_symbol_set: | |||||
| return None | |||||
| return ' '.join(parts) | |||||
| @@ -0,0 +1,70 @@ | |||||
| import re | |||||
| import inflect | |||||
| _inflect = inflect.engine() | |||||
| _comma_number_re = re.compile(r'([0-9][0-9\,]+[0-9])') | |||||
| _decimal_number_re = re.compile(r'([0-9]+\.[0-9]+)') | |||||
| _pounds_re = re.compile(r'£([0-9\,]*[0-9]+)') | |||||
| _dollars_re = re.compile(r'\$([0-9\.\,]*[0-9]+)') | |||||
| _ordinal_re = re.compile(r'[0-9]+(st|nd|rd|th)') | |||||
| _number_re = re.compile(r'[0-9]+') | |||||
| def _remove_commas(m): | |||||
| return m.group(1).replace(',', '') | |||||
| def _expand_decimal_point(m): | |||||
| return m.group(1).replace('.', ' point ') | |||||
| def _expand_dollars(m): | |||||
| match = m.group(1) | |||||
| parts = match.split('.') | |||||
| if len(parts) > 2: | |||||
| return match + ' dollars' # Unexpected format | |||||
| dollars = int(parts[0]) if parts[0] else 0 | |||||
| cents = int(parts[1]) if len(parts) > 1 and parts[1] else 0 | |||||
| if dollars and cents: | |||||
| dollar_unit = 'dollar' if dollars == 1 else 'dollars' | |||||
| cent_unit = 'cent' if cents == 1 else 'cents' | |||||
| return '%s %s, %s %s' % (dollars, dollar_unit, cents, cent_unit) | |||||
| elif dollars: | |||||
| dollar_unit = 'dollar' if dollars == 1 else 'dollars' | |||||
| return '%s %s' % (dollars, dollar_unit) | |||||
| elif cents: | |||||
| cent_unit = 'cent' if cents == 1 else 'cents' | |||||
| return '%s %s' % (cents, cent_unit) | |||||
| else: | |||||
| return 'zero dollars' | |||||
| def _expand_ordinal(m): | |||||
| return _inflect.number_to_words(m.group(0)) | |||||
| def _expand_number(m): | |||||
| num = int(m.group(0)) | |||||
| if num > 1000 and num < 3000: | |||||
| if num == 2000: | |||||
| return 'two thousand' | |||||
| elif num > 2000 and num < 2010: | |||||
| return 'two thousand ' + _inflect.number_to_words(num % 100) | |||||
| elif num % 100 == 0: | |||||
| return _inflect.number_to_words(num // 100) + ' hundred' | |||||
| else: | |||||
| return _inflect.number_to_words( | |||||
| num, andword='', zero='oh', group=2).replace(', ', ' ') | |||||
| else: | |||||
| return _inflect.number_to_words(num, andword='') | |||||
| def normalize_numbers(text): | |||||
| text = re.sub(_comma_number_re, _remove_commas, text) | |||||
| text = re.sub(_pounds_re, r'\1 pounds', text) | |||||
| text = re.sub(_dollars_re, _expand_dollars, text) | |||||
| text = re.sub(_decimal_number_re, _expand_decimal_point, text) | |||||
| text = re.sub(_ordinal_re, _expand_ordinal, text) | |||||
| text = re.sub(_number_re, _expand_number, text) | |||||
| return text | |||||
| @@ -0,0 +1,95 @@ | |||||
| ''' | |||||
| Defines the set of symbols used in text input to the model. | |||||
| The default is a set of ASCII characters that works well for English or text that has been run | |||||
| through Unidecode. For other data, you can modify _characters. See TRAINING_DATA.md for details. | |||||
| ''' | |||||
| import codecs | |||||
| import os | |||||
| _pad = '_' | |||||
| _eos = '~' | |||||
| _mask = '@[MASK]' | |||||
| def load_symbols(dict_path): | |||||
| _characters = '' | |||||
| _ch_symbols = [] | |||||
| sy_dict_name = 'sy_dict.txt' | |||||
| sy_dict_path = os.path.join(dict_path, sy_dict_name) | |||||
| f = codecs.open(sy_dict_path, 'r') | |||||
| for line in f: | |||||
| line = line.strip('\r\n') | |||||
| _ch_symbols.append(line) | |||||
| _arpabet = ['@' + s for s in _ch_symbols] | |||||
| # Export all symbols: | |||||
| sy = list(_characters) + _arpabet + [_pad, _eos, _mask] | |||||
| _characters = '' | |||||
| _ch_tones = [] | |||||
| tone_dict_name = 'tone_dict.txt' | |||||
| tone_dict_path = os.path.join(dict_path, tone_dict_name) | |||||
| f = codecs.open(tone_dict_path, 'r') | |||||
| for line in f: | |||||
| line = line.strip('\r\n') | |||||
| _ch_tones.append(line) | |||||
| # Export all tones: | |||||
| tone = list(_characters) + _ch_tones + [_pad, _eos, _mask] | |||||
| _characters = '' | |||||
| _ch_syllable_flags = [] | |||||
| syllable_flag_name = 'syllable_flag_dict.txt' | |||||
| syllable_flag_path = os.path.join(dict_path, syllable_flag_name) | |||||
| f = codecs.open(syllable_flag_path, 'r') | |||||
| for line in f: | |||||
| line = line.strip('\r\n') | |||||
| _ch_syllable_flags.append(line) | |||||
| # Export all syllable_flags: | |||||
| syllable_flag = list(_characters) + _ch_syllable_flags + [ | |||||
| _pad, _eos, _mask | |||||
| ] | |||||
| _characters = '' | |||||
| _ch_word_segments = [] | |||||
| word_segment_name = 'word_segment_dict.txt' | |||||
| word_segment_path = os.path.join(dict_path, word_segment_name) | |||||
| f = codecs.open(word_segment_path, 'r') | |||||
| for line in f: | |||||
| line = line.strip('\r\n') | |||||
| _ch_word_segments.append(line) | |||||
| # Export all syllable_flags: | |||||
| word_segment = list(_characters) + _ch_word_segments + [_pad, _eos, _mask] | |||||
| _characters = '' | |||||
| _ch_emo_types = [] | |||||
| emo_category_name = 'emo_category_dict.txt' | |||||
| emo_category_path = os.path.join(dict_path, emo_category_name) | |||||
| f = codecs.open(emo_category_path, 'r') | |||||
| for line in f: | |||||
| line = line.strip('\r\n') | |||||
| _ch_emo_types.append(line) | |||||
| emo_category = list(_characters) + _ch_emo_types + [_pad, _eos, _mask] | |||||
| _characters = '' | |||||
| _ch_speakers = [] | |||||
| speaker_name = 'speaker_dict.txt' | |||||
| speaker_path = os.path.join(dict_path, speaker_name) | |||||
| f = codecs.open(speaker_path, 'r') | |||||
| for line in f: | |||||
| line = line.strip('\r\n') | |||||
| _ch_speakers.append(line) | |||||
| # Export all syllable_flags: | |||||
| speaker = list(_characters) + _ch_speakers + [_pad, _eos, _mask] | |||||
| return sy, tone, syllable_flag, word_segment, emo_category, speaker | |||||
| @@ -0,0 +1,200 @@ | |||||
| import re | |||||
| import sys | |||||
| from .cleaners import (basic_cleaners, english_cleaners, | |||||
| transliteration_cleaners) | |||||
| class SymbolsDict: | |||||
| def __init__(self, sy, tone, syllable_flag, word_segment, emo_category, | |||||
| speaker, inputs_dim, lfeat_type_list): | |||||
| self._inputs_dim = inputs_dim | |||||
| self._lfeat_type_list = lfeat_type_list | |||||
| self._sy_to_id = {s: i for i, s in enumerate(sy)} | |||||
| self._id_to_sy = {i: s for i, s in enumerate(sy)} | |||||
| self._tone_to_id = {s: i for i, s in enumerate(tone)} | |||||
| self._id_to_tone = {i: s for i, s in enumerate(tone)} | |||||
| self._syllable_flag_to_id = {s: i for i, s in enumerate(syllable_flag)} | |||||
| self._id_to_syllable_flag = {i: s for i, s in enumerate(syllable_flag)} | |||||
| self._word_segment_to_id = {s: i for i, s in enumerate(word_segment)} | |||||
| self._id_to_word_segment = {i: s for i, s in enumerate(word_segment)} | |||||
| self._emo_category_to_id = {s: i for i, s in enumerate(emo_category)} | |||||
| self._id_to_emo_category = {i: s for i, s in enumerate(emo_category)} | |||||
| self._speaker_to_id = {s: i for i, s in enumerate(speaker)} | |||||
| self._id_to_speaker = {i: s for i, s in enumerate(speaker)} | |||||
| print('_sy_to_id: ') | |||||
| print(self._sy_to_id) | |||||
| print('_tone_to_id: ') | |||||
| print(self._tone_to_id) | |||||
| print('_syllable_flag_to_id: ') | |||||
| print(self._syllable_flag_to_id) | |||||
| print('_word_segment_to_id: ') | |||||
| print(self._word_segment_to_id) | |||||
| print('_emo_category_to_id: ') | |||||
| print(self._emo_category_to_id) | |||||
| print('_speaker_to_id: ') | |||||
| print(self._speaker_to_id) | |||||
| self._curly_re = re.compile(r'(.*?)\{(.+?)\}(.*)') | |||||
| self._cleaners = { | |||||
| basic_cleaners.__name__: basic_cleaners, | |||||
| transliteration_cleaners.__name__: transliteration_cleaners, | |||||
| english_cleaners.__name__: english_cleaners | |||||
| } | |||||
| def _clean_text(self, text, cleaner_names): | |||||
| for name in cleaner_names: | |||||
| cleaner = self._cleaners.get(name) | |||||
| if not cleaner: | |||||
| raise Exception('Unknown cleaner: %s' % name) | |||||
| text = cleaner(text) | |||||
| return text | |||||
| def _sy_to_sequence(self, sy): | |||||
| return [self._sy_to_id[s] for s in sy if self._should_keep_sy(s)] | |||||
| def _arpabet_to_sequence(self, text): | |||||
| return self._sy_to_sequence(['@' + s for s in text.split()]) | |||||
| def _should_keep_sy(self, s): | |||||
| return s in self._sy_to_id and s != '_' and s != '~' | |||||
| def symbol_to_sequence(self, this_lfeat_symbol, lfeat_type, cleaner_names): | |||||
| sequence = [] | |||||
| if lfeat_type == 'sy': | |||||
| this_lfeat_symbol = this_lfeat_symbol.strip().split(' ') | |||||
| this_lfeat_symbol_format = '' | |||||
| index = 0 | |||||
| while index < len(this_lfeat_symbol): | |||||
| this_lfeat_symbol_format = this_lfeat_symbol_format + '{' + this_lfeat_symbol[ | |||||
| index] + '}' + ' ' | |||||
| index = index + 1 | |||||
| sequence = self.text_to_sequence(this_lfeat_symbol_format, | |||||
| cleaner_names) | |||||
| elif lfeat_type == 'tone': | |||||
| sequence = self.tone_to_sequence(this_lfeat_symbol) | |||||
| elif lfeat_type == 'syllable_flag': | |||||
| sequence = self.syllable_flag_to_sequence(this_lfeat_symbol) | |||||
| elif lfeat_type == 'word_segment': | |||||
| sequence = self.word_segment_to_sequence(this_lfeat_symbol) | |||||
| elif lfeat_type == 'emo_category': | |||||
| sequence = self.emo_category_to_sequence(this_lfeat_symbol) | |||||
| elif lfeat_type == 'speaker': | |||||
| sequence = self.speaker_to_sequence(this_lfeat_symbol) | |||||
| else: | |||||
| raise Exception('Unknown lfeat type: %s' % lfeat_type) | |||||
| return sequence | |||||
| def text_to_sequence(self, text, cleaner_names): | |||||
| '''Converts a string of text to a sequence of IDs corresponding to the symbols in the text. | |||||
| The text can optionally have ARPAbet sequences enclosed in curly braces embedded | |||||
| in it. For example, "Turn left on {HH AW1 S S T AH0 N} Street." | |||||
| Args: | |||||
| text: string to convert to a sequence | |||||
| cleaner_names: names of the cleaner functions to run the text through | |||||
| Returns: | |||||
| List of integers corresponding to the symbols in the text | |||||
| ''' | |||||
| sequence = [] | |||||
| # Check for curly braces and treat their contents as ARPAbet: | |||||
| while len(text): | |||||
| m = self._curly_re.match(text) | |||||
| if not m: | |||||
| sequence += self._sy_to_sequence( | |||||
| self._clean_text(text, cleaner_names)) | |||||
| break | |||||
| sequence += self._sy_to_sequence( | |||||
| self._clean_text(m.group(1), cleaner_names)) | |||||
| sequence += self._arpabet_to_sequence(m.group(2)) | |||||
| text = m.group(3) | |||||
| # Append EOS token | |||||
| sequence.append(self._sy_to_id['~']) | |||||
| return sequence | |||||
| def tone_to_sequence(self, tone): | |||||
| tones = tone.strip().split(' ') | |||||
| sequence = [] | |||||
| for this_tone in tones: | |||||
| sequence.append(self._tone_to_id[this_tone]) | |||||
| sequence.append(self._tone_to_id['~']) | |||||
| return sequence | |||||
| def syllable_flag_to_sequence(self, syllable_flag): | |||||
| syllable_flags = syllable_flag.strip().split(' ') | |||||
| sequence = [] | |||||
| for this_syllable_flag in syllable_flags: | |||||
| sequence.append(self._syllable_flag_to_id[this_syllable_flag]) | |||||
| sequence.append(self._syllable_flag_to_id['~']) | |||||
| return sequence | |||||
| def word_segment_to_sequence(self, word_segment): | |||||
| word_segments = word_segment.strip().split(' ') | |||||
| sequence = [] | |||||
| for this_word_segment in word_segments: | |||||
| sequence.append(self._word_segment_to_id[this_word_segment]) | |||||
| sequence.append(self._word_segment_to_id['~']) | |||||
| return sequence | |||||
| def emo_category_to_sequence(self, emo_type): | |||||
| emo_categories = emo_type.strip().split(' ') | |||||
| sequence = [] | |||||
| for this_category in emo_categories: | |||||
| sequence.append(self._emo_category_to_id[this_category]) | |||||
| sequence.append(self._emo_category_to_id['~']) | |||||
| return sequence | |||||
| def speaker_to_sequence(self, speaker): | |||||
| speakers = speaker.strip().split(' ') | |||||
| sequence = [] | |||||
| for this_speaker in speakers: | |||||
| sequence.append(self._speaker_to_id[this_speaker]) | |||||
| sequence.append(self._speaker_to_id['~']) | |||||
| return sequence | |||||
| def sequence_to_symbol(self, sequence): | |||||
| result = '' | |||||
| pre_lfeat_dim = 0 | |||||
| for lfeat_type in self._lfeat_type_list: | |||||
| current_one_hot_sequence = sequence[:, pre_lfeat_dim:pre_lfeat_dim | |||||
| + self._inputs_dim[lfeat_type]] | |||||
| current_sequence = current_one_hot_sequence.argmax(1) | |||||
| length = current_sequence.shape[0] | |||||
| index = 0 | |||||
| while index < length: | |||||
| this_sequence = current_sequence[index] | |||||
| s = '' | |||||
| if lfeat_type == 'sy': | |||||
| s = self._id_to_sy[this_sequence] | |||||
| if len(s) > 1 and s[0] == '@': | |||||
| s = s[1:] | |||||
| elif lfeat_type == 'tone': | |||||
| s = self._id_to_tone[this_sequence] | |||||
| elif lfeat_type == 'syllable_flag': | |||||
| s = self._id_to_syllable_flag[this_sequence] | |||||
| elif lfeat_type == 'word_segment': | |||||
| s = self._id_to_word_segment[this_sequence] | |||||
| elif lfeat_type == 'emo_category': | |||||
| s = self._id_to_emo_category[this_sequence] | |||||
| elif lfeat_type == 'speaker': | |||||
| s = self._id_to_speaker[this_sequence] | |||||
| else: | |||||
| raise Exception('Unknown lfeat type: %s' % lfeat_type) | |||||
| if index == 0: | |||||
| result = result + lfeat_type + ': ' | |||||
| result = result + '{' + s + '}' | |||||
| if index == length - 1: | |||||
| result = result + '; ' | |||||
| index = index + 1 | |||||
| pre_lfeat_dim = pre_lfeat_dim + self._inputs_dim[lfeat_type] | |||||
| return result | |||||
| @@ -0,0 +1 @@ | |||||
| from .generic_text_to_speech_frontend import * # noqa F403 | |||||
| @@ -0,0 +1,39 @@ | |||||
| import os | |||||
| import zipfile | |||||
| from typing import Any, Dict, List | |||||
| from modelscope.models.base import Model | |||||
| from modelscope.models.builder import MODELS | |||||
| from modelscope.utils.audio.tts_exceptions import ( | |||||
| TtsFrontendInitializeFailedException, | |||||
| TtsFrontendLanguageTypeInvalidException) | |||||
| from modelscope.utils.constant import Tasks | |||||
| __all__ = ['GenericTtsFrontend'] | |||||
| @MODELS.register_module( | |||||
| Tasks.text_to_speech, module_name=r'generic_tts_frontend') | |||||
| class GenericTtsFrontend(Model): | |||||
| def __init__(self, model_dir='.', lang_type='pinyin', *args, **kwargs): | |||||
| super().__init__(model_dir, *args, **kwargs) | |||||
| import ttsfrd | |||||
| frontend = ttsfrd.TtsFrontendEngine() | |||||
| zip_file = os.path.join(model_dir, 'resource.zip') | |||||
| self._res_path = os.path.join(model_dir, 'resource') | |||||
| with zipfile.ZipFile(zip_file, 'r') as zip_ref: | |||||
| zip_ref.extractall(model_dir) | |||||
| if not frontend.initialize(self._res_path): | |||||
| raise TtsFrontendInitializeFailedException( | |||||
| 'resource invalid: {}'.format(self._res_path)) | |||||
| if not frontend.set_lang_type(lang_type): | |||||
| raise TtsFrontendLanguageTypeInvalidException( | |||||
| 'language type invalid: {}, valid is pinyin and chenmix'. | |||||
| format(lang_type)) | |||||
| self._frontend = frontend | |||||
| def forward(self, data: str) -> Dict[str, List]: | |||||
| result = self._frontend.gen_tacotron_symbols(data) | |||||
| return {'texts': [s for s in result.splitlines() if s != '']} | |||||
| @@ -0,0 +1 @@ | |||||
| from .hifigan16k import * # noqa F403 | |||||
| @@ -0,0 +1,73 @@ | |||||
| from __future__ import (absolute_import, division, print_function, | |||||
| unicode_literals) | |||||
| import argparse | |||||
| import glob | |||||
| import os | |||||
| import time | |||||
| import json | |||||
| import numpy as np | |||||
| import torch | |||||
| from scipy.io.wavfile import write | |||||
| from modelscope.models.base import Model | |||||
| from modelscope.models.builder import MODELS | |||||
| from modelscope.utils.audio.tts_exceptions import \ | |||||
| TtsVocoderMelspecShapeMismatchException | |||||
| from modelscope.utils.constant import ModelFile, Tasks | |||||
| from .models import Generator | |||||
| __all__ = ['Hifigan16k', 'AttrDict'] | |||||
| MAX_WAV_VALUE = 32768.0 | |||||
| def load_checkpoint(filepath, device): | |||||
| assert os.path.isfile(filepath) | |||||
| print("Loading '{}'".format(filepath)) | |||||
| checkpoint_dict = torch.load(filepath, map_location=device) | |||||
| print('Complete.') | |||||
| return checkpoint_dict | |||||
| class AttrDict(dict): | |||||
| def __init__(self, *args, **kwargs): | |||||
| super(AttrDict, self).__init__(*args, **kwargs) | |||||
| self.__dict__ = self | |||||
| @MODELS.register_module(Tasks.text_to_speech, module_name=r'hifigan16k') | |||||
| class Hifigan16k(Model): | |||||
| def __init__(self, model_dir, *args, **kwargs): | |||||
| self._ckpt_path = os.path.join(model_dir, | |||||
| ModelFile.TORCH_MODEL_BIN_FILE) | |||||
| self._config = AttrDict(**kwargs) | |||||
| super().__init__(self._ckpt_path, *args, **kwargs) | |||||
| if torch.cuda.is_available(): | |||||
| torch.manual_seed(self._config.seed) | |||||
| self._device = torch.device('cuda') | |||||
| else: | |||||
| self._device = torch.device('cpu') | |||||
| self._generator = Generator(self._config).to(self._device) | |||||
| state_dict_g = load_checkpoint(self._ckpt_path, self._device) | |||||
| self._generator.load_state_dict(state_dict_g['generator']) | |||||
| self._generator.eval() | |||||
| self._generator.remove_weight_norm() | |||||
| def forward(self, melspec): | |||||
| dim0 = list(melspec.shape)[-1] | |||||
| if dim0 != 80: | |||||
| raise TtsVocoderMelspecShapeMismatchException( | |||||
| 'input melspec mismatch 0 dim require 80 but {}'.format(dim0)) | |||||
| with torch.no_grad(): | |||||
| x = melspec.T | |||||
| x = torch.FloatTensor(x).to(self._device) | |||||
| if len(x.shape) == 2: | |||||
| x = x.unsqueeze(0) | |||||
| y_g_hat = self._generator(x) | |||||
| audio = y_g_hat.squeeze() | |||||
| audio = audio * MAX_WAV_VALUE | |||||
| audio = audio.cpu().numpy().astype('int16') | |||||
| return audio | |||||
| @@ -0,0 +1 @@ | |||||
| from .models import Generator | |||||
| @@ -0,0 +1,516 @@ | |||||
| from distutils.version import LooseVersion | |||||
| import torch | |||||
| import torch.nn as nn | |||||
| import torch.nn.functional as F | |||||
| from torch.nn import AvgPool1d, Conv1d, Conv2d, ConvTranspose1d | |||||
| from torch.nn.utils import remove_weight_norm, spectral_norm, weight_norm | |||||
| from .utils import get_padding, init_weights | |||||
| is_pytorch_17plus = LooseVersion(torch.__version__) >= LooseVersion('1.7') | |||||
| def stft(x, fft_size, hop_size, win_length, window): | |||||
| """Perform STFT and convert to magnitude spectrogram. | |||||
| Args: | |||||
| x (Tensor): Input signal tensor (B, T). | |||||
| fft_size (int): FFT size. | |||||
| hop_size (int): Hop size. | |||||
| win_length (int): Window length. | |||||
| window (str): Window function type. | |||||
| Returns: | |||||
| Tensor: Magnitude spectrogram (B, #frames, fft_size // 2 + 1). | |||||
| """ | |||||
| if is_pytorch_17plus: | |||||
| x_stft = torch.stft( | |||||
| x, fft_size, hop_size, win_length, window, return_complex=False) | |||||
| else: | |||||
| x_stft = torch.stft(x, fft_size, hop_size, win_length, window) | |||||
| real = x_stft[..., 0] | |||||
| imag = x_stft[..., 1] | |||||
| # NOTE(kan-bayashi): clamp is needed to avoid nan or inf | |||||
| return torch.sqrt(torch.clamp(real**2 + imag**2, min=1e-7)).transpose(2, 1) | |||||
| LRELU_SLOPE = 0.1 | |||||
| def get_padding_casual(kernel_size, dilation=1): | |||||
| return int(kernel_size * dilation - dilation) | |||||
| class Conv1dCasual(torch.nn.Module): | |||||
| def __init__(self, | |||||
| in_channels, | |||||
| out_channels, | |||||
| kernel_size, | |||||
| stride=1, | |||||
| padding=0, | |||||
| dilation=1, | |||||
| groups=1, | |||||
| bias=True, | |||||
| padding_mode='zeros'): | |||||
| super(Conv1dCasual, self).__init__() | |||||
| self.pad = padding | |||||
| self.conv1d = weight_norm( | |||||
| Conv1d( | |||||
| in_channels, | |||||
| out_channels, | |||||
| kernel_size, | |||||
| stride, | |||||
| padding=0, | |||||
| dilation=dilation, | |||||
| groups=groups, | |||||
| bias=bias, | |||||
| padding_mode=padding_mode)) | |||||
| self.conv1d.apply(init_weights) | |||||
| def forward(self, x): # bdt | |||||
| # described starting from the last dimension and moving forward. | |||||
| x = F.pad(x, (self.pad, 0, 0, 0, 0, 0), 'constant') | |||||
| x = self.conv1d(x) | |||||
| return x | |||||
| def remove_weight_norm(self): | |||||
| remove_weight_norm(self.conv1d) | |||||
| class ConvTranspose1dCausal(torch.nn.Module): | |||||
| """CausalConvTranspose1d module with customized initialization.""" | |||||
| def __init__(self, | |||||
| in_channels, | |||||
| out_channels, | |||||
| kernel_size, | |||||
| stride, | |||||
| padding=0): | |||||
| """Initialize CausalConvTranspose1d module.""" | |||||
| super(ConvTranspose1dCausal, self).__init__() | |||||
| self.deconv = weight_norm( | |||||
| ConvTranspose1d(in_channels, out_channels, kernel_size, stride)) | |||||
| self.stride = stride | |||||
| self.deconv.apply(init_weights) | |||||
| self.pad = kernel_size - stride | |||||
| def forward(self, x): | |||||
| """Calculate forward propagation. | |||||
| Args: | |||||
| x (Tensor): Input tensor (B, in_channels, T_in). | |||||
| Returns: | |||||
| Tensor: Output tensor (B, out_channels, T_out). | |||||
| """ | |||||
| # x = F.pad(x, (self.pad, 0, 0, 0, 0, 0), "constant") | |||||
| return self.deconv(x)[:, :, :-self.pad] | |||||
| def remove_weight_norm(self): | |||||
| remove_weight_norm(self.deconv) | |||||
| class ResBlock1(torch.nn.Module): | |||||
| def __init__(self, h, channels, kernel_size=3, dilation=(1, 3, 5)): | |||||
| super(ResBlock1, self).__init__() | |||||
| self.h = h | |||||
| self.convs1 = nn.ModuleList([ | |||||
| Conv1dCasual( | |||||
| channels, | |||||
| channels, | |||||
| kernel_size, | |||||
| 1, | |||||
| dilation=dilation[i], | |||||
| padding=get_padding_casual(kernel_size, dilation[i])) | |||||
| for i in range(len(dilation)) | |||||
| ]) | |||||
| self.convs2 = nn.ModuleList([ | |||||
| Conv1dCasual( | |||||
| channels, | |||||
| channels, | |||||
| kernel_size, | |||||
| 1, | |||||
| dilation=1, | |||||
| padding=get_padding_casual(kernel_size, 1)) | |||||
| for i in range(len(dilation)) | |||||
| ]) | |||||
| def forward(self, x): | |||||
| for c1, c2 in zip(self.convs1, self.convs2): | |||||
| xt = F.leaky_relu(x, LRELU_SLOPE) | |||||
| xt = c1(xt) | |||||
| xt = F.leaky_relu(xt, LRELU_SLOPE) | |||||
| xt = c2(xt) | |||||
| x = xt + x | |||||
| return x | |||||
| def remove_weight_norm(self): | |||||
| for layer in self.convs1: | |||||
| layer.remove_weight_norm() | |||||
| for layer in self.convs2: | |||||
| layer.remove_weight_norm() | |||||
| class Generator(torch.nn.Module): | |||||
| def __init__(self, h): | |||||
| super(Generator, self).__init__() | |||||
| self.h = h | |||||
| self.num_kernels = len(h.resblock_kernel_sizes) | |||||
| self.num_upsamples = len(h.upsample_rates) | |||||
| print('num_kernels={}, num_upsamples={}'.format( | |||||
| self.num_kernels, self.num_upsamples)) | |||||
| self.conv_pre = Conv1dCasual( | |||||
| 80, h.upsample_initial_channel, 7, 1, padding=7 - 1) | |||||
| resblock = ResBlock1 if h.resblock == '1' else ResBlock2 | |||||
| self.ups = nn.ModuleList() | |||||
| self.repeat_ups = nn.ModuleList() | |||||
| for i, (u, k) in enumerate( | |||||
| zip(h.upsample_rates, h.upsample_kernel_sizes)): | |||||
| upsample = nn.Sequential( | |||||
| nn.Upsample(mode='nearest', scale_factor=u), | |||||
| nn.LeakyReLU(LRELU_SLOPE), | |||||
| Conv1dCasual( | |||||
| h.upsample_initial_channel // (2**i), | |||||
| h.upsample_initial_channel // (2**(i + 1)), | |||||
| kernel_size=7, | |||||
| stride=1, | |||||
| padding=7 - 1)) | |||||
| self.repeat_ups.append(upsample) | |||||
| self.ups.append( | |||||
| ConvTranspose1dCausal( | |||||
| h.upsample_initial_channel // (2**i), | |||||
| h.upsample_initial_channel // (2**(i + 1)), | |||||
| k, | |||||
| u, | |||||
| padding=(k - u) // 2)) | |||||
| self.resblocks = nn.ModuleList() | |||||
| for i in range(len(self.ups)): | |||||
| ch = h.upsample_initial_channel // (2**(i + 1)) | |||||
| for j, (k, d) in enumerate( | |||||
| zip(h.resblock_kernel_sizes, h.resblock_dilation_sizes)): | |||||
| self.resblocks.append(resblock(h, ch, k, d)) | |||||
| self.conv_post = Conv1dCasual(ch, 1, 7, 1, padding=7 - 1) | |||||
| def forward(self, x): | |||||
| x = self.conv_pre(x) | |||||
| for i in range(self.num_upsamples): | |||||
| x = torch.sin(x) + x | |||||
| # transconv | |||||
| x1 = F.leaky_relu(x, LRELU_SLOPE) | |||||
| x1 = self.ups[i](x1) | |||||
| # repeat | |||||
| x2 = self.repeat_ups[i](x) | |||||
| x = x1 + x2 | |||||
| xs = None | |||||
| for j in range(self.num_kernels): | |||||
| if xs is None: | |||||
| xs = self.resblocks[i * self.num_kernels + j](x) | |||||
| else: | |||||
| xs += self.resblocks[i * self.num_kernels + j](x) | |||||
| x = xs / self.num_kernels | |||||
| x = F.leaky_relu(x) | |||||
| x = self.conv_post(x) | |||||
| x = torch.tanh(x) | |||||
| return x | |||||
| def remove_weight_norm(self): | |||||
| print('Removing weight norm...') | |||||
| for layer in self.ups: | |||||
| layer.remove_weight_norm() | |||||
| for layer in self.repeat_ups: | |||||
| layer[-1].remove_weight_norm() | |||||
| for layer in self.resblocks: | |||||
| layer.remove_weight_norm() | |||||
| self.conv_pre.remove_weight_norm() | |||||
| self.conv_post.remove_weight_norm() | |||||
| class DiscriminatorP(torch.nn.Module): | |||||
| def __init__(self, | |||||
| period, | |||||
| kernel_size=5, | |||||
| stride=3, | |||||
| use_spectral_norm=False): | |||||
| super(DiscriminatorP, self).__init__() | |||||
| self.period = period | |||||
| norm_f = weight_norm if use_spectral_norm is False else spectral_norm | |||||
| self.convs = nn.ModuleList([ | |||||
| norm_f( | |||||
| Conv2d( | |||||
| 1, | |||||
| 32, (kernel_size, 1), (stride, 1), | |||||
| padding=(get_padding(5, 1), 0))), | |||||
| norm_f( | |||||
| Conv2d( | |||||
| 32, | |||||
| 128, (kernel_size, 1), (stride, 1), | |||||
| padding=(get_padding(5, 1), 0))), | |||||
| norm_f( | |||||
| Conv2d( | |||||
| 128, | |||||
| 512, (kernel_size, 1), (stride, 1), | |||||
| padding=(get_padding(5, 1), 0))), | |||||
| norm_f( | |||||
| Conv2d( | |||||
| 512, | |||||
| 1024, (kernel_size, 1), (stride, 1), | |||||
| padding=(get_padding(5, 1), 0))), | |||||
| norm_f(Conv2d(1024, 1024, (kernel_size, 1), 1, padding=(2, 0))), | |||||
| ]) | |||||
| self.conv_post = norm_f(Conv2d(1024, 1, (3, 1), 1, padding=(1, 0))) | |||||
| def forward(self, x): | |||||
| fmap = [] | |||||
| # 1d to 2d | |||||
| b, c, t = x.shape | |||||
| if t % self.period != 0: # pad first | |||||
| n_pad = self.period - (t % self.period) | |||||
| x = F.pad(x, (0, n_pad), 'reflect') | |||||
| t = t + n_pad | |||||
| x = x.view(b, c, t // self.period, self.period) | |||||
| for layer in self.convs: | |||||
| x = layer(x) | |||||
| x = F.leaky_relu(x, LRELU_SLOPE) | |||||
| fmap.append(x) | |||||
| x = self.conv_post(x) | |||||
| fmap.append(x) | |||||
| x = torch.flatten(x, 1, -1) | |||||
| return x, fmap | |||||
| class MultiPeriodDiscriminator(torch.nn.Module): | |||||
| def __init__(self): | |||||
| super(MultiPeriodDiscriminator, self).__init__() | |||||
| self.discriminators = nn.ModuleList([ | |||||
| DiscriminatorP(2), | |||||
| DiscriminatorP(3), | |||||
| DiscriminatorP(5), | |||||
| DiscriminatorP(7), | |||||
| DiscriminatorP(11), | |||||
| ]) | |||||
| def forward(self, y, y_hat): | |||||
| y_d_rs = [] | |||||
| y_d_gs = [] | |||||
| fmap_rs = [] | |||||
| fmap_gs = [] | |||||
| for i, d in enumerate(self.discriminators): | |||||
| y_d_r, fmap_r = d(y) | |||||
| y_d_g, fmap_g = d(y_hat) | |||||
| y_d_rs.append(y_d_r) | |||||
| fmap_rs.append(fmap_r) | |||||
| y_d_gs.append(y_d_g) | |||||
| fmap_gs.append(fmap_g) | |||||
| return y_d_rs, y_d_gs, fmap_rs, fmap_gs | |||||
| class DiscriminatorS(torch.nn.Module): | |||||
| def __init__(self, use_spectral_norm=False): | |||||
| super(DiscriminatorS, self).__init__() | |||||
| norm_f = weight_norm if use_spectral_norm is False else spectral_norm | |||||
| self.convs = nn.ModuleList([ | |||||
| norm_f(Conv1d(1, 128, 15, 1, padding=7)), | |||||
| norm_f(Conv1d(128, 128, 41, 2, groups=4, padding=20)), | |||||
| norm_f(Conv1d(128, 256, 41, 2, groups=16, padding=20)), | |||||
| norm_f(Conv1d(256, 512, 41, 4, groups=16, padding=20)), | |||||
| norm_f(Conv1d(512, 1024, 41, 4, groups=16, padding=20)), | |||||
| norm_f(Conv1d(1024, 1024, 41, 1, groups=16, padding=20)), | |||||
| norm_f(Conv1d(1024, 1024, 5, 1, padding=2)), | |||||
| ]) | |||||
| self.conv_post = norm_f(Conv1d(1024, 1, 3, 1, padding=1)) | |||||
| def forward(self, x): | |||||
| fmap = [] | |||||
| for layer in self.convs: | |||||
| x = layer(x) | |||||
| x = F.leaky_relu(x, LRELU_SLOPE) | |||||
| fmap.append(x) | |||||
| x = self.conv_post(x) | |||||
| fmap.append(x) | |||||
| x = torch.flatten(x, 1, -1) | |||||
| return x, fmap | |||||
| class MultiScaleDiscriminator(torch.nn.Module): | |||||
| def __init__(self): | |||||
| super(MultiScaleDiscriminator, self).__init__() | |||||
| self.discriminators = nn.ModuleList([ | |||||
| DiscriminatorS(use_spectral_norm=True), | |||||
| DiscriminatorS(), | |||||
| DiscriminatorS(), | |||||
| ]) | |||||
| from pytorch_wavelets import DWT1DForward | |||||
| self.meanpools = nn.ModuleList( | |||||
| [DWT1DForward(wave='db3', J=1), | |||||
| DWT1DForward(wave='db3', J=1)]) | |||||
| self.convs = nn.ModuleList([ | |||||
| weight_norm(Conv1d(2, 1, 15, 1, padding=7)), | |||||
| weight_norm(Conv1d(2, 1, 15, 1, padding=7)) | |||||
| ]) | |||||
| def forward(self, y, y_hat): | |||||
| y_d_rs = [] | |||||
| y_d_gs = [] | |||||
| fmap_rs = [] | |||||
| fmap_gs = [] | |||||
| for i, d in enumerate(self.discriminators): | |||||
| if i != 0: | |||||
| yl, yh = self.meanpools[i - 1](y) | |||||
| y = torch.cat([yl, yh[0]], dim=1) | |||||
| y = self.convs[i - 1](y) | |||||
| y = F.leaky_relu(y, LRELU_SLOPE) | |||||
| yl_hat, yh_hat = self.meanpools[i - 1](y_hat) | |||||
| y_hat = torch.cat([yl_hat, yh_hat[0]], dim=1) | |||||
| y_hat = self.convs[i - 1](y_hat) | |||||
| y_hat = F.leaky_relu(y_hat, LRELU_SLOPE) | |||||
| y_d_r, fmap_r = d(y) | |||||
| y_d_g, fmap_g = d(y_hat) | |||||
| y_d_rs.append(y_d_r) | |||||
| fmap_rs.append(fmap_r) | |||||
| y_d_gs.append(y_d_g) | |||||
| fmap_gs.append(fmap_g) | |||||
| return y_d_rs, y_d_gs, fmap_rs, fmap_gs | |||||
| class DiscriminatorSTFT(torch.nn.Module): | |||||
| def __init__(self, | |||||
| kernel_size=11, | |||||
| stride=2, | |||||
| use_spectral_norm=False, | |||||
| fft_size=1024, | |||||
| shift_size=120, | |||||
| win_length=600, | |||||
| window='hann_window'): | |||||
| super(DiscriminatorSTFT, self).__init__() | |||||
| self.fft_size = fft_size | |||||
| self.shift_size = shift_size | |||||
| self.win_length = win_length | |||||
| norm_f = weight_norm if use_spectral_norm is False else spectral_norm | |||||
| self.convs = nn.ModuleList([ | |||||
| norm_f( | |||||
| Conv2d( | |||||
| fft_size // 2 + 1, | |||||
| 32, (15, 1), (1, 1), | |||||
| padding=(get_padding(15, 1), 0))), | |||||
| norm_f( | |||||
| Conv2d( | |||||
| 32, | |||||
| 32, (kernel_size, 1), (stride, 1), | |||||
| padding=(get_padding(9, 1), 0))), | |||||
| norm_f( | |||||
| Conv2d( | |||||
| 32, | |||||
| 32, (kernel_size, 1), (stride, 1), | |||||
| padding=(get_padding(9, 1), 0))), | |||||
| norm_f( | |||||
| Conv2d( | |||||
| 32, | |||||
| 32, (kernel_size, 1), (stride, 1), | |||||
| padding=(get_padding(9, 1), 0))), | |||||
| norm_f(Conv2d(32, 32, (5, 1), (1, 1), padding=(2, 0))), | |||||
| ]) | |||||
| self.conv_post = norm_f(Conv2d(32, 1, (3, 1), (1, 1), padding=(1, 0))) | |||||
| self.register_buffer('window', getattr(torch, window)(win_length)) | |||||
| def forward(self, wav): | |||||
| wav = torch.squeeze(wav, 1) | |||||
| x_mag = stft(wav, self.fft_size, self.shift_size, self.win_length, | |||||
| self.window) | |||||
| x = torch.transpose(x_mag, 2, 1).unsqueeze(-1) | |||||
| fmap = [] | |||||
| for layer in self.convs: | |||||
| x = layer(x) | |||||
| x = F.leaky_relu(x, LRELU_SLOPE) | |||||
| fmap.append(x) | |||||
| x = self.conv_post(x) | |||||
| fmap.append(x) | |||||
| x = x.squeeze(-1) | |||||
| return x, fmap | |||||
| class MultiSTFTDiscriminator(torch.nn.Module): | |||||
| def __init__( | |||||
| self, | |||||
| fft_sizes=[1024, 2048, 512], | |||||
| hop_sizes=[120, 240, 50], | |||||
| win_lengths=[600, 1200, 240], | |||||
| window='hann_window', | |||||
| ): | |||||
| super(MultiSTFTDiscriminator, self).__init__() | |||||
| self.discriminators = nn.ModuleList() | |||||
| for fs, ss, wl in zip(fft_sizes, hop_sizes, win_lengths): | |||||
| self.discriminators += [ | |||||
| DiscriminatorSTFT(fft_size=fs, shift_size=ss, win_length=wl) | |||||
| ] | |||||
| def forward(self, y, y_hat): | |||||
| y_d_rs = [] | |||||
| y_d_gs = [] | |||||
| fmap_rs = [] | |||||
| fmap_gs = [] | |||||
| for i, d in enumerate(self.discriminators): | |||||
| y_d_r, fmap_r = d(y) | |||||
| y_d_g, fmap_g = d(y_hat) | |||||
| y_d_rs.append(y_d_r) | |||||
| fmap_rs.append(fmap_r) | |||||
| y_d_gs.append(y_d_g) | |||||
| fmap_gs.append(fmap_g) | |||||
| return y_d_rs, y_d_gs, fmap_rs, fmap_gs | |||||
| def feature_loss(fmap_r, fmap_g): | |||||
| loss = 0 | |||||
| for dr, dg in zip(fmap_r, fmap_g): | |||||
| for rl, gl in zip(dr, dg): | |||||
| loss += torch.mean(torch.abs(rl - gl)) | |||||
| return loss * 2 | |||||
| def discriminator_loss(disc_real_outputs, disc_generated_outputs): | |||||
| loss = 0 | |||||
| r_losses = [] | |||||
| g_losses = [] | |||||
| for dr, dg in zip(disc_real_outputs, disc_generated_outputs): | |||||
| r_loss = torch.mean((1 - dr)**2) | |||||
| g_loss = torch.mean(dg**2) | |||||
| loss += (r_loss + g_loss) | |||||
| r_losses.append(r_loss.item()) | |||||
| g_losses.append(g_loss.item()) | |||||
| return loss, r_losses, g_losses | |||||
| def generator_loss(disc_outputs): | |||||
| loss = 0 | |||||
| gen_losses = [] | |||||
| for dg in disc_outputs: | |||||
| temp_loss = torch.mean((1 - dg)**2) | |||||
| gen_losses.append(temp_loss) | |||||
| loss += temp_loss | |||||
| return loss, gen_losses | |||||
| @@ -0,0 +1,59 @@ | |||||
| import glob | |||||
| import os | |||||
| import matplotlib | |||||
| import matplotlib.pylab as plt | |||||
| import torch | |||||
| from torch.nn.utils import weight_norm | |||||
| matplotlib.use('Agg') | |||||
| def plot_spectrogram(spectrogram): | |||||
| fig, ax = plt.subplots(figsize=(10, 2)) | |||||
| im = ax.imshow( | |||||
| spectrogram, aspect='auto', origin='lower', interpolation='none') | |||||
| plt.colorbar(im, ax=ax) | |||||
| fig.canvas.draw() | |||||
| plt.close() | |||||
| return fig | |||||
| def init_weights(m, mean=0.0, std=0.01): | |||||
| classname = m.__class__.__name__ | |||||
| if classname.find('Conv') != -1: | |||||
| m.weight.data.normal_(mean, std) | |||||
| def apply_weight_norm(m): | |||||
| classname = m.__class__.__name__ | |||||
| if classname.find('Conv') != -1: | |||||
| weight_norm(m) | |||||
| def get_padding(kernel_size, dilation=1): | |||||
| return int((kernel_size * dilation - dilation) / 2) | |||||
| def load_checkpoint(filepath, device): | |||||
| assert os.path.isfile(filepath) | |||||
| print("Loading '{}'".format(filepath)) | |||||
| checkpoint_dict = torch.load(filepath, map_location=device) | |||||
| print('Complete.') | |||||
| return checkpoint_dict | |||||
| def save_checkpoint(filepath, obj): | |||||
| print('Saving checkpoint to {}'.format(filepath)) | |||||
| torch.save(obj, filepath) | |||||
| print('Complete.') | |||||
| def scan_checkpoint(cp_dir, prefix): | |||||
| pattern = os.path.join(cp_dir, prefix + '????????') | |||||
| cp_list = glob.glob(pattern) | |||||
| if len(cp_list) == 0: | |||||
| return None | |||||
| return sorted(cp_list)[-1] | |||||
| @@ -62,4 +62,6 @@ class Model(ABC): | |||||
| if hasattr(model_cfg, 'model_type') and not hasattr(model_cfg, 'type'): | if hasattr(model_cfg, 'model_type') and not hasattr(model_cfg, 'type'): | ||||
| model_cfg.type = model_cfg.model_type | model_cfg.type = model_cfg.model_type | ||||
| model_cfg.model_dir = local_model_dir | model_cfg.model_dir = local_model_dir | ||||
| for k, v in kwargs.items(): | |||||
| model_cfg.k = v | |||||
| return build_model(model_cfg, task_name) | return build_model(model_cfg, task_name) | ||||
| @@ -0,0 +1 @@ | |||||
| from .image_captioning_model import OfaForImageCaptioning | |||||
| @@ -0,0 +1,80 @@ | |||||
| import os.path as osp | |||||
| from typing import Any, Dict | |||||
| from PIL import Image | |||||
| from modelscope.utils.constant import ModelFile, Tasks | |||||
| from ..base import Model | |||||
| from ..builder import MODELS | |||||
| __all__ = ['OfaForImageCaptioning'] | |||||
| @MODELS.register_module( | |||||
| Tasks.image_captioning, module_name=r'ofa-image-captioning') | |||||
| class OfaForImageCaptioning(Model): | |||||
| def __init__(self, model_dir, *args, **kwargs): | |||||
| super().__init__(model_dir=model_dir, *args, **kwargs) | |||||
| ckpt_name = ModelFile.TORCH_MODEL_FILE | |||||
| local_model = osp.join(model_dir, ckpt_name) | |||||
| bpe_dir = model_dir | |||||
| # turn on cuda if GPU is available | |||||
| from fairseq import checkpoint_utils, tasks, utils | |||||
| from ofa.tasks.mm_tasks import CaptionTask | |||||
| from ofa.utils.eval_utils import eval_caption | |||||
| self.eval_caption = eval_caption | |||||
| tasks.register_task('caption', CaptionTask) | |||||
| use_cuda = kwargs['use_cuda'] if 'use_cuda' in kwargs else False | |||||
| use_fp16 = kwargs[ | |||||
| 'use_fp16'] if 'use_fp16' in kwargs and use_cuda else False | |||||
| overrides = { | |||||
| 'bpe_dir': bpe_dir, | |||||
| 'eval_cider': False, | |||||
| 'beam': 5, | |||||
| 'max_len_b': 16, | |||||
| 'no_repeat_ngram_size': 3, | |||||
| 'seed': 7 | |||||
| } | |||||
| models, cfg, task = checkpoint_utils.load_model_ensemble_and_task( | |||||
| utils.split_paths(local_model), arg_overrides=overrides) | |||||
| # Move models to GPU | |||||
| for model in models: | |||||
| model.eval() | |||||
| if use_cuda: | |||||
| model.cuda() | |||||
| if use_fp16: | |||||
| model.half() | |||||
| model.prepare_for_inference_(cfg) | |||||
| self.models = models | |||||
| # Initialize generator | |||||
| self.generator = task.build_generator(models, cfg.generation) | |||||
| # Initialize transform | |||||
| from torchvision import transforms | |||||
| mean = [0.5, 0.5, 0.5] | |||||
| std = [0.5, 0.5, 0.5] | |||||
| self.patch_resize_transform = transforms.Compose([ | |||||
| lambda image: image.convert('RGB'), | |||||
| transforms.Resize( | |||||
| (cfg.task.patch_image_size, cfg.task.patch_image_size), | |||||
| interpolation=Image.BICUBIC), | |||||
| transforms.ToTensor(), | |||||
| transforms.Normalize(mean=mean, std=std), | |||||
| ]) | |||||
| self.task = task | |||||
| def forward(self, input: Dict[str, Any]) -> Dict[str, Any]: | |||||
| results, _ = self.eval_caption(self.task, self.generator, self.models, | |||||
| input) | |||||
| return { | |||||
| 'image_id': results[0]['image_id'], | |||||
| 'caption': results[0]['caption'] | |||||
| } | |||||
| def postprocess(self, inputs: Dict[str, Any]) -> Dict[str, Any]: | |||||
| # What should we do here ? | |||||
| return inputs | |||||
| @@ -1,4 +1,5 @@ | |||||
| from .masked_language_model import * # noqa F403 | from .masked_language_model import * # noqa F403 | ||||
| from .sentence_similarity_model import * # noqa F403 | |||||
| from .sequence_classification_model import * # noqa F403 | |||||
| from .text_generation_model import * # noqa F403 | |||||
| from .bert_for_sequence_classification import * # noqa F403 | |||||
| from .palm_for_text_generation import * # noqa F403 | |||||
| from .sbert_for_sentence_similarity import * # noqa F403 | |||||
| from .sbert_for_token_classification import * # noqa F403 | |||||
| @@ -0,0 +1,43 @@ | |||||
| from typing import Dict | |||||
| from modelscope.utils.constant import Tasks | |||||
| from ..base import Model, Tensor | |||||
| from ..builder import MODELS | |||||
| __all__ = ['PalmForTextGeneration'] | |||||
| @MODELS.register_module(Tasks.text_generation, module_name=r'palm2.0') | |||||
| class PalmForTextGeneration(Model): | |||||
| def __init__(self, model_dir: str, *args, **kwargs): | |||||
| """initialize the text generation model from the `model_dir` path. | |||||
| Args: | |||||
| model_dir (str): the model path. | |||||
| model_cls (Optional[Any], optional): model loader, if None, use the | |||||
| default loader to load model weights, by default None. | |||||
| """ | |||||
| super().__init__(model_dir, *args, **kwargs) | |||||
| self.model_dir = model_dir | |||||
| from sofa.models.palm_v2 import PalmForConditionalGeneration, Translator | |||||
| model = PalmForConditionalGeneration.from_pretrained(model_dir) | |||||
| self.tokenizer = model.tokenizer | |||||
| self.generator = Translator(model) | |||||
| def forward(self, input: Dict[str, Tensor]) -> Dict[str, Tensor]: | |||||
| """return the result by the model | |||||
| Args: | |||||
| input (Dict[str, Tensor]): the preprocessed data | |||||
| Returns: | |||||
| Dict[str, Tensor]: results | |||||
| Example: | |||||
| { | |||||
| 'predictions': Tensor([[1377, 4959, 2785, 6392...])]), # tokens need to be decode by tokenizer | |||||
| } | |||||
| """ | |||||
| return self.generator(**input) | |||||
| @@ -0,0 +1,56 @@ | |||||
| from typing import Any, Dict, Union | |||||
| import numpy as np | |||||
| import torch | |||||
| from sofa import SbertConfig, SbertForTokenClassification | |||||
| from modelscope.utils.constant import Tasks | |||||
| from ..base import Model, Tensor | |||||
| from ..builder import MODELS | |||||
| __all__ = ['StructBertForTokenClassification'] | |||||
| @MODELS.register_module( | |||||
| Tasks.word_segmentation, | |||||
| module_name=r'structbert-chinese-word-segmentation') | |||||
| class StructBertForTokenClassification(Model): | |||||
| def __init__(self, model_dir: str, *args, **kwargs): | |||||
| """initialize the word segmentation model from the `model_dir` path. | |||||
| Args: | |||||
| model_dir (str): the model path. | |||||
| model_cls (Optional[Any], optional): model loader, if None, use the | |||||
| default loader to load model weights, by default None. | |||||
| """ | |||||
| super().__init__(model_dir, *args, **kwargs) | |||||
| self.model_dir = model_dir | |||||
| self.model = SbertForTokenClassification.from_pretrained( | |||||
| self.model_dir) | |||||
| self.config = SbertConfig.from_pretrained(self.model_dir) | |||||
| def forward(self, input: Dict[str, | |||||
| Any]) -> Dict[str, Union[str, np.ndarray]]: | |||||
| """return the result by the model | |||||
| Args: | |||||
| input (Dict[str, Any]): the preprocessed data | |||||
| Returns: | |||||
| Dict[str, Union[str,np.ndarray]]: results | |||||
| Example: | |||||
| { | |||||
| 'predictions': array([1,4]), # lable 0-negative 1-positive | |||||
| 'logits': array([[-0.53860897, 1.5029076 ]], dtype=float32) # true value | |||||
| 'text': str(今天), | |||||
| } | |||||
| """ | |||||
| input_ids = torch.tensor(input['input_ids']).unsqueeze(0) | |||||
| output = self.model(input_ids) | |||||
| logits = output.logits | |||||
| pred = torch.argmax(logits[0], dim=-1) | |||||
| pred = pred.numpy() | |||||
| rst = {'predictions': pred, 'logits': logits, 'text': input['text']} | |||||
| return rst | |||||
| @@ -1,52 +0,0 @@ | |||||
| from typing import Any, Dict | |||||
| from modelscope.utils.constant import Tasks | |||||
| from ..base import Model, Tensor | |||||
| from ..builder import MODELS | |||||
| __all__ = ['PalmForTextGenerationModel'] | |||||
| @MODELS.register_module(Tasks.text_generation, module_name=r'palm') | |||||
| class PalmForTextGenerationModel(Model): | |||||
| def __init__(self, model_dir: str, *args, **kwargs): | |||||
| """initialize the text generation model from the `model_dir` path. | |||||
| Args: | |||||
| model_dir (str): the model path. | |||||
| model_cls (Optional[Any], optional): model loader, if None, use the | |||||
| default loader to load model weights, by default None. | |||||
| """ | |||||
| from sofa import PalmTokenizer | |||||
| super().__init__(model_dir, *args, **kwargs) | |||||
| self.model_dir = model_dir | |||||
| from sofa.models.palm import PalmForConditionalGeneration, TextGenerator | |||||
| tokenizer = kwargs.pop('tokenizer', | |||||
| PalmTokenizer.from_pretrained(model_dir)) | |||||
| model = PalmForConditionalGeneration.from_pretrained(model_dir) | |||||
| self.generator = TextGenerator(model, tokenizer) | |||||
| def forward(self, input: Dict[str, Tensor]) -> Dict[str, Tensor]: | |||||
| """return the result by the model | |||||
| Args: | |||||
| input (Dict[str, Any]): the preprocessed data | |||||
| Returns: | |||||
| Dict[str, np.ndarray]: results | |||||
| Example: | |||||
| { | |||||
| 'predictions': array([1]), # lable 0-negative 1-positive | |||||
| 'probabilities': array([[0.11491239, 0.8850876 ]], dtype=float32), | |||||
| 'logits': array([[-0.53860897, 1.5029076 ]], dtype=float32) # true value | |||||
| } | |||||
| """ | |||||
| encoder_inputs = [ | |||||
| input['input_ids'], input['token_type_ids'], | |||||
| input['attention_mask'] | |||||
| ] | |||||
| return self.generator(encoder_inputs) | |||||
| @@ -1,4 +1,4 @@ | |||||
| from .audio import * # noqa F403 | |||||
| from .audio import LinearAECPipeline | |||||
| from .base import Pipeline | from .base import Pipeline | ||||
| from .builder import pipeline | from .builder import pipeline | ||||
| from .cv import * # noqa F403 | from .cv import * # noqa F403 | ||||
| @@ -0,0 +1,2 @@ | |||||
| from .linear_aec_pipeline import LinearAECPipeline | |||||
| from .text_to_speech_pipeline import * # noqa F403 | |||||
| @@ -0,0 +1,160 @@ | |||||
| import importlib | |||||
| import os | |||||
| from typing import Any, Dict | |||||
| import numpy as np | |||||
| import scipy.io.wavfile as wav | |||||
| import torch | |||||
| import yaml | |||||
| from modelscope.preprocessors.audio import LinearAECAndFbank | |||||
| from modelscope.utils.constant import ModelFile, Tasks | |||||
| from ..base import Pipeline | |||||
| from ..builder import PIPELINES | |||||
| FEATURE_MVN = 'feature.DEY.mvn.txt' | |||||
| CONFIG_YAML = 'dey_mini.yaml' | |||||
| def initialize_config(module_cfg): | |||||
| r"""According to config items, load specific module dynamically with params. | |||||
| 1. Load the module corresponding to the "module" param. | |||||
| 2. Call function (or instantiate class) corresponding to the "main" param. | |||||
| 3. Send the param (in "args") into the function (or class) when calling ( or instantiating). | |||||
| Args: | |||||
| module_cfg (dict): config items, eg: | |||||
| { | |||||
| "module": "models.model", | |||||
| "main": "Model", | |||||
| "args": {...} | |||||
| } | |||||
| Returns: | |||||
| the module loaded. | |||||
| """ | |||||
| module = importlib.import_module(module_cfg['module']) | |||||
| return getattr(module, module_cfg['main'])(**module_cfg['args']) | |||||
| @PIPELINES.register_module( | |||||
| Tasks.speech_signal_process, module_name=r'speech_dfsmn_aec_psm_16k') | |||||
| class LinearAECPipeline(Pipeline): | |||||
| r"""AEC Inference Pipeline only support 16000 sample rate. | |||||
| When invoke the class with pipeline.__call__(), you should provide two params: | |||||
| Dict[str, Any] | |||||
| the path of wav files,eg:{ | |||||
| "nearend_mic": "/your/data/near_end_mic_audio.wav", | |||||
| "farend_speech": "/your/data/far_end_speech_audio.wav"} | |||||
| output_path (str, optional): "/your/output/audio_after_aec.wav" | |||||
| the file path to write generate audio. | |||||
| """ | |||||
| def __init__(self, model): | |||||
| r""" | |||||
| Args: | |||||
| model: model id on modelscope hub. | |||||
| """ | |||||
| super().__init__(model=model) | |||||
| self.use_cuda = torch.cuda.is_available() | |||||
| with open( | |||||
| os.path.join(self.model, CONFIG_YAML), encoding='utf-8') as f: | |||||
| self.config = yaml.full_load(f.read()) | |||||
| self.config['io']['mvn'] = os.path.join(self.model, FEATURE_MVN) | |||||
| self._init_model() | |||||
| self.preprocessor = LinearAECAndFbank(self.config['io']) | |||||
| n_fft = self.config['loss']['args']['n_fft'] | |||||
| hop_length = self.config['loss']['args']['hop_length'] | |||||
| winlen = n_fft | |||||
| window = torch.hamming_window(winlen, periodic=False) | |||||
| def stft(x): | |||||
| return torch.stft( | |||||
| x, | |||||
| n_fft, | |||||
| hop_length, | |||||
| winlen, | |||||
| center=False, | |||||
| window=window.to(x.device), | |||||
| return_complex=False) | |||||
| def istft(x, slen): | |||||
| return torch.istft( | |||||
| x, | |||||
| n_fft, | |||||
| hop_length, | |||||
| winlen, | |||||
| window=window.to(x.device), | |||||
| center=False, | |||||
| length=slen) | |||||
| self.stft = stft | |||||
| self.istft = istft | |||||
| def _init_model(self): | |||||
| checkpoint = torch.load( | |||||
| os.path.join(self.model, ModelFile.TORCH_MODEL_BIN_FILE), | |||||
| map_location='cpu') | |||||
| self.model = initialize_config(self.config['nnet']) | |||||
| if self.use_cuda: | |||||
| self.model = self.model.cuda() | |||||
| self.model.load_state_dict(checkpoint) | |||||
| def forward(self, inputs: Dict[str, Any]) -> Dict[str, Any]: | |||||
| r"""The AEC process. | |||||
| Args: | |||||
| inputs: dict={'feature': Tensor, 'base': Tensor} | |||||
| 'feature' feature of input audio. | |||||
| 'base' the base audio to mask. | |||||
| Returns: | |||||
| dict: | |||||
| { | |||||
| 'output_pcm': generated audio array | |||||
| } | |||||
| """ | |||||
| output_data = self._process(inputs['feature'], inputs['base']) | |||||
| return {'output_pcm': output_data} | |||||
| def postprocess(self, inputs: Dict[str, Any], **kwargs) -> Dict[str, Any]: | |||||
| r"""The post process. Will save audio to file, if the output_path is given. | |||||
| Args: | |||||
| inputs: dict: | |||||
| { | |||||
| 'output_pcm': generated audio array | |||||
| } | |||||
| kwargs: accept 'output_path' which is the path to write generated audio | |||||
| Returns: | |||||
| dict: | |||||
| { | |||||
| 'output_pcm': generated audio array | |||||
| } | |||||
| """ | |||||
| if 'output_path' in kwargs.keys(): | |||||
| wav.write(kwargs['output_path'], self.preprocessor.SAMPLE_RATE, | |||||
| inputs['output_pcm'].astype(np.int16)) | |||||
| inputs['output_pcm'] = inputs['output_pcm'] / 32768.0 | |||||
| return inputs | |||||
| def _process(self, fbanks, mixture): | |||||
| if self.use_cuda: | |||||
| fbanks = fbanks.cuda() | |||||
| mixture = mixture.cuda() | |||||
| if self.model.vad: | |||||
| with torch.no_grad(): | |||||
| masks, vad = self.model(fbanks.unsqueeze(0)) | |||||
| masks = masks.permute([2, 1, 0]) | |||||
| else: | |||||
| with torch.no_grad(): | |||||
| masks = self.model(fbanks.unsqueeze(0)) | |||||
| masks = masks.permute([2, 1, 0]) | |||||
| spectrum = self.stft(mixture) | |||||
| masked_spec = spectrum * masks | |||||
| masked_sig = self.istft(masked_spec, len(mixture)).cpu().numpy() | |||||
| return masked_sig | |||||
| @@ -0,0 +1,46 @@ | |||||
| import time | |||||
| from typing import Any, Dict, List | |||||
| import numpy as np | |||||
| from modelscope.models import Model | |||||
| from modelscope.models.audio.tts.am import SambertNetHifi16k | |||||
| from modelscope.models.audio.tts.vocoder import Hifigan16k | |||||
| from modelscope.pipelines.base import Pipeline | |||||
| from modelscope.pipelines.builder import PIPELINES | |||||
| from modelscope.preprocessors import TextToTacotronSymbols, build_preprocessor | |||||
| from modelscope.utils.constant import Fields, Tasks | |||||
| __all__ = ['TextToSpeechSambertHifigan16kPipeline'] | |||||
| @PIPELINES.register_module( | |||||
| Tasks.text_to_speech, module_name=r'tts-sambert-hifigan-16k') | |||||
| class TextToSpeechSambertHifigan16kPipeline(Pipeline): | |||||
| def __init__(self, | |||||
| config_file: str = None, | |||||
| model: List[Model] = None, | |||||
| preprocessor: TextToTacotronSymbols = None, | |||||
| **kwargs): | |||||
| super().__init__( | |||||
| config_file=config_file, | |||||
| model=model, | |||||
| preprocessor=preprocessor, | |||||
| **kwargs) | |||||
| assert len(model) == 2, 'model number should be 2' | |||||
| self._am = model[0] | |||||
| self._vocoder = model[1] | |||||
| self._preprocessor = preprocessor | |||||
| def forward(self, inputs: Dict[str, Any]) -> Dict[str, np.ndarray]: | |||||
| texts = inputs['texts'] | |||||
| audio_total = np.empty((0), dtype='int16') | |||||
| for line in texts: | |||||
| line = line.strip().split('\t') | |||||
| audio = self._vocoder.forward(self._am.forward(line[1])) | |||||
| audio_total = np.append(audio_total, audio, axis=0) | |||||
| return {'output': audio_total} | |||||
| def postprocess(self, inputs: Dict[str, Any]) -> Dict[str, Any]: | |||||
| return inputs | |||||
| @@ -13,18 +13,23 @@ PIPELINES = Registry('pipelines') | |||||
| DEFAULT_MODEL_FOR_PIPELINE = { | DEFAULT_MODEL_FOR_PIPELINE = { | ||||
| # TaskName: (pipeline_module_name, model_repo) | # TaskName: (pipeline_module_name, model_repo) | ||||
| Tasks.word_segmentation: | |||||
| ('structbert-chinese-word-segmentation', | |||||
| 'damo/nlp_structbert_word-segmentation_chinese-base'), | |||||
| Tasks.sentence_similarity: | Tasks.sentence_similarity: | ||||
| ('sbert-base-chinese-sentence-similarity', | ('sbert-base-chinese-sentence-similarity', | ||||
| 'damo/nlp_structbert_sentence-similarity_chinese-base'), | 'damo/nlp_structbert_sentence-similarity_chinese-base'), | ||||
| Tasks.image_matting: ('image-matting', 'damo/cv_unet_image-matting_damo'), | |||||
| Tasks.image_matting: ('image-matting', 'damo/cv_unet_image-matting'), | |||||
| Tasks.text_classification: | Tasks.text_classification: | ||||
| ('bert-sentiment-analysis', 'damo/bert-base-sst2'), | ('bert-sentiment-analysis', 'damo/bert-base-sst2'), | ||||
| Tasks.text_generation: ('palm', 'damo/nlp_palm_text-generation_chinese'), | |||||
| Tasks.image_captioning: ('ofa', None), | |||||
| Tasks.text_generation: ('palm2.0', | |||||
| 'damo/nlp_palm2.0_text-generation_chinese-base'), | |||||
| Tasks.image_captioning: ('ofa', 'damo/ofa_image-caption_coco_large_en'), | |||||
| Tasks.image_generation: | Tasks.image_generation: | ||||
| ('person-image-cartoon', | ('person-image-cartoon', | ||||
| 'damo/cv_unet_person-image-cartoon_compound-models'), | 'damo/cv_unet_person-image-cartoon_compound-models'), | ||||
| Tasks.fill_mask: ('sbert', 'damo/nlp_structbert_fill-mask_chinese-large'), | |||||
| Tasks.ocr_detection: ('ocr-detection', | |||||
| 'damo/cv_resnet18_ocr-detection-line-level_damo'), | |||||
| Tasks.fill_mask: ('veco', 'damo/nlp_veco_fill-mask_large') | Tasks.fill_mask: ('veco', 'damo/nlp_veco_fill-mask_large') | ||||
| } | } | ||||
| @@ -1,2 +1,3 @@ | |||||
| from .image_cartoon_pipeline import ImageCartoonPipeline | from .image_cartoon_pipeline import ImageCartoonPipeline | ||||
| from .image_matting_pipeline import ImageMattingPipeline | from .image_matting_pipeline import ImageMattingPipeline | ||||
| from .ocr_detection_pipeline import OCRDetectionPipeline | |||||
| @@ -0,0 +1,167 @@ | |||||
| import math | |||||
| import os | |||||
| import os.path as osp | |||||
| import sys | |||||
| from typing import Any, Dict, List, Tuple, Union | |||||
| import cv2 | |||||
| import numpy as np | |||||
| import PIL | |||||
| import tensorflow as tf | |||||
| import tf_slim as slim | |||||
| from modelscope.pipelines.base import Input | |||||
| from modelscope.preprocessors import load_image | |||||
| from modelscope.utils.constant import ModelFile, Tasks | |||||
| from modelscope.utils.logger import get_logger | |||||
| from ..base import Pipeline | |||||
| from ..builder import PIPELINES | |||||
| from .ocr_utils import model_resnet_mutex_v4_linewithchar, ops, utils | |||||
| if tf.__version__ >= '2.0': | |||||
| tf = tf.compat.v1 | |||||
| tf.compat.v1.disable_eager_execution() | |||||
| logger = get_logger() | |||||
| # constant | |||||
| RBOX_DIM = 5 | |||||
| OFFSET_DIM = 6 | |||||
| WORD_POLYGON_DIM = 8 | |||||
| OFFSET_VARIANCE = [0.1, 0.1, 0.1, 0.1, 0.1, 0.1] | |||||
| FLAGS = tf.app.flags.FLAGS | |||||
| tf.app.flags.DEFINE_float('node_threshold', 0.4, | |||||
| 'Confidence threshold for nodes') | |||||
| tf.app.flags.DEFINE_float('link_threshold', 0.6, | |||||
| 'Confidence threshold for links') | |||||
| @PIPELINES.register_module( | |||||
| Tasks.ocr_detection, module_name=Tasks.ocr_detection) | |||||
| class OCRDetectionPipeline(Pipeline): | |||||
| def __init__(self, model: str): | |||||
| super().__init__(model=model) | |||||
| model_path = osp.join( | |||||
| osp.join(self.model, ModelFile.TF_CHECKPOINT_FOLDER), | |||||
| 'checkpoint-80000') | |||||
| config = tf.ConfigProto(allow_soft_placement=True) | |||||
| config.gpu_options.allow_growth = True | |||||
| self._session = tf.Session(config=config) | |||||
| global_step = tf.get_variable( | |||||
| 'global_step', [], | |||||
| initializer=tf.constant_initializer(0), | |||||
| dtype=tf.int64, | |||||
| trainable=False) | |||||
| variable_averages = tf.train.ExponentialMovingAverage( | |||||
| 0.997, global_step) | |||||
| self.input_images = tf.placeholder( | |||||
| tf.float32, shape=[1, 1024, 1024, 3], name='input_images') | |||||
| self.output = {} | |||||
| # detector | |||||
| detector = model_resnet_mutex_v4_linewithchar.SegLinkDetector() | |||||
| all_maps = detector.build_model(self.input_images, is_training=False) | |||||
| # decode local predictions | |||||
| all_nodes, all_links, all_reg = [], [], [] | |||||
| for i, maps in enumerate(all_maps): | |||||
| cls_maps, lnk_maps, reg_maps = maps[0], maps[1], maps[2] | |||||
| reg_maps = tf.multiply(reg_maps, OFFSET_VARIANCE) | |||||
| cls_prob = tf.nn.softmax(tf.reshape(cls_maps, [-1, 2])) | |||||
| lnk_prob_pos = tf.nn.softmax(tf.reshape(lnk_maps, [-1, 4])[:, :2]) | |||||
| lnk_prob_mut = tf.nn.softmax(tf.reshape(lnk_maps, [-1, 4])[:, 2:]) | |||||
| lnk_prob = tf.concat([lnk_prob_pos, lnk_prob_mut], axis=1) | |||||
| all_nodes.append(cls_prob) | |||||
| all_links.append(lnk_prob) | |||||
| all_reg.append(reg_maps) | |||||
| # decode segments and links | |||||
| image_size = tf.shape(self.input_images)[1:3] | |||||
| segments, group_indices, segment_counts, _ = ops.decode_segments_links_python( | |||||
| image_size, | |||||
| all_nodes, | |||||
| all_links, | |||||
| all_reg, | |||||
| anchor_sizes=list(detector.anchor_sizes)) | |||||
| # combine segments | |||||
| combined_rboxes, combined_counts = ops.combine_segments_python( | |||||
| segments, group_indices, segment_counts) | |||||
| self.output['combined_rboxes'] = combined_rboxes | |||||
| self.output['combined_counts'] = combined_counts | |||||
| with self._session.as_default() as sess: | |||||
| logger.info(f'loading model from {model_path}') | |||||
| # load model | |||||
| model_loader = tf.train.Saver( | |||||
| variable_averages.variables_to_restore()) | |||||
| model_loader.restore(sess, model_path) | |||||
| def preprocess(self, input: Input) -> Dict[str, Any]: | |||||
| if isinstance(input, str): | |||||
| img = np.array(load_image(input)) | |||||
| elif isinstance(input, PIL.Image.Image): | |||||
| img = np.array(input.convert('RGB')) | |||||
| elif isinstance(input, np.ndarray): | |||||
| if len(input.shape) == 2: | |||||
| img = cv2.cvtColor(img, cv2.COLOR_GRAY2BGR) | |||||
| img = input[:, :, ::-1] # in rgb order | |||||
| else: | |||||
| raise TypeError(f'input should be either str, PIL.Image,' | |||||
| f' np.array, but got {type(input)}') | |||||
| h, w, c = img.shape | |||||
| img_pad = np.zeros((max(h, w), max(h, w), 3), dtype=np.float32) | |||||
| img_pad[:h, :w, :] = img | |||||
| resize_size = 1024 | |||||
| img_pad_resize = cv2.resize(img_pad, (resize_size, resize_size)) | |||||
| img_pad_resize = cv2.cvtColor(img_pad_resize, cv2.COLOR_RGB2BGR) | |||||
| img_pad_resize = img_pad_resize - np.array([123.68, 116.78, 103.94], | |||||
| dtype=np.float32) | |||||
| resize_size = tf.stack([resize_size, resize_size]) | |||||
| orig_size = tf.stack([max(h, w), max(h, w)]) | |||||
| self.output['orig_size'] = orig_size | |||||
| self.output['resize_size'] = resize_size | |||||
| result = {'img': np.expand_dims(img_pad_resize, axis=0)} | |||||
| return result | |||||
| def forward(self, input: Dict[str, Any]) -> Dict[str, Any]: | |||||
| with self._session.as_default(): | |||||
| feed_dict = {self.input_images: input['img']} | |||||
| sess_outputs = self._session.run(self.output, feed_dict=feed_dict) | |||||
| return sess_outputs | |||||
| def postprocess(self, inputs: Dict[str, Any]) -> Dict[str, Any]: | |||||
| rboxes = inputs['combined_rboxes'][0] | |||||
| count = inputs['combined_counts'][0] | |||||
| rboxes = rboxes[:count, :] | |||||
| # convert rboxes to polygons and find its coordinates on the original image | |||||
| orig_h, orig_w = inputs['orig_size'] | |||||
| resize_h, resize_w = inputs['resize_size'] | |||||
| polygons = utils.rboxes_to_polygons(rboxes) | |||||
| scale_y = float(orig_h) / float(resize_h) | |||||
| scale_x = float(orig_w) / float(resize_w) | |||||
| # confine polygons inside image | |||||
| polygons[:, ::2] = np.maximum( | |||||
| 0, np.minimum(polygons[:, ::2] * scale_x, orig_w - 1)) | |||||
| polygons[:, 1::2] = np.maximum( | |||||
| 0, np.minimum(polygons[:, 1::2] * scale_y, orig_h - 1)) | |||||
| polygons = np.round(polygons).astype(np.int32) | |||||
| # nms | |||||
| dt_n9 = [o + [utils.cal_width(o)] for o in polygons.tolist()] | |||||
| dt_nms = utils.nms_python(dt_n9) | |||||
| dt_polygons = np.array([o[:8] for o in dt_nms]) | |||||
| result = {'det_polygons': dt_polygons} | |||||
| return result | |||||
| @@ -0,0 +1,158 @@ | |||||
| import tensorflow as tf | |||||
| import tf_slim as slim | |||||
| from . import ops, resnet18_v1, resnet_utils | |||||
| if tf.__version__ >= '2.0': | |||||
| tf = tf.compat.v1 | |||||
| # constants | |||||
| OFFSET_DIM = 6 | |||||
| N_LOCAL_LINKS = 8 | |||||
| N_CROSS_LINKS = 4 | |||||
| N_SEG_CLASSES = 2 | |||||
| N_LNK_CLASSES = 4 | |||||
| POS_LABEL = 1 | |||||
| NEG_LABEL = 0 | |||||
| class SegLinkDetector(): | |||||
| def __init__(self): | |||||
| self.anchor_sizes = [6., 11.84210526, 23.68421053, 45., 90., 150.] | |||||
| def _detection_classifier(self, | |||||
| maps, | |||||
| ksize, | |||||
| weight_decay, | |||||
| cross_links=False, | |||||
| scope=None): | |||||
| with tf.variable_scope(scope): | |||||
| seg_depth = N_SEG_CLASSES | |||||
| if cross_links: | |||||
| lnk_depth = N_LNK_CLASSES * (N_LOCAL_LINKS + N_CROSS_LINKS) | |||||
| else: | |||||
| lnk_depth = N_LNK_CLASSES * N_LOCAL_LINKS | |||||
| reg_depth = OFFSET_DIM | |||||
| map_depth = maps.get_shape()[3] | |||||
| inter_maps, inter_relu = ops.conv2d( | |||||
| maps, map_depth, 256, 1, 1, 'SAME', scope='conv_inter') | |||||
| dir_maps, dir_relu = ops.conv2d( | |||||
| inter_relu, 256, 2, ksize, 1, 'SAME', scope='conv_dir') | |||||
| cen_maps, cen_relu = ops.conv2d( | |||||
| inter_relu, 256, 2, ksize, 1, 'SAME', scope='conv_cen') | |||||
| pol_maps, pol_relu = ops.conv2d( | |||||
| inter_relu, 256, 8, ksize, 1, 'SAME', scope='conv_pol') | |||||
| concat_relu = tf.concat([dir_relu, cen_relu, pol_relu], axis=-1) | |||||
| _, lnk_embedding = ops.conv_relu( | |||||
| concat_relu, 12, 256, 1, 1, scope='lnk_embedding') | |||||
| lnk_maps, lnk_relu = ops.conv2d( | |||||
| inter_relu + lnk_embedding, | |||||
| 256, | |||||
| lnk_depth, | |||||
| ksize, | |||||
| 1, | |||||
| 'SAME', | |||||
| scope='conv_lnk') | |||||
| char_seg_maps, char_seg_relu = ops.conv2d( | |||||
| inter_relu, | |||||
| 256, | |||||
| seg_depth, | |||||
| ksize, | |||||
| 1, | |||||
| 'SAME', | |||||
| scope='conv_char_cls') | |||||
| char_reg_maps, char_reg_relu = ops.conv2d( | |||||
| inter_relu, | |||||
| 256, | |||||
| reg_depth, | |||||
| ksize, | |||||
| 1, | |||||
| 'SAME', | |||||
| scope='conv_char_reg') | |||||
| concat_char_relu = tf.concat([char_seg_relu, char_reg_relu], | |||||
| axis=-1) | |||||
| _, char_embedding = ops.conv_relu( | |||||
| concat_char_relu, 8, 256, 1, 1, scope='conv_char_embedding') | |||||
| seg_maps, seg_relu = ops.conv2d( | |||||
| inter_relu + char_embedding, | |||||
| 256, | |||||
| seg_depth, | |||||
| ksize, | |||||
| 1, | |||||
| 'SAME', | |||||
| scope='conv_cls') | |||||
| reg_maps, reg_relu = ops.conv2d( | |||||
| inter_relu + char_embedding, | |||||
| 256, | |||||
| reg_depth, | |||||
| ksize, | |||||
| 1, | |||||
| 'SAME', | |||||
| scope='conv_reg') | |||||
| return seg_relu, lnk_relu, reg_relu | |||||
| def _build_cnn(self, images, weight_decay, is_training): | |||||
| with slim.arg_scope( | |||||
| resnet18_v1.resnet_arg_scope(weight_decay=weight_decay)): | |||||
| logits, end_points = resnet18_v1.resnet_v1_18( | |||||
| images, is_training=is_training, scope='resnet_v1_18') | |||||
| outputs = { | |||||
| 'conv3_3': end_points['pool1'], | |||||
| 'conv4_3': end_points['pool2'], | |||||
| 'fc7': end_points['pool3'], | |||||
| 'conv8_2': end_points['pool4'], | |||||
| 'conv9_2': end_points['pool5'], | |||||
| 'conv10_2': end_points['pool6'], | |||||
| } | |||||
| return outputs | |||||
| def build_model(self, images, is_training=True, scope=None): | |||||
| weight_decay = 5e-4 # FLAGS.weight_decay | |||||
| cnn_outputs = self._build_cnn(images, weight_decay, is_training) | |||||
| det_0 = self._detection_classifier( | |||||
| cnn_outputs['conv3_3'], | |||||
| 3, | |||||
| weight_decay, | |||||
| cross_links=False, | |||||
| scope='dete_0') | |||||
| det_1 = self._detection_classifier( | |||||
| cnn_outputs['conv4_3'], | |||||
| 3, | |||||
| weight_decay, | |||||
| cross_links=True, | |||||
| scope='dete_1') | |||||
| det_2 = self._detection_classifier( | |||||
| cnn_outputs['fc7'], | |||||
| 3, | |||||
| weight_decay, | |||||
| cross_links=True, | |||||
| scope='dete_2') | |||||
| det_3 = self._detection_classifier( | |||||
| cnn_outputs['conv8_2'], | |||||
| 3, | |||||
| weight_decay, | |||||
| cross_links=True, | |||||
| scope='dete_3') | |||||
| det_4 = self._detection_classifier( | |||||
| cnn_outputs['conv9_2'], | |||||
| 3, | |||||
| weight_decay, | |||||
| cross_links=True, | |||||
| scope='dete_4') | |||||
| det_5 = self._detection_classifier( | |||||
| cnn_outputs['conv10_2'], | |||||
| 3, | |||||
| weight_decay, | |||||
| cross_links=True, | |||||
| scope='dete_5') | |||||
| outputs = [det_0, det_1, det_2, det_3, det_4, det_5] | |||||
| return outputs | |||||
| @@ -0,0 +1,432 @@ | |||||
| """Contains definitions for the original form of Residual Networks. | |||||
| The 'v1' residual networks (ResNets) implemented in this module were proposed | |||||
| by: | |||||
| [1] Kaiming He, Xiangyu Zhang, Shaoqing Ren, Jian Sun | |||||
| Deep Residual Learning for Image Recognition. arXiv:1512.03385 | |||||
| Other variants were introduced in: | |||||
| [2] Kaiming He, Xiangyu Zhang, Shaoqing Ren, Jian Sun | |||||
| Identity Mappings in Deep Residual Networks. arXiv: 1603.05027 | |||||
| The networks defined in this module utilize the bottleneck building block of | |||||
| [1] with projection shortcuts only for increasing depths. They employ batch | |||||
| normalization *after* every weight layer. This is the architecture used by | |||||
| MSRA in the Imagenet and MSCOCO 2016 competition models ResNet-101 and | |||||
| ResNet-152. See [2; Fig. 1a] for a comparison between the current 'v1' | |||||
| architecture and the alternative 'v2' architecture of [2] which uses batch | |||||
| normalization *before* every weight layer in the so-called full pre-activation | |||||
| units. | |||||
| Typical use: | |||||
| from tensorflow.contrib.slim.nets import resnet_v1 | |||||
| ResNet-101 for image classification into 1000 classes: | |||||
| # inputs has shape [batch, 224, 224, 3] | |||||
| with slim.arg_scope(resnet_v1.resnet_arg_scope()): | |||||
| net, end_points = resnet_v1.resnet_v1_101(inputs, 1000, is_training=False) | |||||
| ResNet-101 for semantic segmentation into 21 classes: | |||||
| # inputs has shape [batch, 513, 513, 3] | |||||
| with slim.arg_scope(resnet_v1.resnet_arg_scope()): | |||||
| net, end_points = resnet_v1.resnet_v1_101(inputs, | |||||
| 21, | |||||
| is_training=False, | |||||
| global_pool=False, | |||||
| output_stride=16) | |||||
| """ | |||||
| import tensorflow as tf | |||||
| import tf_slim as slim | |||||
| from . import resnet_utils | |||||
| if tf.__version__ >= '2.0': | |||||
| tf = tf.compat.v1 | |||||
| resnet_arg_scope = resnet_utils.resnet_arg_scope | |||||
| @slim.add_arg_scope | |||||
| def basicblock(inputs, | |||||
| depth, | |||||
| depth_bottleneck, | |||||
| stride, | |||||
| rate=1, | |||||
| outputs_collections=None, | |||||
| scope=None): | |||||
| """Bottleneck residual unit variant with BN after convolutions. | |||||
| This is the original residual unit proposed in [1]. See Fig. 1(a) of [2] for | |||||
| its definition. Note that we use here the bottleneck variant which has an | |||||
| extra bottleneck layer. | |||||
| When putting together two consecutive ResNet blocks that use this unit, one | |||||
| should use stride = 2 in the last unit of the first block. | |||||
| Args: | |||||
| inputs: A tensor of size [batch, height, width, channels]. | |||||
| depth: The depth of the ResNet unit output. | |||||
| depth_bottleneck: The depth of the bottleneck layers. | |||||
| stride: The ResNet unit's stride. Determines the amount of downsampling of | |||||
| the units output compared to its input. | |||||
| rate: An integer, rate for atrous convolution. | |||||
| outputs_collections: Collection to add the ResNet unit output. | |||||
| scope: Optional variable_scope. | |||||
| Returns: | |||||
| The ResNet unit's output. | |||||
| """ | |||||
| with tf.variable_scope(scope, 'bottleneck_v1', [inputs]) as sc: | |||||
| depth_in = slim.utils.last_dimension(inputs.get_shape(), min_rank=4) | |||||
| if depth == depth_in: | |||||
| shortcut = resnet_utils.subsample(inputs, stride, 'shortcut') | |||||
| else: | |||||
| shortcut = slim.conv2d( | |||||
| inputs, | |||||
| depth, [1, 1], | |||||
| stride=stride, | |||||
| activation_fn=None, | |||||
| scope='shortcut') | |||||
| residual = resnet_utils.conv2d_same( | |||||
| inputs, depth, 3, stride, rate=rate, scope='conv1') | |||||
| residual = resnet_utils.conv2d_same( | |||||
| residual, depth, 3, 1, rate=rate, scope='conv2') | |||||
| output = tf.nn.relu(residual + shortcut) | |||||
| return slim.utils.collect_named_outputs(outputs_collections, | |||||
| sc.original_name_scope, output) | |||||
| @slim.add_arg_scope | |||||
| def bottleneck(inputs, | |||||
| depth, | |||||
| depth_bottleneck, | |||||
| stride, | |||||
| rate=1, | |||||
| outputs_collections=None, | |||||
| scope=None): | |||||
| """Bottleneck residual unit variant with BN after convolutions. | |||||
| This is the original residual unit proposed in [1]. See Fig. 1(a) of [2] for | |||||
| its definition. Note that we use here the bottleneck variant which has an | |||||
| extra bottleneck layer. | |||||
| When putting together two consecutive ResNet blocks that use this unit, one | |||||
| should use stride = 2 in the last unit of the first block. | |||||
| Args: | |||||
| inputs: A tensor of size [batch, height, width, channels]. | |||||
| depth: The depth of the ResNet unit output. | |||||
| depth_bottleneck: The depth of the bottleneck layers. | |||||
| stride: The ResNet unit's stride. Determines the amount of downsampling of | |||||
| the units output compared to its input. | |||||
| rate: An integer, rate for atrous convolution. | |||||
| outputs_collections: Collection to add the ResNet unit output. | |||||
| scope: Optional variable_scope. | |||||
| Returns: | |||||
| The ResNet unit's output. | |||||
| """ | |||||
| with tf.variable_scope(scope, 'bottleneck_v1', [inputs]) as sc: | |||||
| depth_in = slim.utils.last_dimension(inputs.get_shape(), min_rank=4) | |||||
| if depth == depth_in: | |||||
| shortcut = resnet_utils.subsample(inputs, stride, 'shortcut') | |||||
| else: | |||||
| shortcut = slim.conv2d( | |||||
| inputs, | |||||
| depth, [1, 1], | |||||
| stride=stride, | |||||
| activation_fn=None, | |||||
| scope='shortcut') | |||||
| residual = slim.conv2d( | |||||
| inputs, depth_bottleneck, [1, 1], stride=1, scope='conv1') | |||||
| residual = resnet_utils.conv2d_same( | |||||
| residual, depth_bottleneck, 3, stride, rate=rate, scope='conv2') | |||||
| residual = slim.conv2d( | |||||
| residual, | |||||
| depth, [1, 1], | |||||
| stride=1, | |||||
| activation_fn=None, | |||||
| scope='conv3') | |||||
| output = tf.nn.relu(shortcut + residual) | |||||
| return slim.utils.collect_named_outputs(outputs_collections, | |||||
| sc.original_name_scope, output) | |||||
| def resnet_v1(inputs, | |||||
| blocks, | |||||
| num_classes=None, | |||||
| is_training=True, | |||||
| global_pool=True, | |||||
| output_stride=None, | |||||
| include_root_block=True, | |||||
| spatial_squeeze=True, | |||||
| reuse=None, | |||||
| scope=None): | |||||
| """Generator for v1 ResNet models. | |||||
| This function generates a family of ResNet v1 models. See the resnet_v1_*() | |||||
| methods for specific model instantiations, obtained by selecting different | |||||
| block instantiations that produce ResNets of various depths. | |||||
| Training for image classification on Imagenet is usually done with [224, 224] | |||||
| inputs, resulting in [7, 7] feature maps at the output of the last ResNet | |||||
| block for the ResNets defined in [1] that have nominal stride equal to 32. | |||||
| However, for dense prediction tasks we advise that one uses inputs with | |||||
| spatial dimensions that are multiples of 32 plus 1, e.g., [321, 321]. In | |||||
| this case the feature maps at the ResNet output will have spatial shape | |||||
| [(height - 1) / output_stride + 1, (width - 1) / output_stride + 1] | |||||
| and corners exactly aligned with the input image corners, which greatly | |||||
| facilitates alignment of the features to the image. Using as input [225, 225] | |||||
| images results in [8, 8] feature maps at the output of the last ResNet block. | |||||
| For dense prediction tasks, the ResNet needs to run in fully-convolutional | |||||
| (FCN) mode and global_pool needs to be set to False. The ResNets in [1, 2] all | |||||
| have nominal stride equal to 32 and a good choice in FCN mode is to use | |||||
| output_stride=16 in order to increase the density of the computed features at | |||||
| small computational and memory overhead, cf. http://arxiv.org/abs/1606.00915. | |||||
| Args: | |||||
| inputs: A tensor of size [batch, height_in, width_in, channels]. | |||||
| blocks: A list of length equal to the number of ResNet blocks. Each element | |||||
| is a resnet_utils.Block object describing the units in the block. | |||||
| num_classes: Number of predicted classes for classification tasks. If None | |||||
| we return the features before the logit layer. | |||||
| is_training: whether is training or not. | |||||
| global_pool: If True, we perform global average pooling before computing the | |||||
| logits. Set to True for image classification, False for dense prediction. | |||||
| output_stride: If None, then the output will be computed at the nominal | |||||
| network stride. If output_stride is not None, it specifies the requested | |||||
| ratio of input to output spatial resolution. | |||||
| include_root_block: If True, include the initial convolution followed by | |||||
| max-pooling, if False excludes it. | |||||
| spatial_squeeze: if True, logits is of shape [B, C], if false logits is | |||||
| of shape [B, 1, 1, C], where B is batch_size and C is number of classes. | |||||
| reuse: whether or not the network and its variables should be reused. To be | |||||
| able to reuse 'scope' must be given. | |||||
| scope: Optional variable_scope. | |||||
| Returns: | |||||
| net: A rank-4 tensor of size [batch, height_out, width_out, channels_out]. | |||||
| If global_pool is False, then height_out and width_out are reduced by a | |||||
| factor of output_stride compared to the respective height_in and width_in, | |||||
| else both height_out and width_out equal one. If num_classes is None, then | |||||
| net is the output of the last ResNet block, potentially after global | |||||
| average pooling. If num_classes is not None, net contains the pre-softmax | |||||
| activations. | |||||
| end_points: A dictionary from components of the network to the corresponding | |||||
| activation. | |||||
| Raises: | |||||
| ValueError: If the target output_stride is not valid. | |||||
| """ | |||||
| with tf.variable_scope(scope, 'resnet_v1', [inputs], reuse=reuse) as sc: | |||||
| end_points_collection = sc.name + '_end_points' | |||||
| with slim.arg_scope( | |||||
| [slim.conv2d, bottleneck, resnet_utils.stack_blocks_dense], | |||||
| outputs_collections=end_points_collection): | |||||
| with slim.arg_scope([slim.batch_norm], is_training=is_training): | |||||
| net = inputs | |||||
| if include_root_block: | |||||
| if output_stride is not None: | |||||
| if output_stride % 4 != 0: | |||||
| raise ValueError( | |||||
| 'The output_stride needs to be a multiple of 4.' | |||||
| ) | |||||
| output_stride /= 4 | |||||
| net = resnet_utils.conv2d_same( | |||||
| net, 64, 7, stride=2, scope='conv1') | |||||
| net = tf.pad(net, [[0, 0], [1, 1], [1, 1], [0, 0]]) | |||||
| net = slim.max_pool2d(net, [3, 3], stride=2, scope='pool1') | |||||
| net = slim.utils.collect_named_outputs( | |||||
| end_points_collection, 'pool2', net) | |||||
| net = resnet_utils.stack_blocks_dense(net, blocks, | |||||
| output_stride) | |||||
| end_points = slim.utils.convert_collection_to_dict( | |||||
| end_points_collection) | |||||
| end_points['pool1'] = end_points['resnet_v1_18/block2/unit_2'] | |||||
| end_points['pool2'] = end_points['resnet_v1_18/block3/unit_2'] | |||||
| end_points['pool3'] = end_points['resnet_v1_18/block4/unit_2'] | |||||
| end_points['pool4'] = end_points['resnet_v1_18/block5/unit_2'] | |||||
| end_points['pool5'] = end_points['resnet_v1_18/block6/unit_2'] | |||||
| end_points['pool6'] = net | |||||
| return net, end_points | |||||
| resnet_v1.default_image_size = 224 | |||||
| def resnet_v1_18(inputs, | |||||
| num_classes=None, | |||||
| is_training=True, | |||||
| global_pool=True, | |||||
| output_stride=None, | |||||
| spatial_squeeze=True, | |||||
| reuse=None, | |||||
| scope='resnet_v1_18'): | |||||
| """ResNet-18 model of [1]. See resnet_v1() for arg and return description.""" | |||||
| blocks = [ | |||||
| resnet_utils.Block('block1', basicblock, | |||||
| [(64, 64, 1)] + [(64, 64, 1)]), | |||||
| resnet_utils.Block('block2', basicblock, | |||||
| [(128, 128, 1)] + [(128, 128, 1)]), | |||||
| resnet_utils.Block('block3', basicblock, | |||||
| [(256, 256, 2)] + [(256, 256, 1)]), | |||||
| resnet_utils.Block('block4', basicblock, | |||||
| [(512, 512, 2)] + [(512, 512, 1)]), | |||||
| resnet_utils.Block('block5', basicblock, | |||||
| [(256, 256, 2)] + [(256, 256, 1)]), | |||||
| resnet_utils.Block('block6', basicblock, | |||||
| [(256, 256, 2)] + [(256, 256, 1)]), | |||||
| resnet_utils.Block('block7', basicblock, | |||||
| [(256, 256, 2)] + [(256, 256, 1)]), | |||||
| ] | |||||
| return resnet_v1( | |||||
| inputs, | |||||
| blocks, | |||||
| num_classes, | |||||
| is_training, | |||||
| global_pool=global_pool, | |||||
| output_stride=output_stride, | |||||
| include_root_block=True, | |||||
| spatial_squeeze=spatial_squeeze, | |||||
| reuse=reuse, | |||||
| scope=scope) | |||||
| resnet_v1_18.default_image_size = resnet_v1.default_image_size | |||||
| def resnet_v1_50(inputs, | |||||
| num_classes=None, | |||||
| is_training=True, | |||||
| global_pool=True, | |||||
| output_stride=None, | |||||
| spatial_squeeze=True, | |||||
| reuse=None, | |||||
| scope='resnet_v1_50'): | |||||
| """ResNet-50 model of [1]. See resnet_v1() for arg and return description.""" | |||||
| blocks = [ | |||||
| resnet_utils.Block('block1', bottleneck, | |||||
| [(256, 64, 1)] * 2 + [(256, 64, 2)]), | |||||
| resnet_utils.Block('block2', bottleneck, | |||||
| [(512, 128, 1)] * 3 + [(512, 128, 2)]), | |||||
| resnet_utils.Block('block3', bottleneck, | |||||
| [(1024, 256, 1)] * 5 + [(1024, 256, 2)]), | |||||
| resnet_utils.Block('block4', bottleneck, | |||||
| [(2048, 512, 1)] * 3 + [(2048, 512, 2)]), | |||||
| resnet_utils.Block('block5', bottleneck, | |||||
| [(1024, 256, 1)] * 2 + [(1024, 256, 2)]), | |||||
| resnet_utils.Block('block6', bottleneck, [(1024, 256, 1)] * 2), | |||||
| ] | |||||
| return resnet_v1( | |||||
| inputs, | |||||
| blocks, | |||||
| num_classes, | |||||
| is_training, | |||||
| global_pool=global_pool, | |||||
| output_stride=output_stride, | |||||
| include_root_block=True, | |||||
| spatial_squeeze=spatial_squeeze, | |||||
| reuse=reuse, | |||||
| scope=scope) | |||||
| resnet_v1_50.default_image_size = resnet_v1.default_image_size | |||||
| def resnet_v1_101(inputs, | |||||
| num_classes=None, | |||||
| is_training=True, | |||||
| global_pool=True, | |||||
| output_stride=None, | |||||
| spatial_squeeze=True, | |||||
| reuse=None, | |||||
| scope='resnet_v1_101'): | |||||
| """ResNet-101 model of [1]. See resnet_v1() for arg and return description.""" | |||||
| blocks = [ | |||||
| resnet_utils.Block('block1', bottleneck, | |||||
| [(256, 64, 1)] * 2 + [(256, 64, 2)]), | |||||
| resnet_utils.Block('block2', bottleneck, | |||||
| [(512, 128, 1)] * 3 + [(512, 128, 2)]), | |||||
| resnet_utils.Block('block3', bottleneck, | |||||
| [(1024, 256, 1)] * 22 + [(1024, 256, 2)]), | |||||
| resnet_utils.Block('block4', bottleneck, [(2048, 512, 1)] * 3) | |||||
| ] | |||||
| return resnet_v1( | |||||
| inputs, | |||||
| blocks, | |||||
| num_classes, | |||||
| is_training, | |||||
| global_pool=global_pool, | |||||
| output_stride=output_stride, | |||||
| include_root_block=True, | |||||
| spatial_squeeze=spatial_squeeze, | |||||
| reuse=reuse, | |||||
| scope=scope) | |||||
| resnet_v1_101.default_image_size = resnet_v1.default_image_size | |||||
| def resnet_v1_152(inputs, | |||||
| num_classes=None, | |||||
| is_training=True, | |||||
| global_pool=True, | |||||
| output_stride=None, | |||||
| spatial_squeeze=True, | |||||
| reuse=None, | |||||
| scope='resnet_v1_152'): | |||||
| """ResNet-152 model of [1]. See resnet_v1() for arg and return description.""" | |||||
| blocks = [ | |||||
| resnet_utils.Block('block1', bottleneck, | |||||
| [(256, 64, 1)] * 2 + [(256, 64, 2)]), | |||||
| resnet_utils.Block('block2', bottleneck, | |||||
| [(512, 128, 1)] * 7 + [(512, 128, 2)]), | |||||
| resnet_utils.Block('block3', bottleneck, | |||||
| [(1024, 256, 1)] * 35 + [(1024, 256, 2)]), | |||||
| resnet_utils.Block('block4', bottleneck, [(2048, 512, 1)] * 3) | |||||
| ] | |||||
| return resnet_v1( | |||||
| inputs, | |||||
| blocks, | |||||
| num_classes, | |||||
| is_training, | |||||
| global_pool=global_pool, | |||||
| output_stride=output_stride, | |||||
| include_root_block=True, | |||||
| spatial_squeeze=spatial_squeeze, | |||||
| reuse=reuse, | |||||
| scope=scope) | |||||
| resnet_v1_152.default_image_size = resnet_v1.default_image_size | |||||
| def resnet_v1_200(inputs, | |||||
| num_classes=None, | |||||
| is_training=True, | |||||
| global_pool=True, | |||||
| output_stride=None, | |||||
| spatial_squeeze=True, | |||||
| reuse=None, | |||||
| scope='resnet_v1_200'): | |||||
| """ResNet-200 model of [2]. See resnet_v1() for arg and return description.""" | |||||
| blocks = [ | |||||
| resnet_utils.Block('block1', bottleneck, | |||||
| [(256, 64, 1)] * 2 + [(256, 64, 2)]), | |||||
| resnet_utils.Block('block2', bottleneck, | |||||
| [(512, 128, 1)] * 23 + [(512, 128, 2)]), | |||||
| resnet_utils.Block('block3', bottleneck, | |||||
| [(1024, 256, 1)] * 35 + [(1024, 256, 2)]), | |||||
| resnet_utils.Block('block4', bottleneck, [(2048, 512, 1)] * 3) | |||||
| ] | |||||
| return resnet_v1( | |||||
| inputs, | |||||
| blocks, | |||||
| num_classes, | |||||
| is_training, | |||||
| global_pool=global_pool, | |||||
| output_stride=output_stride, | |||||
| include_root_block=True, | |||||
| spatial_squeeze=spatial_squeeze, | |||||
| reuse=reuse, | |||||
| scope=scope) | |||||
| resnet_v1_200.default_image_size = resnet_v1.default_image_size | |||||
| if __name__ == '__main__': | |||||
| input = tf.placeholder(tf.float32, shape=(None, 224, 224, 3), name='input') | |||||
| with slim.arg_scope(resnet_arg_scope()) as sc: | |||||
| logits = resnet_v1_50(input) | |||||
| @@ -0,0 +1,231 @@ | |||||
| """Contains building blocks for various versions of Residual Networks. | |||||
| Residual networks (ResNets) were proposed in: | |||||
| Kaiming He, Xiangyu Zhang, Shaoqing Ren, Jian Sun | |||||
| Deep Residual Learning for Image Recognition. arXiv:1512.03385, 2015 | |||||
| More variants were introduced in: | |||||
| Kaiming He, Xiangyu Zhang, Shaoqing Ren, Jian Sun | |||||
| Identity Mappings in Deep Residual Networks. arXiv: 1603.05027, 2016 | |||||
| We can obtain different ResNet variants by changing the network depth, width, | |||||
| and form of residual unit. This module implements the infrastructure for | |||||
| building them. Concrete ResNet units and full ResNet networks are implemented in | |||||
| the accompanying resnet_v1.py and resnet_v2.py modules. | |||||
| Compared to https://github.com/KaimingHe/deep-residual-networks, in the current | |||||
| implementation we subsample the output activations in the last residual unit of | |||||
| each block, instead of subsampling the input activations in the first residual | |||||
| unit of each block. The two implementations give identical results but our | |||||
| implementation is more memory efficient. | |||||
| """ | |||||
| import collections | |||||
| import tensorflow as tf | |||||
| import tf_slim as slim | |||||
| if tf.__version__ >= '2.0': | |||||
| tf = tf.compat.v1 | |||||
| class Block(collections.namedtuple('Block', ['scope', 'unit_fn', 'args'])): | |||||
| """A named tuple describing a ResNet block. | |||||
| Its parts are: | |||||
| scope: The scope of the `Block`. | |||||
| unit_fn: The ResNet unit function which takes as input a `Tensor` and | |||||
| returns another `Tensor` with the output of the ResNet unit. | |||||
| args: A list of length equal to the number of units in the `Block`. The list | |||||
| contains one (depth, depth_bottleneck, stride) tuple for each unit in the | |||||
| block to serve as argument to unit_fn. | |||||
| """ | |||||
| def subsample(inputs, factor, scope=None): | |||||
| """Subsamples the input along the spatial dimensions. | |||||
| Args: | |||||
| inputs: A `Tensor` of size [batch, height_in, width_in, channels]. | |||||
| factor: The subsampling factor. | |||||
| scope: Optional variable_scope. | |||||
| Returns: | |||||
| output: A `Tensor` of size [batch, height_out, width_out, channels] with the | |||||
| input, either intact (if factor == 1) or subsampled (if factor > 1). | |||||
| """ | |||||
| if factor == 1: | |||||
| return inputs | |||||
| else: | |||||
| return slim.max_pool2d(inputs, [1, 1], stride=factor, scope=scope) | |||||
| def conv2d_same(inputs, num_outputs, kernel_size, stride, rate=1, scope=None): | |||||
| """Strided 2-D convolution with 'SAME' padding. | |||||
| When stride > 1, then we do explicit zero-padding, followed by conv2d with | |||||
| 'VALID' padding. | |||||
| Note that | |||||
| net = conv2d_same(inputs, num_outputs, 3, stride=stride) | |||||
| is equivalent to | |||||
| net = slim.conv2d(inputs, num_outputs, 3, stride=1, padding='SAME') | |||||
| net = subsample(net, factor=stride) | |||||
| whereas | |||||
| net = slim.conv2d(inputs, num_outputs, 3, stride=stride, padding='SAME') | |||||
| is different when the input's height or width is even, which is why we add the | |||||
| current function. For more details, see ResnetUtilsTest.testConv2DSameEven(). | |||||
| Args: | |||||
| inputs: A 4-D tensor of size [batch, height_in, width_in, channels]. | |||||
| num_outputs: An integer, the number of output filters. | |||||
| kernel_size: An int with the kernel_size of the filters. | |||||
| stride: An integer, the output stride. | |||||
| rate: An integer, rate for atrous convolution. | |||||
| scope: Scope. | |||||
| Returns: | |||||
| output: A 4-D tensor of size [batch, height_out, width_out, channels] with | |||||
| the convolution output. | |||||
| """ | |||||
| if stride == 1: | |||||
| return slim.conv2d( | |||||
| inputs, | |||||
| num_outputs, | |||||
| kernel_size, | |||||
| stride=1, | |||||
| rate=rate, | |||||
| padding='SAME', | |||||
| scope=scope) | |||||
| else: | |||||
| kernel_size_effective = kernel_size + (kernel_size - 1) * (rate - 1) | |||||
| pad_total = kernel_size_effective - 1 | |||||
| pad_beg = pad_total // 2 | |||||
| pad_end = pad_total - pad_beg | |||||
| inputs = tf.pad( | |||||
| inputs, [[0, 0], [pad_beg, pad_end], [pad_beg, pad_end], [0, 0]]) | |||||
| return slim.conv2d( | |||||
| inputs, | |||||
| num_outputs, | |||||
| kernel_size, | |||||
| stride=stride, | |||||
| rate=rate, | |||||
| padding='VALID', | |||||
| scope=scope) | |||||
| @slim.add_arg_scope | |||||
| def stack_blocks_dense(net, | |||||
| blocks, | |||||
| output_stride=None, | |||||
| outputs_collections=None): | |||||
| """Stacks ResNet `Blocks` and controls output feature density. | |||||
| First, this function creates scopes for the ResNet in the form of | |||||
| 'block_name/unit_1', 'block_name/unit_2', etc. | |||||
| Second, this function allows the user to explicitly control the ResNet | |||||
| output_stride, which is the ratio of the input to output spatial resolution. | |||||
| This is useful for dense prediction tasks such as semantic segmentation or | |||||
| object detection. | |||||
| Most ResNets consist of 4 ResNet blocks and subsample the activations by a | |||||
| factor of 2 when transitioning between consecutive ResNet blocks. This results | |||||
| to a nominal ResNet output_stride equal to 8. If we set the output_stride to | |||||
| half the nominal network stride (e.g., output_stride=4), then we compute | |||||
| responses twice. | |||||
| Control of the output feature density is implemented by atrous convolution. | |||||
| Args: | |||||
| net: A `Tensor` of size [batch, height, width, channels]. | |||||
| blocks: A list of length equal to the number of ResNet `Blocks`. Each | |||||
| element is a ResNet `Block` object describing the units in the `Block`. | |||||
| output_stride: If `None`, then the output will be computed at the nominal | |||||
| network stride. If output_stride is not `None`, it specifies the requested | |||||
| ratio of input to output spatial resolution, which needs to be equal to | |||||
| the product of unit strides from the start up to some level of the ResNet. | |||||
| For example, if the ResNet employs units with strides 1, 2, 1, 3, 4, 1, | |||||
| then valid values for the output_stride are 1, 2, 6, 24 or None (which | |||||
| is equivalent to output_stride=24). | |||||
| outputs_collections: Collection to add the ResNet block outputs. | |||||
| Returns: | |||||
| net: Output tensor with stride equal to the specified output_stride. | |||||
| Raises: | |||||
| ValueError: If the target output_stride is not valid. | |||||
| """ | |||||
| # The current_stride variable keeps track of the effective stride of the | |||||
| # activations. This allows us to invoke atrous convolution whenever applying | |||||
| # the next residual unit would result in the activations having stride larger | |||||
| # than the target output_stride. | |||||
| current_stride = 1 | |||||
| # The atrous convolution rate parameter. | |||||
| rate = 1 | |||||
| for block in blocks: | |||||
| with tf.variable_scope(block.scope, 'block', [net]): | |||||
| for i, unit in enumerate(block.args): | |||||
| if output_stride is not None and current_stride > output_stride: | |||||
| raise ValueError( | |||||
| 'The target output_stride cannot be reached.') | |||||
| with tf.variable_scope( | |||||
| 'unit_%d' % (i + 1), values=[net]) as sc: | |||||
| unit_depth, unit_depth_bottleneck, unit_stride = unit | |||||
| # If we have reached the target output_stride, then we need to employ | |||||
| # atrous convolution with stride=1 and multiply the atrous rate by the | |||||
| # current unit's stride for use in subsequent layers. | |||||
| if output_stride is not None and current_stride == output_stride: | |||||
| net = block.unit_fn( | |||||
| net, | |||||
| depth=unit_depth, | |||||
| depth_bottleneck=unit_depth_bottleneck, | |||||
| stride=1, | |||||
| rate=rate) | |||||
| rate *= unit_stride | |||||
| else: | |||||
| net = block.unit_fn( | |||||
| net, | |||||
| depth=unit_depth, | |||||
| depth_bottleneck=unit_depth_bottleneck, | |||||
| stride=unit_stride, | |||||
| rate=1) | |||||
| current_stride *= unit_stride | |||||
| net = slim.utils.collect_named_outputs( | |||||
| outputs_collections, sc.name, net) | |||||
| if output_stride is not None and current_stride != output_stride: | |||||
| raise ValueError('The target output_stride cannot be reached.') | |||||
| return net | |||||
| def resnet_arg_scope(weight_decay=0.0001, | |||||
| batch_norm_decay=0.997, | |||||
| batch_norm_epsilon=1e-5, | |||||
| batch_norm_scale=True): | |||||
| """Defines the default ResNet arg scope. | |||||
| TODO(gpapan): The batch-normalization related default values above are | |||||
| appropriate for use in conjunction with the reference ResNet models | |||||
| released at https://github.com/KaimingHe/deep-residual-networks. When | |||||
| training ResNets from scratch, they might need to be tuned. | |||||
| Args: | |||||
| weight_decay: The weight decay to use for regularizing the model. | |||||
| batch_norm_decay: The moving average decay when estimating layer activation | |||||
| statistics in batch normalization. | |||||
| batch_norm_epsilon: Small constant to prevent division by zero when | |||||
| normalizing activations by their variance in batch normalization. | |||||
| batch_norm_scale: If True, uses an explicit `gamma` multiplier to scale the | |||||
| activations in the batch normalization layer. | |||||
| Returns: | |||||
| An `arg_scope` to use for the resnet models. | |||||
| """ | |||||
| batch_norm_params = { | |||||
| 'decay': batch_norm_decay, | |||||
| 'epsilon': batch_norm_epsilon, | |||||
| 'scale': batch_norm_scale, | |||||
| 'updates_collections': tf.GraphKeys.UPDATE_OPS, | |||||
| } | |||||
| with slim.arg_scope( | |||||
| [slim.conv2d], | |||||
| weights_regularizer=slim.l2_regularizer(weight_decay), | |||||
| weights_initializer=slim.variance_scaling_initializer(), | |||||
| activation_fn=tf.nn.relu, | |||||
| normalizer_fn=slim.batch_norm, | |||||
| normalizer_params=batch_norm_params): | |||||
| with slim.arg_scope([slim.batch_norm], **batch_norm_params): | |||||
| # The following implies padding='SAME' for pool1, which makes feature | |||||
| # alignment easier for dense prediction tasks. This is also used in | |||||
| # https://github.com/facebook/fb.resnet.torch. However the accompanying | |||||
| # code of 'Deep Residual Learning for Image Recognition' uses | |||||
| # padding='VALID' for pool1. You can switch to that choice by setting | |||||
| # slim.arg_scope([slim.max_pool2d], padding='VALID'). | |||||
| with slim.arg_scope([slim.max_pool2d], padding='VALID') as arg_sc: | |||||
| return arg_sc | |||||
| @@ -0,0 +1,108 @@ | |||||
| import cv2 | |||||
| import numpy as np | |||||
| def rboxes_to_polygons(rboxes): | |||||
| """ | |||||
| Convert rboxes to polygons | |||||
| ARGS | |||||
| `rboxes`: [n, 5] | |||||
| RETURN | |||||
| `polygons`: [n, 8] | |||||
| """ | |||||
| theta = rboxes[:, 4:5] | |||||
| cxcy = rboxes[:, :2] | |||||
| half_w = rboxes[:, 2:3] / 2. | |||||
| half_h = rboxes[:, 3:4] / 2. | |||||
| v1 = np.hstack([np.cos(theta) * half_w, np.sin(theta) * half_w]) | |||||
| v2 = np.hstack([-np.sin(theta) * half_h, np.cos(theta) * half_h]) | |||||
| p1 = cxcy - v1 - v2 | |||||
| p2 = cxcy + v1 - v2 | |||||
| p3 = cxcy + v1 + v2 | |||||
| p4 = cxcy - v1 + v2 | |||||
| polygons = np.hstack([p1, p2, p3, p4]) | |||||
| return polygons | |||||
| def cal_width(box): | |||||
| pd1 = point_dist(box[0], box[1], box[2], box[3]) | |||||
| pd2 = point_dist(box[4], box[5], box[6], box[7]) | |||||
| return (pd1 + pd2) / 2 | |||||
| def point_dist(x1, y1, x2, y2): | |||||
| return np.sqrt((x2 - x1) * (x2 - x1) + (y2 - y1) * (y2 - y1)) | |||||
| def draw_polygons(img, polygons): | |||||
| for p in polygons.tolist(): | |||||
| p = [int(o) for o in p] | |||||
| cv2.line(img, (p[0], p[1]), (p[2], p[3]), (0, 255, 0), 1) | |||||
| cv2.line(img, (p[2], p[3]), (p[4], p[5]), (0, 255, 0), 1) | |||||
| cv2.line(img, (p[4], p[5]), (p[6], p[7]), (0, 255, 0), 1) | |||||
| cv2.line(img, (p[6], p[7]), (p[0], p[1]), (0, 255, 0), 1) | |||||
| return img | |||||
| def nms_python(boxes): | |||||
| boxes = sorted(boxes, key=lambda x: -x[8]) | |||||
| nms_flag = [True] * len(boxes) | |||||
| for i, a in enumerate(boxes): | |||||
| if not nms_flag[i]: | |||||
| continue | |||||
| else: | |||||
| for j, b in enumerate(boxes): | |||||
| if not j > i: | |||||
| continue | |||||
| if not nms_flag[j]: | |||||
| continue | |||||
| score_a = a[8] | |||||
| score_b = b[8] | |||||
| rbox_a = polygon2rbox(a[:8]) | |||||
| rbox_b = polygon2rbox(b[:8]) | |||||
| if point_in_rbox(rbox_a[:2], rbox_b) or point_in_rbox( | |||||
| rbox_b[:2], rbox_a): | |||||
| if score_a > score_b: | |||||
| nms_flag[j] = False | |||||
| boxes_nms = [] | |||||
| for i, box in enumerate(boxes): | |||||
| if nms_flag[i]: | |||||
| boxes_nms.append(box) | |||||
| return boxes_nms | |||||
| def point_in_rbox(c, rbox): | |||||
| cx0, cy0 = c[0], c[1] | |||||
| cx1, cy1 = rbox[0], rbox[1] | |||||
| w, h = rbox[2], rbox[3] | |||||
| theta = rbox[4] | |||||
| dist_x = np.abs((cx1 - cx0) * np.cos(theta) + (cy1 - cy0) * np.sin(theta)) | |||||
| dist_y = np.abs(-(cx1 - cx0) * np.sin(theta) + (cy1 - cy0) * np.cos(theta)) | |||||
| return ((dist_x < w / 2.0) and (dist_y < h / 2.0)) | |||||
| def polygon2rbox(polygon): | |||||
| x1, x2, x3, x4 = polygon[0], polygon[2], polygon[4], polygon[6] | |||||
| y1, y2, y3, y4 = polygon[1], polygon[3], polygon[5], polygon[7] | |||||
| c_x = (x1 + x2 + x3 + x4) / 4 | |||||
| c_y = (y1 + y2 + y3 + y4) / 4 | |||||
| w1 = point_dist(x1, y1, x2, y2) | |||||
| w2 = point_dist(x3, y3, x4, y4) | |||||
| h1 = point_line_dist(c_x, c_y, x1, y1, x2, y2) | |||||
| h2 = point_line_dist(c_x, c_y, x3, y3, x4, y4) | |||||
| h = h1 + h2 | |||||
| w = (w1 + w2) / 2 | |||||
| theta1 = np.arctan2(y2 - y1, x2 - x1) | |||||
| theta2 = np.arctan2(y3 - y4, x3 - x4) | |||||
| theta = (theta1 + theta2) / 2.0 | |||||
| return [c_x, c_y, w, h, theta] | |||||
| def point_line_dist(px, py, x1, y1, x2, y2): | |||||
| eps = 1e-6 | |||||
| dx = x2 - x1 | |||||
| dy = y2 - y1 | |||||
| div = np.sqrt(dx * dx + dy * dy) + eps | |||||
| dist = np.abs(px * dy - py * dx + x2 * y1 - y2 * x1) / div | |||||
| return dist | |||||
| @@ -1 +1 @@ | |||||
| from .image_captioning import ImageCaptionPipeline | |||||
| from .image_captioning_pipeline import ImageCaptionPipeline | |||||
| @@ -0,0 +1,33 @@ | |||||
| from typing import Any, Dict, Union | |||||
| from modelscope.preprocessors import OfaImageCaptionPreprocessor, Preprocessor | |||||
| from modelscope.utils.constant import Tasks | |||||
| from modelscope.utils.logger import get_logger | |||||
| from ..base import Model, Pipeline | |||||
| from ..builder import PIPELINES | |||||
| logger = get_logger() | |||||
| @PIPELINES.register_module(Tasks.image_captioning, module_name='ofa') | |||||
| class ImageCaptionPipeline(Pipeline): | |||||
| def __init__(self, | |||||
| model: Union[Model, str], | |||||
| preprocessor: [Preprocessor] = None, | |||||
| **kwargs): | |||||
| super().__init__() | |||||
| assert isinstance(model, str) or isinstance(model, Model), \ | |||||
| 'model must be a single str or OfaForImageCaptioning' | |||||
| if isinstance(model, str): | |||||
| pipe_model = Model.from_pretrained(model) | |||||
| elif isinstance(model, Model): | |||||
| pipe_model = model | |||||
| else: | |||||
| raise NotImplementedError | |||||
| if preprocessor is None and pipe_model: | |||||
| preprocessor = OfaImageCaptionPreprocessor(model_dir=model) | |||||
| super().__init__(model=pipe_model, preprocessor=preprocessor, **kwargs) | |||||
| def postprocess(self, inputs: Dict[str, Any]) -> Dict[str, Any]: | |||||
| return inputs | |||||
| @@ -2,3 +2,4 @@ from .fill_mask_pipeline import * # noqa F403 | |||||
| from .sentence_similarity_pipeline import * # noqa F403 | from .sentence_similarity_pipeline import * # noqa F403 | ||||
| from .sequence_classification_pipeline import * # noqa F403 | from .sequence_classification_pipeline import * # noqa F403 | ||||
| from .text_generation_pipeline import * # noqa F403 | from .text_generation_pipeline import * # noqa F403 | ||||
| from .word_segmentation_pipeline import * # noqa F403 | |||||
| @@ -1,8 +1,5 @@ | |||||
| import os | |||||
| import uuid | |||||
| from typing import Any, Dict, Union | from typing import Any, Dict, Union | ||||
| import json | |||||
| import numpy as np | import numpy as np | ||||
| from modelscope.models.nlp import SbertForSentenceSimilarity | from modelscope.models.nlp import SbertForSentenceSimilarity | ||||
| @@ -1,8 +1,5 @@ | |||||
| import os | |||||
| import uuid | |||||
| from typing import Any, Dict, Union | from typing import Any, Dict, Union | ||||
| import json | |||||
| import numpy as np | import numpy as np | ||||
| from modelscope.models.nlp import BertForSequenceClassification | from modelscope.models.nlp import BertForSequenceClassification | ||||
| @@ -1,7 +1,7 @@ | |||||
| from typing import Dict, Optional, Union | from typing import Dict, Optional, Union | ||||
| from modelscope.models import Model | from modelscope.models import Model | ||||
| from modelscope.models.nlp import PalmForTextGenerationModel | |||||
| from modelscope.models.nlp import PalmForTextGeneration | |||||
| from modelscope.preprocessors import TextGenerationPreprocessor | from modelscope.preprocessors import TextGenerationPreprocessor | ||||
| from modelscope.utils.constant import Tasks | from modelscope.utils.constant import Tasks | ||||
| from ..base import Pipeline, Tensor | from ..base import Pipeline, Tensor | ||||
| @@ -10,11 +10,11 @@ from ..builder import PIPELINES | |||||
| __all__ = ['TextGenerationPipeline'] | __all__ = ['TextGenerationPipeline'] | ||||
| @PIPELINES.register_module(Tasks.text_generation, module_name=r'palm') | |||||
| @PIPELINES.register_module(Tasks.text_generation, module_name=r'palm2.0') | |||||
| class TextGenerationPipeline(Pipeline): | class TextGenerationPipeline(Pipeline): | ||||
| def __init__(self, | def __init__(self, | ||||
| model: Union[PalmForTextGenerationModel, str], | |||||
| model: Union[PalmForTextGeneration, str], | |||||
| preprocessor: Optional[TextGenerationPreprocessor] = None, | preprocessor: Optional[TextGenerationPreprocessor] = None, | ||||
| **kwargs): | **kwargs): | ||||
| """use `model` and `preprocessor` to create a nlp text classification pipeline for prediction | """use `model` and `preprocessor` to create a nlp text classification pipeline for prediction | ||||
| @@ -23,16 +23,16 @@ class TextGenerationPipeline(Pipeline): | |||||
| model (SequenceClassificationModel): a model instance | model (SequenceClassificationModel): a model instance | ||||
| preprocessor (SequenceClassificationPreprocessor): a preprocessor instance | preprocessor (SequenceClassificationPreprocessor): a preprocessor instance | ||||
| """ | """ | ||||
| sc_model = model if isinstance( | |||||
| model, | |||||
| PalmForTextGenerationModel) else Model.from_pretrained(model) | |||||
| model = model if isinstance( | |||||
| model, PalmForTextGeneration) else Model.from_pretrained(model) | |||||
| if preprocessor is None: | if preprocessor is None: | ||||
| preprocessor = TextGenerationPreprocessor( | preprocessor = TextGenerationPreprocessor( | ||||
| sc_model.model_dir, | |||||
| model.model_dir, | |||||
| model.tokenizer, | |||||
| first_sequence='sentence', | first_sequence='sentence', | ||||
| second_sequence=None) | second_sequence=None) | ||||
| super().__init__(model=sc_model, preprocessor=preprocessor, **kwargs) | |||||
| self.tokenizer = preprocessor.tokenizer | |||||
| super().__init__(model=model, preprocessor=preprocessor, **kwargs) | |||||
| self.tokenizer = model.tokenizer | |||||
| def postprocess(self, inputs: Dict[str, Tensor]) -> Dict[str, str]: | def postprocess(self, inputs: Dict[str, Tensor]) -> Dict[str, str]: | ||||
| """process the prediction results | """process the prediction results | ||||
| @@ -43,17 +43,20 @@ class TextGenerationPipeline(Pipeline): | |||||
| Returns: | Returns: | ||||
| Dict[str, str]: the prediction results | Dict[str, str]: the prediction results | ||||
| """ | """ | ||||
| replace_tokens_bert = (('[unused0]', ''), ('[PAD]', ''), | |||||
| ('[unused1]', ''), (r' +', ' '), ('[SEP]', ''), | |||||
| ('[unused2]', ''), ('[CLS]', ''), ('[UNK]', '')) | |||||
| replace_tokens_roberta = ((r' +', ' '), ('<mask>', '<q>'), ('<pad>', | |||||
| ''), | |||||
| ('<s>', ''), ('</s>', ''), ('<unk>', ' ')) | |||||
| vocab_size = len(self.tokenizer.vocab) | |||||
| pred_list = inputs['predictions'] | pred_list = inputs['predictions'] | ||||
| pred_ids = pred_list[0][0].cpu().numpy().tolist() | pred_ids = pred_list[0][0].cpu().numpy().tolist() | ||||
| for j in range(len(pred_ids)): | |||||
| if pred_ids[j] >= vocab_size: | |||||
| pred_ids[j] = 100 | |||||
| pred = self.tokenizer.convert_ids_to_tokens(pred_ids) | |||||
| pred_string = ''.join(pred).replace( | |||||
| '##', | |||||
| '').split('[SEP]')[0].replace('[CLS]', | |||||
| '').replace('[SEP]', | |||||
| '').replace('[UNK]', '') | |||||
| pred_string = self.tokenizer.decode(pred_ids) | |||||
| for _old, _new in replace_tokens_bert: | |||||
| pred_string = pred_string.replace(_old, _new) | |||||
| pred_string.strip() | |||||
| for _old, _new in replace_tokens_roberta: | |||||
| pred_string = pred_string.replace(_old, _new) | |||||
| pred_string.strip() | |||||
| return {'text': pred_string} | return {'text': pred_string} | ||||
| @@ -0,0 +1,69 @@ | |||||
| from typing import Any, Dict, Optional, Union | |||||
| from modelscope.models import Model | |||||
| from modelscope.models.nlp import StructBertForTokenClassification | |||||
| from modelscope.preprocessors import TokenClassifcationPreprocessor | |||||
| from modelscope.utils.constant import Tasks | |||||
| from ..base import Pipeline, Tensor | |||||
| from ..builder import PIPELINES | |||||
| __all__ = ['WordSegmentationPipeline'] | |||||
| @PIPELINES.register_module( | |||||
| Tasks.word_segmentation, | |||||
| module_name=r'structbert-chinese-word-segmentation') | |||||
| class WordSegmentationPipeline(Pipeline): | |||||
| def __init__(self, | |||||
| model: Union[StructBertForTokenClassification, str], | |||||
| preprocessor: Optional[TokenClassifcationPreprocessor] = None, | |||||
| **kwargs): | |||||
| """use `model` and `preprocessor` to create a nlp word segmentation pipeline for prediction | |||||
| Args: | |||||
| model (StructBertForTokenClassification): a model instance | |||||
| preprocessor (TokenClassifcationPreprocessor): a preprocessor instance | |||||
| """ | |||||
| model = model if isinstance( | |||||
| model, | |||||
| StructBertForTokenClassification) else Model.from_pretrained(model) | |||||
| if preprocessor is None: | |||||
| preprocessor = TokenClassifcationPreprocessor(model.model_dir) | |||||
| super().__init__(model=model, preprocessor=preprocessor, **kwargs) | |||||
| self.tokenizer = preprocessor.tokenizer | |||||
| self.config = model.config | |||||
| self.id2label = self.config.id2label | |||||
| def postprocess(self, inputs: Dict[str, Any]) -> Dict[str, str]: | |||||
| """process the prediction results | |||||
| Args: | |||||
| inputs (Dict[str, Any]): _description_ | |||||
| Returns: | |||||
| Dict[str, str]: the prediction results | |||||
| """ | |||||
| pred_list = inputs['predictions'] | |||||
| labels = [] | |||||
| for pre in pred_list: | |||||
| labels.append(self.id2label[pre]) | |||||
| labels = labels[1:-1] | |||||
| chunks = [] | |||||
| chunk = '' | |||||
| assert len(inputs['text']) == len(labels) | |||||
| for token, label in zip(inputs['text'], labels): | |||||
| if label[0] == 'B' or label[0] == 'I': | |||||
| chunk += token | |||||
| else: | |||||
| chunk += token | |||||
| chunks.append(chunk) | |||||
| chunk = '' | |||||
| if chunk: | |||||
| chunks.append(chunk) | |||||
| seg_result = ' '.join(chunks) | |||||
| rst = { | |||||
| 'output': seg_result, | |||||
| } | |||||
| return rst | |||||
| @@ -54,6 +54,13 @@ TASK_OUTPUTS = { | |||||
| # } | # } | ||||
| Tasks.pose_estimation: ['poses', 'boxes'], | Tasks.pose_estimation: ['poses', 'boxes'], | ||||
| # ocr detection result for single sample | |||||
| # { | |||||
| # "det_polygons": np.array with shape [num_text, 8], each box is | |||||
| # [x1, y1, x2, y2, x3, y3, x4, y4] | |||||
| # } | |||||
| Tasks.ocr_detection: ['det_polygons'], | |||||
| # ============ nlp tasks =================== | # ============ nlp tasks =================== | ||||
| # text classification result for single sample | # text classification result for single sample | ||||
| @@ -75,8 +82,27 @@ TASK_OUTPUTS = { | |||||
| # } | # } | ||||
| Tasks.fill_mask: ['text'], | Tasks.fill_mask: ['text'], | ||||
| # word segmentation result for single sample | |||||
| # { | |||||
| # "output": "今天 天气 不错 , 适合 出去 游玩" | |||||
| # } | |||||
| Tasks.word_segmentation: ['output'], | |||||
| # sentence similarity result for single sample | |||||
| # { | |||||
| # "labels": "1", | |||||
| # "scores": 0.9 | |||||
| # } | |||||
| Tasks.sentence_similarity: ['scores', 'labels'], | |||||
| # ============ audio tasks =================== | # ============ audio tasks =================== | ||||
| # audio processed for single file in PCM format | |||||
| # { | |||||
| # "output_pcm": np.array with shape(samples,) and dtype float32 | |||||
| # } | |||||
| Tasks.speech_signal_process: ['output_pcm'], | |||||
| # ============ multi-modal tasks =================== | # ============ multi-modal tasks =================== | ||||
| # image caption result for single sample | # image caption result for single sample | ||||
| @@ -1,7 +1,10 @@ | |||||
| # Copyright (c) Alibaba, Inc. and its affiliates. | # Copyright (c) Alibaba, Inc. and its affiliates. | ||||
| from .audio import LinearAECAndFbank | |||||
| from .base import Preprocessor | from .base import Preprocessor | ||||
| from .builder import PREPROCESSORS, build_preprocessor | from .builder import PREPROCESSORS, build_preprocessor | ||||
| from .common import Compose | from .common import Compose | ||||
| from .image import LoadImage, load_image | from .image import LoadImage, load_image | ||||
| from .multi_model import OfaImageCaptionPreprocessor | |||||
| from .nlp import * # noqa F403 | from .nlp import * # noqa F403 | ||||
| from .text_to_speech import * # noqa F403 | |||||
| @@ -0,0 +1,231 @@ | |||||
| import ctypes | |||||
| import os | |||||
| from typing import Any, Dict | |||||
| import numpy as np | |||||
| import scipy.io.wavfile as wav | |||||
| import torch | |||||
| from numpy.ctypeslib import ndpointer | |||||
| from modelscope.utils.constant import Fields | |||||
| from .builder import PREPROCESSORS | |||||
| def load_wav(path): | |||||
| samp_rate, data = wav.read(path) | |||||
| return np.float32(data), samp_rate | |||||
| def load_library(libaec): | |||||
| libaec_in_cwd = os.path.join('.', libaec) | |||||
| if os.path.exists(libaec_in_cwd): | |||||
| libaec = libaec_in_cwd | |||||
| mitaec = ctypes.cdll.LoadLibrary(libaec) | |||||
| fe_process = mitaec.fe_process_inst | |||||
| fe_process.argtypes = [ | |||||
| ndpointer(ctypes.c_float, flags='C_CONTIGUOUS'), | |||||
| ndpointer(ctypes.c_float, flags='C_CONTIGUOUS'), ctypes.c_int, | |||||
| ndpointer(ctypes.c_float, flags='C_CONTIGUOUS'), | |||||
| ndpointer(ctypes.c_float, flags='C_CONTIGUOUS'), | |||||
| ndpointer(ctypes.c_float, flags='C_CONTIGUOUS') | |||||
| ] | |||||
| return fe_process | |||||
| def do_linear_aec(fe_process, mic, ref, int16range=True): | |||||
| mic = np.float32(mic) | |||||
| ref = np.float32(ref) | |||||
| if len(mic) > len(ref): | |||||
| mic = mic[:len(ref)] | |||||
| out_mic = np.zeros_like(mic) | |||||
| out_linear = np.zeros_like(mic) | |||||
| out_echo = np.zeros_like(mic) | |||||
| out_ref = np.zeros_like(mic) | |||||
| if int16range: | |||||
| mic /= 32768 | |||||
| ref /= 32768 | |||||
| fe_process(mic, ref, len(mic), out_mic, out_linear, out_echo) | |||||
| # out_ref not in use here | |||||
| if int16range: | |||||
| out_mic *= 32768 | |||||
| out_linear *= 32768 | |||||
| out_echo *= 32768 | |||||
| return out_mic, out_ref, out_linear, out_echo | |||||
| def load_kaldi_feature_transform(filename): | |||||
| fp = open(filename, 'r') | |||||
| all_str = fp.read() | |||||
| pos1 = all_str.find('AddShift') | |||||
| pos2 = all_str.find('[', pos1) | |||||
| pos3 = all_str.find(']', pos2) | |||||
| mean = np.fromstring(all_str[pos2 + 1:pos3], dtype=np.float32, sep=' ') | |||||
| pos1 = all_str.find('Rescale') | |||||
| pos2 = all_str.find('[', pos1) | |||||
| pos3 = all_str.find(']', pos2) | |||||
| scale = np.fromstring(all_str[pos2 + 1:pos3], dtype=np.float32, sep=' ') | |||||
| fp.close() | |||||
| return mean, scale | |||||
| class Feature: | |||||
| r"""Extract feat from one utterance. | |||||
| """ | |||||
| def __init__(self, | |||||
| fbank_config, | |||||
| feat_type='spec', | |||||
| mvn_file=None, | |||||
| cuda=False): | |||||
| r""" | |||||
| Args: | |||||
| fbank_config (dict): | |||||
| feat_type (str): | |||||
| raw: do nothing | |||||
| fbank: use kaldi.fbank | |||||
| spec: Real/Imag | |||||
| logpow: log(1+|x|^2) | |||||
| mvn_file (str): the path of data file for mean variance normalization | |||||
| cuda: | |||||
| """ | |||||
| self.fbank_config = fbank_config | |||||
| self.feat_type = feat_type | |||||
| self.n_fft = fbank_config['frame_length'] * fbank_config[ | |||||
| 'sample_frequency'] // 1000 | |||||
| self.hop_length = fbank_config['frame_shift'] * fbank_config[ | |||||
| 'sample_frequency'] // 1000 | |||||
| self.window = torch.hamming_window(self.n_fft, periodic=False) | |||||
| self.mvn = False | |||||
| if mvn_file is not None and os.path.exists(mvn_file): | |||||
| print(f'loading mvn file: {mvn_file}') | |||||
| shift, scale = load_kaldi_feature_transform(mvn_file) | |||||
| self.shift = torch.from_numpy(shift) | |||||
| self.scale = torch.from_numpy(scale) | |||||
| self.mvn = True | |||||
| if cuda: | |||||
| self.window = self.window.cuda() | |||||
| if self.mvn: | |||||
| self.shift = self.shift.cuda() | |||||
| self.scale = self.scale.cuda() | |||||
| def compute(self, utt): | |||||
| r""" | |||||
| Args: | |||||
| utt: in [-32768, 32767] range | |||||
| Returns: | |||||
| [..., T, F] | |||||
| """ | |||||
| if self.feat_type == 'raw': | |||||
| return utt | |||||
| elif self.feat_type == 'fbank': | |||||
| # have to use local import before modelscope framework supoort lazy loading | |||||
| import torchaudio.compliance.kaldi as kaldi | |||||
| if len(utt.shape) == 1: | |||||
| utt = utt.unsqueeze(0) | |||||
| feat = kaldi.fbank(utt, **self.fbank_config) | |||||
| elif self.feat_type == 'spec': | |||||
| spec = torch.stft( | |||||
| utt / 32768, | |||||
| self.n_fft, | |||||
| self.hop_length, | |||||
| self.n_fft, | |||||
| self.window, | |||||
| center=False, | |||||
| return_complex=True) | |||||
| feat = torch.cat([spec.real, spec.imag], dim=-2).permute(-1, -2) | |||||
| elif self.feat_type == 'logpow': | |||||
| spec = torch.stft( | |||||
| utt, | |||||
| self.n_fft, | |||||
| self.hop_length, | |||||
| self.n_fft, | |||||
| self.window, | |||||
| center=False, | |||||
| return_complex=True) | |||||
| abspow = torch.abs(spec)**2 | |||||
| feat = torch.log(1 + abspow).permute(-1, -2) | |||||
| return feat | |||||
| def normalize(self, feat): | |||||
| if self.mvn: | |||||
| feat = feat + self.shift | |||||
| feat = feat * self.scale | |||||
| return feat | |||||
| @PREPROCESSORS.register_module(Fields.audio) | |||||
| class LinearAECAndFbank: | |||||
| SAMPLE_RATE = 16000 | |||||
| def __init__(self, io_config): | |||||
| self.trunc_length = 7200 * self.SAMPLE_RATE | |||||
| self.linear_aec_delay = io_config['linear_aec_delay'] | |||||
| self.feature = Feature(io_config['fbank_config'], | |||||
| io_config['feat_type'], io_config['mvn']) | |||||
| self.mitaec = load_library(io_config['mitaec_library']) | |||||
| self.mask_on_mic = io_config['mask_on'] == 'nearend_mic' | |||||
| def __call__(self, data: Dict[str, Any]) -> Dict[str, Any]: | |||||
| """ linear filtering the near end mic and far end audio, then extract the feature | |||||
| :param data: dict with two keys and correspond audios: "nearend_mic" and "farend_speech" | |||||
| :return: dict with two keys and Tensor values: "base" linear filtered audio,and "feature" | |||||
| """ | |||||
| # read files | |||||
| nearend_mic, fs = load_wav(data['nearend_mic']) | |||||
| assert fs == self.SAMPLE_RATE, f'The sample rate should be {self.SAMPLE_RATE}' | |||||
| farend_speech, fs = load_wav(data['farend_speech']) | |||||
| assert fs == self.SAMPLE_RATE, f'The sample rate should be {self.SAMPLE_RATE}' | |||||
| if 'nearend_speech' in data: | |||||
| nearend_speech, fs = load_wav(data['nearend_speech']) | |||||
| assert fs == self.SAMPLE_RATE, f'The sample rate should be {self.SAMPLE_RATE}' | |||||
| else: | |||||
| nearend_speech = np.zeros_like(nearend_mic) | |||||
| out_mic, out_ref, out_linear, out_echo = do_linear_aec( | |||||
| self.mitaec, nearend_mic, farend_speech) | |||||
| # fix 20ms linear aec delay by delaying the target speech | |||||
| extra_zeros = np.zeros([int(self.linear_aec_delay * fs)]) | |||||
| nearend_speech = np.concatenate([extra_zeros, nearend_speech]) | |||||
| # truncate files to the same length | |||||
| flen = min( | |||||
| len(out_mic), len(out_ref), len(out_linear), len(out_echo), | |||||
| len(nearend_speech)) | |||||
| fstart = 0 | |||||
| flen = min(flen, self.trunc_length) | |||||
| nearend_mic, out_ref, out_linear, out_echo, nearend_speech = ( | |||||
| out_mic[fstart:flen], out_ref[fstart:flen], | |||||
| out_linear[fstart:flen], out_echo[fstart:flen], | |||||
| nearend_speech[fstart:flen]) | |||||
| # extract features (frames, [mic, linear, ref, aes?]) | |||||
| feat = torch.FloatTensor() | |||||
| nearend_mic = torch.from_numpy(np.float32(nearend_mic)) | |||||
| fbank_nearend_mic = self.feature.compute(nearend_mic) | |||||
| feat = torch.cat([feat, fbank_nearend_mic], dim=1) | |||||
| out_linear = torch.from_numpy(np.float32(out_linear)) | |||||
| fbank_out_linear = self.feature.compute(out_linear) | |||||
| feat = torch.cat([feat, fbank_out_linear], dim=1) | |||||
| out_echo = torch.from_numpy(np.float32(out_echo)) | |||||
| fbank_out_echo = self.feature.compute(out_echo) | |||||
| feat = torch.cat([feat, fbank_out_echo], dim=1) | |||||
| # feature transform | |||||
| feat = self.feature.normalize(feat) | |||||
| # prepare target | |||||
| if nearend_speech is not None: | |||||
| nearend_speech = torch.from_numpy(np.float32(nearend_speech)) | |||||
| if self.mask_on_mic: | |||||
| base = nearend_mic | |||||
| else: | |||||
| base = out_linear | |||||
| out_data = {'base': base, 'target': nearend_speech, 'feature': feat} | |||||
| return out_data | |||||
| @@ -1,32 +1,50 @@ | |||||
| from typing import Any, Dict | |||||
| # Copyright (c) Alibaba, Inc. and its affiliates. | |||||
| import os.path as osp | |||||
| from typing import Any, Dict, Union | |||||
| import numpy as np | import numpy as np | ||||
| import torch | import torch | ||||
| from maas_hub.snapshot_download import snapshot_download | |||||
| from PIL import Image | from PIL import Image | ||||
| from modelscope.pipelines.base import Input | |||||
| from modelscope.preprocessors import load_image | |||||
| from modelscope.utils.constant import Tasks | |||||
| from modelscope.utils.logger import get_logger | |||||
| from ..base import Pipeline | |||||
| from ..builder import PIPELINES | |||||
| from modelscope.utils.constant import Fields, ModelFile | |||||
| from modelscope.utils.hub import get_model_cache_dir | |||||
| from modelscope.utils.type_assert import type_assert | |||||
| from .base import Preprocessor | |||||
| from .builder import PREPROCESSORS | |||||
| from .image import load_image | |||||
| logger = get_logger() | |||||
| __all__ = [ | |||||
| 'OfaImageCaptionPreprocessor', | |||||
| ] | |||||
| @PIPELINES.register_module(Tasks.image_captioning, module_name='ofa') | |||||
| class ImageCaptionPipeline(Pipeline): | |||||
| # TODO: refine using modelhub | |||||
| def __init__(self, model: str, bpe_dir: str): | |||||
| super().__init__() | |||||
| # turn on cuda if GPU is available | |||||
| @PREPROCESSORS.register_module( | |||||
| Fields.multi_modal, module_name=r'ofa-image-caption') | |||||
| class OfaImageCaptionPreprocessor(Preprocessor): | |||||
| def __init__(self, model_dir: str, *args, **kwargs): | |||||
| """preprocess the data via the vocab.txt from the `model_dir` path | |||||
| Args: | |||||
| model_dir (str): model path | |||||
| """ | |||||
| super().__init__(*args, **kwargs) | |||||
| if osp.exists(model_dir): | |||||
| local_model_dir = model_dir | |||||
| else: | |||||
| cache_path = get_model_cache_dir(model_dir) | |||||
| local_model_dir = cache_path if osp.exists( | |||||
| cache_path) else snapshot_download(model_dir) | |||||
| local_model = osp.join(local_model_dir, ModelFile.TORCH_MODEL_FILE) | |||||
| bpe_dir = local_model_dir | |||||
| from fairseq import checkpoint_utils, tasks, utils | from fairseq import checkpoint_utils, tasks, utils | ||||
| from ofa.tasks.mm_tasks import CaptionTask | from ofa.tasks.mm_tasks import CaptionTask | ||||
| tasks.register_task('caption', CaptionTask) | tasks.register_task('caption', CaptionTask) | ||||
| use_cuda = False | |||||
| # use fp16 only when GPU is available | |||||
| use_fp16 = False | |||||
| overrides = { | overrides = { | ||||
| 'bpe_dir': bpe_dir, | 'bpe_dir': bpe_dir, | ||||
| 'eval_cider': False, | 'eval_cider': False, | ||||
| @@ -35,21 +53,9 @@ class ImageCaptionPipeline(Pipeline): | |||||
| 'no_repeat_ngram_size': 3, | 'no_repeat_ngram_size': 3, | ||||
| 'seed': 7 | 'seed': 7 | ||||
| } | } | ||||
| models, cfg, task = checkpoint_utils.load_model_ensemble_and_task( | |||||
| utils.split_paths(model), arg_overrides=overrides) | |||||
| # Move models to GPU | |||||
| for model in models: | |||||
| model.eval() | |||||
| if use_cuda: | |||||
| model.cuda() | |||||
| if use_fp16: | |||||
| model.half() | |||||
| model.prepare_for_inference_(cfg) | |||||
| self.models = models | |||||
| # Initialize generator | |||||
| self.generator = task.build_generator(models, cfg.generation) | |||||
| model, cfg, task = checkpoint_utils.load_model_ensemble_and_task( | |||||
| utils.split_paths(local_model), arg_overrides=overrides) | |||||
| del model | |||||
| # Initialize transform | # Initialize transform | ||||
| from torchvision import transforms | from torchvision import transforms | ||||
| mean = [0.5, 0.5, 0.5] | mean = [0.5, 0.5, 0.5] | ||||
| @@ -69,7 +75,8 @@ class ImageCaptionPipeline(Pipeline): | |||||
| self.eos_item = torch.LongTensor([task.src_dict.eos()]) | self.eos_item = torch.LongTensor([task.src_dict.eos()]) | ||||
| self.pad_idx = task.src_dict.pad() | self.pad_idx = task.src_dict.pad() | ||||
| def preprocess(self, input: Input) -> Dict[str, Any]: | |||||
| @type_assert(object, (str, tuple)) | |||||
| def __call__(self, data: Union[str, tuple]) -> Dict[str, Any]: | |||||
| def encode_text(text, length=None, append_bos=False, append_eos=False): | def encode_text(text, length=None, append_bos=False, append_eos=False): | ||||
| s = self.task.tgt_dict.encode_line( | s = self.task.tgt_dict.encode_line( | ||||
| @@ -88,7 +95,7 @@ class ImageCaptionPipeline(Pipeline): | |||||
| patch_image = self.patch_resize_transform(input).unsqueeze(0) | patch_image = self.patch_resize_transform(input).unsqueeze(0) | ||||
| else: | else: | ||||
| patch_image = self.patch_resize_transform( | patch_image = self.patch_resize_transform( | ||||
| load_image(input)).unsqueeze(0) | |||||
| load_image(data)).unsqueeze(0) | |||||
| patch_mask = torch.tensor([True]) | patch_mask = torch.tensor([True]) | ||||
| text = 'what does the image describe?' | text = 'what does the image describe?' | ||||
| src_text = encode_text( | src_text = encode_text( | ||||
| @@ -105,17 +112,3 @@ class ImageCaptionPipeline(Pipeline): | |||||
| } | } | ||||
| } | } | ||||
| return sample | return sample | ||||
| def forward(self, input: Dict[str, Any]) -> Dict[str, Any]: | |||||
| from ofa.utils.eval_utils import eval_caption | |||||
| results, _ = eval_caption(self.task, self.generator, self.models, | |||||
| input) | |||||
| return { | |||||
| 'image_id': results[0]['image_id'], | |||||
| 'caption': results[0]['caption'] | |||||
| } | |||||
| def postprocess(self, inputs: Dict[str, Any]) -> Dict[str, Any]: | |||||
| # What should we do here ? | |||||
| return inputs | |||||
| @@ -12,7 +12,8 @@ from .builder import PREPROCESSORS | |||||
| __all__ = [ | __all__ = [ | ||||
| 'Tokenize', 'SequenceClassificationPreprocessor', | 'Tokenize', 'SequenceClassificationPreprocessor', | ||||
| 'TextGenerationPreprocessor', 'FillMaskPreprocessor' | |||||
| 'TextGenerationPreprocessor', 'TokenClassifcationPreprocessor', | |||||
| 'FillMaskPreprocessor' | |||||
| ] | ] | ||||
| @@ -53,12 +54,12 @@ class SequenceClassificationPreprocessor(Preprocessor): | |||||
| self.tokenizer = AutoTokenizer.from_pretrained(self.model_dir) | self.tokenizer = AutoTokenizer.from_pretrained(self.model_dir) | ||||
| print(f'this is the tokenzier {self.tokenizer}') | print(f'this is the tokenzier {self.tokenizer}') | ||||
| @type_assert(object, (str, tuple)) | |||||
| def __call__(self, data: Union[str, tuple]) -> Dict[str, Any]: | |||||
| @type_assert(object, (str, tuple, Dict)) | |||||
| def __call__(self, data: Union[str, tuple, Dict]) -> Dict[str, Any]: | |||||
| """process the raw input data | """process the raw input data | ||||
| Args: | Args: | ||||
| data (str or tuple): | |||||
| data (str or tuple, Dict): | |||||
| sentence1 (str): a sentence | sentence1 (str): a sentence | ||||
| Example: | Example: | ||||
| 'you are so handsome.' | 'you are so handsome.' | ||||
| @@ -70,22 +71,31 @@ class SequenceClassificationPreprocessor(Preprocessor): | |||||
| sentence2 (str): a sentence | sentence2 (str): a sentence | ||||
| Example: | Example: | ||||
| 'you are so beautiful.' | 'you are so beautiful.' | ||||
| or | |||||
| {field1: field_value1, field2: field_value2} | |||||
| field1 (str): field name, default 'first_sequence' | |||||
| field_value1 (str): a sentence | |||||
| Example: | |||||
| 'you are so handsome.' | |||||
| field2 (str): field name, default 'second_sequence' | |||||
| field_value2 (str): a sentence | |||||
| Example: | |||||
| 'you are so beautiful.' | |||||
| Returns: | Returns: | ||||
| Dict[str, Any]: the preprocessed data | Dict[str, Any]: the preprocessed data | ||||
| """ | """ | ||||
| if not isinstance(data, tuple): | |||||
| data = ( | |||||
| data, | |||||
| None, | |||||
| ) | |||||
| sentence1, sentence2 = data | |||||
| new_data = { | |||||
| self.first_sequence: sentence1, | |||||
| self.second_sequence: sentence2 | |||||
| } | |||||
| if isinstance(data, str): | |||||
| new_data = {self.first_sequence: data} | |||||
| elif isinstance(data, tuple): | |||||
| sentence1, sentence2 = data | |||||
| new_data = { | |||||
| self.first_sequence: sentence1, | |||||
| self.second_sequence: sentence2 | |||||
| } | |||||
| else: | |||||
| new_data = data | |||||
| # preprocess the data for the model input | # preprocess the data for the model input | ||||
| @@ -115,17 +125,15 @@ class SequenceClassificationPreprocessor(Preprocessor): | |||||
| return rst | return rst | ||||
| @PREPROCESSORS.register_module(Fields.nlp, module_name=r'palm') | |||||
| @PREPROCESSORS.register_module(Fields.nlp, module_name=r'palm2.0') | |||||
| class TextGenerationPreprocessor(Preprocessor): | class TextGenerationPreprocessor(Preprocessor): | ||||
| def __init__(self, model_dir: str, *args, **kwargs): | |||||
| def __init__(self, model_dir: str, tokenizer, *args, **kwargs): | |||||
| """preprocess the data using the vocab.txt from the `model_dir` path | """preprocess the data using the vocab.txt from the `model_dir` path | ||||
| Args: | Args: | ||||
| model_dir (str): model path | model_dir (str): model path | ||||
| """ | """ | ||||
| from sofa import PalmTokenizer | |||||
| super().__init__(*args, **kwargs) | super().__init__(*args, **kwargs) | ||||
| self.model_dir: str = model_dir | self.model_dir: str = model_dir | ||||
| @@ -134,7 +142,7 @@ class TextGenerationPreprocessor(Preprocessor): | |||||
| self.second_sequence: str = kwargs.pop('second_sequence', | self.second_sequence: str = kwargs.pop('second_sequence', | ||||
| 'second_sequence') | 'second_sequence') | ||||
| self.sequence_length: int = kwargs.pop('sequence_length', 128) | self.sequence_length: int = kwargs.pop('sequence_length', 128) | ||||
| self.tokenizer = PalmTokenizer.from_pretrained(model_dir) | |||||
| self.tokenizer = tokenizer | |||||
| @type_assert(object, str) | @type_assert(object, str) | ||||
| def __call__(self, data: str) -> Dict[str, Any]: | def __call__(self, data: str) -> Dict[str, Any]: | ||||
| @@ -153,7 +161,7 @@ class TextGenerationPreprocessor(Preprocessor): | |||||
| new_data = {self.first_sequence: data} | new_data = {self.first_sequence: data} | ||||
| # preprocess the data for the model input | # preprocess the data for the model input | ||||
| rst = {'input_ids': [], 'attention_mask': [], 'token_type_ids': []} | |||||
| rst = {'input_ids': [], 'attention_mask': []} | |||||
| max_seq_length = self.sequence_length | max_seq_length = self.sequence_length | ||||
| @@ -225,3 +233,51 @@ class FillMaskPreprocessor(Preprocessor): | |||||
| rst['token_type_ids'].append(feature['token_type_ids']) | rst['token_type_ids'].append(feature['token_type_ids']) | ||||
| return {k: torch.tensor(v) for k, v in rst.items()} | return {k: torch.tensor(v) for k, v in rst.items()} | ||||
| @PREPROCESSORS.register_module( | |||||
| Fields.nlp, module_name=r'bert-token-classification') | |||||
| class TokenClassifcationPreprocessor(Preprocessor): | |||||
| def __init__(self, model_dir: str, *args, **kwargs): | |||||
| """preprocess the data via the vocab.txt from the `model_dir` path | |||||
| Args: | |||||
| model_dir (str): model path | |||||
| """ | |||||
| super().__init__(*args, **kwargs) | |||||
| from sofa import SbertTokenizer | |||||
| self.model_dir: str = model_dir | |||||
| self.tokenizer = SbertTokenizer.from_pretrained(self.model_dir) | |||||
| @type_assert(object, str) | |||||
| def __call__(self, data: str) -> Dict[str, Any]: | |||||
| """process the raw input data | |||||
| Args: | |||||
| data (str): a sentence | |||||
| Example: | |||||
| 'you are so handsome.' | |||||
| Returns: | |||||
| Dict[str, Any]: the preprocessed data | |||||
| """ | |||||
| # preprocess the data for the model input | |||||
| text = data.replace(' ', '').strip() | |||||
| tokens = [] | |||||
| for token in text: | |||||
| token = self.tokenizer.tokenize(token) | |||||
| tokens.extend(token) | |||||
| input_ids = self.tokenizer.convert_tokens_to_ids(tokens) | |||||
| input_ids = self.tokenizer.build_inputs_with_special_tokens(input_ids) | |||||
| attention_mask = [1] * len(input_ids) | |||||
| token_type_ids = [0] * len(input_ids) | |||||
| return { | |||||
| 'text': text, | |||||
| 'input_ids': input_ids, | |||||
| 'attention_mask': attention_mask, | |||||
| 'token_type_ids': token_type_ids | |||||
| } | |||||
| @@ -0,0 +1,51 @@ | |||||
| # Copyright (c) Alibaba, Inc. and its affiliates. | |||||
| import io | |||||
| from typing import Any, Dict, Union | |||||
| from modelscope.fileio import File | |||||
| from modelscope.models.audio.tts.frontend import GenericTtsFrontend | |||||
| from modelscope.models.base import Model | |||||
| from modelscope.utils.audio.tts_exceptions import * # noqa F403 | |||||
| from modelscope.utils.constant import Fields | |||||
| from .base import Preprocessor | |||||
| from .builder import PREPROCESSORS | |||||
| __all__ = ['TextToTacotronSymbols', 'text_to_tacotron_symbols'] | |||||
| @PREPROCESSORS.register_module( | |||||
| Fields.audio, module_name=r'text_to_tacotron_symbols') | |||||
| class TextToTacotronSymbols(Preprocessor): | |||||
| """extract tacotron symbols from text. | |||||
| Args: | |||||
| res_path (str): TTS frontend resource url | |||||
| lang_type (str): language type, valid values are "pinyin" and "chenmix" | |||||
| """ | |||||
| def __init__(self, model_name, lang_type='pinyin'): | |||||
| self._frontend_model = Model.from_pretrained( | |||||
| model_name, lang_type=lang_type) | |||||
| assert self._frontend_model is not None, 'load model from pretained failed' | |||||
| def __call__(self, data: str) -> Dict[str, Any]: | |||||
| """Call functions to load text and get tacotron symbols. | |||||
| Args: | |||||
| input (str): text with utf-8 | |||||
| Returns: | |||||
| symbos (list[str]): texts in tacotron symbols format. | |||||
| """ | |||||
| return self._frontend_model.forward(data) | |||||
| def text_to_tacotron_symbols(text='', path='./', lang='pinyin'): | |||||
| """ simple interface to transform text to tacotron symbols | |||||
| Args: | |||||
| text (str): input text | |||||
| path (str): resource path | |||||
| lang (str): language type from one of "pinyin" and "chenmix" | |||||
| """ | |||||
| transform = TextToTacotronSymbols(path, lang) | |||||
| return transform(text) | |||||
| @@ -0,0 +1,22 @@ | |||||
| import os | |||||
| from pathlib import Path | |||||
| # Cache location | |||||
| DEFAULT_CACHE_HOME = '~/.cache' | |||||
| CACHE_HOME = os.getenv('CACHE_HOME', DEFAULT_CACHE_HOME) | |||||
| DEFAULT_MS_CACHE_HOME = os.path.join(CACHE_HOME, 'modelscope/hub') | |||||
| MS_CACHE_HOME = os.path.expanduser( | |||||
| os.getenv('MS_CACHE_HOME', DEFAULT_MS_CACHE_HOME)) | |||||
| DEFAULT_MS_DATASETS_CACHE = os.path.join(MS_CACHE_HOME, 'datasets') | |||||
| MS_DATASETS_CACHE = Path( | |||||
| os.getenv('MS_DATASETS_CACHE', DEFAULT_MS_DATASETS_CACHE)) | |||||
| DOWNLOADED_DATASETS_DIR = 'downloads' | |||||
| DEFAULT_DOWNLOADED_DATASETS_PATH = os.path.join(MS_DATASETS_CACHE, | |||||
| DOWNLOADED_DATASETS_DIR) | |||||
| DOWNLOADED_DATASETS_PATH = Path( | |||||
| os.getenv('DOWNLOADED_DATASETS_PATH', DEFAULT_DOWNLOADED_DATASETS_PATH)) | |||||
| MS_HUB_ENDPOINT = os.environ.get('MS_HUB_ENDPOINT', | |||||
| 'http://101.201.119.157:31752') | |||||
| @@ -1,64 +1,81 @@ | |||||
| from typing import (Any, Callable, Dict, List, Mapping, Optional, Sequence, | |||||
| Union) | |||||
| import os | |||||
| from typing import (Any, Callable, Dict, Iterable, List, Mapping, Optional, | |||||
| Sequence, Union) | |||||
| from datasets import Dataset, load_dataset | |||||
| import numpy as np | |||||
| from datasets import Dataset | |||||
| from datasets import load_dataset as hf_load_dataset | |||||
| from datasets.config import TF_AVAILABLE, TORCH_AVAILABLE | |||||
| from datasets.packaged_modules import _PACKAGED_DATASETS_MODULES | |||||
| from datasets.utils.file_utils import (is_relative_path, | |||||
| relative_to_absolute_path) | |||||
| from modelscope.pydatasets.config import MS_DATASETS_CACHE | |||||
| from modelscope.pydatasets.utils.ms_api import MsApi | |||||
| from modelscope.utils.constant import Hubs | from modelscope.utils.constant import Hubs | ||||
| from modelscope.utils.logger import get_logger | from modelscope.utils.logger import get_logger | ||||
| logger = get_logger() | logger = get_logger() | ||||
| def format_list(para) -> List: | |||||
| if para is None: | |||||
| para = [] | |||||
| elif isinstance(para, str): | |||||
| para = [para] | |||||
| elif len(set(para)) < len(para): | |||||
| raise ValueError(f'List columns contains duplicates: {para}') | |||||
| return para | |||||
| class PyDataset: | class PyDataset: | ||||
| _hf_ds = None # holds the underlying HuggingFace Dataset | _hf_ds = None # holds the underlying HuggingFace Dataset | ||||
| """A PyDataset backed by hugging face Dataset.""" | """A PyDataset backed by hugging face Dataset.""" | ||||
| def __init__(self, hf_ds: Dataset): | |||||
| def __init__(self, hf_ds: Dataset, target: Optional[str] = None): | |||||
| self._hf_ds = hf_ds | self._hf_ds = hf_ds | ||||
| self.target = None | |||||
| self.target = target | |||||
| def __iter__(self): | def __iter__(self): | ||||
| if isinstance(self._hf_ds, Dataset): | |||||
| for item in self._hf_ds: | |||||
| if self.target is not None: | |||||
| yield item[self.target] | |||||
| else: | |||||
| yield item | |||||
| else: | |||||
| for ds in self._hf_ds.values(): | |||||
| for item in ds: | |||||
| if self.target is not None: | |||||
| yield item[self.target] | |||||
| else: | |||||
| yield item | |||||
| for item in self._hf_ds: | |||||
| if self.target is not None: | |||||
| yield item[self.target] | |||||
| else: | |||||
| yield item | |||||
| def __getitem__(self, key): | |||||
| return self._hf_ds[key] | |||||
| @classmethod | @classmethod | ||||
| def from_hf_dataset(cls, | def from_hf_dataset(cls, | ||||
| hf_ds: Dataset, | hf_ds: Dataset, | ||||
| target: str = None) -> 'PyDataset': | |||||
| dataset = cls(hf_ds) | |||||
| dataset.target = target | |||||
| return dataset | |||||
| target: str = None) -> Union[dict, 'PyDataset']: | |||||
| if isinstance(hf_ds, Dataset): | |||||
| return cls(hf_ds, target) | |||||
| if len(hf_ds.keys()) == 1: | |||||
| return cls(next(iter(hf_ds.values())), target) | |||||
| return {k: cls(v, target) for k, v in hf_ds.items()} | |||||
| @staticmethod | @staticmethod | ||||
| def load(path: Union[str, list], | |||||
| target: Optional[str] = None, | |||||
| version: Optional[str] = None, | |||||
| name: Optional[str] = None, | |||||
| split: Optional[str] = None, | |||||
| data_dir: Optional[str] = None, | |||||
| data_files: Optional[Union[str, Sequence[str], | |||||
| Mapping[str, | |||||
| Union[str, | |||||
| Sequence[str]]]]] = None, | |||||
| hub: Optional[Hubs] = None) -> 'PyDataset': | |||||
| def load( | |||||
| dataset_name: Union[str, list], | |||||
| target: Optional[str] = None, | |||||
| version: Optional[str] = None, | |||||
| hub: Optional[Hubs] = Hubs.modelscope, | |||||
| subset_name: Optional[str] = None, | |||||
| split: Optional[str] = None, | |||||
| data_dir: Optional[str] = None, | |||||
| data_files: Optional[Union[str, Sequence[str], | |||||
| Mapping[str, Union[str, | |||||
| Sequence[str]]]]] = None | |||||
| ) -> Union[dict, 'PyDataset']: | |||||
| """Load a PyDataset from the ModelScope Hub, Hugging Face Hub, urls, or a local dataset. | """Load a PyDataset from the ModelScope Hub, Hugging Face Hub, urls, or a local dataset. | ||||
| Args: | Args: | ||||
| path (str): Path or name of the dataset. | |||||
| dataset_name (str): Path or name of the dataset. | |||||
| target (str, optional): Name of the column to output. | target (str, optional): Name of the column to output. | ||||
| version (str, optional): Version of the dataset script to load: | version (str, optional): Version of the dataset script to load: | ||||
| name (str, optional): Defining the subset_name of the dataset. | |||||
| subset_name (str, optional): Defining the subset_name of the dataset. | |||||
| data_dir (str, optional): Defining the data_dir of the dataset configuration. I | data_dir (str, optional): Defining the data_dir of the dataset configuration. I | ||||
| data_files (str or Sequence or Mapping, optional): Path(s) to source data file(s). | data_files (str or Sequence or Mapping, optional): Path(s) to source data file(s). | ||||
| split (str, optional): Which split of the data to load. | split (str, optional): Which split of the data to load. | ||||
| @@ -67,53 +84,302 @@ class PyDataset: | |||||
| Returns: | Returns: | ||||
| PyDataset (obj:`PyDataset`): PyDataset object for a certain dataset. | PyDataset (obj:`PyDataset`): PyDataset object for a certain dataset. | ||||
| """ | """ | ||||
| if Hubs.modelscope == hub: | |||||
| # TODO: parse data meta information from modelscope hub | |||||
| # and possibly download data files to local (and update path) | |||||
| print('getting data from modelscope hub') | |||||
| if isinstance(path, str): | |||||
| dataset = load_dataset( | |||||
| path, | |||||
| name=name, | |||||
| if hub == Hubs.huggingface: | |||||
| dataset = hf_load_dataset( | |||||
| dataset_name, | |||||
| name=subset_name, | |||||
| revision=version, | revision=version, | ||||
| split=split, | split=split, | ||||
| data_dir=data_dir, | data_dir=data_dir, | ||||
| data_files=data_files) | data_files=data_files) | ||||
| elif isinstance(path, list): | |||||
| return PyDataset.from_hf_dataset(dataset, target=target) | |||||
| else: | |||||
| return PyDataset._load_ms_dataset( | |||||
| dataset_name, | |||||
| target=target, | |||||
| subset_name=subset_name, | |||||
| version=version, | |||||
| split=split, | |||||
| data_dir=data_dir, | |||||
| data_files=data_files) | |||||
| @staticmethod | |||||
| def _load_ms_dataset( | |||||
| dataset_name: Union[str, list], | |||||
| target: Optional[str] = None, | |||||
| version: Optional[str] = None, | |||||
| subset_name: Optional[str] = None, | |||||
| split: Optional[str] = None, | |||||
| data_dir: Optional[str] = None, | |||||
| data_files: Optional[Union[str, Sequence[str], | |||||
| Mapping[str, Union[str, | |||||
| Sequence[str]]]]] = None | |||||
| ) -> Union[dict, 'PyDataset']: | |||||
| if isinstance(dataset_name, str): | |||||
| use_hf = False | |||||
| if dataset_name in _PACKAGED_DATASETS_MODULES or os.path.isdir(dataset_name) or \ | |||||
| (os.path.isfile(dataset_name) and dataset_name.endswith('.py')): | |||||
| use_hf = True | |||||
| elif is_relative_path(dataset_name): | |||||
| ms_api = MsApi() | |||||
| dataset_scripts = ms_api.fetch_dataset_scripts( | |||||
| dataset_name, version) | |||||
| if 'py' in dataset_scripts: # dataset copied from hf datasets | |||||
| dataset_name = dataset_scripts['py'][0] | |||||
| use_hf = True | |||||
| else: | |||||
| raise FileNotFoundError( | |||||
| f"Couldn't find a dataset script at {relative_to_absolute_path(dataset_name)} " | |||||
| f'or any data file in the same directory.') | |||||
| if use_hf: | |||||
| dataset = hf_load_dataset( | |||||
| dataset_name, | |||||
| name=subset_name, | |||||
| revision=version, | |||||
| split=split, | |||||
| data_dir=data_dir, | |||||
| data_files=data_files, | |||||
| cache_dir=MS_DATASETS_CACHE) | |||||
| else: | |||||
| # TODO load from ms datahub | |||||
| raise NotImplementedError( | |||||
| f'Dataset {dataset_name} load from modelscope datahub to be implemented in ' | |||||
| f'the future') | |||||
| elif isinstance(dataset_name, list): | |||||
| if target is None: | if target is None: | ||||
| target = 'target' | target = 'target' | ||||
| dataset = Dataset.from_dict({target: [p] for p in path}) | |||||
| dataset = Dataset.from_dict({target: dataset_name}) | |||||
| else: | else: | ||||
| raise TypeError('path must be a str or a list, but got' | raise TypeError('path must be a str or a list, but got' | ||||
| f' {type(path)}') | |||||
| f' {type(dataset_name)}') | |||||
| return PyDataset.from_hf_dataset(dataset, target=target) | return PyDataset.from_hf_dataset(dataset, target=target) | ||||
| def to_torch_dataset_with_processors( | |||||
| self, | |||||
| preprocessors: Union[Callable, List[Callable]], | |||||
| columns: Union[str, List[str]] = None, | |||||
| ): | |||||
| preprocessor_list = preprocessors if isinstance( | |||||
| preprocessors, list) else [preprocessors] | |||||
| columns = format_list(columns) | |||||
| columns = [ | |||||
| key for key in self._hf_ds.features.keys() if key in columns | |||||
| ] | |||||
| sample = next(iter(self._hf_ds)) | |||||
| sample_res = {k: np.array(sample[k]) for k in columns} | |||||
| for processor in preprocessor_list: | |||||
| sample_res.update( | |||||
| {k: np.array(v) | |||||
| for k, v in processor(sample).items()}) | |||||
| def is_numpy_number(value): | |||||
| return np.issubdtype(value.dtype, np.integer) or np.issubdtype( | |||||
| value.dtype, np.floating) | |||||
| retained_columns = [] | |||||
| for k in sample_res.keys(): | |||||
| if not is_numpy_number(sample_res[k]): | |||||
| logger.warning( | |||||
| f'Data of column {k} is non-numeric, will be removed') | |||||
| continue | |||||
| retained_columns.append(k) | |||||
| import torch | |||||
| class MsIterableDataset(torch.utils.data.IterableDataset): | |||||
| def __init__(self, dataset: Iterable): | |||||
| super(MsIterableDataset).__init__() | |||||
| self.dataset = dataset | |||||
| def __iter__(self): | |||||
| for item_dict in self.dataset: | |||||
| res = { | |||||
| k: np.array(item_dict[k]) | |||||
| for k in columns if k in retained_columns | |||||
| } | |||||
| for preprocessor in preprocessor_list: | |||||
| res.update({ | |||||
| k: np.array(v) | |||||
| for k, v in preprocessor(item_dict).items() | |||||
| if k in retained_columns | |||||
| }) | |||||
| yield res | |||||
| return MsIterableDataset(self._hf_ds) | |||||
| def to_torch_dataset( | def to_torch_dataset( | ||||
| self, | self, | ||||
| columns: Union[str, List[str]] = None, | columns: Union[str, List[str]] = None, | ||||
| output_all_columns: bool = False, | |||||
| preprocessors: Union[Callable, List[Callable]] = None, | |||||
| **format_kwargs, | **format_kwargs, | ||||
| ): | ): | ||||
| self._hf_ds.reset_format() | |||||
| self._hf_ds.set_format( | |||||
| type='torch', | |||||
| columns=columns, | |||||
| output_all_columns=output_all_columns, | |||||
| format_kwargs=format_kwargs) | |||||
| return self._hf_ds | |||||
| """Create a torch.utils.data.Dataset from the MS Dataset. The torch.utils.data.Dataset can be passed to | |||||
| torch.utils.data.DataLoader. | |||||
| Args: | |||||
| preprocessors (Callable or List[Callable], default None): (list of) Preprocessor object used to process | |||||
| every sample of the dataset. The output type of processors is dict, and each numeric field of the dict | |||||
| will be used as a field of torch.utils.data.Dataset. | |||||
| columns (str or List[str], default None): Dataset column(s) to be loaded (numeric data only). If the | |||||
| preprocessor is None, the arg columns must have at least one column. If the `preprocessors` is not None, | |||||
| the output fields of processors will also be added. | |||||
| format_kwargs: A `dict` of arguments to be passed to the `torch.tensor`. | |||||
| Returns: | |||||
| :class:`tf.data.Dataset` | |||||
| """ | |||||
| if not TORCH_AVAILABLE: | |||||
| raise ImportError( | |||||
| 'The function to_torch_dataset requires pytorch to be installed' | |||||
| ) | |||||
| if preprocessors is not None: | |||||
| return self.to_torch_dataset_with_processors(preprocessors) | |||||
| else: | |||||
| self._hf_ds.reset_format() | |||||
| self._hf_ds.set_format( | |||||
| type='torch', columns=columns, format_kwargs=format_kwargs) | |||||
| return self._hf_ds | |||||
| def to_tf_dataset_with_processors( | |||||
| self, | |||||
| batch_size: int, | |||||
| shuffle: bool, | |||||
| preprocessors: Union[Callable, List[Callable]], | |||||
| drop_remainder: bool = None, | |||||
| prefetch: bool = True, | |||||
| label_cols: Union[str, List[str]] = None, | |||||
| columns: Union[str, List[str]] = None, | |||||
| ): | |||||
| preprocessor_list = preprocessors if isinstance( | |||||
| preprocessors, list) else [preprocessors] | |||||
| label_cols = format_list(label_cols) | |||||
| columns = format_list(columns) | |||||
| cols_to_retain = list(set(label_cols + columns)) | |||||
| retained_columns = [ | |||||
| key for key in self._hf_ds.features.keys() if key in cols_to_retain | |||||
| ] | |||||
| import tensorflow as tf | |||||
| tf_dataset = tf.data.Dataset.from_tensor_slices( | |||||
| np.arange(len(self._hf_ds), dtype=np.int64)) | |||||
| if shuffle: | |||||
| tf_dataset = tf_dataset.shuffle(buffer_size=len(self._hf_ds)) | |||||
| def func(i, return_dict=False): | |||||
| i = int(i) | |||||
| res = {k: np.array(self._hf_ds[i][k]) for k in retained_columns} | |||||
| for preprocessor in preprocessor_list: | |||||
| # TODO preprocessor output may have the same key | |||||
| res.update({ | |||||
| k: np.array(v) | |||||
| for k, v in preprocessor(self._hf_ds[i]).items() | |||||
| }) | |||||
| if return_dict: | |||||
| return res | |||||
| return tuple(list(res.values())) | |||||
| sample_res = func(0, True) | |||||
| @tf.function(input_signature=[tf.TensorSpec(None, tf.int64)]) | |||||
| def fetch_function(i): | |||||
| output = tf.numpy_function( | |||||
| func, | |||||
| inp=[i], | |||||
| Tout=[ | |||||
| tf.dtypes.as_dtype(val.dtype) | |||||
| for val in sample_res.values() | |||||
| ], | |||||
| ) | |||||
| return {key: output[i] for i, key in enumerate(sample_res)} | |||||
| tf_dataset = tf_dataset.map( | |||||
| fetch_function, num_parallel_calls=tf.data.AUTOTUNE) | |||||
| if label_cols: | |||||
| def split_features_and_labels(input_batch): | |||||
| labels = { | |||||
| key: tensor | |||||
| for key, tensor in input_batch.items() if key in label_cols | |||||
| } | |||||
| if len(input_batch) == 1: | |||||
| input_batch = next(iter(input_batch.values())) | |||||
| if len(labels) == 1: | |||||
| labels = next(iter(labels.values())) | |||||
| return input_batch, labels | |||||
| tf_dataset = tf_dataset.map(split_features_and_labels) | |||||
| elif len(columns) == 1: | |||||
| tf_dataset = tf_dataset.map(lambda x: next(iter(x.values()))) | |||||
| if batch_size > 1: | |||||
| tf_dataset = tf_dataset.batch( | |||||
| batch_size, drop_remainder=drop_remainder) | |||||
| if prefetch: | |||||
| tf_dataset = tf_dataset.prefetch(tf.data.experimental.AUTOTUNE) | |||||
| return tf_dataset | |||||
| def to_tf_dataset( | def to_tf_dataset( | ||||
| self, | self, | ||||
| columns: Union[str, List[str]], | |||||
| batch_size: int, | batch_size: int, | ||||
| shuffle: bool, | shuffle: bool, | ||||
| collate_fn: Callable, | |||||
| preprocessors: Union[Callable, List[Callable]] = None, | |||||
| columns: Union[str, List[str]] = None, | |||||
| collate_fn: Callable = None, | |||||
| drop_remainder: bool = None, | drop_remainder: bool = None, | ||||
| collate_fn_args: Dict[str, Any] = None, | collate_fn_args: Dict[str, Any] = None, | ||||
| label_cols: Union[str, List[str]] = None, | label_cols: Union[str, List[str]] = None, | ||||
| dummy_labels: bool = False, | |||||
| prefetch: bool = True, | prefetch: bool = True, | ||||
| ): | ): | ||||
| """Create a tf.data.Dataset from the MS Dataset. This tf.data.Dataset can be passed to tf methods like | |||||
| model.fit() or model.predict(). | |||||
| Args: | |||||
| batch_size (int): Number of samples in a single batch. | |||||
| shuffle(bool): Shuffle the dataset order. | |||||
| preprocessors (Callable or List[Callable], default None): (list of) Preprocessor object used to process | |||||
| every sample of the dataset. The output type of processors is dict, and each field of the dict will be | |||||
| used as a field of the tf.data. Dataset. If the `preprocessors` is None, the `collate_fn` | |||||
| shouldn't be None. | |||||
| columns (str or List[str], default None): Dataset column(s) to be loaded. If the preprocessor is None, | |||||
| the arg columns must have at least one column. If the `preprocessors` is not None, the output fields of | |||||
| processors will also be added. | |||||
| collate_fn(Callable, default None): A callable object used to collect lists of samples into a batch. If | |||||
| the `preprocessors` is None, the `collate_fn` shouldn't be None. | |||||
| drop_remainder(bool, default None): Drop the last incomplete batch when loading. | |||||
| collate_fn_args (Dict, optional): A `dict` of arguments to be passed to the`collate_fn`. | |||||
| label_cols (str or List[str], defalut None): Dataset column(s) to load as labels. | |||||
| prefetch (bool, default True): Prefetch data. | |||||
| Returns: | |||||
| :class:`tf.data.Dataset` | |||||
| """ | |||||
| if not TF_AVAILABLE: | |||||
| raise ImportError( | |||||
| 'The function to_tf_dataset requires Tensorflow to be installed.' | |||||
| ) | |||||
| if preprocessors is not None: | |||||
| return self.to_tf_dataset_with_processors( | |||||
| batch_size, | |||||
| shuffle, | |||||
| preprocessors, | |||||
| drop_remainder=drop_remainder, | |||||
| prefetch=prefetch, | |||||
| label_cols=label_cols, | |||||
| columns=columns) | |||||
| if collate_fn is None: | |||||
| logger.error( | |||||
| 'The `preprocessors` and the `collate_fn` should`t be both None.' | |||||
| ) | |||||
| return None | |||||
| self._hf_ds.reset_format() | self._hf_ds.reset_format() | ||||
| return self._hf_ds.to_tf_dataset( | return self._hf_ds.to_tf_dataset( | ||||
| columns, | columns, | ||||
| @@ -123,7 +389,6 @@ class PyDataset: | |||||
| drop_remainder=drop_remainder, | drop_remainder=drop_remainder, | ||||
| collate_fn_args=collate_fn_args, | collate_fn_args=collate_fn_args, | ||||
| label_cols=label_cols, | label_cols=label_cols, | ||||
| dummy_labels=dummy_labels, | |||||
| prefetch=prefetch) | prefetch=prefetch) | ||||
| def to_hf_dataset(self) -> Dataset: | def to_hf_dataset(self) -> Dataset: | ||||
| @@ -0,0 +1,66 @@ | |||||
| import os | |||||
| from collections import defaultdict | |||||
| from typing import Optional | |||||
| import requests | |||||
| from modelscope.pydatasets.config import (DOWNLOADED_DATASETS_PATH, | |||||
| MS_HUB_ENDPOINT) | |||||
| from modelscope.utils.logger import get_logger | |||||
| logger = get_logger() | |||||
| class MsApi: | |||||
| def __init__(self, endpoint=MS_HUB_ENDPOINT): | |||||
| self.endpoint = endpoint | |||||
| def list_datasets(self): | |||||
| path = f'{self.endpoint}/api/v1/datasets' | |||||
| headers = None | |||||
| params = {} | |||||
| r = requests.get(path, params=params, headers=headers) | |||||
| r.raise_for_status() | |||||
| dataset_list = r.json()['Data'] | |||||
| return [x['Name'] for x in dataset_list] | |||||
| def fetch_dataset_scripts(self, | |||||
| dataset_name: str, | |||||
| version: Optional[str] = 'master', | |||||
| force_download=False): | |||||
| datahub_url = f'{self.endpoint}/api/v1/datasets?Query={dataset_name}' | |||||
| r = requests.get(datahub_url) | |||||
| r.raise_for_status() | |||||
| dataset_list = r.json()['Data'] | |||||
| if len(dataset_list) == 0: | |||||
| return None | |||||
| dataset_id = dataset_list[0]['Id'] | |||||
| version = version or 'master' | |||||
| datahub_url = f'{self.endpoint}/api/v1/datasets/{dataset_id}/repo/tree?Revision={version}' | |||||
| r = requests.get(datahub_url) | |||||
| r.raise_for_status() | |||||
| file_list = r.json()['Data']['Files'] | |||||
| cache_dir = os.path.join(DOWNLOADED_DATASETS_PATH, dataset_name, | |||||
| version) | |||||
| os.makedirs(cache_dir, exist_ok=True) | |||||
| local_paths = defaultdict(list) | |||||
| for file_info in file_list: | |||||
| file_path = file_info['Path'] | |||||
| if file_path.endswith('.py'): | |||||
| datahub_url = f'{self.endpoint}/api/v1/datasets/{dataset_id}/repo/files?' \ | |||||
| f'Revision={version}&Path={file_path}' | |||||
| r = requests.get(datahub_url) | |||||
| r.raise_for_status() | |||||
| content = r.json()['Data']['Content'] | |||||
| local_path = os.path.join(cache_dir, file_path) | |||||
| if os.path.exists(local_path) and not force_download: | |||||
| logger.warning( | |||||
| f"Reusing dataset {dataset_name}'s python file ({local_path})" | |||||
| ) | |||||
| local_paths['py'].append(local_path) | |||||
| continue | |||||
| with open(local_path, 'w') as f: | |||||
| f.writelines(content) | |||||
| local_paths['py'].append(local_path) | |||||
| return local_paths | |||||
| @@ -0,0 +1,42 @@ | |||||
| """ | |||||
| Define TTS exceptions | |||||
| """ | |||||
| class TtsException(Exception): | |||||
| """ | |||||
| TTS exception class. | |||||
| """ | |||||
| pass | |||||
| class TtsFrontendException(TtsException): | |||||
| """ | |||||
| TTS frontend module level exceptions. | |||||
| """ | |||||
| pass | |||||
| class TtsFrontendInitializeFailedException(TtsFrontendException): | |||||
| """ | |||||
| If tts frontend resource is invalid or not exist, this exception will be raised. | |||||
| """ | |||||
| pass | |||||
| class TtsFrontendLanguageTypeInvalidException(TtsFrontendException): | |||||
| """ | |||||
| If language type is invalid, this exception will be raised. | |||||
| """ | |||||
| class TtsVocoderException(TtsException): | |||||
| """ | |||||
| Vocoder exception | |||||
| """ | |||||
| class TtsVocoderMelspecShapeMismatchException(TtsVocoderException): | |||||
| """ | |||||
| If vocoder's input melspec shape mismatch, this exception will be raised. | |||||
| """ | |||||
| @@ -28,8 +28,10 @@ class Tasks(object): | |||||
| image_editing = 'image-editing' | image_editing = 'image-editing' | ||||
| image_generation = 'image-generation' | image_generation = 'image-generation' | ||||
| image_matting = 'image-matting' | image_matting = 'image-matting' | ||||
| ocr_detection = 'ocr-detection' | |||||
| # nlp tasks | # nlp tasks | ||||
| word_segmentation = 'word-segmentation' | |||||
| sentiment_analysis = 'sentiment-analysis' | sentiment_analysis = 'sentiment-analysis' | ||||
| sentence_similarity = 'sentence-similarity' | sentence_similarity = 'sentence-similarity' | ||||
| text_classification = 'text-classification' | text_classification = 'text-classification' | ||||
| @@ -67,7 +67,6 @@ class Registry(object): | |||||
| if module_name in self._modules[group_key]: | if module_name in self._modules[group_key]: | ||||
| raise KeyError(f'{module_name} is already registered in ' | raise KeyError(f'{module_name} is already registered in ' | ||||
| f'{self._name}[{group_key}]') | f'{self._name}[{group_key}]') | ||||
| self._modules[group_key][module_name] = module_cls | self._modules[group_key][module_name] = module_cls | ||||
| module_cls.group_key = group_key | module_cls.group_key = group_key | ||||
| @@ -2,6 +2,9 @@ | |||||
| # Copyright (c) Alibaba, Inc. and its affiliates. | # Copyright (c) Alibaba, Inc. and its affiliates. | ||||
| import os | import os | ||||
| import unittest | |||||
| from datasets.config import TF_AVAILABLE, TORCH_AVAILABLE | |||||
| TEST_LEVEL = 2 | TEST_LEVEL = 2 | ||||
| TEST_LEVEL_STR = 'TEST_LEVEL' | TEST_LEVEL_STR = 'TEST_LEVEL' | ||||
| @@ -15,6 +18,18 @@ def test_level(): | |||||
| return TEST_LEVEL | return TEST_LEVEL | ||||
| def require_tf(test_case): | |||||
| if not TF_AVAILABLE: | |||||
| test_case = unittest.skip('test requires TensorFlow')(test_case) | |||||
| return test_case | |||||
| def require_torch(test_case): | |||||
| if not TORCH_AVAILABLE: | |||||
| test_case = unittest.skip('test requires PyTorch')(test_case) | |||||
| return test_case | |||||
| def set_test_level(level: int): | def set_test_level(level: int): | ||||
| global TEST_LEVEL | global TEST_LEVEL | ||||
| TEST_LEVEL = level | TEST_LEVEL = level | ||||
| @@ -2,4 +2,5 @@ | |||||
| -r requirements/pipeline.txt | -r requirements/pipeline.txt | ||||
| -r requirements/multi-modal.txt | -r requirements/multi-modal.txt | ||||
| -r requirements/nlp.txt | -r requirements/nlp.txt | ||||
| -r requirements/audio.txt | |||||
| -r requirements/cv.txt | -r requirements/cv.txt | ||||
| @@ -0,0 +1,26 @@ | |||||
| #tts | |||||
| h5py==2.10.0 | |||||
| #https://isv-data.oss-cn-hangzhou.aliyuncs.com/ics/MaaS/TTS/requirements/ttsfrd-0.0.1-cp36-cp36m-linux_x86_64.whl | |||||
| https://isv-data.oss-cn-hangzhou.aliyuncs.com/ics/MaaS/TTS/requirements/ttsfrd-0.0.1-cp37-cp37m-linux_x86_64.whl | |||||
| https://swap.oss-cn-hangzhou.aliyuncs.com/Jiaqi%2Fmaas%2Ftts%2Frequirements%2Fpytorch_wavelets-1.3.0-py3-none-any.whl?Expires=1685688388&OSSAccessKeyId=LTAI4Ffebq4d9jTVDwiSbY4L&Signature=jcQbg5EZ%2Bdys3%2F4BRn3srrKLdIg%3D | |||||
| #https://isv-data.oss-cn-hangzhou.aliyuncs.com/ics/MaaS/TTS/requirements/ttsfrd-0.0.1-cp38-cp38-linux_x86_64.whl | |||||
| #https://isv-data.oss-cn-hangzhou.aliyuncs.com/ics/MaaS/TTS/requirements/ttsfrd-0.0.1-cp39-cp39-linux_x86_64.whl | |||||
| inflect | |||||
| keras==2.2.4 | |||||
| librosa | |||||
| lxml | |||||
| matplotlib | |||||
| nara_wpe | |||||
| numpy==1.18.* | |||||
| protobuf==3.20.* | |||||
| ptflops | |||||
| PyWavelets>=1.0.0 | |||||
| scikit-learn==0.23.2 | |||||
| sox | |||||
| tensorboard | |||||
| tensorflow==1.15.* | |||||
| torch==1.10.* | |||||
| torchaudio | |||||
| torchvision | |||||
| tqdm | |||||
| unidecode | |||||
| @@ -1 +1,2 @@ | |||||
| easydict | easydict | ||||
| tf_slim | |||||
| @@ -1,12 +1,13 @@ | |||||
| addict | addict | ||||
| datasets | datasets | ||||
| easydict | easydict | ||||
| https://mindscope.oss-cn-hangzhou.aliyuncs.com/sdklib/maas_hub-0.2.2.dev0-py3-none-any.whl | |||||
| https://mindscope.oss-cn-hangzhou.aliyuncs.com/sdklib/maas_hub-0.2.4.dev0-py3-none-any.whl | |||||
| numpy | numpy | ||||
| opencv-python-headless | opencv-python-headless | ||||
| Pillow>=6.2.0 | Pillow>=6.2.0 | ||||
| pyyaml | pyyaml | ||||
| requests | requests | ||||
| scipy | |||||
| tokenizers<=0.10.3 | tokenizers<=0.10.3 | ||||
| transformers<=4.16.2 | transformers<=4.16.2 | ||||
| yapf | yapf | ||||
| @@ -11,6 +11,7 @@ default_section = THIRDPARTY | |||||
| BASED_ON_STYLE = pep8 | BASED_ON_STYLE = pep8 | ||||
| BLANK_LINE_BEFORE_NESTED_CLASS_OR_DEF = true | BLANK_LINE_BEFORE_NESTED_CLASS_OR_DEF = true | ||||
| SPLIT_BEFORE_EXPRESSION_AFTER_OPENING_PAREN = true | SPLIT_BEFORE_EXPRESSION_AFTER_OPENING_PAREN = true | ||||
| SPLIT_BEFORE_ARITHMETIC_OPERATOR = true | |||||
| [codespell] | [codespell] | ||||
| skip = *.ipynb | skip = *.ipynb | ||||
| @@ -20,5 +21,5 @@ ignore-words-list = patten,nd,ty,mot,hist,formating,winn,gool,datas,wan,confids | |||||
| [flake8] | [flake8] | ||||
| select = B,C,E,F,P,T4,W,B9 | select = B,C,E,F,P,T4,W,B9 | ||||
| max-line-length = 120 | max-line-length = 120 | ||||
| ignore = F401,F821 | |||||
| ignore = F401,F821,W503 | |||||
| exclude = docs/src,*.pyi,.git | exclude = docs/src,*.pyi,.git | ||||
| @@ -80,8 +80,7 @@ class CustomPipelineTest(unittest.TestCase): | |||||
| pipe2 = pipeline(dummy_task) | pipe2 = pipeline(dummy_task) | ||||
| self.assertTrue(type(pipe) is type(pipe2)) | self.assertTrue(type(pipe) is type(pipe2)) | ||||
| img_url = 'http://pai-vision-data-hz.oss-cn-zhangjiakou.' \ | |||||
| 'aliyuncs.com/data/test/images/image1.jpg' | |||||
| img_url = 'data/test/images/image1.jpg' | |||||
| output = pipe(img_url) | output = pipe(img_url) | ||||
| self.assertEqual(output['filename'], img_url) | self.assertEqual(output['filename'], img_url) | ||||
| self.assertEqual(output['output_png'].shape, (318, 512, 3)) | self.assertEqual(output['output_png'].shape, (318, 512, 3)) | ||||